DE1965925A1 - Substituierte Diguanide und Verfahren zu ihrer Herstellung - Google Patents
Substituierte Diguanide und Verfahren zu ihrer HerstellungInfo
- Publication number
- DE1965925A1 DE1965925A1 DE19691965925 DE1965925A DE1965925A1 DE 1965925 A1 DE1965925 A1 DE 1965925A1 DE 19691965925 DE19691965925 DE 19691965925 DE 1965925 A DE1965925 A DE 1965925A DE 1965925 A1 DE1965925 A1 DE 1965925A1
- Authority
- DE
- Germany
- Prior art keywords
- group
- substituted
- compounds according
- atoms
- radical
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000002360 preparation method Methods 0.000 title claims description 8
- 238000000034 method Methods 0.000 title claims description 5
- -1 triazin-1-yl) residue Chemical group 0.000 claims description 42
- 150000001875 compounds Chemical class 0.000 claims description 17
- 125000004432 carbon atom Chemical group C* 0.000 claims description 13
- 125000005843 halogen group Chemical group 0.000 claims description 9
- 125000001424 substituent group Chemical group 0.000 claims description 7
- VDEUYMSGMPQMIK-UHFFFAOYSA-N benzhydroxamic acid Chemical compound ONC(=O)C1=CC=CC=C1 VDEUYMSGMPQMIK-UHFFFAOYSA-N 0.000 claims description 6
- 125000000217 alkyl group Chemical group 0.000 claims description 5
- 125000003118 aryl group Chemical group 0.000 claims description 5
- SYNHCENRCUAUNM-UHFFFAOYSA-N Nitrogen mustard N-oxide hydrochloride Chemical compound Cl.ClCC[N+]([O-])(C)CCCl SYNHCENRCUAUNM-UHFFFAOYSA-N 0.000 claims description 4
- 125000003545 alkoxy group Chemical group 0.000 claims description 4
- QGBSISYHAICWAH-UHFFFAOYSA-N dicyandiamide Chemical compound NC(N)=NC#N QGBSISYHAICWAH-UHFFFAOYSA-N 0.000 claims description 4
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 4
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 4
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 claims description 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 3
- 201000004792 malaria Diseases 0.000 claims description 3
- 229910052760 oxygen Inorganic materials 0.000 claims description 3
- 239000001301 oxygen Substances 0.000 claims description 3
- 229910052717 sulfur Inorganic materials 0.000 claims description 3
- 125000004434 sulfur atom Chemical group 0.000 claims description 3
- 239000004215 Carbon black (E152) Substances 0.000 claims description 2
- 239000002253 acid Substances 0.000 claims description 2
- 239000004480 active ingredient Substances 0.000 claims description 2
- 125000001931 aliphatic group Chemical group 0.000 claims description 2
- 125000003277 amino group Chemical group 0.000 claims description 2
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 2
- 229930195733 hydrocarbon Natural products 0.000 claims description 2
- 125000001624 naphthyl group Chemical group 0.000 claims description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 2
- 150000003918 triazines Chemical class 0.000 claims description 2
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 claims 2
- 125000003342 alkenyl group Chemical group 0.000 claims 2
- 125000004183 alkoxy alkyl group Chemical group 0.000 claims 2
- 125000003710 aryl alkyl group Chemical group 0.000 claims 2
- 125000004966 cyanoalkyl group Chemical group 0.000 claims 2
- 125000000623 heterocyclic group Chemical group 0.000 claims 2
- 125000005429 oxyalkyl group Chemical group 0.000 claims 2
- 125000003282 alkyl amino group Chemical group 0.000 claims 1
- 125000004688 alkyl sulfonyl alkyl group Chemical group 0.000 claims 1
- 125000004390 alkyl sulfonyl group Chemical group 0.000 claims 1
