DE1906050B2 - S-Alkyl-(methyl-hexahydro-lHazepin)-1 -carbothiolate - Google Patents
S-Alkyl-(methyl-hexahydro-lHazepin)-1 -carbothiolateInfo
- Publication number
- DE1906050B2 DE1906050B2 DE1906050A DE1906050A DE1906050B2 DE 1906050 B2 DE1906050 B2 DE 1906050B2 DE 1906050 A DE1906050 A DE 1906050A DE 1906050 A DE1906050 A DE 1906050A DE 1906050 B2 DE1906050 B2 DE 1906050B2
- Authority
- DE
- Germany
- Prior art keywords
- hexahydro
- azepine
- methyl
- carbothiolate
- alkyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- ZKUKXSWKWGHYKJ-UHFFFAOYSA-N 1-methylazepane Chemical compound CN1CCCCCC1 ZKUKXSWKWGHYKJ-UHFFFAOYSA-N 0.000 claims description 8
- 239000004480 active ingredient Substances 0.000 description 8
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 6
- 244000062793 Sorghum vulgare Species 0.000 description 5
- 235000019713 millet Nutrition 0.000 description 5
- 239000000203 mixture Substances 0.000 description 5
- 235000007320 Avena fatua Nutrition 0.000 description 4
- 240000007594 Oryza sativa Species 0.000 description 4
- 235000007164 Oryza sativa Nutrition 0.000 description 4
- 244000292693 Poa annua Species 0.000 description 4
- 239000004009 herbicide Substances 0.000 description 4
- DSBOHBZVJVNQRR-UHFFFAOYSA-N 3-methylazepane Chemical compound CC1CCCCNC1 DSBOHBZVJVNQRR-UHFFFAOYSA-N 0.000 description 3
- 241000209764 Avena fatua Species 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- 241000220243 Brassica sp. Species 0.000 description 3
- 244000152970 Digitaria sanguinalis Species 0.000 description 3
- 235000010823 Digitaria sanguinalis Nutrition 0.000 description 3
- 241000209082 Lolium Species 0.000 description 3
- 240000004296 Lolium perenne Species 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 235000021307 Triticum Nutrition 0.000 description 3
- 244000098338 Triticum aestivum Species 0.000 description 3
- 239000013543 active substance Substances 0.000 description 3
- -1 alkyl radical Chemical class 0.000 description 3
- 229910052799 carbon Inorganic materials 0.000 description 3
- 239000000839 emulsion Substances 0.000 description 3
- 230000002363 herbicidal effect Effects 0.000 description 3
- 238000002360 preparation method Methods 0.000 description 3
- SLRMQYXOBQWXCR-UHFFFAOYSA-N 2154-56-5 Chemical compound [CH2]C1=CC=CC=C1 SLRMQYXOBQWXCR-UHFFFAOYSA-N 0.000 description 2
- 241000743985 Alopecurus Species 0.000 description 2
- 244000075850 Avena orientalis Species 0.000 description 2
- 235000011331 Brassica Nutrition 0.000 description 2
- 240000007124 Brassica oleracea Species 0.000 description 2
- 240000004585 Dactylis glomerata Species 0.000 description 2
- 244000058871 Echinochloa crus-galli Species 0.000 description 2
- 241000287828 Gallus gallus Species 0.000 description 2
- 240000005979 Hordeum vulgare Species 0.000 description 2
- 235000007340 Hordeum vulgare Nutrition 0.000 description 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- 235000011999 Panicum crusgalli Nutrition 0.000 description 2
- 244000152045 Themeda triandra Species 0.000 description 2
- 239000008280 blood Substances 0.000 description 2
- 210000004369 blood Anatomy 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 239000012141 concentrate Substances 0.000 description 2
- 239000002270 dispersing agent Substances 0.000 description 2
- 238000000034 method Methods 0.000 description 2
- UAEPNZWRGJTJPN-UHFFFAOYSA-N methylcyclohexane Chemical compound CC1CCCCC1 UAEPNZWRGJTJPN-UHFFFAOYSA-N 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- SYSQUGFVNFXIIT-UHFFFAOYSA-N n-[4-(1,3-benzoxazol-2-yl)phenyl]-4-nitrobenzenesulfonamide Chemical class C1=CC([N+](=O)[O-])=CC=C1S(=O)(=O)NC1=CC=C(C=2OC3=CC=CC=C3N=2)C=C1 SYSQUGFVNFXIIT-UHFFFAOYSA-N 0.000 description 2
- 239000003921 oil Substances 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 235000009566 rice Nutrition 0.000 description 2
