DE2007794A1 - Fungizide Mittel - Google Patents
Fungizide MittelInfo
- Publication number
- DE2007794A1 DE2007794A1 DE19702007794 DE2007794A DE2007794A1 DE 2007794 A1 DE2007794 A1 DE 2007794A1 DE 19702007794 DE19702007794 DE 19702007794 DE 2007794 A DE2007794 A DE 2007794A DE 2007794 A1 DE2007794 A1 DE 2007794A1
- Authority
- DE
- Germany
- Prior art keywords
- phenyl
- imidazolyl
- plants
- active ingredient
- carbon atoms
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 239000000417 fungicide Substances 0.000 title claims description 6
- 125000004432 carbon atom Chemical group C* 0.000 claims description 12
- 150000001875 compounds Chemical class 0.000 claims description 11
- 241000233866 Fungi Species 0.000 claims description 10
- 125000000217 alkyl group Chemical group 0.000 claims description 8
- 125000001931 aliphatic group Chemical group 0.000 claims description 6
- 238000000034 method Methods 0.000 claims description 4
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 4
- 239000004606 Fillers/Extenders Substances 0.000 claims description 3
- 125000003342 alkenyl group Chemical group 0.000 claims description 3
- 125000003545 alkoxy group Chemical group 0.000 claims description 3
- 125000004414 alkyl thio group Chemical group 0.000 claims description 3
- 229910052739 hydrogen Inorganic materials 0.000 claims description 3
- 239000001257 hydrogen Substances 0.000 claims description 3
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims description 3
- 150000003839 salts Chemical class 0.000 claims description 3
- 125000004104 aryloxy group Chemical group 0.000 claims description 2
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 2
- 238000002360 preparation method Methods 0.000 claims description 2
- 125000004076 pyridyl group Chemical group 0.000 claims description 2
- 125000003107 substituted aryl group Chemical group 0.000 claims description 2
- 239000004094 surface-active agent Substances 0.000 claims description 2
- 235000021190 leftovers Nutrition 0.000 claims 1
- 239000004480 active ingredient Substances 0.000 description 39
- 241000196324 Embryophyta Species 0.000 description 28
- 206010061217 Infestation Diseases 0.000 description 20
- 239000002904 solvent Substances 0.000 description 14
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 12
- 239000007788 liquid Substances 0.000 description 11
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 11
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 10
- 241000220225 Malus Species 0.000 description 10
- -1 4-phenoxyphenyl Chemical group 0.000 description 9
- 239000007921 spray Substances 0.000 description 9
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 7
- 239000003995 emulsifying agent Substances 0.000 description 7
- 238000011081 inoculation Methods 0.000 description 7
- 239000000203 mixture Substances 0.000 description 7
- 239000000126 substance Substances 0.000 description 7
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- OTMSDBZUPAUEDD-UHFFFAOYSA-N Ethane Chemical compound CC OTMSDBZUPAUEDD-UHFFFAOYSA-N 0.000 description 6
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 6
- 239000000654 additive Substances 0.000 description 6
- 239000012141 concentrate Substances 0.000 description 6
- 206010039509 Scab Diseases 0.000 description 5
- 125000002877 alkyl aryl group Chemical group 0.000 description 5
- 208000015181 infectious disease Diseases 0.000 description 5
- 229920000151 polyglycol Polymers 0.000 description 5
- 239000010695 polyglycol Substances 0.000 description 5
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- 239000002253 acid Substances 0.000 description 4
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- 238000009472 formulation Methods 0.000 description 4
- 238000002844 melting Methods 0.000 description 4
- 230000008018 melting Effects 0.000 description 4
- 230000003032 phytopathogenic effect Effects 0.000 description 4
- 230000001681 protective effect Effects 0.000 description 4
- 239000000725 suspension Substances 0.000 description 4
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- 241000235349 Ascomycota Species 0.000 description 3
