DE1911334C3 - - Google Patents
Info
- Publication number
- DE1911334C3 DE1911334C3 DE19691911334 DE1911334A DE1911334C3 DE 1911334 C3 DE1911334 C3 DE 1911334C3 DE 19691911334 DE19691911334 DE 19691911334 DE 1911334 A DE1911334 A DE 1911334A DE 1911334 C3 DE1911334 C3 DE 1911334C3
- Authority
- DE
- Germany
- Prior art keywords
- layer
- photoconductive
- powder
- core
- particles
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000000843 powder Substances 0.000 claims description 73
- 239000000463 material Substances 0.000 claims description 41
- 239000002245 particle Substances 0.000 claims description 35
- 229910052709 silver Inorganic materials 0.000 claims description 14
- 229910052802 copper Inorganic materials 0.000 claims description 11
- 239000004065 semiconductor Substances 0.000 claims description 9
- 238000004519 manufacturing process Methods 0.000 claims description 6
- 229910052717 sulfur Inorganic materials 0.000 claims description 6
- 229910052760 oxygen Inorganic materials 0.000 claims description 4
- 229910052711 selenium Inorganic materials 0.000 claims description 4
- UHYPYGJEEGLRJD-UHFFFAOYSA-N cadmium(2+);selenium(2-) Chemical compound [Se-2].[Cd+2] UHYPYGJEEGLRJD-UHFFFAOYSA-N 0.000 claims description 3
- 239000010410 layer Substances 0.000 description 97
- 230000035945 sensitivity Effects 0.000 description 22
- 239000000243 solution Substances 0.000 description 18
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 17
- 239000000203 mixture Substances 0.000 description 16
- 238000000034 method Methods 0.000 description 15
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 14
- 229910052980 cadmium sulfide Inorganic materials 0.000 description 14
- 239000011162 core material Substances 0.000 description 13
- 239000010949 copper Substances 0.000 description 11
- XLOMVQKBTHCTTD-UHFFFAOYSA-N Zinc monoxide Chemical group [Zn]=O XLOMVQKBTHCTTD-UHFFFAOYSA-N 0.000 description 9
- 230000008569 process Effects 0.000 description 9
- 239000000126 substance Substances 0.000 description 9
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 description 8
- 239000004332 silver Substances 0.000 description 8
- SQGYOTSLMSWVJD-UHFFFAOYSA-N silver(1+) nitrate Chemical compound [Ag+].[O-]N(=O)=O SQGYOTSLMSWVJD-UHFFFAOYSA-N 0.000 description 8
- WUPHOULIZUERAE-UHFFFAOYSA-N 3-(oxolan-2-yl)propanoic acid Chemical compound OC(=O)CCC1CCCO1 WUPHOULIZUERAE-UHFFFAOYSA-N 0.000 description 7
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 7
- 229910052757 nitrogen Inorganic materials 0.000 description 7
- YKYOUMDCQGMQQO-UHFFFAOYSA-L cadmium dichloride Chemical compound Cl[Cd]Cl YKYOUMDCQGMQQO-UHFFFAOYSA-L 0.000 description 6
- 229910052793 cadmium Inorganic materials 0.000 description 5
- BDOSMKKIYDKNTQ-UHFFFAOYSA-N cadmium atom Chemical compound [Cd] BDOSMKKIYDKNTQ-UHFFFAOYSA-N 0.000 description 5
- 239000002800 charge carrier Substances 0.000 description 5
- 239000002244 precipitate Substances 0.000 description 5
- 229920005989 resin Polymers 0.000 description 5
- 239000011347 resin Substances 0.000 description 5
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 4
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 4
- 239000007864 aqueous solution Substances 0.000 description 4
- 229910052751 metal Inorganic materials 0.000 description 4
- 239000002184 metal Substances 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- 239000010453 quartz Substances 0.000 description 4
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N silicon dioxide Inorganic materials O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 4
- 229910001961 silver nitrate Inorganic materials 0.000 description 4
- 238000006467 substitution reaction Methods 0.000 description 4
- 239000011787 zinc oxide Substances 0.000 description 4