- 239000000243 solution Substances 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 244000045561 useful plants Species 0.000 description 2
- LGONGMXQDFYGKU-UHFFFAOYSA-N 2-methylazepane Chemical compound CC1CCCCCN1 LGONGMXQDFYGKU-UHFFFAOYSA-N 0.000 description 1
- FGSUUFDRDVJCLT-UHFFFAOYSA-N 3-methylazepan-2-one Chemical compound CC1CCCCNC1=O FGSUUFDRDVJCLT-UHFFFAOYSA-N 0.000 description 1
- WKZHYWWKUYGHKO-UHFFFAOYSA-N 4-methylazepane Chemical compound CC1CCCNCC1 WKZHYWWKUYGHKO-UHFFFAOYSA-N 0.000 description 1
- 240000004731 Acer pseudoplatanus Species 0.000 description 1
- 240000001592 Amaranthus caudatus Species 0.000 description 1
- 235000009328 Amaranthus caudatus Nutrition 0.000 description 1
- 241001666377 Apera Species 0.000 description 1
- 235000005781 Avena Nutrition 0.000 description 1
- 235000004535 Avena sterilis Nutrition 0.000 description 1
- 238000006237 Beckmann rearrangement reaction Methods 0.000 description 1
- 244000025254 Cannabis sativa Species 0.000 description 1
- 241001251296 Carex pendula Species 0.000 description 1
- 241000234653 Cyperus Species 0.000 description 1
- 241000196324 Embryophyta Species 0.000 description 1
- 241000088861 Latua Species 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- 240000003461 Setaria viridis Species 0.000 description 1
- 235000002248 Setaria viridis Nutrition 0.000 description 1
- 241000209140 Triticum Species 0.000 description 1
- 235000005373 Uvularia sessilifolia Nutrition 0.000 description 1
- 230000000844 anti-bacterial effect Effects 0.000 description 1
- ZSIQJIWKELUFRJ-UHFFFAOYSA-N azepane Chemical compound C1CCCNCC1 ZSIQJIWKELUFRJ-UHFFFAOYSA-N 0.000 description 1
- 239000003899 bactericide agent Substances 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 239000012876 carrier material Substances 0.000 description 1
- 239000011280 coal tar Substances 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- 239000002283 diesel fuel Substances 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 239000003337 fertilizer Substances 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 239000000417 fungicide Substances 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 238000000227 grinding Methods 0.000 description 1
- 239000002917 insecticide Substances 0.000 description 1
- 239000003350 kerosene Substances 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- GYNNXHKOJHMOHS-UHFFFAOYSA-N methyl-cycloheptane Natural products CC1CCCCCC1 GYNNXHKOJHMOHS-UHFFFAOYSA-N 0.000 description 1
- 239000002480 mineral oil Substances 0.000 description 1
- 235000010446 mineral oil Nutrition 0.000 description 1
- 150000002790 naphthalenes Chemical class 0.000 description 1
- 239000002689 soil Substances 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- CXWXQJXEFPUFDZ-UHFFFAOYSA-N tetralin Chemical compound C1=CC=C2CCCCC2=C1 CXWXQJXEFPUFDZ-UHFFFAOYSA-N 0.000 description 1
- 150000007970 thio esters Chemical class 0.000 description 1
- ILWRPSCZWQJDMK-UHFFFAOYSA-N triethylazanium;chloride Chemical compound Cl.CCN(CC)CC ILWRPSCZWQJDMK-UHFFFAOYSA-N 0.000 description 1
- 235000013311 vegetables Nutrition 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D223/00—Heterocyclic compounds containing seven-membered rings having one nitrogen atom as the only ring hetero atom
- C07D223/02—Heterocyclic compounds containing seven-membered rings having one nitrogen atom as the only ring hetero atom not condensed with other rings
- C07D223/04—Heterocyclic compounds containing seven-membered rings having one nitrogen atom as the only ring hetero atom not condensed with other rings with only hydrogen atoms, halogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Other In-Based Heterocyclic Compounds (AREA)
Description
in welcher R einen Alkylrest mit 1—3 C-Atomen oder einen Benzylrest bedeutet.