- 240000008067 Cucumis sativus Species 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- 241000221785 Erysiphales Species 0.000 description 3
- 241000221787 Erysiphe Species 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- 240000007594 Oryza sativa Species 0.000 description 3
- 241000896242 Podosphaera Species 0.000 description 3
- 241001617088 Thanatephorus sasakii Species 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- 239000000460 chlorine Chemical group 0.000 description 3
- 201000010099 disease Diseases 0.000 description 3
- 239000002270 dispersing agent Substances 0.000 description 3
- DQYBDCGIPTYXML-UHFFFAOYSA-N ethoxyethane;hydrate Chemical compound O.CCOCC DQYBDCGIPTYXML-UHFFFAOYSA-N 0.000 description 3
- 230000000855 fungicidal effect Effects 0.000 description 3
- 239000000243 solution Substances 0.000 description 3
- 238000005507 spraying Methods 0.000 description 3
- NPZDCTUDQYGYQD-UHFFFAOYSA-N 1-tritylimidazole Chemical class C1=NC=CN1C(C=1C=CC=CC=1)(C=1C=CC=CC=1)C1=CC=CC=C1 NPZDCTUDQYGYQD-UHFFFAOYSA-N 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical group [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- 241001480059 Erysiphaceae Species 0.000 description 2
- 241000489964 Fusicladium Species 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- 235000007164 Oryza sativa Nutrition 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- 239000013543 active substance Substances 0.000 description 2
- 239000000969 carrier Substances 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 125000004663 dialkyl amino group Chemical group 0.000 description 2
- 239000000839 emulsion Substances 0.000 description 2
- 239000011737 fluorine Substances 0.000 description 2
- 229910052731 fluorine Inorganic materials 0.000 description 2
- 230000002538 fungal effect Effects 0.000 description 2
- 239000008187 granular material Substances 0.000 description 2
- 229910052736 halogen Inorganic materials 0.000 description 2
- 150000002367 halogens Chemical class 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 239000006072 paste Substances 0.000 description 2
- 244000052769 pathogen Species 0.000 description 2
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 2
- 239000002798 polar solvent Substances 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 235000009566 rice Nutrition 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- 125000004179 3-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(Cl)=C1[H] 0.000 description 1
- 125000001255 4-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1F 0.000 description 1
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 1
- KNIUHBNRWZGIQQ-UHFFFAOYSA-N 7-diethoxyphosphinothioyloxy-4-methylchromen-2-one Chemical compound CC1=CC(=O)OC2=CC(OP(=S)(OCC)OCC)=CC=C21 KNIUHBNRWZGIQQ-UHFFFAOYSA-N 0.000 description 1
- 229920001817 Agar Polymers 0.000 description 1
- 241000221198 Basidiomycota Species 0.000 description 1
- 241001450781 Bipolaris oryzae Species 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- 241001330975 Magnaporthe oryzae Species 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- GXCLVBGFBYZDAG-UHFFFAOYSA-N N-[2-(1H-indol-3-yl)ethyl]-N-methylprop-2-en-1-amine Chemical compound CN(CCC1=CNC2=C1C=CC=C2)CC=C GXCLVBGFBYZDAG-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 241001337928 Podosphaera leucotricha Species 0.000 description 1
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 1
- BCKXLBQYZLBQEK-KVVVOXFISA-M Sodium oleate Chemical compound [Na+].CCCCCCCC\C=C/CCCCCCCC([O-])=O BCKXLBQYZLBQEK-KVVVOXFISA-M 0.000 description 1
- 241000191940 Staphylococcus Species 0.000 description 1
- 244000269722 Thea sinensis Species 0.000 description 1
- 241000317942 Venturia <ichneumonid wasp> Species 0.000 description 1
- 241000228452 Venturia inaequalis Species 0.000 description 1
- FXXACINHVKSMDR-UHFFFAOYSA-N acetyl bromide Chemical compound CC(Br)=O FXXACINHVKSMDR-UHFFFAOYSA-N 0.000 description 1
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 1
