DE1955318A1 - Neue Pyrimidin-Derivate und Verfahren zu deren Herstellung - Google Patents
Neue Pyrimidin-Derivate und Verfahren zu deren HerstellungInfo
- Publication number
- DE1955318A1 DE1955318A1 DE19691955318 DE1955318A DE1955318A1 DE 1955318 A1 DE1955318 A1 DE 1955318A1 DE 19691955318 DE19691955318 DE 19691955318 DE 1955318 A DE1955318 A DE 1955318A DE 1955318 A1 DE1955318 A1 DE 1955318A1
- Authority
- DE
- Germany
- Prior art keywords
- bis
- morpholino
- pyrimidine
- compounds
- carbo
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 55
- 238000002360 preparation method Methods 0.000 title claims description 19
- 229940083082 pyrimidine derivative acting on arteriolar smooth muscle Drugs 0.000 title description 3
- 150000003230 pyrimidines Chemical class 0.000 title description 3
- 150000001875 compounds Chemical class 0.000 claims description 103
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 claims description 36
- 239000002253 acid Substances 0.000 claims description 36
- 150000003839 salts Chemical class 0.000 claims description 28
- -1 2-methyl-butoxy Chemical group 0.000 claims description 25
- 125000004432 carbon atom Chemical group C* 0.000 claims description 17
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 17
- 229910001868 water Inorganic materials 0.000 claims description 17
- CZPWVGJYEJSRLH-UHFFFAOYSA-N Pyrimidine Chemical compound C1=CN=CN=C1 CZPWVGJYEJSRLH-UHFFFAOYSA-N 0.000 claims description 15
- 125000005843 halogen group Chemical group 0.000 claims description 15
- BRNULMACUQOKMR-UHFFFAOYSA-N thiomorpholine Chemical compound C1CSCCN1 BRNULMACUQOKMR-UHFFFAOYSA-N 0.000 claims description 15
- 125000000217 alkyl group Chemical group 0.000 claims description 14
- 229910052736 halogen Inorganic materials 0.000 claims description 11
- 150000002367 halogens Chemical class 0.000 claims description 11
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 10
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 10
- 229910052794 bromium Inorganic materials 0.000 claims description 10
- 229910052801 chlorine Inorganic materials 0.000 claims description 10
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 9
- 125000003342 alkenyl group Chemical group 0.000 claims description 9
- 239000000460 chlorine Substances 0.000 claims description 9
- 125000001153 fluoro group Chemical group F* 0.000 claims description 9
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 9
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 9
- KNATWQKKAILTOM-UHFFFAOYSA-N 2-butoxypyrimidine Chemical compound CCCCOC1=NC=CC=N1 KNATWQKKAILTOM-UHFFFAOYSA-N 0.000 claims description 8
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 7
- 125000001316 cycloalkyl alkyl group Chemical group 0.000 claims description 7
- 229910052739 hydrogen Inorganic materials 0.000 claims description 7
- 239000001257 hydrogen Substances 0.000 claims description 7
- 229910052751 metal Inorganic materials 0.000 claims description 7
- 239000002184 metal Substances 0.000 claims description 7
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 claims description 6
- XOQOZXFMXJSQPL-UHFFFAOYSA-N 2-pentoxypyrimidine Chemical compound CCCCCOC1=NC=CC=N1 XOQOZXFMXJSQPL-UHFFFAOYSA-N 0.000 claims description 5
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 5
- 150000001298 alcohols Chemical class 0.000 claims description 5
