DE2004620C3 - Druckgaserzeugende Ladungen - Google Patents
Druckgaserzeugende LadungenInfo
- Publication number
- DE2004620C3 DE2004620C3 DE2004620A DE2004620A DE2004620C3 DE 2004620 C3 DE2004620 C3 DE 2004620C3 DE 2004620 A DE2004620 A DE 2004620A DE 2004620 A DE2004620 A DE 2004620A DE 2004620 C3 DE2004620 C3 DE 2004620C3
- Authority
- DE
- Germany
- Prior art keywords
- gas
- contain
- compressed gas
- charges
- percent
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000007789 gas Substances 0.000 claims description 10
- 239000000203 mixture Substances 0.000 claims description 9
- 239000000126 substance Substances 0.000 claims description 9
- HAMNKKUPIHEESI-UHFFFAOYSA-N aminoguanidine Chemical compound NNC(N)=N HAMNKKUPIHEESI-UHFFFAOYSA-N 0.000 claims description 7
- 150000003536 tetrazoles Chemical class 0.000 claims description 5
- 239000000654 additive Substances 0.000 claims description 4
- JGZAFSFVZSXXCJ-ONEGZZNKSA-N (E)-bis(2H-tetrazol-5-yl)diazene Chemical class N(=N\C1=NN=NN1)/C1=NN=NN1 JGZAFSFVZSXXCJ-ONEGZZNKSA-N 0.000 claims description 3
- 238000000354 decomposition reaction Methods 0.000 claims description 3
- NDEMNVPZDAFUKN-UHFFFAOYSA-N guanidine;nitric acid Chemical compound NC(N)=N.O[N+]([O-])=O.O[N+]([O-])=O NDEMNVPZDAFUKN-UHFFFAOYSA-N 0.000 claims description 3
- XTEGARKTQYYJKE-UHFFFAOYSA-M Chlorate Chemical class [O-]Cl(=O)=O XTEGARKTQYYJKE-UHFFFAOYSA-M 0.000 claims description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 2
- 239000003054 catalyst Substances 0.000 claims description 2
- 150000002823 nitrates Chemical class 0.000 claims description 2
- 239000001301 oxygen Substances 0.000 claims description 2
- 229910052760 oxygen Inorganic materials 0.000 claims description 2
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical class OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 claims description 2
- 238000005474 detonation Methods 0.000 claims 2
- 239000002360 explosive Substances 0.000 claims 2
- 230000006378 damage Effects 0.000 claims 1
- 150000007529 inorganic bases Chemical class 0.000 claims 1
- 239000000020 Nitrocellulose Substances 0.000 description 3
- 238000006243 chemical reaction Methods 0.000 description 3
- 229920001220 nitrocellulos Polymers 0.000 description 3
- 239000000843 powder Substances 0.000 description 3
- 150000003839 salts Chemical class 0.000 description 3
- 239000007864 aqueous solution Substances 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- ZSWFCLXCOIISFI-UHFFFAOYSA-N cyclopentadiene Chemical compound C1C=CC=C1 ZSWFCLXCOIISFI-UHFFFAOYSA-N 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 230000003647 oxidation Effects 0.000 description 2
- 238000007254 oxidation reaction Methods 0.000 description 2
- FGIUAXJPYTZDNR-UHFFFAOYSA-N potassium nitrate Chemical compound [K+].[O-][N+]([O-])=O FGIUAXJPYTZDNR-UHFFFAOYSA-N 0.000 description 2
- 239000003380 propellant Substances 0.000 description 2
- IDCPFAYURAQKDZ-UHFFFAOYSA-N 1-nitroguanidine Chemical compound NC(=N)N[N+]([O-])=O IDCPFAYURAQKDZ-UHFFFAOYSA-N 0.000 description 1
- KJUGUADJHNHALS-UHFFFAOYSA-N 1H-tetrazole Substances C=1N=NNN=1 KJUGUADJHNHALS-UHFFFAOYSA-N 0.000 description 1
