DE2011794C3 - Halbleiterspeicheranordnung - Google Patents
HalbleiterspeicheranordnungInfo
- Publication number
- DE2011794C3 DE2011794C3 DE2011794A DE2011794A DE2011794C3 DE 2011794 C3 DE2011794 C3 DE 2011794C3 DE 2011794 A DE2011794 A DE 2011794A DE 2011794 A DE2011794 A DE 2011794A DE 2011794 C3 DE2011794 C3 DE 2011794C3
- Authority
- DE
- Germany
- Prior art keywords
- voltage
- column
- row
- control
- switches
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000004065 semiconductor Substances 0.000 title claims description 18
- 230000015654 memory Effects 0.000 claims description 38
- 239000000758 substrate Substances 0.000 claims description 29
- 239000004020 conductor Substances 0.000 claims description 25
- 238000003860 storage Methods 0.000 claims description 22
- 230000005669 field effect Effects 0.000 claims description 2
- 230000005611 electricity Effects 0.000 claims 1
- 239000011159 matrix material Substances 0.000 description 11
- 238000010586 diagram Methods 0.000 description 5
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical compound [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 description 4
- 238000004519 manufacturing process Methods 0.000 description 4
- 150000004767 nitrides Chemical class 0.000 description 4
- 229910052710 silicon Inorganic materials 0.000 description 4
- 239000010703 silicon Substances 0.000 description 4
- 230000008859 change Effects 0.000 description 3
- 238000000034 method Methods 0.000 description 3
- 239000011521 glass Substances 0.000 description 2
- 230000007246 mechanism Effects 0.000 description 2
- 230000008569 process Effects 0.000 description 2
- 229910052594 sapphire Inorganic materials 0.000 description 2
- 239000010980 sapphire Substances 0.000 description 2
- VZSRBBMJRBPUNF-UHFFFAOYSA-N 2-(2,3-dihydro-1H-inden-2-ylamino)-N-[3-oxo-3-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)propyl]pyrimidine-5-carboxamide Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)C(=O)NCCC(N1CC2=C(CC1)NN=N2)=O VZSRBBMJRBPUNF-UHFFFAOYSA-N 0.000 description 1
- 229910052581 Si3N4 Inorganic materials 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- 230000002146 bilateral effect Effects 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000003990 capacitor Substances 0.000 description 1
- 230000008878 coupling Effects 0.000 description 1
- 238000010168 coupling process Methods 0.000 description 1
- 238000005859 coupling reaction Methods 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- 230000018109 developmental process Effects 0.000 description 1
- 238000009792 diffusion process Methods 0.000 description 1
- 230000006870 function Effects 0.000 description 1
- 230000001771 impaired effect Effects 0.000 description 1
- 239000011810 insulating material Substances 0.000 description 1
- 239000012212 insulator Substances 0.000 description 1
- 238000011835 investigation Methods 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 238000001465 metallisation Methods 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 238000012545 processing Methods 0.000 description 1
- HQVNEWCFYHHQES-UHFFFAOYSA-N silicon nitride Chemical compound N12[Si]34N5[Si]62N3[Si]51N64 HQVNEWCFYHHQES-UHFFFAOYSA-N 0.000 description 1
- 239000010409 thin film Substances 0.000 description 1
- 238000012546 transfer Methods 0.000 description 1
- 230000007704 transition Effects 0.000 description 1
- 238000007740 vapor deposition Methods 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H10—SEMICONDUCTOR DEVICES; ELECTRIC SOLID-STATE DEVICES NOT OTHERWISE PROVIDED FOR
- H10D—INORGANIC ELECTRIC SEMICONDUCTOR DEVICES
- H10D30/00—Field-effect transistors [FET]
- H10D30/60—Insulated-gate field-effect transistors [IGFET]
- H10D30/69—IGFETs having charge trapping gate insulators, e.g. MNOS transistors
-
- G—PHYSICS
- G11—INFORMATION STORAGE
- G11C—STATIC STORES
- G11C16/00—Erasable programmable read-only memories
- G11C16/02—Erasable programmable read-only memories electrically programmable
- G11C16/04—Erasable programmable read-only memories electrically programmable using variable threshold transistors, e.g. FAMOS