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 5
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 5
- 239000012433 hydrogen halide Substances 0.000 claims description 5
- 229910000039 hydrogen halide Inorganic materials 0.000 claims description 5
- 229910052760 oxygen Inorganic materials 0.000 claims description 5
- 239000001301 oxygen Substances 0.000 claims description 5
- 125000001424 substituent group Chemical group 0.000 claims description 5
- 229910052717 sulfur Inorganic materials 0.000 claims description 5
- 239000011593 sulfur Substances 0.000 claims description 5
- 239000000825 pharmaceutical preparation Substances 0.000 claims description 4
- NUGMIVWUTBSCLJ-UHFFFAOYSA-N 2-ethoxyethyl 2,4-dimorpholin-4-ylpyrimidine-5-carboxylate Chemical compound O1CCN(CC1)C1=NC=C(C(=N1)N1CCOCC1)C(=O)OCCOCC NUGMIVWUTBSCLJ-UHFFFAOYSA-N 0.000 claims description 3
- 125000004183 alkoxy alkyl group Chemical group 0.000 claims description 3
- 125000000392 cycloalkenyl group Chemical group 0.000 claims description 3
- VPPFPQHRZIKWTO-UHFFFAOYSA-N methyl 2,4-dimorpholin-4-ylpyrimidine-5-carboxylate Chemical compound O1CCN(CC1)C1=NC=C(C(=N1)N1CCOCC1)C(=O)OC VPPFPQHRZIKWTO-UHFFFAOYSA-N 0.000 claims description 3
- QLUGGIVKRIETAJ-UHFFFAOYSA-N propan-2-yl 2,4-dimorpholin-4-ylpyrimidine-5-carboxylate Chemical compound O1CCN(CC1)C1=NC=C(C(=N1)N1CCOCC1)C(=O)OC(C)C QLUGGIVKRIETAJ-UHFFFAOYSA-N 0.000 claims description 3
- 239000004480 active ingredient Substances 0.000 claims description 2
- MBJJUFPGBZVMRH-UHFFFAOYSA-N octyl 2,4-dimorpholin-4-ylpyrimidine-5-carboxylate Chemical compound O1CCN(CC1)C1=NC=C(C(=N1)N1CCOCC1)C(=O)OCCCCCCCC MBJJUFPGBZVMRH-UHFFFAOYSA-N 0.000 claims description 2
- 125000000547 substituted alkyl group Chemical group 0.000 claims 2
- OTQPXGIILIEFGE-UHFFFAOYSA-N 2-(2-methoxyethoxy)pyrimidine Chemical compound COCCOC1=NC=CC=N1 OTQPXGIILIEFGE-UHFFFAOYSA-N 0.000 claims 1
- 125000003118 aryl group Chemical group 0.000 claims 1
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 38
- 238000002844 melting Methods 0.000 description 33
- 230000008018 melting Effects 0.000 description 33
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 32
- 238000006243 chemical reaction Methods 0.000 description 28
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 27
- 239000011541 reaction mixture Substances 0.000 description 27
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 24
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 24
- 238000009835 boiling Methods 0.000 description 17
- 239000000243 solution Substances 0.000 description 17
- 239000000203 mixture Substances 0.000 description 14
- OXNIZHLAWKMVMX-UHFFFAOYSA-N picric acid Chemical compound OC1=C([N+]([O-])=O)C=C([N+]([O-])=O)C=C1[N+]([O-])=O OXNIZHLAWKMVMX-UHFFFAOYSA-N 0.000 description 14
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 14
- 239000007858 starting material Substances 0.000 description 13
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 12
- 229910052938 sodium sulfate Inorganic materials 0.000 description 12
- 235000011152 sodium sulphate Nutrition 0.000 description 12
- 238000001704 evaporation Methods 0.000 description 11
- 230000008020 evaporation Effects 0.000 description 11
- 239000003960 organic solvent Substances 0.000 description 11
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 9
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 9