- 125000004414 alkyl thio group Chemical group 0.000 claims 1
- 125000004093 cyano group Chemical group *C#N 0.000 claims 1
- 125000001188 haloalkyl group Chemical group 0.000 claims 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims 1
- 150000003254 radicals Chemical group 0.000 description 23
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 21
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 15
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 15
- 239000000203 mixture Substances 0.000 description 12
- 239000000126 substance Substances 0.000 description 11
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 10
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 9
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 8
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 8
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 8
- 239000007787 solid Substances 0.000 description 7
- 238000001953 recrystallisation Methods 0.000 description 6
- 239000002904 solvent Substances 0.000 description 6
- 239000000155 melt Substances 0.000 description 5
- 230000008018 melting Effects 0.000 description 5
- 238000002844 melting Methods 0.000 description 5
- 239000000523 sample Substances 0.000 description 4
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 3
- 238000001704 evaporation Methods 0.000 description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- FIDRAVVQGKNYQK-UHFFFAOYSA-N 1,2,3,4-tetrahydrotriazine Chemical class C1NNNC=C1 FIDRAVVQGKNYQK-UHFFFAOYSA-N 0.000 description 2
- XNCOSPRUTUOJCJ-UHFFFAOYSA-N Biguanide Chemical compound NC(N)=NC(N)=N XNCOSPRUTUOJCJ-UHFFFAOYSA-N 0.000 description 2
- 229940123208 Biguanide Drugs 0.000 description 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- 239000000538 analytical sample Substances 0.000 description 2
- 125000004429 atom Chemical group 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 2
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 2
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- JDLGLPSFTWWZQQ-UHFFFAOYSA-N o-(2-naphthalen-2-yloxyethyl)hydroxylamine;hydrochloride Chemical compound Cl.C1=CC=CC2=CC(OCCON)=CC=C21 JDLGLPSFTWWZQQ-UHFFFAOYSA-N 0.000 description 2
- 125000000286 phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 238000011282 treatment Methods 0.000 description 2
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 2
- ATWLRNODAYAMQS-UHFFFAOYSA-N 1,1-dibromopropane Chemical compound CCC(Br)Br ATWLRNODAYAMQS-UHFFFAOYSA-N 0.000 description 1
- JYEUMXHLPRZUAT-UHFFFAOYSA-N 1,2,3-triazine Chemical compound C1=CN=NN=C1 JYEUMXHLPRZUAT-UHFFFAOYSA-N 0.000 description 1
- VEFLKXRACNJHOV-UHFFFAOYSA-N 1,3-dibromopropane Chemical compound BrCCCBr VEFLKXRACNJHOV-UHFFFAOYSA-N 0.000 description 1
- JFPLHTXLQHQPOR-UHFFFAOYSA-N 1-(3-bromopropoxy)-2,4,5-trichlorobenzene Chemical compound ClC1=CC(Cl)=C(OCCCBr)C=C1Cl JFPLHTXLQHQPOR-UHFFFAOYSA-N 0.000 description 1
- LHJGJYXLEPZJPM-UHFFFAOYSA-N 2,4,5-trichlorophenol Chemical compound OC1=CC(Cl)=C(Cl)C=C1Cl LHJGJYXLEPZJPM-UHFFFAOYSA-N 0.000 description 1
- NKALVESVNGTFHZ-UHFFFAOYSA-N 2-(2-bromoethoxy)naphthalene Chemical compound C1=CC=CC2=CC(OCCBr)=CC=C21 NKALVESVNGTFHZ-UHFFFAOYSA-N 0.000 description 1
- 241001480043 Arthrodermataceae Species 0.000 description 1
- 241000894006 Bacteria Species 0.000 description 1
- 241000222120 Candida <Saccharomycetales> Species 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 241000233866 Fungi Species 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 125000005428 anthryl group Chemical group [H]C1=C([H])C([H])=C2C([H])=C3C(*)=C([H])C([H])=C([H])C3=C([H])C2=C1[H] 0.000 description 1