- 239000012346 acetyl chloride Substances 0.000 description 1
- 239000008272 agar Substances 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- 239000007900 aqueous suspension Substances 0.000 description 1
- 125000005228 aryl sulfonate group Chemical group 0.000 description 1
- 150000003851 azoles Chemical group 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical class OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 150000008422 chlorobenzenes Chemical class 0.000 description 1
- DMSZORWOGDLWGN-UHFFFAOYSA-N ctk1a3526 Chemical compound NP(N)(N)=O DMSZORWOGDLWGN-UHFFFAOYSA-N 0.000 description 1
- 125000004093 cyano group Chemical group *C#N 0.000 description 1
- 150000001991 dicarboxylic acids Chemical class 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 231100000676 disease causative agent Toxicity 0.000 description 1
- 238000010410 dusting Methods 0.000 description 1
- 235000013399 edible fruits Nutrition 0.000 description 1
- 238000004049 embossing Methods 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 235000013312 flour Nutrition 0.000 description 1
- 125000001153 fluoro group Chemical group F* 0.000 description 1
- 125000004216 fluoromethyl group Chemical group [H]C([H])(F)* 0.000 description 1
- 230000002464 fungitoxic effect Effects 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 230000012010 growth Effects 0.000 description 1
- 230000002140 halogenating effect Effects 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 150000002460 imidazoles Chemical class 0.000 description 1
- 150000003949 imides Chemical class 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 239000002917 insecticide Substances 0.000 description 1
- 229920005610 lignin Polymers 0.000 description 1
- 239000006193 liquid solution Substances 0.000 description 1
- 231100000053 low toxicity Toxicity 0.000 description 1
- 125000000040 m-tolyl group Chemical group [H]C1=C([H])C(*)=C([H])C(=C1[H])C([H])([H])[H] 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 235000010981 methylcellulose Nutrition 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 150000002763 monocarboxylic acids Chemical class 0.000 description 1
- CRSOQBOWXPBRES-UHFFFAOYSA-N neopentane Chemical compound CC(C)(C)C CRSOQBOWXPBRES-UHFFFAOYSA-N 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- LYGJENNIWJXYER-UHFFFAOYSA-N nitromethane Chemical compound C[N+]([O-])=O LYGJENNIWJXYER-UHFFFAOYSA-N 0.000 description 1
- 125000003261 o-tolyl group Chemical group [H]C1=C([H])C(*)=C(C([H])=C1[H])C([H])([H])[H] 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 230000001717 pathogenic effect Effects 0.000 description 1
- 239000000575 pesticide Substances 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 1
- 235000011007 phosphoric acid Nutrition 0.000 description 1
- 150000003016 phosphoric acids Chemical class 0.000 description 1
- UXCDUFKZSUBXGM-UHFFFAOYSA-N phosphoric tribromide Chemical compound BrP(Br)(Br)=O UXCDUFKZSUBXGM-UHFFFAOYSA-N 0.000 description 1
- 230000008635 plant growth Effects 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 239000011435 rock Substances 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 125000000475 sulfinyl group Chemical group [*:2]S([*:1])=O 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-L sulfite Chemical compound [O-]S([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-L 0.000 description 1
- 125000001273 sulfonato group Chemical class [O-]S(*)(=O)=O 0.000 description 1
- 150000003460 sulfonic acids Chemical class 0.000 description 1
- 230000009897 systematic effect Effects 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 239000002699 waste material Substances 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/54—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members
- C07D233/56—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members with only hydrogen atoms or radicals containing only hydrogen and carbon atoms, attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D231/00—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings
- C07D231/02—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings