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- 239000000047 product Substances 0.000 description 9
- ZXEKIIBDNHEJCQ-UHFFFAOYSA-N isobutanol Chemical compound CC(C)CO ZXEKIIBDNHEJCQ-UHFFFAOYSA-N 0.000 description 8
- 241000699666 Mus <mouse, genus> Species 0.000 description 7
- 238000001816 cooling Methods 0.000 description 7
- 229940075930 picrate Drugs 0.000 description 7
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 6
- 239000013078 crystal Substances 0.000 description 6
- 239000007788 liquid Substances 0.000 description 6
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 6
- OXNIZHLAWKMVMX-UHFFFAOYSA-M picrate anion Chemical compound [O-]C1=C([N+]([O-])=O)C=C([N+]([O-])=O)C=C1[N+]([O-])=O OXNIZHLAWKMVMX-UHFFFAOYSA-M 0.000 description 6
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 5
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 5
- 239000002585 base Substances 0.000 description 5
- 239000011230 binding agent Substances 0.000 description 5
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 5
- 239000002904 solvent Substances 0.000 description 5
- 239000003826 tablet Substances 0.000 description 5
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 4
- 125000005907 alkyl ester group Chemical group 0.000 description 4
- 239000000706 filtrate Substances 0.000 description 4
- 150000004820 halides Chemical class 0.000 description 4
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 4
- 230000007935 neutral effect Effects 0.000 description 4
- 238000010992 reflux Methods 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- 230000001988 toxicity Effects 0.000 description 4
- 231100000419 toxicity Toxicity 0.000 description 4
- WCCBUIFEOVVMKO-UHFFFAOYSA-N 2,4-dimorpholin-4-ylpyrimidine-5-carboxylic acid hydrochloride Chemical compound Cl.O1CCN(CC1)C1=NC=C(C(=N1)N1CCOCC1)C(=O)O WCCBUIFEOVVMKO-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- QGMRQYFBGABWDR-UHFFFAOYSA-M Pentobarbital sodium Chemical compound [Na+].CCCC(C)C1(CC)C(=O)NC(=O)[N-]C1=O QGMRQYFBGABWDR-UHFFFAOYSA-M 0.000 description 3
- 125000004414 alkyl thio group Chemical group 0.000 description 3
- 125000004659 aryl alkyl thio group Chemical group 0.000 description 3
- 239000003054 catalyst Substances 0.000 description 3
- 150000001805 chlorine compounds Chemical class 0.000 description 3
- 230000008030 elimination Effects 0.000 description 3
- 238000003379 elimination reaction Methods 0.000 description 3
- KUSUZZBVEACCKQ-UHFFFAOYSA-N ethyl 2,4-dimorpholin-4-ylpyrimidine-5-carboxylate Chemical compound O1CCN(CC1)C1=NC=C(C(=N1)N1CCOCC1)C(=O)OCC KUSUZZBVEACCKQ-UHFFFAOYSA-N 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 239000000155 melt Substances 0.000 description 3
- 150000007522 mineralic acids Chemical class 0.000 description 3
- 230000003533 narcotic effect Effects 0.000 description 3
- 229960002275 pentobarbital sodium Drugs 0.000 description 3
- 239000012071 phase Substances 0.000 description 3
- IVIHUCXXDVVSBH-UHFFFAOYSA-N 2,4-dichloropyrimidine-5-carboxylic acid Chemical compound OC(=O)C1=CN=C(Cl)N=C1Cl IVIHUCXXDVVSBH-UHFFFAOYSA-N 0.000 description 2
- 229920002261 Corn starch Polymers 0.000 description 2
- LCGLNKUTAGEVQW-UHFFFAOYSA-N Dimethyl ether Chemical compound COC LCGLNKUTAGEVQW-UHFFFAOYSA-N 0.000 description 2
- 108010010803 Gelatin Proteins 0.000 description 2