- 150000004283 biguanides Chemical class 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- 125000004369 butenyl group Chemical group C(=CCC)* 0.000 description 1
- 150000001728 carbonyl compounds Chemical class 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 125000000490 cinnamyl group Chemical group C(C=CC1=CC=CC=C1)* 0.000 description 1
- 230000037304 dermatophytes Effects 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 239000012259 ether extract Substances 0.000 description 1
- 125000000031 ethylamino group Chemical group [H]C([H])([H])C([H])([H])N([H])[*] 0.000 description 1
- 125000004705 ethylthio group Chemical group C(C)S* 0.000 description 1
- 229910010272 inorganic material Inorganic materials 0.000 description 1
- 239000011147 inorganic material Substances 0.000 description 1
- 229910003480 inorganic solid Inorganic materials 0.000 description 1
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 description 1
- 125000000250 methylamino group Chemical group [H]N(*)C([H])([H])[H] 0.000 description 1
- 125000002816 methylsulfanyl group Chemical group [H]C([H])([H])S[*] 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- FEVAULLYQXCDNK-UHFFFAOYSA-N o-[3-(2,4,5-trichlorophenoxy)propyl]hydroxylamine;hydrochloride Chemical compound Cl.NOCCCOC1=CC(Cl)=C(Cl)C=C1Cl FEVAULLYQXCDNK-UHFFFAOYSA-N 0.000 description 1
- 244000045947 parasite Species 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 125000005561 phenanthryl group Chemical group 0.000 description 1
- 125000004344 phenylpropyl group Chemical group 0.000 description 1
- 238000011321 prophylaxis Methods 0.000 description 1
- 125000002572 propoxy group Chemical group [*]OC([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- QQONPFPTGQHPMA-UHFFFAOYSA-N propylene Natural products CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 description 1
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 description 1
- 125000004742 propyloxycarbonyl group Chemical group 0.000 description 1
- 125000001725 pyrenyl group Chemical group 0.000 description 1
- 125000004076 pyridyl group Chemical group 0.000 description 1
- 125000005493 quinolyl group Chemical group 0.000 description 1
- FYZUCVSCZVWCBR-UHFFFAOYSA-N sodium;n-oxidobenzamide Chemical compound [Na+].[O-]NC(=O)C1=CC=CC=C1 FYZUCVSCZVWCBR-UHFFFAOYSA-N 0.000 description 1
- 239000011343 solid material Substances 0.000 description 1
- 239000011877 solvent mixture Substances 0.000 description 1
- 125000005420 sulfonamido group Chemical group S(=O)(=O)(N*)* 0.000 description 1
- 125000001712 tetrahydronaphthyl group Chemical group C1(CCCC2=CC=CC=C12)* 0.000 description 1
- 125000000383 tetramethylene group Chemical group [H]C([H])([*:1])C([H])([H])C([H])([H])C([H])([H])[*:2] 0.000 description 1
- 125000003396 thiol group Chemical group [H]S* 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D319/00—Heterocyclic compounds containing six-membered rings having two oxygen atoms as the only ring hetero atoms
- C07D319/04—1,3-Dioxanes; Hydrogenated 1,3-dioxanes
- C07D319/08—1,3-Dioxanes; Hydrogenated 1,3-dioxanes condensed with carbocyclic rings or ring systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C323/00—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C43/00—Ethers; Compounds having groups, groups or groups
- C07C43/02—Ethers
- C07C43/03—Ethers having all ether-oxygen atoms bound to acyclic carbon atoms