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 230000004888 barrier function Effects 0.000 description 3
- 238000006243 chemical reaction Methods 0.000 description 3
- 239000011248 coating agent Substances 0.000 description 3
- 238000000576 coating method Methods 0.000 description 3
- 239000003822 epoxy resin Substances 0.000 description 3
- 239000010419 fine particle Substances 0.000 description 3
- 230000004907 flux Effects 0.000 description 3
- 239000003574 free electron Substances 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 229920000647 polyepoxide Polymers 0.000 description 3
- 238000006722 reduction reaction Methods 0.000 description 3
- 239000011669 selenium Substances 0.000 description 3
- 238000005245 sintering Methods 0.000 description 3
- 230000003595 spectral effect Effects 0.000 description 3
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 2
- BUGBHKTXTAQXES-UHFFFAOYSA-N Selenium Chemical compound [Se] BUGBHKTXTAQXES-UHFFFAOYSA-N 0.000 description 2
- 235000019270 ammonium chloride Nutrition 0.000 description 2
- 239000012298 atmosphere Substances 0.000 description 2
- 239000011230 binding agent Substances 0.000 description 2
- KXZJHVJKXJLBKO-UHFFFAOYSA-N chembl1408157 Chemical compound N=1C2=CC=CC=C2C(C(=O)O)=CC=1C1=CC=C(O)C=C1 KXZJHVJKXJLBKO-UHFFFAOYSA-N 0.000 description 2
- 229910000365 copper sulfate Inorganic materials 0.000 description 2
- ARUVKPQLZAKDPS-UHFFFAOYSA-L copper(II) sulfate Chemical compound [Cu+2].[O-][S+2]([O-])([O-])[O-] ARUVKPQLZAKDPS-UHFFFAOYSA-L 0.000 description 2
- DOBRDRYODQBAMW-UHFFFAOYSA-N copper(i) cyanide Chemical compound [Cu+].N#[C-] DOBRDRYODQBAMW-UHFFFAOYSA-N 0.000 description 2
- 238000009792 diffusion process Methods 0.000 description 2
- 239000006185 dispersion Substances 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 230000005684 electric field Effects 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 239000011521 glass Substances 0.000 description 2
- 229910052738 indium Inorganic materials 0.000 description 2
- APFVFJFRJDLVQX-UHFFFAOYSA-N indium atom Chemical compound [In] APFVFJFRJDLVQX-UHFFFAOYSA-N 0.000 description 2
- 229910017604 nitric acid Inorganic materials 0.000 description 2
- 230000009467 reduction Effects 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- NDVLTYZPCACLMA-UHFFFAOYSA-N silver oxide Chemical compound [O-2].[Ag+].[Ag+] NDVLTYZPCACLMA-UHFFFAOYSA-N 0.000 description 2
- 239000011593 sulfur Substances 0.000 description 2
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- 241000251730 Chondrichthyes Species 0.000 description 1
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical compound S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 description 1
- YCKRFDGAMUMZLT-UHFFFAOYSA-N Fluorine atom Chemical compound [F] YCKRFDGAMUMZLT-UHFFFAOYSA-N 0.000 description 1
- GYHNNYVSQQEPJS-UHFFFAOYSA-N Gallium Chemical compound [Ga] GYHNNYVSQQEPJS-UHFFFAOYSA-N 0.000 description 1
- MKYBYDHXWVHEJW-UHFFFAOYSA-N N-[1-oxo-1-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)propan-2-yl]-2-[[3-(trifluoromethoxy)phenyl]methylamino]pyrimidine-5-carboxamide Chemical compound O=C(C(C)NC(=O)C=1C=NC(=NC=1)NCC1=CC(=CC=C1)OC(F)(F)F)N1CC2=C(CC1)NN=N2 MKYBYDHXWVHEJW-UHFFFAOYSA-N 0.000 description 1
- XTXRWKRVRITETP-UHFFFAOYSA-N Vinyl acetate Chemical compound CC(=O)OC=C XTXRWKRVRITETP-UHFFFAOYSA-N 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 235000011114 ammonium hydroxide Nutrition 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- 230000005540 biological transmission Effects 0.000 description 1
- 230000000903 blocking effect Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 239000005018 casein Substances 0.000 description 1
