DE1965585A1 - Stilbenverbindungen - Google Patents
StilbenverbindungenInfo
- Publication number
- DE1965585A1 DE1965585A1 DE19691965585 DE1965585A DE1965585A1 DE 1965585 A1 DE1965585 A1 DE 1965585A1 DE 19691965585 DE19691965585 DE 19691965585 DE 1965585 A DE1965585 A DE 1965585A DE 1965585 A1 DE1965585 A1 DE 1965585A1
- Authority
- DE
- Germany
- Prior art keywords
- formula
- stilbene
- compound
- stilbene compounds
- compounds
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- PJANXHGTPQOBST-UHFFFAOYSA-N stilbene Chemical class C=1C=CC=CC=1C=CC1=CC=CC=C1 PJANXHGTPQOBST-UHFFFAOYSA-N 0.000 title claims description 12
- -1 unsaturated alkyl radicals Chemical class 0.000 claims description 22
- 125000004432 carbon atom Chemical group C* 0.000 claims description 6
- MGNCLNQXLYJVJD-UHFFFAOYSA-N cyanuric chloride Chemical compound ClC1=NC(Cl)=NC(Cl)=N1 MGNCLNQXLYJVJD-UHFFFAOYSA-N 0.000 claims description 5
- 229910052739 hydrogen Inorganic materials 0.000 claims description 5
- 239000001257 hydrogen Substances 0.000 claims description 5
- 229920000742 Cotton Polymers 0.000 claims description 4
- 238000004519 manufacturing process Methods 0.000 claims description 4
- 239000000463 material Substances 0.000 claims description 4
- 238000000034 method Methods 0.000 claims description 4
- 150000003839 salts Chemical class 0.000 claims description 4
- 239000004952 Polyamide Substances 0.000 claims description 3
- 150000001412 amines Chemical class 0.000 claims description 3
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 3
- 150000005840 aryl radicals Chemical class 0.000 claims description 3
- 238000005282 brightening Methods 0.000 claims description 3
- 150000001768 cations Chemical class 0.000 claims description 3
- 229920002647 polyamide Polymers 0.000 claims description 3
- 239000011734 sodium Substances 0.000 claims description 3
- 125000000547 substituted alkyl group Chemical group 0.000 claims description 3
- SLRMQYXOBQWXCR-UHFFFAOYSA-N 2154-56-5 Chemical compound [CH2]C1=CC=CC=C1 SLRMQYXOBQWXCR-UHFFFAOYSA-N 0.000 claims description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 claims description 2
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 2
- 230000003287 optical effect Effects 0.000 claims description 2
- 229910052700 potassium Inorganic materials 0.000 claims description 2
- 239000011591 potassium Substances 0.000 claims description 2
- 229920006395 saturated elastomer Polymers 0.000 claims description 2
- 229910052708 sodium Inorganic materials 0.000 claims description 2
- PJANXHGTPQOBST-VAWYXSNFSA-N Stilbene Natural products C=1C=CC=CC=1/C=C/C1=CC=CC=C1 PJANXHGTPQOBST-VAWYXSNFSA-N 0.000 claims 5
- 235000021286 stilbenes Nutrition 0.000 claims 5
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims 3
- 229920002678 cellulose Polymers 0.000 claims 2
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 claims 1
- 230000015572 biosynthetic process Effects 0.000 claims 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 claims 1
- 239000003795 chemical substances by application Substances 0.000 description 6
- 239000000243 solution Substances 0.000 description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 6
- 150000001875 compounds Chemical class 0.000 description 5