2. Herbizid, enthaltend ein S-Alkyl-(methyl-hexahydro-1
H-azepin)-1-carbothiolat, wie in Anspruch 1 gekennzeichnet.
Methylcaprolactam, erhalten durch Photooximierung
von Methylcyclohexan und anschließender Beckmann-Umlagerung,
reduziert wird.
Herstellung von S-n-Propyl-(3-methyl-hexahydro-1
H-azepin)-1 -carbothiolat
Zu einer Mischung von 11,3 Gewichtsteilen 3-Methylhexahydro-1
H-azepin, 10,5 Gewichtsteilen Triethylamin und 175 Gewichtsteilen Benzol werden bei 20° C 14
Gewichtsteile Chlorameisensäure-ihio-n-propyl-ester
zugetropft. Nach einer Stunde wird vom Triäthylammoniumchlorid abgetrennt; das Filtrat wird mit Wasser
gewaschen, mit Magnesiumsulfat getrocknet und anschließend im Vakuum eingeengt. Die Destillation des
Rückstandes liefert die Substanz als farblose Flüssigkeit: Kp.o.) ,„m = 107-108° C,n? = 1,5071.
Die Verbindung hat folgende Strukturformel:
I Π Ν -C-S-C1II7(H)
Il
H1C O
Die vorliegende Erfindung betrifft neue wertvolle S-Alkyl-(methy!-hexa-hydro-l H-azepin)- 1-carbothiolate
und diese enthaltende Herbizide.
Es ist bekannt, S-Äthyl-hexahydro-1 H-azepin-1 -carbothiolat
(US-PS 3198 786) zur Bekämpfung unerwünschter Pflanzen in Kulturen von Nutzpflanzen, wie
Gerste, Weizen und Reis, zu verwenden.
Es wurde gefunden, daß S-Alkyl-(methyl-hexahydro-1 H-azepin)-1-carbothiolate der allgemlinen Formel
I..C
Il N C S R
in der R einen Alkylrest mit I —3 C-Atomen oder einen Bcnzylrest bedeutet, eine gute herbizide Wirkung
haben. Sie besitzen bei manchmal gleicher und oft besserer herbizider Wirkung eine bessere Nutzpflanzenverträglichkeit
als S-Äthyl-hexahydro-IH-azepin-1-carbthiolat.
Die Herstellung der Wirkstoffe kann in der Weise durchgeführt werden, daß ein geeigneter Chlorameisensiiurethiolester
mit einem Methyl-hexahydro-1 H-azepin umgesetzt wird. Ebenso kann man die neuen Wirkstoffe
erhalten, wenn man Methylhexahydro-IH-azepine in
Form der entsprechenden N-Carbonsäurechloride mit geeigneten Mercuptanen reagieren läßt.
Meiliyl-hexahydro-lH-azepine sind z.B. durch Reduktion
entsprechender Methylcaprolactame zugänglich (|. A. C. S. 76,2 317 [1954]).
Als Methyl-hexahydro-1 H-azepine für die Herstellung der Wirkstoffe sind z. B. geeignet:
2-Melliyl-hexahydro-1 H-azepin,
J-Methyl-hexahydro-l H-azepin,
4-Melhyl hexahydro-1 H-azepin.
J-Methyl-hexahydro-l H-azepin,
4-Melhyl hexahydro-1 H-azepin.