- PAWQVTBBRAZDMG-UHFFFAOYSA-N 2-(3-bromo-2-fluorophenyl)acetic acid Chemical compound OC(=O)CC1=CC=CC(Br)=C1F PAWQVTBBRAZDMG-UHFFFAOYSA-N 0.000 description 1
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 description 1
- ZOKXTWBITQBERF-UHFFFAOYSA-N Molybdenum Chemical compound [Mo] ZOKXTWBITQBERF-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 1
- FJWGYAHXMCUOOM-QHOUIDNNSA-N [(2s,3r,4s,5r,6r)-2-[(2r,3r,4s,5r,6s)-4,5-dinitrooxy-2-(nitrooxymethyl)-6-[(2r,3r,4s,5r,6s)-4,5,6-trinitrooxy-2-(nitrooxymethyl)oxan-3-yl]oxyoxan-3-yl]oxy-3,5-dinitrooxy-6-(nitrooxymethyl)oxan-4-yl] nitrate Chemical compound O([C@@H]1O[C@@H]([C@H]([C@H](O[N+]([O-])=O)[C@H]1O[N+]([O-])=O)O[C@H]1[C@@H]([C@@H](O[N+]([O-])=O)[C@H](O[N+]([O-])=O)[C@@H](CO[N+]([O-])=O)O1)O[N+]([O-])=O)CO[N+](=O)[O-])[C@@H]1[C@@H](CO[N+]([O-])=O)O[C@@H](O[N+]([O-])=O)[C@H](O[N+]([O-])=O)[C@H]1O[N+]([O-])=O FJWGYAHXMCUOOM-QHOUIDNNSA-N 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 150000001447 alkali salts Chemical class 0.000 description 1
- VBIXEXWLHSRNKB-UHFFFAOYSA-N ammonium oxalate Chemical compound [NH4+].[NH4+].[O-]C(=O)C([O-])=O VBIXEXWLHSRNKB-UHFFFAOYSA-N 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 229910052804 chromium Inorganic materials 0.000 description 1
- 239000011651 chromium Substances 0.000 description 1
- 229910017052 cobalt Inorganic materials 0.000 description 1
- 239000010941 cobalt Substances 0.000 description 1
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 1
- 150000001896 cresols Chemical class 0.000 description 1
- 239000000446 fuel Substances 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 229910001959 inorganic nitrate Inorganic materials 0.000 description 1
- 239000011872 intimate mixture Substances 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- 229910052750 molybdenum Inorganic materials 0.000 description 1
- 239000011733 molybdenum Substances 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- 239000004014 plasticizer Substances 0.000 description 1
- VKJKEPKFPUWCAS-UHFFFAOYSA-M potassium chlorate Chemical compound [K+].[O-]Cl(=O)=O VKJKEPKFPUWCAS-UHFFFAOYSA-M 0.000 description 1
- 235000010333 potassium nitrate Nutrition 0.000 description 1
- 239000004323 potassium nitrate Substances 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 230000001737 promoting effect Effects 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 description 1
- 229910052721 tungsten Inorganic materials 0.000 description 1
- 239000010937 tungsten Substances 0.000 description 1
- 229910052720 vanadium Inorganic materials 0.000 description 1
- GPPXJZIENCGNKB-UHFFFAOYSA-N vanadium Chemical compound [V]#[V] GPPXJZIENCGNKB-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C06—EXPLOSIVES; MATCHES
- C06B—EXPLOSIVES OR THERMIC COMPOSITIONS; MANUFACTURE THEREOF; USE OF SINGLE SUBSTANCES AS EXPLOSIVES
- C06B43/00—Compositions characterised by explosive or thermic constituents not provided for in groups C06B25/00 - C06B41/00
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Air Bags (AREA)
- Feeding, Discharge, Calcimining, Fusing, And Gas-Generation Devices (AREA)
- Catalysts (AREA)
- Treating Waste Gases (AREA)
