DE1908009A1 - Rundstrickmaschine zur Herstellung von Plueschware mit eingekaemmten Fasern - Google Patents
Rundstrickmaschine zur Herstellung von Plueschware mit eingekaemmten FasernInfo
- Publication number
- DE1908009A1 DE1908009A1 DE19691908009 DE1908009A DE1908009A1 DE 1908009 A1 DE1908009 A1 DE 1908009A1 DE 19691908009 DE19691908009 DE 19691908009 DE 1908009 A DE1908009 A DE 1908009A DE 1908009 A1 DE1908009 A1 DE 1908009A1
- Authority
- DE
- Germany
- Prior art keywords
- drive
- ring gear
- knitting machine
- circular knitting
- needle cylinder
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000009940 knitting Methods 0.000 title claims description 17
- 239000000835 fiber Substances 0.000 title claims description 8
- 238000004519 manufacturing process Methods 0.000 title claims description 6
- 239000004744 fabric Substances 0.000 title 1
- 238000009960 carding Methods 0.000 claims description 12
- 210000001520 comb Anatomy 0.000 claims 1
- 230000005540 biological transmission Effects 0.000 description 2
- 230000008859 change Effects 0.000 description 2
- 230000007246 mechanism Effects 0.000 description 2
- 230000009467 reduction Effects 0.000 description 2
- LXVKDQQAKAPLOW-UHFFFAOYSA-N 2-[4-(1-amino-2-methylbutyl)triazol-1-yl]-1-[4-[4-[4-[2-[4-(1-amino-2-methylbutyl)triazol-1-yl]-3-(4-hydroxyphenyl)propanoyl]piperazin-1-yl]-6-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethylamino]-1,3,5-triazin-2-yl]piperazin-1-yl]-3-(4-hydroxyphenyl)propan-1-on Chemical compound Cl.N1=NC(C(N)C(C)CC)=CN1C(C(=O)N1CCN(CC1)C=1N=C(N=C(NCCOCCOCCOCC#C)N=1)N1CCN(CC1)C(=O)C(CC=1C=CC(O)=CC=1)N1N=NC(=C1)C(N)C(C)CC)CC1=CC=C(O)C=C1 LXVKDQQAKAPLOW-UHFFFAOYSA-N 0.000 description 1
- 229910000086 alane Inorganic materials 0.000 description 1
- AZDRQVAHHNSJOQ-UHFFFAOYSA-N alumane Chemical compound [AlH3] AZDRQVAHHNSJOQ-UHFFFAOYSA-N 0.000 description 1
- 239000003638 chemical reducing agent Substances 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012544 monitoring process Methods 0.000 description 1
- 239000013641 positive control Substances 0.000 description 1
- 230000008569 process Effects 0.000 description 1
- 238000009987 spinning Methods 0.000 description 1
- 238000009732 tufting Methods 0.000 description 1
Classifications
-
- D—TEXTILES; PAPER
- D04—BRAIDING; LACE-MAKING; KNITTING; TRIMMINGS; NON-WOVEN FABRICS
- D04B—KNITTING
- D04B9/00—Circular knitting machines with independently-movable needles
- D04B9/14—Circular knitting machines with independently-movable needles with provision for incorporating loose fibres, e.g. in high-pile fabrics
Landscapes
- Engineering & Computer Science (AREA)
- Textile Engineering (AREA)
- Preliminary Treatment Of Fibers (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US71242268A | 1968-03-12 | 1968-03-12 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1908009A1 true DE1908009A1 (de) | 1969-10-02 |
Family
ID=24862042
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19691908009 Pending DE1908009A1 (de) | 1968-03-12 | 1969-02-18 | Rundstrickmaschine zur Herstellung von Plueschware mit eingekaemmten Fasern |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US3495422A (enExample) |
| BE (1) | BE727856A (enExample) |
| CH (1) | CH492053A (enExample) |
| DE (1) | DE1908009A1 (enExample) |
| FR (1) | FR2003685A1 (enExample) |
| GB (1) | GB1236552A (enExample) |
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2451900A1 (de) * | 1973-11-02 | 1975-05-07 | Herbert York | Vielsystemige rundstrickmaschine zum herstellen von hochflorigen gestricken |
| WO1992020849A1 (en) * | 1991-05-10 | 1992-11-26 | Mayer Industries, Inc. | Circular sliver knitting machine having increased carding capacity |
| DE4322255A1 (de) * | 1993-07-05 | 1995-01-19 | Festo Kg | Dämpfungsvorrichtung |
Families Citing this family (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3896637A (en) * | 1972-11-06 | 1975-07-29 | Glenoit Mills | Sliver feeding means for high pile fabric circular knitting machines |
| US3896636A (en) * | 1972-11-06 | 1975-07-29 | Glenoit Mills | Sliver feeding means for high pile fabric circular knitting machines |
| US3973414A (en) * | 1973-05-08 | 1976-08-10 | Bunker Ramo Corporation | Apparatus for producing patterned deep pile circular knitted fabrics |
| US3918273A (en) * | 1973-11-14 | 1975-11-11 | Glenoit Mills | Sliver feeding means for high pile fabric knitting machines |
| FR2254211A5 (enExample) * | 1973-12-10 | 1975-07-04 | Fegeat Antoine | |