Ebenso eignen sich Gemische, die die drei einzelnen strukturisomeren Methyl-hexahydro-1 H-azepine in verschiedenen
Verhältnissen enthalten. So eignet sich /.. B. ein Methyl-hexahydro-1 H-azepin-lsomerengemisch,
das erhalten wird, wenn ein Isomerengemisch von Nach dem gleichen Verfahren lassen sich auch die
folgenden Verbindungen herstellen:
S-Äthyl-(2-methyl-hexahydro-1 H-azepin)-1
-carbothiolat
Kp.2.5mn, = 124°C, Π ΐ = 1,5102
S-Äthyl-(3-methyl-hexahydro-ϊ H-azepin)-
1 -carbothiolat
Kp.0,4,,,,,, = 104-105° C, η-,ν = 1,5108
S-Äthyl-(4-methyl-hexahydro-1 H-azepin)-
S-Äthyl-(4-methyl-hexahydro-1 H-azepin)-
1-carbothiolat
Kp.o.4,„n, = 102° C,n, = 1,5110
S-n-Propyl-(3-methyl-hexahydro-lH-azepin)-
S-n-Propyl-(3-methyl-hexahydro-lH-azepin)-
1-carbothiolat
Kp.o,imm = 107-108° Cn,.' = 1,5070
S-iso-Propyl-(3-methyI-hexahydro-lH-azepin)-
S-iso-Propyl-(3-methyI-hexahydro-lH-azepin)-
I-carbothiolat
Kp-ojs,.,,η = 94° C,n, = 1,5046
Ebenso erhält man die S-Alkyl-(methyl-hexahydro-1 H-azepin)-1-carbothiolate als Isomerengemische,
wenn man nach dem oben beschriebenen Verfahren Methyl-hexyhydro-1 H-azepin als Isomerengeniisch mit
Chlorameisensäurethioestern umsetzt.
Die erfindungsgemäßen Herbizide können als Lösungen, Emulsionen, Suspensionen oder Stäubemittel
angewendet werden. Die Anwendungsformen richten sich ganz nach den Verwendungszwecken; sie sollen in
jedem Fall eine feine Verteilung der wirksamen Substanz gewährleisten. Zur Herstellung von direkt
versprühbaren Lösungen kommen Mineralölfraktionen von mittlerem bis hohem Siedepunkt, wie Kerosin oder
Dieselöl, ferner Kohlenteeröle sowie öle pflanzlichen oder tierischen Ursprungs, außerdem cyclische Kohlenwasserstoffe,
wie Tetrahydronaphthalin und alkylierte Naphthaline, in Betracht.
Wäßrige Anwendungsformen können aus Emulsionskonzentraten, Pasten oder netzbaren Pulvern (Spritzpulvern)
durch Zusatz von Wasser bereitet werden. Zur Herstellung von Emulsionen können die Substanzen als
solche oder in einem Lösungsmittel gelöst mittels Netzoder Dispergiermitteln in Wasser homogenisiert werden.
Es können aber auch aus wirksamer Substanz
Emulgier- oder Dispergiermittel und eventuell Lösungsmittel bestehende Konzentrate hergestellt werden, die
zur Verdünnung mit Wasser geeignet sind. Die Ausbringung kann auch als Granulat erfolgen.
Ein Zusatz von Insektiziden, Fungiziden, Bakteriziden ;
und anderen herbiziden Mitteln ist ebenso möglich wie die Mischung mit Düngemitteln.
Stäubemittel können durch Mischen oder gemeinsames Vermählen der wirksamen Substanzen mit einem
festen Trägerstoff hergestellt werden. in
Die folgenden Beispiele erläutern die Anwendung der neuen Wirkstoffe.
Sandboden wurde in Versuchsgefäße gefüllt, mit Samen von Brassica sp. (Kohlarten), Mordeum vulgäre
(Gerste), Triticum vulgäre (Weizen), Oryza sativa (Reis), Digitaria sanguinalis (Bluthirse), Setaria viridis (grüne
Borstenhirse), Echinochloa crus-galli (Hühnerhirse), _ίι
Avena fatua (Flughafer), Poa annua (einj. Rispengras), Lolium perenne (deutsches Weidelgras), Alopecurus
niyosuroides (Ackerfuchsschwanz), Dactylis glomerata (Knäuelgras), Cyperus sp. (Zypergrasarten) besät und
unmittelbar danach mit
1-carbothiolat (I) S-Äthyl-(3-methyl-hexahydro-1 H-azepin)-
l-carbothiolat (II) S-Äthyl-(4-methyl-hexahydro-lH-azepin)-
l-carbothio!at (III) S-Isopropyl-(4-methyl-hexahydro-1 H-azepin)-
1-carbothiolat (IV) S-Isopropyl-(3-methyl-hexahydro-1 H-azepin)-
I-carbothiolat (V) S-Propyl-(3-methyl-hexahydro-1 H-azepin)-
1-carbothiolat (VI) und im Vergleich dazu mit
1-carbothiolat (VII)
jeweils in einer Aufwandmenge von 3 kg Wirkstoff je ha, dispergiert in 500 Liter Wasser je ha, — behandelt.