Priority Applications (5)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2004620A DE2004620C3 (de) | 1970-02-03 | 1970-02-03 | Druckgaserzeugende Ladungen |
| US00110601A US3719604A (en) | 1970-02-03 | 1971-01-28 | Pressurizing-gas-producing charges containing an aminoguanidine tetrazole and an oxygen-liberating or gas-evolving additive |
| FR7103450A FR2078084A5 (enExample) | 1970-02-03 | 1971-02-02 | |
| CA104,338A CA981024A (en) | 1970-02-03 | 1971-02-02 | Pressure gas producing charges |
| GB2062871A GB1313619A (en) | 1970-02-03 | 1971-04-19 | Gas-producing combustible charges |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2004620A DE2004620C3 (de) | 1970-02-03 | 1970-02-03 | Druckgaserzeugende Ladungen |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2004620A1 DE2004620A1 (de) | 1971-08-19 |
| DE2004620B2 DE2004620B2 (de) | 1974-12-12 |
| DE2004620C3 true DE2004620C3 (de) | 1975-07-17 |
Family
ID=5761179
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2004620A Expired DE2004620C3 (de) | 1970-02-03 | 1970-02-03 | Druckgaserzeugende Ladungen |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US3719604A (enExample) |
| CA (1) | CA981024A (enExample) |
| DE (1) | DE2004620C3 (enExample) |
| FR (1) | FR2078084A5 (enExample) |
| GB (1) | GB1313619A (enExample) |
Families Citing this family (41)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| AR204386A1 (es) * | 1971-03-16 | 1976-02-06 | Minnesota Mining & Mfg | Emulsion fotografica a base de haluros de plata |
| US4369079A (en) * | 1980-12-31 | 1983-01-18 | Thiokol Corporation | Solid non-azide nitrogen gas generant compositions |
| US4601344A (en) * | 1983-09-29 | 1986-07-22 | The United States Of America As Represented By The Secretary Of The Navy | Pyrotechnic fire extinguishing method |
| US5053086A (en) * | 1985-03-15 | 1991-10-01 | The United States Of America As Represented By The Secretary Of The Navy | Gas generant compositions containing energetic high nitrogen binders |
| US5015309A (en) * | 1989-05-04 | 1991-05-14 | Morton International, Inc. | Gas generant compositions containing salts of 5-nitrobarbituric acid, salts of nitroorotic acid, or 5-nitrouracil |
| DE4034645A1 (de) * | 1990-10-31 | 1992-05-07 | Fraunhofer Ges Forschung | Stabile, stickstoffreiche verbindung |
| DE4108225C1 (enExample) * | 1991-03-14 | 1992-04-09 | Fraunhofer-Gesellschaft Zur Foerderung Der Angewandten Forschung Ev, 8000 Muenchen, De | |
| US5197758A (en) * | 1991-10-09 | 1993-03-30 | Morton International, Inc. | Non-azide gas generant formulation, method, and apparatus |
| US5160386A (en) * | 1991-11-04 | 1992-11-03 | Morton International, Inc. | Gas generant formulations containing poly(nitrito) metal complexes as oxidants and method |
| US5783773A (en) * | 1992-04-13 | 1998-07-21 | Automotive Systems Laboratory Inc. | Low-residue azide-free gas generant composition |
| JP3182010B2 (ja) * | 1992-11-30 | 2001-07-03 | 東洋化成工業株式会社 | エアーバック用ガス発生剤 |
| US5425886A (en) * | 1993-06-23 | 1995-06-20 | The United States Of America As Represented By The Secretary Of The Navy | On demand, non-halon, fire extinguishing systems |