- BECPQYXYKAMYBN-UHFFFAOYSA-N casein, tech. Chemical compound NCCCCC(C(O)=O)N=C(O)C(CC(O)=O)N=C(O)C(CCC(O)=N)N=C(O)C(CC(C)C)N=C(O)C(CCC(O)=O)N=C(O)C(CC(O)=O)N=C(O)C(CCC(O)=O)N=C(O)C(C(C)O)N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=O)N=C(O)C(CCC(O)=O)N=C(O)C(COP(O)(O)=O)N=C(O)C(CCC(O)=N)N=C(O)C(N)CC1=CC=CC=C1 BECPQYXYKAMYBN-UHFFFAOYSA-N 0.000 description 1
- 235000021240 caseins Nutrition 0.000 description 1
- 239000003638 chemical reducing agent Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 239000004020 conductor Substances 0.000 description 1
- OMZSGWSJDCOLKM-UHFFFAOYSA-N copper(II) sulfide Chemical compound [S-2].[Cu+2] OMZSGWSJDCOLKM-UHFFFAOYSA-N 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 239000011888 foil Substances 0.000 description 1
- 229910052733 gallium Inorganic materials 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 229910000037 hydrogen sulfide Inorganic materials 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 239000012212 insulator Substances 0.000 description 1
- 239000011229 interlayer Substances 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- 230000007246 mechanism Effects 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 239000004570 mortar (masonry) Substances 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- 229920000728 polyester Polymers 0.000 description 1
- 238000005036 potential barrier Methods 0.000 description 1
- 230000000717 retained effect Effects 0.000 description 1
- 229920002050 silicone resin Polymers 0.000 description 1
- 229910001923 silver oxide Inorganic materials 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 1
- 239000002344 surface layer Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP43015287A JPS4910709B1 (enExample) | 1968-03-08 | 1968-03-08 | |
| JP1528768 | 1968-03-08 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE1911334A1 DE1911334A1 (de) | 1969-10-02 |
| DE1911334B2 DE1911334B2 (de) | 1977-02-24 |
| DE1911334C3 true DE1911334C3 (enExample) | 1977-10-13 |
Family
ID=11884619
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19691911334 Granted DE1911334B2 (de) | 1968-03-08 | 1969-03-06 | Photoleitfaehiges pulver zur herstellung elektrophotographischer aufzeichnungsmaterialien |
Country Status (4)
| Country | Link |
|---|---|
| US (1) | US3904409A (enExample) |
| JP (1) | JPS4910709B1 (enExample) |
| DE (1) | DE1911334B2 (enExample) |
| NL (1) | NL6903538A (enExample) |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4043813A (en) * | 1973-06-06 | 1977-08-23 | Bell & Howell Company | Photoconductive particles of zinc oxide |
| DE2448338C3 (de) * | 1974-10-10 | 1978-10-26 | Bayer Ag, 5090 Leverkusen | Stabilisierte Chalkogenide auf der Basis von Cadmium |
| US4098609A (en) * | 1975-07-07 | 1978-07-04 | Bell & Howell Company | Method of making improved photoconductive particles |
| JPS5646242A (en) * | 1979-09-19 | 1981-04-27 | Canon Inc | Electrophotographic photoconductive material |
| US5128064A (en) * | 1989-04-18 | 1992-07-07 | Wisconsin Alumni Research Foundation | Cadmium sulfide membranes |
Family Cites Families (18)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| USB287620I5 (enExample) * | 1954-12-01 | |||
| US2844640A (en) * | 1956-05-11 | 1958-07-22 | Donald C Reynolds | Cadmium sulfide barrier layer cell |
| US2908588A (en) * | 1957-03-15 | 1959-10-13 | Rca Corp | Zinc sulfide-coated phosphor particles, phosphor screen, and method of making screen |
| US3041166A (en) * | 1958-02-12 | 1962-06-26 | Xerox Corp | Xerographic plate and method |
| US3060134A (en) * | 1959-03-03 | 1962-10-23 | New Jersey Zinc Co | Photoconductive zinc oxide pigment |
| NL280609A (enExample) * | 1961-07-13 | |||
| US3162526A (en) * | 1961-10-26 | 1964-12-22 | Grace W R & Co | Method of doping semiconductor materials |
| CH451338A (de) * | 1962-10-13 | 1968-05-15 | Bayer Ag | Fotoleitendes Bauelement aus Cadmiumsulfid und/oder -selenid enthaltendem Material und Verfahren zu dessen Herstellung |