- C07D231/10—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D231/12—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D249/00—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms
- C07D249/02—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms not condensed with other rings
- C07D249/08—1,2,4-Triazoles; Hydrogenated 1,2,4-triazoles
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
Priority Applications (13)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19702007794 DE2007794A1 (de) | 1970-02-20 | 1970-02-20 | Fungizide Mittel |
| CH101671A CH546536A (de) | 1970-02-20 | 1971-01-22 | Verwendung von imidazolen zur bekaempfung von pilzen. |
| IL7136058A IL36058A (en) | 1970-02-20 | 1971-01-25 | Fungicidal compositions containing n-aralkylimidazoles |
| BG016719A BG18821A3 (bg) | 1970-02-20 | 1971-02-03 | Фунгицидно средство |
| TR16717A TR16717A (tr) | 1970-02-20 | 1971-02-04 | Mantar oeldueruecue terkipler |
| RO65859A RO59612A (en:Method) | 1970-02-20 | 1971-02-09 | |
| NL7102111A NL7102111A (en:Method) | 1970-02-20 | 1971-02-17 | |
| US00116291A US3769422A (en) | 1970-02-20 | 1971-02-17 | N-arylalkylimidazole fungicidal agents |
| BE763216A BE763216A (fr) | 1970-02-20 | 1971-02-19 | Nouvelle composition fongicide |
| FR7105815A FR2080672B1 (en:Method) | 1970-02-20 | 1971-02-19 | |
| HUBA2541A HU162526B (en:Method) | 1970-02-20 | 1971-02-19 | |
| ES388439A ES388439A1 (es) | 1970-02-20 | 1971-02-19 | Procedimiento para la obtencion de composiciones fungici- das. |
| GB22120/71A GB1287253A (en) | 1970-02-20 | 1971-04-19 | Fungicidal agents |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19702007794 DE2007794A1 (de) | 1970-02-20 | 1970-02-20 | Fungizide Mittel |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2007794A1 true DE2007794A1 (de) | 1971-09-02 |
Family
ID=5762801
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19702007794 Pending DE2007794A1 (de) | 1970-02-20 | 1970-02-20 | Fungizide Mittel |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US3769422A (en:Method) |
| BE (1) | BE763216A (en:Method) |
| BG (1) | BG18821A3 (en:Method) |
| CH (1) | CH546536A (en:Method) |
| DE (1) | DE2007794A1 (en:Method) |
| ES (1) | ES388439A1 (en:Method) |
| FR (1) | FR2080672B1 (en:Method) |
| GB (1) | GB1287253A (en:Method) |
| HU (1) | HU162526B (en:Method) |
| IL (1) | IL36058A (en:Method) |
| NL (1) | NL7102111A (en:Method) |
| RO (1) | RO59612A (en:Method) |
| TR (1) | TR16717A (en:Method) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2461406A1 (de) * | 1974-12-24 | 1976-07-08 | Bayer Ag | Azolyl-(1)-methane und deren salze, verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel |
Families Citing this family (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| IE40911B1 (en) * | 1974-04-11 | 1979-09-12 | Schering Ag | Imidazole derivatives and process for their manufacture |
| US4237158A (en) * | 1975-02-05 | 1980-12-02 | Rohm And Haas Company | 1-Substituted aralkyl imidazoles and their use as fungicides |
| US4115578A (en) * | 1975-12-18 | 1978-09-19 | Rohm And Haas Company | 1-Substituted aralkyl imidazoles |
| US4118461A (en) * | 1975-12-18 | 1978-10-03 | Rohm And Haas Company | 1-Substituted aralkyl imidazoles |
| US4431815A (en) * | 1977-08-26 | 1984-02-14 | Burroughs Wellcome Co. | 1-[3-(2,4-Dichlorophenyl)propyl]imidazole and salts thereof |
| DE2808086A1 (de) * | 1978-02-24 | 1979-08-30 | Bayer Ag | Substituierte diphenyl-imidazolyl- methane, verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel |
| DK75680A (da) * | 1979-02-22 | 1980-08-23 | Wellcome Found | Fremgangsmaade til fremstilling af 1-substituerede imidazoler |
| US4755526A (en) * | 1984-06-18 | 1988-07-05 | Eli Lilly And Company | Method of inhibiting aromatase |
| US4978672A (en) * | 1986-03-07 | 1990-12-18 | Ciba-Geigy Corporation | Alpha-heterocyclc substituted tolunitriles |
| US4937250A (en) * | 1988-03-07 | 1990-06-26 | Ciba-Geigy Corporation | Alpha-heterocycle substituted tolunitriles |
| US4749713A (en) * | 1986-03-07 | 1988-06-07 | Ciba-Geigy Corporation | Alpha-heterocycle substituted tolunitriles |
