DE1954358U - Spielzeugpuppe mit veraenderlichen gesichtszuegen. - Google Patents
Spielzeugpuppe mit veraenderlichen gesichtszuegen.Info
- Publication number
- DE1954358U DE1954358U DEA26748U DEA0026748U DE1954358U DE 1954358 U DE1954358 U DE 1954358U DE A26748 U DEA26748 U DE A26748U DE A0026748 U DEA0026748 U DE A0026748U DE 1954358 U DE1954358 U DE 1954358U
- Authority
- DE
- Germany
- Prior art keywords
- des
- doll
- ait
- head
- die
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 241001293250 Lagascea decipiens Species 0.000 claims description 4
- 239000000463 material Substances 0.000 claims 2
- 230000000694 effects Effects 0.000 claims 1
- 102200058975 rs28940575 Human genes 0.000 claims 1
- 241000272522 Anas Species 0.000 description 2
- 241001122767 Theaceae Species 0.000 description 2
- POXUQBFHDHCZAD-MHTLYPKNSA-N (2r)-2-[(4s)-2,2-dimethyl-1,3-dioxolan-4-yl]-3,4-dihydroxy-2h-furan-5-one Chemical compound O1C(C)(C)OC[C@H]1[C@@H]1C(O)=C(O)C(=O)O1 POXUQBFHDHCZAD-MHTLYPKNSA-N 0.000 description 1
- 101150023977 Baat gene Proteins 0.000 description 1
- 241001633942 Dais Species 0.000 description 1
- 101150093411 ZNF143 gene Proteins 0.000 description 1
- 230000003068 static effect Effects 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A63—SPORTS; GAMES; AMUSEMENTS
- A63H—TOYS, e.g. TOPS, DOLLS, HOOPS OR BUILDING BLOCKS
- A63H3/00—Dolls
- A63H3/36—Details; Accessories
- A63H3/48—Mounting of parts within dolls, e.g. automatic eyes or parts for animation
-
- A—HUMAN NECESSITIES
- A63—SPORTS; GAMES; AMUSEMENTS
- A63H—TOYS, e.g. TOPS, DOLLS, HOOPS OR BUILDING BLOCKS
- A63H3/00—Dolls
- A63H3/20—Dolls with parts moved due to movements of other parts, e.g. limbs
Landscapes
- Toys (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US59221066A | 1966-11-04 | 1966-11-04 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1954358U true DE1954358U (de) | 1967-01-26 |
Family
ID=24369772
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEA26748U Expired DE1954358U (de) | 1966-11-04 | 1966-11-25 | Spielzeugpuppe mit veraenderlichen gesichtszuegen. |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US3494068A (enExample) |
| BE (1) | BE690818A (enExample) |
| DE (1) | DE1954358U (enExample) |
| FR (1) | FR1521369A (enExample) |
| NL (1) | NL6616950A (enExample) |
Families Citing this family (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3745696A (en) * | 1972-03-01 | 1973-07-17 | Mattel Inc | Doll having means for changing facial expression upon turning of head |
| US3808735A (en) * | 1972-11-06 | 1974-05-07 | Marvin Glass & Associates | Movable figure toy |
| US4126960A (en) * | 1977-01-21 | 1978-11-28 | Mattel, Inc. | Doll with pivotable head and puckering lips |
| US4560362A (en) * | 1985-01-03 | 1985-12-24 | Mattel, Inc. | Animated figure toy having a moveable torso and articulating jaw |
| GB2232899A (en) * | 1989-06-05 | 1991-01-02 | New Lee Lim Metal & Plastic Lt | Toy head |
| EP1148919B1 (en) * | 1999-02-05 | 2006-05-17 | Mattel, Inc. | Doll having eye movement responsive to limb movement |
| US6068536A (en) | 1999-04-29 | 2000-05-30 | Merriment Inc. | Mechanism for animated character |
| US7207859B1 (en) * | 2004-04-30 | 2007-04-24 | Hasbro, Inc. | Realistic animatronic toy |
| US7744442B2 (en) * | 2006-06-09 | 2010-06-29 | Mattel, Inc. | Dolls with alterable facial features |
| US8382551B2 (en) * | 2009-11-30 | 2013-02-26 | Mattel, Inc. | Toy figure with motion features |