- IIACRCGMVDHOTQ-UHFFFAOYSA-N sulfamic acid Chemical class NS(O)(=O)=O IIACRCGMVDHOTQ-UHFFFAOYSA-N 0.000 description 4
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- 150000001447 alkali salts Chemical class 0.000 description 3
- 239000007900 aqueous suspension Substances 0.000 description 3
- HVBSAKJJOYLTQU-UHFFFAOYSA-N 4-aminobenzenesulfonic acid Chemical compound NC1=CC=C(S(O)(=O)=O)C=C1 HVBSAKJJOYLTQU-UHFFFAOYSA-N 0.000 description 2
- REJHVSOVQBJEBF-OWOJBTEDSA-N 5-azaniumyl-2-[(e)-2-(4-azaniumyl-2-sulfonatophenyl)ethenyl]benzenesulfonate Chemical compound OS(=O)(=O)C1=CC(N)=CC=C1\C=C\C1=CC=C(N)C=C1S(O)(=O)=O REJHVSOVQBJEBF-OWOJBTEDSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 2
- 150000008041 alkali metal carbonates Chemical class 0.000 description 2
- 150000003863 ammonium salts Chemical class 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 239000011230 binding agent Substances 0.000 description 2
- WQAQPCDUOCURKW-UHFFFAOYSA-N butanethiol Chemical compound CCCCS WQAQPCDUOCURKW-UHFFFAOYSA-N 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 150000003254 radicals Chemical class 0.000 description 2
- CWERGRDVMFNCDR-UHFFFAOYSA-N thioglycolic acid Chemical compound OC(=O)CS CWERGRDVMFNCDR-UHFFFAOYSA-N 0.000 description 2
- 239000000080 wetting agent Substances 0.000 description 2
- 230000002087 whitening effect Effects 0.000 description 2
- JYEUMXHLPRZUAT-UHFFFAOYSA-N 1,2,3-triazine Chemical group C1=CN=NN=C1 JYEUMXHLPRZUAT-UHFFFAOYSA-N 0.000 description 1
- PGJJYXPMHZOQHJ-UHFFFAOYSA-N 2-[1,2-diamino-2-(2-sulfophenyl)ethenyl]benzenesulfonic acid Chemical compound C=1C=CC=C(S(O)(=O)=O)C=1C(N)=C(N)C1=CC=CC=C1S(O)(=O)=O PGJJYXPMHZOQHJ-UHFFFAOYSA-N 0.000 description 1
- RNLJXNUXROETLD-UHFFFAOYSA-N 2-aminobenzene-1,3-disulfonic acid Chemical compound NC1=C(S(O)(=O)=O)C=CC=C1S(O)(=O)=O RNLJXNUXROETLD-UHFFFAOYSA-N 0.000 description 1
- ZMCHBSMFKQYNKA-UHFFFAOYSA-N 2-aminobenzenesulfonic acid Chemical compound NC1=CC=CC=C1S(O)(=O)=O ZMCHBSMFKQYNKA-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- ZAJAQTYSTDTMCU-UHFFFAOYSA-N 3-aminobenzenesulfonic acid Chemical compound NC1=CC=CC(S(O)(=O)=O)=C1 ZAJAQTYSTDTMCU-UHFFFAOYSA-N 0.000 description 1
- GBWNQBBVSVGAAL-UHFFFAOYSA-N 5-aminobenzene-1,3-disulfonic acid Chemical compound NC1=CC(S(O)(=O)=O)=CC(S(O)(=O)=O)=C1 GBWNQBBVSVGAAL-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- REJHVSOVQBJEBF-UHFFFAOYSA-N DSD-acid Natural products OS(=O)(=O)C1=CC(N)=CC=C1C=CC1=CC=C(N)C=C1S(O)(=O)=O REJHVSOVQBJEBF-UHFFFAOYSA-N 0.000 description 1
- QXNVGIXVLWOKEQ-UHFFFAOYSA-N Disodium Chemical class [Na][Na] QXNVGIXVLWOKEQ-UHFFFAOYSA-N 0.000 description 1
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- KLTDNOMFGNIQGC-UHFFFAOYSA-N NC1=C(C=C(C=C1)S(=O)(=O)O)S(=O)(=O)O.NC1=CC=C(C=C1)S(=O)(=O)O Chemical compound NC1=C(C=C(C=C1)S(=O)(=O)O)S(=O)(=O)O.NC1=CC=C(C=C1)S(=O)(=O)O KLTDNOMFGNIQGC-UHFFFAOYSA-N 0.000 description 1
- 241000533901 Narcissus papyraceus Species 0.000 description 1
- BUGBHKTXTAQXES-UHFFFAOYSA-N Selenium Chemical compound [Se] BUGBHKTXTAQXES-UHFFFAOYSA-N 0.000 description 1
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical class OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 1