| US6297239B1 (en) | 1997-10-08 | 2001-10-02 | Merck & Co., Inc. | Inhibitors of prenyl-protein transferase |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1908991B2 (de) * | 1969-02-22 | 1977-05-26 | Bayer Ag, 5090 Leverkusen | Alpha, alpha-disubstituierte n- benzylimidazole und deren salze |
-
1970
- 1970-02-20 DE DE19702007794 patent/DE2007794A1/de active Pending
-
1971
- 1971-01-22 CH CH101671A patent/CH546536A/xx not_active IP Right Cessation
- 1971-01-25 IL IL7136058A patent/IL36058A/xx unknown
- 1971-02-03 BG BG016719A patent/BG18821A3/xx unknown
- 1971-02-04 TR TR16717A patent/TR16717A/xx unknown
- 1971-02-09 RO RO65859A patent/RO59612A/ro unknown
- 1971-02-17 US US00116291A patent/US3769422A/en not_active Expired - Lifetime
- 1971-02-17 NL NL7102111A patent/NL7102111A/xx unknown
- 1971-02-19 FR FR7105815A patent/FR2080672B1/fr not_active Expired
- 1971-02-19 HU HUBA2541A patent/HU162526B/hu unknown
- 1971-02-19 ES ES388439A patent/ES388439A1/es not_active Expired
- 1971-02-19 BE BE763216A patent/BE763216A/xx unknown
- 1971-04-19 GB GB22120/71A patent/GB1287253A/en not_active Expired
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2461406A1 (de) * | 1974-12-24 | 1976-07-08 | Bayer Ag | Azolyl-(1)-methane und deren salze, verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel |
Also Published As
| Publication number | Publication date |
|---|---|
| BE763216A (fr) | 1971-08-19 |
| FR2080672B1 (en:Method) | 1975-02-21 |
| BG18821A3 (bg) | 1975-03-20 |
| US3769422A (en) | 1973-10-30 |
| GB1287253A (en) | 1972-08-31 |
| NL7102111A (en:Method) | 1971-08-24 |
| CH546536A (de) | 1974-03-15 |
| RO59612A (en:Method) | 1976-06-15 |
| FR2080672A1 (en:Method) | 1971-11-19 |
| HU162526B (en:Method) | 1973-03-28 |
| ES388439A1 (es) | 1974-01-16 |
| TR16717A (tr) | 1973-03-01 |
| IL36058A0 (en) | 1971-03-24 |
| IL36058A (en) | 1974-05-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0061051B1 (de) | Substituierte Triazolylmethyl-oxirane, Verfahren zu ihrer Herstellung sowie ihre Verwendung als Zwischenprodukte | |
| DE2037610C3 (en:Method) | ||
| DE2333354A1 (de) | Imidazolyl-o,n-acetale sowie deren salze, verfahren zu ihrer herstellung und ihre verwendung als fungizide | |
| DE2007794A1 (de) | Fungizide Mittel | |
| DE2635663C2 (en:Method) | ||
| DE1670976A1 (de) | N-Trityl-imidazole | |
| DE2325156A1 (de) | Fungizide und mikrobizide mittel | |
| DE2757113A1 (de) | Imidazolylvinylaether und verfahren zu ihrer herstellung | |
| DE2130030A1 (de) | Fungizide und bakterizide Mittel | |
| DE2547954C2 (en:Method) | ||
| EP0000018A1 (de) | Metallsalzkomplexe von 1-Phenyl-2-triazolyl-ethyl-Derivaten, Verfahren zu ihrer Herstellung sowie ihre Verwendung als Fungizide | |
| DE2407305C2 (de) | Triphenyl-1,2,3-triazol-1-yl-methane, Verfahren zu ihrer Herstellung und ihre Verwendung als Fungizide | |
| DE2201062A1 (de) | N-alkoxycarbonyl- bzw. n-alkylthiocarbonyl-2-(2'-thienyl)-benzimidazole, ein verfahren zu ihrer herstellung und ihre verwendung als fungizide | |
| DE2702102A1 (de) | N-azolylacetyl-n-phenyl-alaninester, verfahren zu ihrer herstellung sowie ihre verwendung als fungizide | |
| DE1964996A1 (de) | 9-Azolyl-fluoren-9-carbonsaeure-Derivate,Verfahren zu ihrer Herstellung und ihre Verwendung zur Regulierung des Pflanzenwachstums | |
| DE2334352A1 (de) | Im heterocyclus halogenierte triazolderivate, verfahren zu ihrer herstellung und ihre verwendung als fungizide | |
| DE1767924A1 (de) | 1-Phenyl-4,4-dialkyl-thiosemicarbazide | |
| DE2502932C2 (de) | Metallkomplexe von N-Trityl-azolen, Verfahren zu ihrer Herstellung sowie ihre Verwendung als Fungizide | |
| DE2120861A1 (de) | Fungizide Mittel | |
| DE2022494A1 (de) | Fungizide Mittel | |
| DE1670705A1 (de) | Verfahren zur Herstellung von N-substituierten Phthalimiden | |
| DE2328728A1 (de) | Systemisch-fungizide mittel | |
| DE2242785A1 (de) | 1-alkylsulfonyl-2-trifluormethylbenzimidazole, verfahren zu ihrer herstellung sowie ihre verwendung als ektoparasitenmittel | |
| DE1543604C3 (en:Method) | ||
| DE1670976C3 (de) | N-Trityl-imidazole |