| TWI391171B (zh) * | 2009-12-30 | 2013-04-01 | Univ Southern Taiwan | 可產生表情變化的臉部裝置 |
| US9634855B2 (en) | 2010-05-13 | 2017-04-25 | Alexander Poltorak | Electronic personal interactive device that determines topics of interest using a conversational agent |
| US8932100B2 (en) | 2012-04-13 | 2015-01-13 | Mattel, Inc. | Toy figure with coordinated movements |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2700846A (en) * | 1952-12-13 | 1955-02-01 | Coe Herring | Changeable feature doll |
| US2778155A (en) * | 1956-03-09 | 1957-01-22 | Robert K Ostrander | Doll with mechanism for movable lips |
| US3021641A (en) * | 1960-07-25 | 1962-02-20 | Agnes F Banks | Doll |
| US3195369A (en) * | 1962-04-16 | 1965-07-20 | Nelmor Corp | Remote control device |
| US3298130A (en) * | 1963-02-08 | 1967-01-17 | Mattel Inc | Animated speaking figure toy |
| US3234688A (en) * | 1963-03-01 | 1966-02-15 | Marvin Glass & Associates | Drooling doll |
| US3195268A (en) * | 1963-03-01 | 1965-07-20 | Marvin Glass & Associates | Doll with changeable expression |
| US3195269A (en) * | 1963-10-25 | 1965-07-20 | Ideal Toy Corp | Lip moving mechanisms in a doll |
-
1966
- 1966-11-04 US US592210A patent/US3494068A/en not_active Expired - Lifetime
- 1966-11-25 DE DEA26748U patent/DE1954358U/de not_active Expired
- 1966-12-01 NL NL6616950A patent/NL6616950A/xx unknown
- 1966-12-05 FR FR86154A patent/FR1521369A/fr not_active Expired
- 1966-12-07 BE BE690818D patent/BE690818A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| NL6616950A (enExample) | 1968-05-06 |
| US3494068A (en) | 1970-02-10 |
| BE690818A (enExample) | 1967-06-07 |
| FR1521369A (fr) | 1968-04-19 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1954358U (de) | Spielzeugpuppe mit veraenderlichen gesichtszuegen. | |
| EP1557141B1 (de) | Gehörknöchelchenprothese | |
| EP1602527A2 (de) | Fahrzeugsitz mit einer Kopfstütze | |
| DE3410938A1 (de) | Handbetaetigtes schaltgetriebe | |
| DE102007049942A1 (de) | Fahrradschaltsteuervorrichtung | |
| DE2521043B2 (de) | Fahrrad-kettenschaltung | |
| DE3618544A1 (de) | Bistabile anzeigevorrichtung | |
| DE1945538U (de) | Gehspielzeug. | |
| DE2402613C3 (de) | Tastschalter | |
| DE822997C (de) | Elektrischer Schnapp-Schalter | |
| DE1538559A1 (de) | Stromunterbrecher | |
| DE2231265C3 (de) | Fußsteuervorrichtung, insbesondere für zahnärztliche Geräte | |
| DE1632774A1 (de) | Einrichtung zum Befestigen eines Werkzeuges,insbesondere eines landwirtschaftlichen Geraetes an einem Traktor | |
| EP1302706A3 (de) | Schaltgetriebe | |
| DE3607489C2 (enExample) | ||
| DE102005063224B4 (de) | Automatischer Klinkenaufzugmechanismus | |
| DE1223732B (de) | Schwimmspielzeug | |
| DE3133796C2 (de) | Anordnung zum Freischalten und Erden der Anschlüsse einer Hochspannungs-Hochleistungssicherung eines elektrischen Lastschaltfeldes | |
| DE2655776C2 (de) | Stellvorrichtung für eine Doppelkreuzungsweiche von Spiel- und Modellbahnen | |
| DE1636327A1 (de) | Verfahren und Vorrichtung zur Verbindung der Bahnen eines kontinuierlichen Papierbandes | |
| DE10045253B4 (de) | Aktuatorkopf zur Betätigung eines Schaltknüppels | |
| DE7208445U (de) | Großflächiges Betätigungsorgan fur ein elektrisches Installationsgerät mit einer Ein richtung zur Symbolanzeige | |
| DE962099C (de) | Kontaktfeder-Anordnung bei elektromagnetischem Relais | |
| DE925573C (de) | Umschalter fuer Fahrzeuge, insbesondere Fussabblendschalter | |
| DE3622319C2 (enExample) |