| NL290120A (enExample) * | 1963-03-12 | |||
| US3379527A (en) * | 1963-09-18 | 1968-04-23 | Xerox Corp | Photoconductive insulators comprising activated sulfides, selenides, and sulfoselenides of cadmium |
| US3374108A (en) * | 1964-06-18 | 1968-03-19 | Kewanee Oil Co | Formation of barrier layers in cadmium sulfide solar cells |
| US3312547A (en) * | 1964-07-02 | 1967-04-04 | Xerox Corp | Xerographic plate and processes of making and using same |
| US3568306A (en) * | 1965-09-25 | 1971-03-09 | Matsushita Electric Industrial Co Ltd | Method of making photovoltaic device by electroplating |
| GB1128417A (en) * | 1965-09-29 | 1968-09-25 | Fuji Photo Film Co Ltd | Photoconductive insulating materials |
| US3449148A (en) * | 1966-06-30 | 1969-06-10 | Texas Instruments Inc | Formation of electron barriers on phosphor particles |
| US3560398A (en) * | 1966-12-02 | 1971-02-02 | Texas Instruments Inc | Phosphors for color display systems |
| US3519480A (en) * | 1967-01-13 | 1970-07-07 | Eastman Kodak Co | Process for treating photoconductive cadmium sulfide layers |
| GB1179649A (en) * | 1967-08-22 | 1970-01-28 | Katsuragawa Denki Kk | Method of Preparing Electrophotosensitive Materials and Photosensitive Elements Utilizing the Same |
-
1968
- 1968-03-08 JP JP43015287A patent/JPS4910709B1/ja active Pending
-
1969
- 1969-03-04 US US804142A patent/US3904409A/en not_active Expired - Lifetime
- 1969-03-06 DE DE19691911334 patent/DE1911334B2/de active Granted
- 1969-03-07 NL NL6903538A patent/NL6903538A/xx unknown
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2703430A1 (de) | Solarzelle aus halbleitermaterial und zugehoeriges herstellungsverfahren | |
| DE2527906A1 (de) | Fotoelement | |
| DE1911334C3 (enExample) | ||
| DE1464315B2 (de) | Schaltungsanordnung mit einem strahlungsempfindlichen halbleiterschaltelement | |
| DE1522567B2 (de) | Elektrophotographisches Ver fahren zum Erzeugen eines Ladungs bildes auf einer isolierenden Schicht und Gerat zur Durchfuhrung des Verfahrens | |
| DE3224582C2 (enExample) | ||
| DE2055269B2 (de) | Elektrophotographisches Aufzeichnungsmaterial | |
| DE2806880A1 (de) | Fluessigkeit/halbleiter-photozelle | |
| DE3418596A1 (de) | Elektrophotographischer photorezeptor | |
| DE1522568B2 (de) | Elektrofotografisches verfahren zum erzeugen eines ladungsbildes auf einer isolierenden schicht und geraet zur durchfuehrung des verfahrens | |
| DE1911334B2 (de) | Photoleitfaehiges pulver zur herstellung elektrophotographischer aufzeichnungsmaterialien | |
| DE2813176A1 (de) | Verfahren zum herstellen und behandeln einer photovoltaischen halbleiterdiode aus elementen der gruppe iv und vi des periodischen systems | |
| DE2164141A1 (de) | Verfahren zur Herstellung eines photokonduktiven Pulvers | |
| DE69220756T2 (de) | Photoempfindliche Vorrichtung mit Zusammensetzungs- gradienten und zurückgesetzten Kontakten zum Fixieren der Minoritätsladungsträger und Verfahren zu ihrer erstellung | |
| DE3340568C2 (de) | Elektrophotographisches Aufzeichnungsmaterial | |
| DE2606994A1 (de) | Photodetektor und verfahren zu seiner herstellung | |
| DE2200061C3 (de) | Verfahren zur Herstellung eines pulverförmigen Photoleiters | |
| DE1537148B2 (enExample) | ||
| DE2242508C3 (de) | Elektrophotographisches Verfahren zur Herstellung von Bildern | |
| DE2128584B2 (de) | Elektrophotographisches aufzeichnungsmaterial | |
| DE2207311A1 (de) | Kalium-Tantalat-Detektor für ultraviolette Strahlung | |
| DE1022091B (de) | Lichtempfindliches xerographisches Material | |
| DE2555014A1 (de) | Halbleiteranordnungen | |
| DE2054118A1 (en) | Bipolar charge-/discharge-able coating - for xerography with zinc oxide and photoconductive organic pigment in resin | |
| DE2040163A1 (de) | Elektrophotographisches,lichtempfindliches Element |