| US5682014A (en) * | 1993-08-02 | 1997-10-28 | Thiokol Corporation | Bitetrazoleamine gas generant compositions |
| US5472647A (en) * | 1993-08-02 | 1995-12-05 | Thiokol Corporation | Method for preparing anhydrous tetrazole gas generant compositions |
| EP0723530A4 (en) * | 1993-08-02 | 1996-09-25 | Thiokol Corp | PROCESS FOR THE PREPARATION OF GAS-GENERATING ANHYDROUS TETRAZOLE COMPOSITIONS |
| WO1995004710A1 (en) * | 1993-08-04 | 1995-02-16 | Automotive Systems Laboratory, Inc. | Law residue azide-free gas generant composition |
| US5468866A (en) * | 1994-01-04 | 1995-11-21 | Thiokol Corporation | Methods for synthesizing and processing bis-(1(2)H-tetrazol-5-yl)-amine |
| US5472534A (en) * | 1994-01-06 | 1995-12-05 | Thiokol Corporation | Gas generant composition containing non-metallic salts of 5-nitrobarbituric acid |
| WO1995019341A2 (en) * | 1994-01-06 | 1995-07-20 | Thiokol Corporation | Process for making 5-nitrobarbituric acid and salts thereof |
| US5451682A (en) * | 1994-01-10 | 1995-09-19 | Thiokol Corporation | Method for synthesizing 5-aminotetrazole |
| US5516377A (en) * | 1994-01-10 | 1996-05-14 | Thiokol Corporation | Gas generating compositions based on salts of 5-nitraminotetrazole |
| US5538567A (en) * | 1994-03-18 | 1996-07-23 | Olin Corporation | Gas generating propellant |
| DE19505568A1 (de) * | 1995-02-18 | 1996-08-22 | Dynamit Nobel Ag | Gaserzeugende Mischungen |
| US5641938A (en) * | 1995-03-03 | 1997-06-24 | Primex Technologies, Inc. | Thermally stable gas generating composition |
| US5514230A (en) * | 1995-04-14 | 1996-05-07 | Automotive Systems Laboratory, Inc. | Nonazide gas generating compositions with a built-in catalyst |
| US5844164A (en) * | 1996-02-23 | 1998-12-01 | Breed Automotive Technologies, Inc. | Gas generating device with specific composition |
| US5661261A (en) * | 1996-02-23 | 1997-08-26 | Breed Automotive Technology, Inc. | Gas generating composition |
| US5866842A (en) * | 1996-07-18 | 1999-02-02 | Primex Technologies, Inc. | Low temperature autoigniting propellant composition |
| US6306232B1 (en) | 1996-07-29 | 2001-10-23 | Automotive Systems Laboratory, Inc. | Thermally stable nonazide automotive airbag propellants |
| US5872329A (en) * | 1996-11-08 | 1999-02-16 | Automotive Systems Laboratory, Inc. | Nonazide gas generant compositions |
| WO1999046222A2 (en) * | 1998-03-12 | 1999-09-16 | Automotive Systems Laboratory, Inc. | High gas yield non-azide gas generants |
| US6645325B1 (en) * | 1998-06-01 | 2003-11-11 | Russell R. Nickel | Fast-burning nitrocellulose compositions |
| SE513315C2 (sv) * | 1998-12-30 | 2000-08-21 | Nexplo Bofors Ab | Sätt att framställa gasbildare för gasdrivna bilsäkerhetsdetaljer och pyrotekiska gasbildare framställd i enlighet med sättet |
| US20040154711A1 (en) * | 1998-12-30 | 2004-08-12 | Per Sjoberg | Gas-generating material for gas-actuated car safety devices |
| SE514336C2 (sv) | 1999-05-12 | 2001-02-12 | Bofors Bepab Ab | Sammansatt gasbildare för gasdrivna bilsäkerhetsdetaljer |
| WO2005097711A2 (en) * | 2004-03-29 | 2005-10-20 | Automotive Systems Laboratory, Inc. | Gas generant and manufacturing method thereof |
| US10968147B2 (en) * | 2005-06-02 | 2021-04-06 | Ruag Ammotec Gmbh | Pyrotechnic agent |