- G11C16/0466—Erasable programmable read-only memories electrically programmable using variable threshold transistors, e.g. FAMOS comprising cells with charge storage in an insulating layer, e.g. metal-nitride-oxide-silicon [MNOS], silicon-oxide-nitride-oxide-silicon [SONOS]
-
- H—ELECTRICITY
- H10—SEMICONDUCTOR DEVICES; ELECTRIC SOLID-STATE DEVICES NOT OTHERWISE PROVIDED FOR
- H10B—ELECTRONIC MEMORY DEVICES
- H10B69/00—Erasable-and-programmable ROM [EPROM] devices not provided for in groups H10B41/00 - H10B63/00, e.g. ultraviolet erasable-and-programmable ROM [UVEPROM] devices
Landscapes
- Engineering & Computer Science (AREA)
- Microelectronics & Electronic Packaging (AREA)
- Semiconductor Memories (AREA)
- Read Only Memory (AREA)
Applications Claiming Priority (6)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US68716667A | 1967-12-01 | 1967-12-01 | |
| US80637569A | 1969-03-12 | 1969-03-12 | |
| GB1288371 | 1971-05-04 | ||
| NL7106675A NL7106675A (enExample) | 1967-12-01 | 1971-05-14 | |
| FR7117913A FR2137294B1 (enExample) | 1967-12-01 | 1971-05-18 | |
| US17732171A | 1971-09-02 | 1971-09-02 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2011794A1 DE2011794A1 (de) | 1970-10-01 |
| DE2011794B2 DE2011794B2 (de) | 1975-10-30 |
| DE2011794C3 true DE2011794C3 (de) | 1983-02-03 |
Family
ID=27546323
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2011794A Expired DE2011794C3 (de) | 1967-12-01 | 1970-03-12 | Halbleiterspeicheranordnung |
Country Status (6)
| Country | Link |
|---|---|
| US (2) | US3623023A (enExample) |
| BE (1) | BE747095A (enExample) |
| DE (1) | DE2011794C3 (enExample) |
| FR (2) | FR2034836B1 (enExample) |
| GB (2) | GB1308806A (enExample) |
| NL (2) | NL7003466A (enExample) |
Families Citing this family (21)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3623023A (en) * | 1967-12-01 | 1971-11-23 | Sperry Rand Corp | Variable threshold transistor memory using pulse coincident writing |
| US3624618A (en) * | 1967-12-14 | 1971-11-30 | Sperry Rand Corp | A high-speed memory array using variable threshold transistors |
| DE2125681C2 (de) * | 1971-05-24 | 1982-05-13 | Sperry Corp., 10104 New York, N.Y. | Speicher mit Transistoren mit veränderlichem Leitfähigkeitsschwellenwert |
| US3778783A (en) * | 1971-11-29 | 1973-12-11 | Mostek Corp | Dynamic random access memory |
| US3859642A (en) * | 1973-04-05 | 1975-01-07 | Bell Telephone Labor Inc | Random access memory array of hysteresis loop capacitors |
| US3851317A (en) * | 1973-05-04 | 1974-11-26 | Ibm | Double density non-volatile memory array |
| US3845471A (en) * | 1973-05-14 | 1974-10-29 | Westinghouse Electric Corp | Classification of a subject |
| JPS5346621B2 (enExample) * | 1974-10-21 | 1978-12-15 | ||
| US4012757A (en) * | 1975-05-05 | 1977-03-15 | Intel Corporation | Contactless random-access memory cell and cell pair |
| US4025909A (en) * | 1975-09-08 | 1977-05-24 | Ibm Corporation | Simplified dynamic associative cell |
| US4056807A (en) * | 1976-08-16 | 1977-11-01 | Bell Telephone Laboratories, Incorporated | Electronically alterable diode logic circuit |
| US4112509A (en) * | 1976-12-27 | 1978-09-05 | Texas Instruments Incorporated | Electrically alterable floating gate semiconductor memory device |
| US4184207A (en) * | 1978-01-27 | 1980-01-15 | Texas Instruments Incorporated | High density floating gate electrically programmable ROM |
| US4202044A (en) * | 1978-06-13 | 1980-05-06 | International Business Machines Corporation | Quaternary FET read only memory |
| USRE32401E (en) * | 1978-06-13 | 1987-04-14 | International Business Machines Corporation | Quaternary FET read only memory |
| JPS582436B2 (ja) * | 1978-10-09 | 1983-01-17 | 株式会社日立製作所 | メモリの駆動方法 |
| US4376947A (en) * | 1979-09-04 | 1983-03-15 | Texas Instruments Incorporated | Electrically programmable floating gate semiconductor memory device |
| US4291391A (en) * | 1979-09-14 | 1981-09-22 | Texas Instruments Incorporated | Taper isolated random access memory array and method of operating |
| US4575823A (en) * | 1982-08-17 | 1986-03-11 | Westinghouse Electric Corp. | Electrically alterable non-volatile memory |