Die Versuchsergebnisse nach 5 Wochen sind aus nachfolgender Tabelle zu ersehen:
| Wirkstoff | I | 0 | Il | 0 | Hl | 0 | IV | 0 | V | VI | 0 | |
| VII | K) | 5 | 0 | 5 | 0 | 5 | ||||||
| Brassica sp. | 50 | 5 | 5 | 0 | 5 | 5 | 0 | |||||
| 1 Iordeum vulgäre | 20 | 0 | 0 | 0 | 0 | 5 | 0 | |||||
| Triticum vulgäre | 20 | 100 | 100 | 95 | 100 | 0 | 100 | |||||
| Oryza sativa | 10-20 | 100 | 100 | 95 | 95 | 95 | KKi | |||||
| Digitaria sanguinalis | 90-100 | 100 | 100 | 100 | 95 | 95 | mo | |||||
| Selaria viridis | 80 | 70 | 85 | 75 | 70 | 95 | so | |||||
| üehinochloa crus-galli | 90 | 80 | 80 | 80 | 75 | 75 | so | |||||
| Avena laliia | 40-50 | HO | 80 | 75 | 75 | 75 | so | |||||
| Poa annua | 70 | 80 | 85 | 80 | 75 | 75 | so | |||||
| Lolium perenne | 60-70 | 95 | 95 | 90 | 85 | 80 | 90 | |||||
| Alopecurus niyosuroides | 60-70 | 95 | 95 | 90 | 85 | 85 | 91) | |||||
| Apcru spica venti | 70 | 75 | 75 | 75 | 75 | H 5 | 75 | |||||
| Dactylis glomerata | 70 | 75 | ||||||||||
| (Zyperns sp. | 70 | |||||||||||
0 Ohne Schall igung.
100 Totale .Schädigung.
100 Totale .Schädigung.
Die Pflanzen Brassica sp. (Kohlarten), Avena fatua (Flughafer), Poa annua (einj. Rispengras), Lolium
perenne (deutsches Weidelgras), Apera spica venti (Windhalm), Echinochloa crus-galli (Hühnerhirse), Digitaria
sanguinalis (Bluthirse), C'ypcrus sp. (Zypergrasarten) wurden bei einer Wuchshöhe von 3—15 cm mit
S-Äthyl-(2-niethyl-hexahyclro-1 H-azepin)-
l-carbothiolat (I)
S-Äthyl-(3-methyl-hexahydro-1 H-azepin)-
S-Äthyl-(3-methyl-hexahydro-1 H-azepin)-
1-carbothiolat (H)
S-Äthyl-(4-nielhyl-hexahydro-1 H-azepin)-
S-Äthyl-(4-nielhyl-hexahydro-1 H-azepin)-
l-carbothiolat (111)
S-lsopropyI-(4-methyl-hexahydr<>-1 H-azupin)-
1-carbothiolat (IV) S-lsopropyl-(3-methyl-hexahydro-IH-azepin)-
1-carbothiolat (V) S-Piopyl-(3-methyl-hexahydro-IH-azepin)
1-carbothiolat (VI) und im Vergleich dazu mit
S-Äthyl-(hexahydro-1 H-azepin)-l-carbothiolat
(VlI)
behandelt. Die Aufwandmengen betrugen jeweils -I kg
Wirkstoff je ha, dispergiert in 500 Liter Wasser je ha. Das Versuchsergebnis nach 4 Wochen ist aus naclilol
gender Tabelle zu ersehen:
| 5 | Wirkstoff | 19 06 | 5 | 050 | III | 6 | V | Vl | |
| VIl | 60 | 5 | 10 | 10 | |||||
| 40 | 75 | 55 | IV | 60 | 65 | ||||
| 4U-50 | 1 | 70 | 11 | 70 | H) | 75 | 75 | ||
| Hrassica sp. | 50 | 75 | 10 | 70 | 60 | 70 | 75 | ||
| A ve na latua | 40 | 70 | 65 | 70 | 75 | 70 | 75 | ||
| Poa annua | 40-50 | 65 | 80 | 70 | 70 | 70 | 70 | ||
| Lolium pcrcnnc | 50 | 50 | 75 | 65 | 70 | 65 | 65 | ||
| Apcra spica vcnti | 50 | 75 | 50 | 70 | 55 | 55 | |||
| Iichinochloa crus-galli | 20 | 75 | 65 | ||||||
| Digilaria sanguinalis | 70 | 55 | |||||||
| Cypcrus sp. | 60 | ||||||||
0 = Ohne Schädigung. KX) = Totale Schädigung.