- 241000699670 Mus sp. Species 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- YNYMBPDPZODBSW-UHFFFAOYSA-N butyl 2,4-dichloropyrimidine-5-carboxylate Chemical compound CCCCOC(=O)C1=CN=C(Cl)N=C1Cl YNYMBPDPZODBSW-UHFFFAOYSA-N 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 239000008120 corn starch Substances 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 239000008273 gelatin Substances 0.000 description 2
- 229920000159 gelatin Polymers 0.000 description 2
- 235000019322 gelatine Nutrition 0.000 description 2
- 235000011852 gelatine desserts Nutrition 0.000 description 2
- 230000002140 halogenating effect Effects 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- SPQVSOJOSYKIQT-UHFFFAOYSA-N hexyl 2,4-dimorpholin-4-ylpyrimidine-5-carboxylate Chemical compound O1CCN(CC1)C1=NC=C(C(=N1)N1CCOCC1)C(=O)OCCCCCC SPQVSOJOSYKIQT-UHFFFAOYSA-N 0.000 description 2
- 150000004678 hydrides Chemical class 0.000 description 2
- 230000000147 hypnotic effect Effects 0.000 description 2
- 235000019359 magnesium stearate Nutrition 0.000 description 2
- 150000007524 organic acids Chemical class 0.000 description 2
- 239000003208 petroleum Substances 0.000 description 2
- 230000003285 pharmacodynamic effect Effects 0.000 description 2
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 239000000454 talc Substances 0.000 description 2
- 229910052623 talc Inorganic materials 0.000 description 2
- DNIAPMSPPWPWGF-GSVOUGTGSA-N (R)-(-)-Propylene glycol Chemical compound C[C@@H](O)CO DNIAPMSPPWPWGF-GSVOUGTGSA-N 0.000 description 1
- IXPNQXFRVYWDDI-UHFFFAOYSA-N 1-methyl-2,4-dioxo-1,3-diazinane-5-carboximidamide Chemical compound CN1CC(C(N)=N)C(=O)NC1=O IXPNQXFRVYWDDI-UHFFFAOYSA-N 0.000 description 1
- VYISYNLHTNHZGZ-UHFFFAOYSA-N 2,4-dichloropyrimidine-5-carboxylic acid;hydrochloride Chemical class Cl.OC(=O)C1=CN=C(Cl)N=C1Cl VYISYNLHTNHZGZ-UHFFFAOYSA-N 0.000 description 1
- RVCLISIPGZGQPU-UHFFFAOYSA-N 2,6-dichloro-3-chlorosulfonylbenzoic acid Chemical compound OC(=O)C1=C(Cl)C=CC(S(Cl)(=O)=O)=C1Cl RVCLISIPGZGQPU-UHFFFAOYSA-N 0.000 description 1
- LBLYYCQCTBFVLH-UHFFFAOYSA-N 2-Methylbenzenesulfonic acid Chemical compound CC1=CC=CC=C1S(O)(=O)=O LBLYYCQCTBFVLH-UHFFFAOYSA-N 0.000 description 1
- ZNQVEEAIQZEUHB-UHFFFAOYSA-N 2-ethoxyethanol Chemical compound CCOCCO ZNQVEEAIQZEUHB-UHFFFAOYSA-N 0.000 description 1
- 229940093475 2-ethoxyethanol Drugs 0.000 description 1
- BTVWZWFKMIUSGS-UHFFFAOYSA-N 2-methylpropane-1,2-diol Chemical compound CC(C)(O)CO BTVWZWFKMIUSGS-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- RXXCIBALSKQCAE-UHFFFAOYSA-N 3-methylbutoxymethylbenzene Chemical compound CC(C)CCOCC1=CC=CC=C1 RXXCIBALSKQCAE-UHFFFAOYSA-N 0.000 description 1
- SIRMQTLAUNSEBA-UHFFFAOYSA-N C1([N+](=O)[O-])=CC([N+](=O)[O-])=CC([N+](=O)[O-])=C1O.O1CCN(CC1)C1=NC=C(C(=N1)N1CCOCC1)C(=O)OCCCCC Chemical compound C1([N+](=O)[O-])=CC([N+](=O)[O-])=CC([N+](=O)[O-])=C1O.O1CCN(CC1)C1=NC=C(C(=N1)N1CCOCC1)C(=O)OCCCCC SIRMQTLAUNSEBA-UHFFFAOYSA-N 0.000 description 1
- 241000282472 Canis lupus familiaris Species 0.000 description 1
- 206010020400 Hostility Diseases 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 239000005662 Paraffin oil Substances 0.000 description 1
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 1
- 241000700159 Rattus Species 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 230000002152 alkylating effect Effects 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 150000007514 bases Chemical class 0.000 description 1