- FJJFAPSJYNEBLW-UHFFFAOYSA-N [Na+].O=S=O Chemical compound [Na+].O=S=O FJJFAPSJYNEBLW-UHFFFAOYSA-N 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- DIZPMCHEQGEION-UHFFFAOYSA-H aluminium sulfate (anhydrous) Chemical compound [Al+3].[Al+3].[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O DIZPMCHEQGEION-UHFFFAOYSA-H 0.000 description 1
- 239000007844 bleaching agent Substances 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 239000005018 casein Substances 0.000 description 1
- BECPQYXYKAMYBN-UHFFFAOYSA-N casein, tech. Chemical compound NCCCCC(C(O)=O)N=C(O)C(CC(O)=O)N=C(O)C(CCC(O)=N)N=C(O)C(CC(C)C)N=C(O)C(CCC(O)=O)N=C(O)C(CC(O)=O)N=C(O)C(CCC(O)=O)N=C(O)C(C(C)O)N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=O)N=C(O)C(CCC(O)=O)N=C(O)C(COP(O)(O)=O)N=C(O)C(CCC(O)=N)N=C(O)C(N)CC1=CC=CC=C1 BECPQYXYKAMYBN-UHFFFAOYSA-N 0.000 description 1
- 235000021240 caseins Nutrition 0.000 description 1
- 229920002301 cellulose acetate Polymers 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 238000004040 coloring Methods 0.000 description 1
- 239000007859 condensation product Substances 0.000 description 1
- 239000012084 conversion product Substances 0.000 description 1
- 238000007598 dipping method Methods 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- JBKVHLHDHHXQEQ-UHFFFAOYSA-N epsilon-caprolactam Chemical compound O=C1CCCCCN1 JBKVHLHDHHXQEQ-UHFFFAOYSA-N 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- 150000002191 fatty alcohols Chemical class 0.000 description 1
- 239000000835 fiber Substances 0.000 description 1
- 230000035876 healing Effects 0.000 description 1
- 150000002431 hydrogen Chemical class 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- SQYUJKVKVFILNB-UHFFFAOYSA-N methyl 2-amino-4-[(2,5-dichlorophenyl)carbamoyl]benzoate Chemical compound C1=C(N)C(C(=O)OC)=CC=C1C(=O)NC1=CC(Cl)=CC=C1Cl SQYUJKVKVFILNB-UHFFFAOYSA-N 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 238000003541 multi-stage reaction Methods 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 125000003261 o-tolyl group Chemical group [H]C1=C([H])C(*)=C(C([H])=C1[H])C([H])([H])[H] 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 239000004014 plasticizer Substances 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 229910052711 selenium Inorganic materials 0.000 description 1
- 239000011669 selenium Substances 0.000 description 1
- 238000004513 sizing Methods 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- 229950000244 sulfanilic acid Drugs 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-L sulfite Chemical compound [O-]S([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-L 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 238000005303 weighing Methods 0.000 description 1
Classifications
-
- D—TEXTILES; PAPER
- D06—TREATMENT OF TEXTILES OR THE LIKE; LAUNDERING; FLEXIBLE MATERIALS NOT OTHERWISE PROVIDED FOR
- D06L—DRY-CLEANING, WASHING OR BLEACHING FIBRES, FILAMENTS, THREADS, YARNS, FABRICS, FEATHERS OR MADE-UP FIBROUS GOODS; BLEACHING LEATHER OR FURS
- D06L4/00—Bleaching fibres, filaments, threads, yarns, fabrics, feathers or made-up fibrous goods; Bleaching leather or furs
- D06L4/60—Optical bleaching or brightening
Landscapes
- Engineering & Computer Science (AREA)