- C07C43/04—Saturated ethers
- C07C43/12—Saturated ethers containing halogen
-
- F—MECHANICAL ENGINEERING; LIGHTING; HEATING; WEAPONS; BLASTING
- F16—ENGINEERING ELEMENTS AND UNITS; GENERAL MEASURES FOR PRODUCING AND MAINTAINING EFFECTIVE FUNCTIONING OF MACHINES OR INSTALLATIONS; THERMAL INSULATION IN GENERAL
- F16J—PISTONS; CYLINDERS; SEALINGS
- F16J1/00—Pistons; Trunk pistons; Plungers
- F16J1/10—Connection to driving members
- F16J1/14—Connection to driving members with connecting-rods, i.e. pivotal connections
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Engineering & Computer Science (AREA)
- General Engineering & Computer Science (AREA)
- Combustion & Propulsion (AREA)
- Mechanical Engineering (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB01866/69A GB1270831A (en) | 1968-11-22 | 1968-11-22 | Di-hydro triazine derivatives and processes for their manufacture |
| GB5542868 | 1968-11-22 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1965925A1 true DE1965925A1 (de) | 1970-09-17 |
Family
ID=26248577
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE1957769A Expired DE1957769C3 (de) | 1968-11-22 | 1969-11-17 | 4,6-Diamino-l,2-dihydro-2,2-dimethyl-133-triazin-Derivate, Verfahren zu ihrer Herstellung und diese Verbindungen enthaltende Arzneipräparate |
| DE19691965925 Pending DE1965925A1 (de) | 1968-11-22 | 1969-11-17 | Substituierte Diguanide und Verfahren zu ihrer Herstellung |
Family Applications Before (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE1957769A Expired DE1957769C3 (de) | 1968-11-22 | 1969-11-17 | 4,6-Diamino-l,2-dihydro-2,2-dimethyl-133-triazin-Derivate, Verfahren zu ihrer Herstellung und diese Verbindungen enthaltende Arzneipräparate |
Country Status (13)
| Country | Link |
|---|---|
| AT (1) | AT303748B (enExample) |
| BE (1) | BE741996A (enExample) |
| CH (1) | CH554350A (enExample) |
| DE (2) | DE1957769C3 (enExample) |
| DK (1) | DK134521B (enExample) |
| ES (1) | ES373657A1 (enExample) |
| FR (1) | FR2023866B1 (enExample) |
| GB (1) | GB1270831A (enExample) |
| LU (1) | LU59866A1 (enExample) |
| NL (1) | NL6917536A (enExample) |
| NO (1) | NO128712B (enExample) |
| OA (1) | OA03394A (enExample) |
| SE (1) | SE383883B (enExample) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| IL41744A0 (en) * | 1972-03-16 | 1973-05-31 | Ciba Geigy Ag | New aryl ether derivatives,their production and their use as pesticides |
| US5322858A (en) * | 1992-02-14 | 1994-06-21 | Jacobus Pharmaceutical Co. Inc. | N,N'-substituted imidodicarbonimidic diamides derived from hydroxylamines |
| GB9423515D0 (en) * | 1994-11-22 | 1995-01-11 | Zeneca Ltd | Fungicidal composition |
| US6551614B2 (en) | 2001-03-14 | 2003-04-22 | Jacobus Pharmaceutical Co., Inc. | Antimalarial N,N′-substituted biguanides derived from hydroxylamines |
-
1968
- 1968-11-22 GB GB01866/69A patent/GB1270831A/en not_active Expired
-
1969
- 1969-11-17 DE DE1957769A patent/DE1957769C3/de not_active Expired
- 1969-11-17 DE DE19691965925 patent/DE1965925A1/de active Pending
- 1969-11-18 ES ES373657A patent/ES373657A1/es not_active Expired
- 1969-11-18 FR FR6939532A patent/FR2023866B1/fr not_active Expired
- 1969-11-18 CH CH1712669A patent/CH554350A/xx not_active IP Right Cessation
- 1969-11-19 SE SE6915930A patent/SE383883B/xx unknown
- 1969-11-20 NL NL6917536A patent/NL6917536A/xx unknown
- 1969-11-20 DK DK616869AA patent/DK134521B/da unknown
- 1969-11-20 NO NO04609/69A patent/NO128712B/no unknown
- 1969-11-20 BE BE741996D patent/BE741996A/xx unknown