- QVZZPLDJERFENQ-NKTUOASPSA-N bassianolide Chemical compound CC(C)C[C@@H]1N(C)C(=O)[C@@H](C(C)C)OC(=O)[C@H](CC(C)C)N(C)C(=O)[C@@H](C(C)C)OC(=O)[C@H](CC(C)C)N(C)C(=O)[C@@H](C(C)C)OC(=O)[C@H](CC(C)C)N(C)C(=O)[C@@H](C(C)C)OC1=O QVZZPLDJERFENQ-NKTUOASPSA-N 0.000 description 1
- RKNVIVMYOWOICI-UHFFFAOYSA-N butyl 2,4-dimorpholin-4-ylpyrimidine-5-carboxylate Chemical compound O1CCN(CC1)C1=NC=C(C(=N1)N1CCOCC1)C(=O)OCCCC RKNVIVMYOWOICI-UHFFFAOYSA-N 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 239000008119 colloidal silica Substances 0.000 description 1
- 239000007891 compressed tablet Substances 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- 239000012024 dehydrating agents Substances 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 125000004185 ester group Chemical group 0.000 description 1
- 230000032050 esterification Effects 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- SRJBDGLSCPDXBL-UHFFFAOYSA-N ethyl 2,4-dichloropyrimidine-5-carboxylate Chemical compound CCOC(=O)C1=CN=C(Cl)N=C1Cl SRJBDGLSCPDXBL-UHFFFAOYSA-N 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 239000000499 gel Substances 0.000 description 1
- 239000003193 general anesthetic agent Substances 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- RUFRLQYBIXLXGQ-UHFFFAOYSA-N heptyl 2,4-dichloropyrimidine-5-carboxylate Chemical compound ClC1=NC=C(C(=N1)Cl)C(=O)OCCCCCCC RUFRLQYBIXLXGQ-UHFFFAOYSA-N 0.000 description 1
- AGIHUJDGZDQVRC-UHFFFAOYSA-N hexyl 2,4-dichloropyrimidine-5-carboxylate Chemical compound ClC1=NC=C(C(=N1)Cl)C(=O)OCCCCCC AGIHUJDGZDQVRC-UHFFFAOYSA-N 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 238000001990 intravenous administration Methods 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 229940041476 lactose 100 mg Drugs 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- UKVIEHSSVKSQBA-UHFFFAOYSA-N methane;palladium Chemical compound C.[Pd] UKVIEHSSVKSQBA-UHFFFAOYSA-N 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- FNNAWVXVOHNOFF-UHFFFAOYSA-N methyl 2,4-dichloropyrimidine-5-carboxylate Chemical compound COC(=O)C1=CN=C(Cl)N=C1Cl FNNAWVXVOHNOFF-UHFFFAOYSA-N 0.000 description 1
- 125000002816 methylsulfanyl group Chemical group [H]C([H])([H])S[*] 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 229910000510 noble metal Inorganic materials 0.000 description 1
- FUXPQKHDVZFYJL-UHFFFAOYSA-N nonyl 2,4-dichloropyrimidine-5-carboxylate Chemical compound ClC1=NC=C(C(=N1)Cl)C(=O)OCCCCCCCCC FUXPQKHDVZFYJL-UHFFFAOYSA-N 0.000 description 1
- WUWOEKBMOWTBKW-UHFFFAOYSA-N nonyl 2,4-dimorpholin-4-ylpyrimidine-5-carboxylate Chemical compound O1CCN(CC1)C1=NC=C(C(=N1)N1CCOCC1)C(=O)OCCCCCCCCC WUWOEKBMOWTBKW-UHFFFAOYSA-N 0.000 description 1
- AFVOEVHCZFKTBP-UHFFFAOYSA-N octyl 2,4-dichloropyrimidine-5-carboxylate Chemical compound CCCCCCCCOC(=O)C1=CN=C(Cl)N=C1Cl AFVOEVHCZFKTBP-UHFFFAOYSA-N 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- MUMZUERVLWJKNR-UHFFFAOYSA-N oxoplatinum Chemical compound [Pt]=O MUMZUERVLWJKNR-UHFFFAOYSA-N 0.000 description 1
- LMRSDQYDTOZQLH-UHFFFAOYSA-N pentyl 2,4-dichloropyrimidine-5-carboxylate Chemical compound ClC1=NC=C(C(=N1)Cl)C(=O)OCCCCC LMRSDQYDTOZQLH-UHFFFAOYSA-N 0.000 description 1
- WEKVFJIVPSULLD-UHFFFAOYSA-N pentyl 2,4-dimorpholin-4-ylpyrimidine-5-carboxylate Chemical compound O1CCN(CC1)C1=NC=C(C(=N1)N1CCOCC1)C(=O)OCCCCC WEKVFJIVPSULLD-UHFFFAOYSA-N 0.000 description 1