Claims (1)
1. S-Alkyl-(methyl-hexahydro-1 H-azepin)-1 -carbothiolate
der allgemeinen Formel
I II N-C- S R
-·χ Ι!
H1C O
Priority Applications (19)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE1906050A DE1906050C3 (de) | 1969-02-07 | 1969-02-07 | S-Alkyi-dnethyl-hexahydro-lHazepin)-1 -carbothiolate |
| BG13782A BG17265A3 (de) | 1969-02-07 | 1970-01-20 | |
| HUBA2354A HU162713B (de) | 1969-02-07 | 1970-01-30 | |
| NL7001391A NL7001391A (de) | 1969-02-07 | 1970-01-30 | |
| IL33823A IL33823A (en) | 1969-02-07 | 1970-02-02 | S-alkyl-(methyl-hexahydro-1h-azepine)-1-carbothiolates,their preparation and herbicidal compositions containing them |
| US00008038A US3708471A (en) | 1969-02-07 | 1970-02-02 | S-alkyl-(methylhexahydro-1h-azepine)-1-carbothiolates |
| SE01370/70A SE353445B (de) | 1969-02-07 | 1970-02-03 | |
| SU1401064A SU388380A1 (ru) | 1970-02-04 | Гербицид | |
| BE745468D BE745468A (fr) | 1969-02-07 | 1970-02-04 | S-alcoyl-(methyl-hexahydro-1h-azepine)-1-carbothiolates |
| CH168470A CH530161A (de) | 1969-02-07 | 1970-02-05 | Herbizid |
| JP45009643A JPS4833370B1 (de) | 1969-02-07 | 1970-02-05 | |
| FR7004214A FR2034017A5 (de) | 1969-02-07 | 1970-02-06 | |
| AT110970A AT298147B (de) | 1969-02-07 | 1970-02-06 | Herbizid |
| DK59170AA DK125907B (da) | 1969-02-07 | 1970-02-06 | Herbicid. |
| GB572670A GB1288162A (de) | 1969-02-07 | 1970-02-06 | |
| ES376357A ES376357A1 (es) | 1969-02-07 | 1970-02-07 | Procedimiento para la obtencion de una composicion herbici-da. |
| CS88270*#A CS157659B2 (de) | 1969-02-07 | 1970-02-09 | |
| OA53899A OA03637A (fr) | 1969-02-07 | 1970-04-15 | Nouveaux dérivés de S-alcoyl-(méthyl-hexahydro-1-h-azépine)-1-carbothiolates, leur procédé de préparation. |
| MY210/73A MY7300210A (en) | 1969-02-07 | 1973-12-30 | S.alkly-(methylhexahydro-ih-azepine)-1 carbothiolates |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE1906050A DE1906050C3 (de) | 1969-02-07 | 1969-02-07 | S-Alkyi-dnethyl-hexahydro-lHazepin)-1 -carbothiolate |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE1906050A1 DE1906050A1 (de) | 1970-08-20 |
| DE1906050B2 true DE1906050B2 (de) | 1978-04-27 |
| DE1906050C3 DE1906050C3 (de) | 1979-01-25 |
Family
ID=5724571
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE1906050A Expired DE1906050C3 (de) | 1969-02-07 | 1969-02-07 | S-Alkyi-dnethyl-hexahydro-lHazepin)-1 -carbothiolate |
Country Status (18)
| Country | Link |
|---|---|
| US (1) | US3708471A (de) |
| JP (1) | JPS4833370B1 (de) |
| AT (1) | AT298147B (de) |
| BE (1) | BE745468A (de) |
| BG (1) | BG17265A3 (de) |
| CH (1) | CH530161A (de) |
| CS (1) | CS157659B2 (de) |
| DE (1) | DE1906050C3 (de) |
| DK (1) | DK125907B (de) |
| ES (1) | ES376357A1 (de) |
| FR (1) | FR2034017A5 (de) |