- Textile Engineering (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Treatments For Attaching Organic Compounds To Fibrous Goods (AREA)
- Paper (AREA)
Priority Applications (9)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19691965585 DE1965585A1 (de) | 1969-12-30 | 1969-12-30 | Stilbenverbindungen |
| CA100086A CA921469A (en) | 1969-12-30 | 1970-12-08 | Stilbene compounds |
| GB1296080D GB1296080A (enExample) | 1969-12-30 | 1970-12-22 | |
| JP45119525A JPS4817369B1 (enExample) | 1969-12-30 | 1970-12-28 | |
| NL7018964A NL7018964A (enExample) | 1969-12-30 | 1970-12-29 | |
| CH1934070A CH545802A (enExample) | 1969-12-30 | 1970-12-30 | |
| FR707047396A FR2073511B1 (enExample) | 1969-12-30 | 1970-12-30 | |
| AT1174670A AT299967B (de) | 1969-12-30 | 1970-12-30 | Verfahren zur Herstellung von neuen Stilbenverbindungen |
| BE761065A BE761065A (en) | 1969-12-30 | 1970-12-30 | Stilbene compouds with aminoaryl substitu - ted triazine rings as optical brighteners |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19691965585 DE1965585A1 (de) | 1969-12-30 | 1969-12-30 | Stilbenverbindungen |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1965585A1 true DE1965585A1 (de) | 1971-07-15 |
Family
ID=5755315
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19691965585 Pending DE1965585A1 (de) | 1969-12-30 | 1969-12-30 | Stilbenverbindungen |
Country Status (8)
| Country | Link |
|---|---|
| JP (1) | JPS4817369B1 (enExample) |
| AT (1) | AT299967B (enExample) |
| CA (1) | CA921469A (enExample) |
| CH (1) | CH545802A (enExample) |
| DE (1) | DE1965585A1 (enExample) |
| FR (1) | FR2073511B1 (enExample) |
| GB (1) | GB1296080A (enExample) |
| NL (1) | NL7018964A (enExample) |
Cited By (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2301531A1 (de) * | 1972-08-04 | 1974-02-21 | Nippon Kayaku Kk | 4,4'-diaminostilben-2,2'-disulfonsaeurederivate und ihre verwendung |
| US4212763A (en) * | 1977-07-04 | 1980-07-15 | Ciba-Geigy Corporation | Bis-triazinylaminostilbene compounds and their use as fluorescent brightening agents |
| EP0704444A1 (de) * | 1994-09-14 | 1996-04-03 | Ciba-Geigy Ag | UV-Absorber, ihre Herstellung und Verwendung |
| EP0728749A3 (en) * | 1995-02-22 | 1997-02-26 | Ciba Geigy Ag | Triazine derivatives, their preparation and their application |
-
1969
- 1969-12-30 DE DE19691965585 patent/DE1965585A1/de active Pending
-
1970
- 1970-12-08 CA CA100086A patent/CA921469A/en not_active Expired
- 1970-12-22 GB GB1296080D patent/GB1296080A/en not_active Expired
- 1970-12-28 JP JP45119525A patent/JPS4817369B1/ja active Pending
- 1970-12-29 NL NL7018964A patent/NL7018964A/xx unknown
- 1970-12-30 CH CH1934070A patent/CH545802A/xx not_active IP Right Cessation
- 1970-12-30 AT AT1174670A patent/AT299967B/de not_active IP Right Cessation
- 1970-12-30 FR FR707047396A patent/FR2073511B1/fr not_active Expired
Cited By (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2301531A1 (de) * | 1972-08-04 | 1974-02-21 | Nippon Kayaku Kk | 4,4'-diaminostilben-2,2'-disulfonsaeurederivate und ihre verwendung |
| US4212763A (en) * | 1977-07-04 | 1980-07-15 | Ciba-Geigy Corporation | Bis-triazinylaminostilbene compounds and their use as fluorescent brightening agents |
| EP0704444A1 (de) * | 1994-09-14 | 1996-04-03 | Ciba-Geigy Ag | UV-Absorber, ihre Herstellung und Verwendung |