| FI53324C (fi) * | 1974-04-01 | 1978-04-10 | Glenoit & Lillja | Fibermatningsanordning foer konstpaelsmaskin |
| FR2319728A1 (fr) * | 1975-07-29 | 1977-02-25 | Mecanique Ste Gle | Perfectionnements aux metiers a tricoter circulaires |
| DE4242064C1 (de) * | 1992-12-14 | 1994-06-16 | Terrot Strickmaschinen Gmbh | Rundstrickmaschine zur Herstellung gemusterter Hochflorgestricke |
| USD954113S1 (en) * | 2019-06-12 | 2022-06-07 | Santoni S.P.A. | Textile machine |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB780662A (en) * | 1953-10-17 | 1957-08-07 | Vyzkumy Ustav Tvarecich Stroju | Circular knitting machine |
| US3188834A (en) * | 1962-12-10 | 1965-06-15 | Glenoit Mills | Means for feeding fibers to a pile fabric knitting machine |
| US3299672A (en) * | 1963-12-20 | 1967-01-24 | Arnold W Schmidt | Method and apparatus for producing knit pile fabric |
| US3269147A (en) * | 1964-03-02 | 1966-08-30 | Glenoit Mills | Method and means for knitting pile fabric |
| US3248902A (en) * | 1964-03-26 | 1966-05-03 | Glenoit Mills | Striping attachment for a carding head for a pile fabric knitting machine |
-
1968
- 1968-03-12 US US712422A patent/US3495422A/en not_active Expired - Lifetime
-
1969
- 1969-01-16 GB GB2550/69A patent/GB1236552A/en not_active Expired
- 1969-02-03 BE BE727856D patent/BE727856A/xx unknown
- 1969-02-18 DE DE19691908009 patent/DE1908009A1/de active Pending
- 1969-02-24 FR FR6904615A patent/FR2003685A1/fr not_active Withdrawn
- 1969-03-07 CH CH345969A patent/CH492053A/de not_active IP Right Cessation
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2451900A1 (de) * | 1973-11-02 | 1975-05-07 | Herbert York | Vielsystemige rundstrickmaschine zum herstellen von hochflorigen gestricken |
| WO1992020849A1 (en) * | 1991-05-10 | 1992-11-26 | Mayer Industries, Inc. | Circular sliver knitting machine having increased carding capacity |
| DE4322255A1 (de) * | 1993-07-05 | 1995-01-19 | Festo Kg | Dämpfungsvorrichtung |
Also Published As
| Publication number | Publication date |
|---|---|
| BE727856A (enExample) | 1969-07-16 |
| GB1236552A (en) | 1971-06-23 |
| CH492053A (de) | 1970-06-15 |
| FR2003685A1 (enExample) | 1969-11-14 |
| US3495422A (en) | 1970-02-17 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2343064C2 (de) | Vorrichtung zur Herstellung von Faservliesen aus textilen Faserstoffen u. dgl | |
| DE1908009A1 (de) | Rundstrickmaschine zur Herstellung von Plueschware mit eingekaemmten Fasern | |
| EP0936292B1 (de) | Rundkammantrieb | |
| DE746433C (de) | Kegelfoermiger Haspel zur Streckbehandlung von Faeden, insbesondere Kunstfaeden | |
| DE2164215A1 (de) | Vorrichtung zum Transportieren eines bahnförmigen Materials | |
| DE2229438A1 (de) | Vorrichtung zum speisen von fasergut u.dgl., insbesondere spinngut, zu einer verarbeitungsmaschine | |
| DE1510232A1 (de) | Verfahren und Vorrichtung zum Verziehen und Drehen von Faserbaendern | |
| DE2325888A1 (de) | Spinn- oder zwirnmaschine mit lieferwalzen und galetten | |
| DE102007026158A1 (de) | Vorrichtung an einer Spinnereivorbereitungsmaschine, z.B. Strecke, Karde, Kämmmaschine o. dgl., insbesondere Doppelkopfstrecke, mit mindestens zwei angetriebenen Streckwerken | |
| DE2130691A1 (de) | Verfahren und Vorrichtung zum Anfahren und Stillsetzen schnellaufender Spinnmaschinen | |
| DE69217002T2 (de) | Gatteranordnung für eine Maschine zur Handhabung von Faserbändern | |
| DE2432319A1 (de) | Rotationsstreckwerk | |
| DE484649C (de) | Strang- bzw. Rohrpresse mit Abziehvorrichtung | |
| DE2455746C3 (de) | Krempel an Rundstrickmaschinen zur Herstellung von Rauhflor- oder Kunstpelzstrickwaren | |
| DE19851923B4 (de) | Vorrichtung zum Transportieren von Garn durch eine Klimakammer | |
| DE2442340B2 (de) | Verfahren und Vorrichtung zum OE-Spinnen | |
| DE1685572A1 (de) | Verfahren zum Mischen von Faserbaendern und Vorrichtung zur Durchfuehrung des Verfahrens | |
| DE689667C (de) | Streichgarn-Ringspinnmaschine | |
| DE525710C (de) | Vorrichtung zur Herstellung schattierter Garne bzw. Vorgarne | |
| DE1585250B1 (de) | Rundstrickmaschine zur Herstellung einer glatten Strickware | |
| DE1510414A1 (de) | Verfahren zum Mischen von unterschiedlichen textilen Grundstoffen in der Spinnereivorbereitung | |
| DE1460746C (de) | Kratzenrauhmaschine | |
| DE1064468B (de) | Rauhmaschine | |
| DE2212935A1 (de) | Kettenwirkmaschine | |
| DE1610422A1 (de) | Vorrichtung zur Herstellung von Verschlussgliederreihen fuer Reissverschluesse |