- 1969-11-21 AT AT1088269A patent/AT303748B/de not_active IP Right Cessation
- 1969-11-21 LU LU59866D patent/LU59866A1/xx unknown
- 1969-11-24 OA OA53795A patent/OA03394A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| LU59866A1 (enExample) | 1970-01-21 |
| NL6917536A (enExample) | 1970-05-26 |
| GB1270831A (en) | 1972-04-19 |
| CH554350A (de) | 1974-09-30 |
| DE1957769A1 (de) | 1970-09-17 |
| SE383883B (sv) | 1976-04-05 |
| NO128712B (enExample) | 1974-01-02 |
| DE1957769B2 (de) | 1979-12-20 |
| AT303748B (de) | 1972-12-11 |
| FR2023866A1 (enExample) | 1970-08-21 |
| DK134521B (da) | 1976-11-22 |
| BE741996A (enExample) | 1970-05-20 |
| DE1957769C3 (de) | 1980-08-28 |
| FR2023866B1 (enExample) | 1974-01-11 |
| OA03394A (fr) | 1970-12-15 |
| DK134521C (enExample) | 1977-04-25 |
| ES373657A1 (es) | 1972-02-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1965925A1 (de) | Substituierte Diguanide und Verfahren zu ihrer Herstellung | |
| DE1695780B2 (de) | Neue Benzoxazinderivate, Verfahren zu ihrer Herstellung und Arzneimittel | |
| DE2458638C2 (de) | 4'-substituierte 2-Methyl-3-piperidinopropiophenonderivate, Verfahren zu deren Herstellung und pharmakologische Zubereitungen, welche diese enthalten | |
| DE69229845T2 (de) | 2-Piperazinylbenzimidazolderivate | |
| DE889447C (de) | Verfahren zur Herstellung diquarternaerer Salze des 4-Amino-6-(2'-aminopyrimidyl-4'-amino)-chinazolins | |
| DE2403786A1 (de) | Neue derivate der cumarine | |
| EP0041177B1 (de) | Verfahren zur Herstellung von 4-Amino-6-tert.butyl-3-mercapto-1,2,4-triazin-5-on | |
| DE1593212C3 (de) | Verfahren zur Herstellung von MaIeinamidsäurederivaten | |
| DE1302662B (enExample) | ||
| DE1595910A1 (de) | 3,6-Disubstituierte Pyridazine und Verfahren zu ihrer Herstellung | |
| DE744280C (de) | Verfahren zur Herstellung von Pyrimidinabkoemmlingen | |
| DE1040786B (de) | Verfahren zur Herstellung hoeher-molekularer, durch Antivirus-Wirkung ausgezeichneter Tri-(arylamino)-triazin-Kondensationsprodukte | |
| AT277249B (de) | Verfahren zur Herstellung von neuen Chinolinderivaten | |
| DE934947C (de) | Verfahren zur Herstellung von 2, 4-Diamino-5-p-chlorphenyl-6-aethylpyrimidin | |
| DE1545753C (de) | Tnsubstituierte s Triazine und Ver fahren zu ihrer Herstellung | |
| DE2226618A1 (de) | Thienodiazepin-Verbindungen | |
| DE1767152C3 (de) | Analeptisches, psychotonlsches, antidepressives und krampflösendes Hellmittel | |
| DE1795511C3 (de) | 3-Amino-5-phenyl-7-chlor-2,3dihydro-1 H-1,4-benzodiazepinon-(2) | |
| DE2632831A1 (de) | 4,5-disubstituierte 2-oxazolalkansaeuren, ester und alkalisalze dieser saeuren, verfahren zur herstellung dieser verbindungen sowie diese verbindungen enthaltende arzneimittel | |
| AT282586B (de) | Verfahren zur herstellung von neuem racemischem oder optisch aktivem (1-2'-nitrilophenoxy)-2-hydroxy-3-isopropylaminopropan und dessen salzen | |
| CH514595A (de) | Verfahren zur Herstellung von Verbindungen mit beruhigender Wirkung | |
| DE1570014C (de) | Tetramcotinsaureester des 2,2,6,6 Tetrahydroxymethylcyclohexanols und Ver fahren zu seiner Herstellung | |
| DE1670378C (de) | Verfahren zur Herstellung des Salzes aus4-n-Butyl-3,5-dioxo-l,2-diphenylpyrazolidin und dem beta-Diäthylamino-äthylamid der p-Chlorphenoxyessigsäure | |
| AT209345B (de) | Verfahren zur Herstellung von neuen, im Pyrazolkern substituierten Pyrazolo-pyrimidinen | |
| DE1057093B (de) | Verfahren zur Herstellung von Aminoguanidinen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OHN | Withdrawal |