| EP0728749A3 (en) * | 1995-02-22 | 1997-02-26 | Ciba Geigy Ag | Triazine derivatives, their preparation and their application |
Also Published As
| Publication number | Publication date |
|---|---|
| JPS4817369B1 (enExample) | 1973-05-29 |
| CA921469A (en) | 1973-02-20 |
| FR2073511A1 (enExample) | 1971-10-01 |
| NL7018964A (enExample) | 1971-07-02 |
| FR2073511B1 (enExample) | 1973-02-02 |
| AT299967B (de) | 1972-07-10 |
| GB1296080A (enExample) | 1972-11-15 |
| CH545802A (enExample) | 1974-02-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1795047C3 (de) | Bis-s- triazinylamino-stilben-2,2'disulfonsäuren | |
| DE2503611C2 (de) | Sulfogruppen enthaltende Reaktivfarbstoffe | |
| DE69807397T3 (de) | Triazinylaminostilben Verbindungen | |
| DE1206296B (de) | Konzentriertes fluessiges Aufhellungsmittel fuer Papiere | |
| EP0304751A1 (de) | Wasserlösliche Phthalocyanin-Verbindungen, Verfahren zu ihrer Herstellung und ihre Verwendung als Farbstoffe | |
| DE1965585A1 (de) | Stilbenverbindungen | |
| DE859313C (de) | Verfahren zur Herstellung von Bis-[2-morpholino-4-amino-1, 3, 5-triazyl-(6)]-4, 4''-diaminostilbendisulfon- und -dicarbonsaeuren | |
| DE1955849B2 (de) | Wasserlösliche, reaktive Xanthenfarbstoffe, Verfahren zu ihrer Herstellung und deren Verwendung zum Färben oder Bedrucken | |
| DE2403455A1 (de) | Bis-s-triazinylamino-stilben-2,2'-disulfonsaeuren, deren herstellung und deren verwendung als optische aufhellmittel | |
| DE1696203A1 (de) | Verwendung von Bis-s-triazinylamino-stilben-2,2'-disulfonsaeuren zum optischen Aufhellen von Papier | |
| DE1545920A1 (de) | Verfahren zur Herstellung optischer Aufheller der Stilbenreihe | |
| DE2233429A1 (de) | Bis-s-triazinylamino-stilben-2,2'disulfonsaeuren, deren herstellung und deren verwendung als optische aufhellmittel | |
| EP0685480A1 (de) | Wasserlösliche Triphendioxazinverbindungen, Verfahren zu deren Herstellung und ihre Verwendung als Farbstoffe | |
| DE2524801A1 (de) | Optische aufhellungsmittel und verfahren zu ihrer herstellung | |
| DE2601749A1 (de) | 4,4'-bis- eckige klammer auf 2",4"- bis-(diisopropanolamino)-s-triazin-6"-yl- amino eckige klammer zu -stilben-2,2'- disulfonsaeure, deren herstellung und deren verwendung als optische aufhellmittel | |
| DE1469218B1 (de) | 4,4'-Bis-triazinylamino-stilbenverbindungen und ihre Verwendung als reaktive optischeAufhellungsmittel | |
| DE2406851A1 (de) | Bis-(triazinylamino)-stilbenverbindungen | |
| EP0601416B1 (de) | Wasserlösliche Anthrachinonverbindungen, Verfahren zu ihrer Herstellung und ihre Verwendung als Farbstoffe | |
| DE2854481A1 (de) | Anthrachinon-reaktivfarbstoffe | |
| DE1469218C (de) | 4,4 Bis triazinylamino stilbenver bmdungen und ihre Verwendung als reaktive optische Aufhetlungsmittel | |
| DE1444015A1 (de) | Bis-triazinylaminostilben-disulfonsaeure-Verbindungen | |
| AT265294B (de) | Verfahren zur Herstellung neuer Verbindungen der Stilbenreihe | |
| EP0602550B1 (de) | Wasserlösliche Anthrachinonverbindungen, Verfahren zu ihrer Herstellung und ihre Verwendung als Farbstoffe | |
| DE2422466A1 (de) | Neue reaktivfarbstoffe | |
| DE1644353C (de) | Verfahren zur Herstellung wasserlos hcher, kupferhaltiger Reaktivfarbstoffe |