- CYQAYERJWZKYML-UHFFFAOYSA-N phosphorus pentasulfide Chemical compound S1P(S2)(=S)SP3(=S)SP1(=S)SP2(=S)S3 CYQAYERJWZKYML-UHFFFAOYSA-N 0.000 description 1
- 229910003446 platinum oxide Inorganic materials 0.000 description 1
- 235000015497 potassium bicarbonate Nutrition 0.000 description 1
- 239000011736 potassium bicarbonate Substances 0.000 description 1
- 229910000028 potassium bicarbonate Inorganic materials 0.000 description 1
- 230000002035 prolonged effect Effects 0.000 description 1
- YRJUHXRUVTWBKE-UHFFFAOYSA-N propan-2-yl 2,4-dichloropyrimidine-5-carboxylate Chemical compound CC(C)OC(=O)C1=CN=C(Cl)N=C1Cl YRJUHXRUVTWBKE-UHFFFAOYSA-N 0.000 description 1
- FRHIIYDEWCAKTA-UHFFFAOYSA-N propyl 2,4-dichloropyrimidine-5-carboxylate Chemical compound ClC1=NC=C(C(=N1)Cl)C(=O)OCCC FRHIIYDEWCAKTA-UHFFFAOYSA-N 0.000 description 1
- RPNGOPZNDCTGJQ-UHFFFAOYSA-N propyl 2,4-dimorpholin-4-ylpyrimidine-5-carboxylate Chemical compound O1CCN(CC1)C1=NC=C(C(=N1)N1CCOCC1)C(=O)OCCC RPNGOPZNDCTGJQ-UHFFFAOYSA-N 0.000 description 1
- OSGJLPNIGHAHNR-UHFFFAOYSA-N pyrimidine 2,4,6-trinitrophenol Chemical compound C1([N+](=O)[O-])=CC([N+](=O)[O-])=CC([N+](=O)[O-])=C1O.N1=CN=CC=C1 OSGJLPNIGHAHNR-UHFFFAOYSA-N 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 235000010413 sodium alginate Nutrition 0.000 description 1
- 239000000661 sodium alginate Substances 0.000 description 1
- 229940005550 sodium alginate Drugs 0.000 description 1
- ODZPKZBBUMBTMG-UHFFFAOYSA-N sodium amide Chemical compound [NH2-].[Na+] ODZPKZBBUMBTMG-UHFFFAOYSA-N 0.000 description 1
- 239000011973 solid acid Substances 0.000 description 1
- 125000000475 sulfinyl group Chemical group [*:2]S([*:1])=O 0.000 description 1
- 239000007916 tablet composition Substances 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- 125000005490 tosylate group Chemical group 0.000 description 1
- 229910052720 vanadium Inorganic materials 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/02—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings
- C07D239/24—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members
- C07D239/28—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to ring carbon atoms
- C07D239/30—Halogen atoms or nitro radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/02—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings
- C07D239/24—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members
- C07D239/28—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to ring carbon atoms
- C07D239/46—Two or more oxygen, sulphur or nitrogen atoms
- C07D239/48—Two nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/02—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings
- C07D239/24—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members
- C07D239/28—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to ring carbon atoms
- C07D239/46—Two or more oxygen, sulphur or nitrogen atoms
- C07D239/52—Two oxygen atoms
- C07D239/54—Two oxygen atoms as doubly bound oxygen atoms or as unsubstituted hydroxy radicals
- C07D239/545—Two oxygen atoms as doubly bound oxygen atoms or as unsubstituted hydroxy radicals with other hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to ring carbon atoms
- C07D239/557—Two oxygen atoms as doubly bound oxygen atoms or as unsubstituted hydroxy radicals with other hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to ring carbon atoms with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to ring carbon atoms, e.g. orotic acid