| WO2008054528A2 (en) * | 2006-05-05 | 2008-05-08 | Tk Holdings, Inc. | Gas generant compositions |
| US7692024B2 (en) * | 2006-05-05 | 2010-04-06 | Tk Holdings, Inc. | Gas generant compositions |
| DE112007002257T5 (de) * | 2006-09-30 | 2009-07-30 | TK Holdings, Inc., Armada | Gaserzeugungsmittelzusammensetzungen |
| US9045380B1 (en) | 2007-10-31 | 2015-06-02 | Tk Holdings Inc. | Gas generating compositions |
-
1970
- 1970-02-03 DE DE2004620A patent/DE2004620C3/de not_active Expired
-
1971
- 1971-01-28 US US00110601A patent/US3719604A/en not_active Expired - Lifetime
- 1971-02-02 CA CA104,338A patent/CA981024A/en not_active Expired
- 1971-02-02 FR FR7103450A patent/FR2078084A5/fr not_active Expired
- 1971-04-19 GB GB2062871A patent/GB1313619A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| DE2004620B2 (de) | 1974-12-12 |
| US3719604A (en) | 1973-03-06 |
| CA981024A (en) | 1976-01-06 |
| FR2078084A5 (enExample) | 1971-11-05 |
| GB1313619A (en) | 1973-04-18 |
| DE2004620A1 (de) | 1971-08-19 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2004620C3 (de) | Druckgaserzeugende Ladungen | |
| DE69424041T2 (de) | Zündmittelzusammensetzungen für airbag-gasgeneratoren | |
| EP0691317B1 (de) | Gaserzeugendes, azidfreies Stoffgemisch | |
| DE69609793T2 (de) | Heterogene gaserzeugende Treibladungen | |
| DE69323410T2 (de) | Gaserzeugungsmittel für airbags | |
| DE19840993B4 (de) | Verwendung eines gaserzeugenden Gemisches als Anzündmischung in einem Gasgenerator | |
| DE19730872A1 (de) | Pyrotechnische Mischung als Treibmittel oder als Gassatz mit Kohlenmonoxid-reduzierten Schwaden | |
| DE2601162C2 (de) | Sprengstoffmischung | |
| AT390787B (de) | Verfahren zur herstellung eines sprengund/oder festtreibstoffes | |
| EP1171404A1 (de) | Gaserzeugende stoffe | |
| DE112006002030T5 (de) | Selbstzündungs-/Booster-Zusammensetzung | |
| DE4219960C2 (de) | Zusammensetzung für einen Sicherheitssprengstoff vom Hydrogeltyp und Verfahren zu seiner Herstellung | |
| DE19935187A1 (de) | Vorrichtung mit einer aufblasbaren Fahrzeuginsassen-Schutzvorrichtung und eine Gaserzeugungszusammensetzung dafür | |
| DE60012933T2 (de) | Zusammengesetztes, gaserzeugendes material für gasbetriebene fahrzeugsicherheitseinrichtungen | |
| DE1816751A1 (de) | Anorganische,oxydierende Sprengstoffsalze | |
| DE202004009449U1 (de) | Gaserzeugende Zusammensetzung | |
| DE938596C (de) | Verfahren zur Herstellung von Wettersprengstoffen mit erhoehter Leistung | |
| DE112014002656T5 (de) | Nitroaromatisch substituierte Metallhydroxidnitrate | |
| DE307039C (enExample) | ||
| DE102004062168A1 (de) | Stoffgemisch als thermisch initiierbare Anzündmischung | |
| DE1111079B (de) | Sprengstoffe oder Treibmittel | |
| AT216401B (de) | Plastischer, von flüssigen Salpetersäureestern freier Sicherheitssprengstoff | |
| DE2553055B2 (de) | Sicherheitssprengstoff | |
| DE1177992B (de) | Monergolischer Raketentreibstoff | |
| DE2555335A1 (de) | Nitrato-alkanole enthaltende stoffzusammensetzungen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) | ||
| E77 | Valid patent as to the heymanns-index 1977 | ||
| 8339 | Ceased/non-payment of the annual fee |