| US6580306B2 (en) * | 2001-03-09 | 2003-06-17 | United Memories, Inc. | Switching circuit utilizing a high voltage transistor protection technique for integrated circuit devices incorporating dual supply voltage sources |
| US6731156B1 (en) | 2003-02-07 | 2004-05-04 | United Memories, Inc. | High voltage transistor protection technique and switching circuit for integrated circuit devices utilizing multiple power supply voltages |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL298671A (enExample) * | 1963-10-01 | |||
| US3508211A (en) * | 1967-06-23 | 1970-04-21 | Sperry Rand Corp | Electrically alterable non-destructive readout field effect transistor memory |
| US3623023A (en) * | 1967-12-01 | 1971-11-23 | Sperry Rand Corp | Variable threshold transistor memory using pulse coincident writing |
| US3618051A (en) * | 1969-05-09 | 1971-11-02 | Sperry Rand Corp | Nonvolatile read-write memory with addressing |
-
1967
- 1967-12-01 US US687166A patent/US3623023A/en not_active Expired - Lifetime
-
1970
- 1970-03-05 GB GB1066570A patent/GB1308806A/en not_active Expired
- 1970-03-06 FR FR7008215A patent/FR2034836B1/fr not_active Expired
- 1970-03-09 BE BE747095D patent/BE747095A/xx unknown
- 1970-03-11 NL NL7003466A patent/NL7003466A/xx not_active Application Discontinuation
- 1970-03-12 DE DE2011794A patent/DE2011794C3/de not_active Expired
-
1971
- 1971-05-04 GB GB1288371*[A patent/GB1297745A/en not_active Expired
- 1971-05-14 NL NL7106675A patent/NL7106675A/xx not_active Application Discontinuation
- 1971-05-18 FR FR7117913A patent/FR2137294B1/fr not_active Expired
- 1971-09-02 US US00177321A patent/US3760378A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| NL7106675A (enExample) | 1972-11-16 |
| NL7003466A (enExample) | 1970-09-15 |
| US3760378A (en) | 1973-09-18 |
| BE747095A (fr) | 1970-08-17 |
| US3623023A (en) | 1971-11-23 |
| GB1297745A (enExample) | 1972-11-29 |
| FR2034836A1 (enExample) | 1970-12-18 |
| FR2137294B1 (enExample) | 1976-03-19 |
| DE2011794A1 (de) | 1970-10-01 |
| FR2034836B1 (enExample) | 1974-10-31 |
| GB1308806A (en) | 1973-03-07 |
| FR2137294A1 (enExample) | 1972-12-29 |
| DE2011794B2 (de) | 1975-10-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2011794C3 (de) | Halbleiterspeicheranordnung | |
| EP0006167B1 (de) | Mehrwertiger FET-Festwertspeicher | |
| DE2623507C3 (de) | Schaltungsanordnung für binäre Schaltvariable | |
| DE2144235C3 (de) | Verzögerung sanordnung | |
| DE1803035B2 (de) | Permanentspeicherzelle | |
| DE4017617C2 (de) | Spannungserzeugungsschaltung mit geringer Leistungsaufnahme und stabiler Ausgangsspannung bei kleiner Schaltkreisfläche | |
| DE2363089C3 (de) | Speicherzelle mit Feldeffekttransistoren | |
| DE19502116C2 (de) | MOS-Schaltungsanordnung zum Schalten hoher Spannungen auf einem Halbleiterchip | |
| DE2129687B2 (de) | Digitale Speicherschaltung | |
| DE2201028B2 (de) | Verfahren zum Betrieb eines Feldeffekttransistors und Feldeffekttransistor zur Ausübung dieses Verfahrens | |
| EP0100772B1 (de) | Elektrisch programmierbare Speichermatrix | |
| DE4226844A1 (de) | Datenuebertragungsschaltkreis | |
| DE2153284B2 (de) | Schaltungsanordnung zur Einstellung gewählter Feldeffektbauelemente einer Speichermatrix ohne Störung der nicht gewählten Elemente | |
| DE2309616C2 (de) | Halbleiterspeicherschaltung | |
| DE3046376A1 (de) | Halbleiter-speichervorrichtung | |
| DE2705992B2 (de) | Halbleiterspeicher | |
| DE2152109A1 (de) | Speicher mit Feldeffekt-Halbleiterelementen | |
| DE2160687C3 (de) | Halbleitervorrichtung | |
| DE3032306C2 (enExample) | ||
| EP0135136A2 (de) | Integrierte RS-Flipflop-Schaltung | |
| DE2422717A1 (de) | Analogrechenverfahren zum bestimmen des quadrates einer differenz | |
| DE3102175A1 (de) | Halbleiter-speichervorrichtung | |
| DE112021005740T5 (de) | Gemischt leitendes flüchtiges speicherelement zum beschleunigten beschreiben eines nichtflüchtigen memristiven bauelements | |
| DE3330559A1 (de) | Ausgangsschaltung | |
| DE102020203024B4 (de) | Integrierter Schaltkreis mit einem Widerstandsnetzwerk |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) | ||
| 8339 | Ceased/non-payment of the annual fee |