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D413/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms
- C07D413/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing two hetero rings
- C07D413/04—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D413/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms
- C07D413/14—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing three or more hetero rings
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
- Electrolytic Production Of Metals (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH1667968A CH506550A (de) | 1968-11-08 | 1968-11-08 | Verfahren zur Herstellung von Pyrimidin-Derivaten |
| CH303969A CH514618A (de) | 1969-02-28 | 1969-02-28 | Verfahren zur Herstellung von Pyrimidin-Derivaten |
| CH1185769A CH518303A (de) | 1969-08-05 | 1969-08-05 | Verfahren zur Herstellung von Pyrimidin-Derivate |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1955318A1 true DE1955318A1 (de) | 1970-06-04 |
Family
ID=27174089
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19691955318 Pending DE1955318A1 (de) | 1968-11-08 | 1969-11-04 | Neue Pyrimidin-Derivate und Verfahren zu deren Herstellung |
Country Status (14)
| Country | Link |
|---|---|
| US (1) | US3635962A (https=) |
| AT (1) | AT307433B (https=) |
| BE (1) | BE741376A (https=) |
| DE (1) | DE1955318A1 (https=) |
| DK (1) | DK121440B (https=) |
| ES (1) | ES373237A1 (https=) |
| FR (1) | FR2024819B1 (https=) |
| GB (1) | GB1270120A (https=) |
| IE (1) | IE33364B1 (https=) |
| IL (1) | IL33321A (https=) |
| NL (1) | NL6916269A (https=) |
| NO (1) | NO124209B (https=) |
| OA (1) | OA03165A (https=) |
| RO (5) | RO57209A (https=) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO2005075458A1 (en) * | 2004-02-10 | 2005-08-18 | Sanofi-Aventis | Pyrimidine derivatives as orexin receptors antagonists |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| AT340933B (de) * | 1973-08-20 | 1978-01-10 | Thomae Gmbh Dr K | Verfahren zur herstellung neuer pyrimidinderivate und ihrer saureadditionssalze |
-
1969
- 1969-10-16 GB GB50806/69A patent/GB1270120A/en not_active Expired
- 1969-10-29 NL NL6916269A patent/NL6916269A/xx unknown
- 1969-11-03 US US873646A patent/US3635962A/en not_active Expired - Lifetime
- 1969-11-04 DE DE19691955318 patent/DE1955318A1/de active Pending
- 1969-11-06 RO RO66814A patent/RO57209A/ro unknown
- 1969-11-06 IL IL33321A patent/IL33321A/xx unknown
- 1969-11-06 ES ES373237A patent/ES373237A1/es not_active Expired
- 1969-11-06 RO RO66813A patent/RO57208A/ro unknown
- 1969-11-06 FR FR6938186A patent/FR2024819B1/fr not_active Expired
- 1969-11-06 BE BE741376D patent/BE741376A/xx unknown
- 1969-11-06 RO RO61486A patent/RO55872A/ro unknown
- 1969-11-06 RO RO66816A patent/RO57597A/ro unknown
- 1969-11-06 OA OA53776A patent/OA03165A/xx unknown
- 1969-11-06 AT AT1044569A patent/AT307433B/de not_active IP Right Cessation
- 1969-11-06 RO RO66815A patent/RO57210A/ro unknown
- 1969-11-06 IE IE1515/69A patent/IE33364B1/xx unknown
- 1969-11-07 DK DK591669AA patent/DK121440B/da unknown
- 1969-11-07 NO NO4422/69A patent/NO124209B/no unknown
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO2005075458A1 (en) * | 2004-02-10 | 2005-08-18 | Sanofi-Aventis | Pyrimidine derivatives as orexin receptors antagonists |
| JP2007522197A (ja) * | 2004-02-10 | 2007-08-09 | サノフイ−アベンテイス | オレキシン受容体アンタゴニストとしてのピリミジン誘導体 |
| US7812031B2 (en) | 2004-02-10 | 2010-10-12 | Sanofi-Aventis | Pyrimidine derivatives as orexin receptor antagonists |
Also Published As
| Publication number | Publication date |
|---|---|
| NO124209B (https=) | 1972-03-20 |
| US3635962A (en) | 1972-01-18 |
| NL6916269A (https=) | 1970-05-12 |
| RO57210A (https=) | 1975-01-15 |
| RO55872A (https=) | 1974-02-01 |
| IL33321A (en) | 1972-02-29 |
| FR2024819A1 (https=) | 1970-09-04 |
| RO57597A (https=) | 1974-12-15 |
| FR2024819B1 (https=) | 1974-08-30 |
| DK121440B (da) | 1971-10-18 |
| RO57209A (https=) | 1974-11-11 |
| IE33364B1 (en) | 1974-05-29 |
| ES373237A1 (es) | 1971-12-16 |
| AT307433B (de) | 1973-05-25 |
| IE33364L (en) | 1970-05-08 |
| RO57208A (https=) | 1974-12-15 |
| OA03165A (fr) | 1970-12-15 |
| BE741376A (https=) | 1970-05-06 |
| IL33321A0 (en) | 1970-01-29 |
| GB1270120A (en) | 1972-04-12 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| WO1980000152A1 (fr) | Derives d'un 3-aminopropoxy-aryle, leur preparation et utilisation | |
| EP0287690A1 (de) | Stabile Lösungsmitteladdukte von Z-1-(p-beta-Dimethylamino-ethoxyphenyl)-1-(p-hydroxyphenyl)-2-phenylbut-1-en | |
| DE2006978B2 (de) | N- [H3-Trifluormethyl-phenyl)-propyl-(2)] -glycinderivate, Verfahren zu ihrer Herstellung und diese enthaltende Arzneimittel | |
| DE2523103A1 (de) | Neue propargyl-2-phenylamino-imidazoline-(2), deren saeureadditionssalze, diese enthaltende arzneimittel und verfahren zur herstellung derselben | |
| DE1445878A1 (de) | Verfahren zur Herstellung von Benzodiazepin-Derivaten | |
| CH637646A5 (de) | Analgetisch wirksame triazindione, herstellungsverfahren und pharmazeutische zusammensetzungen. | |
| CH643830A5 (de) | Bis-moranolin-derivate. | |
| DE3877124T2 (de) | Imidazol-derivate, verfahren zu deren herstellung und deren anwendung als alpha-2-adrenoceptor-antagonisten. | |
| DE68912252T2 (de) | Imidazolantiarrythmische Mittel. | |
| DE1955318A1 (de) | Neue Pyrimidin-Derivate und Verfahren zu deren Herstellung | |
| DE2427272C3 (de) | 1-(2-(β-Naphthyloxy)-äthyl)-3-methyl -pyrazolon-(5), Verfahren sowie Verwendung als Antithrombotikum | |
| DE2404946C3 (de) | Verfahren zur Herstellung von 7alpha-Acylthio-Steroidspirolactonen | |
| DE1670463A1 (de) | Verfahren zur Herstellung von Tropinaethern | |
| DE1921049A1 (de) | Neue organische Verbindungen und Verfahren zu ihrer Herstellung | |
| DE1493797A1 (de) | Verfahren zur Herstellung von neuen substituierten Malonsaeuremonohydraziden | |
| DE1935404B2 (de) | Verfahren zur Herstellung von Chinazolinonen | |
| DE2403416C2 (de) | 1-Phenylimidazol-Derivate, ihre Salze, Verfahren zu ihrer Herstellung und ihre Verwendung | |
| DE1957639A1 (de) | Neue heterocyclische Verbindungen und Verfahren zu deren Herstellung | |
| DE2043536A1 (de) | Neue 4 Amino 2 methyl pyrimidine | |
| DE1247315B (de) | Verfahren zur Herstellung von am Stickstoff disubstituierten Carbonsaeureamiden | |
| AT307434B (de) | Verfahren zur Herstellung neuer Pyrimidin-Derivate und ihrer Salze | |
| DE2012943A1 (de) | Neue Triazol-Derivate und Verfahren zur Herstellung derselben | |
| DE1927786A1 (de) | Neue organische Verbindungen und Verfahren zu ihrer Herstellung | |
| AT240373B (de) | Verfahren zur Herstellung von Benzodiazepin-Derivaten | |
| DE1695731A1 (de) | Neue organische Verbindungen |