| GB (1) | GB1288162A (de) |
| HU (1) | HU162713B (de) |
| IL (1) | IL33823A (de) |
| MY (1) | MY7300210A (de) |
| NL (1) | NL7001391A (de) |
| OA (1) | OA03637A (de) |
| SE (1) | SE353445B (de) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2330743A1 (de) * | 1973-06-16 | 1975-01-16 | Basf Ag | Herbizid |
| DE2632676A1 (de) * | 1976-07-16 | 1978-01-19 | Schering Ag | Trimethylperhydroazepin-1-thiocarbonsaeure-s-aethylester, verfahren zur herstellung dieser verbindungen sowie diese enthaltendes herbizides mittel |
| JPS5823602A (ja) * | 1981-08-04 | 1983-02-12 | Asahi Chem Ind Co Ltd | チオ−ルカ−バメ−ト系水田用除草剤組成物 |
-
1969
- 1969-02-07 DE DE1906050A patent/DE1906050C3/de not_active Expired
-
1970
- 1970-01-20 BG BG13782A patent/BG17265A3/xx unknown
- 1970-01-30 NL NL7001391A patent/NL7001391A/xx unknown
- 1970-01-30 HU HUBA2354A patent/HU162713B/hu unknown
- 1970-02-02 US US00008038A patent/US3708471A/en not_active Expired - Lifetime
- 1970-02-02 IL IL33823A patent/IL33823A/xx unknown
- 1970-02-03 SE SE01370/70A patent/SE353445B/xx unknown
- 1970-02-04 BE BE745468D patent/BE745468A/xx unknown
- 1970-02-05 CH CH168470A patent/CH530161A/de not_active IP Right Cessation
- 1970-02-05 JP JP45009643A patent/JPS4833370B1/ja active Pending
- 1970-02-06 DK DK59170AA patent/DK125907B/da unknown
- 1970-02-06 AT AT110970A patent/AT298147B/de not_active IP Right Cessation
- 1970-02-06 FR FR7004214A patent/FR2034017A5/fr not_active Expired
- 1970-02-06 GB GB572670A patent/GB1288162A/en not_active Expired
- 1970-02-07 ES ES376357A patent/ES376357A1/es not_active Expired
- 1970-02-09 CS CS88270*#A patent/CS157659B2/cs unknown
- 1970-04-15 OA OA53899A patent/OA03637A/xx unknown
-
1973
- 1973-12-30 MY MY210/73A patent/MY7300210A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| DE1906050C3 (de) | 1979-01-25 |
| BG17265A3 (de) | 1973-07-25 |
| CH530161A (de) | 1972-11-15 |
| MY7300210A (en) | 1973-12-31 |
| AT298147B (de) | 1972-04-25 |
| DE1906050A1 (de) | 1970-08-20 |
| HU162713B (de) | 1973-04-28 |
| GB1288162A (de) | 1972-09-06 |
| ES376357A1 (es) | 1972-03-16 |
| US3708471A (en) | 1973-01-02 |
| FR2034017A5 (de) | 1970-12-04 |
| SE353445B (de) | 1973-02-05 |
| BE745468A (fr) | 1970-08-04 |
| CS157659B2 (de) | 1974-09-16 |
| IL33823A0 (en) | 1970-04-20 |
| OA03637A (fr) | 1971-12-24 |
| NL7001391A (de) | 1970-08-11 |
| JPS4833370B1 (de) | 1973-10-13 |
| IL33823A (en) | 1972-12-29 |
| DK125907B (da) | 1973-05-21 |
| SU388380A3 (de) | 1973-06-22 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1793602C3 (de) | N-O-ChloM-bromphenyO-K-methyl-K-methoxy-harnstoff. Ausscheidung aus: 1542724 | |
| CH642620A5 (de) | Herbizide n-haloacetyl-2-alkyl-6-acylaniline. | |
| DE1906050C3 (de) | S-Alkyi-dnethyl-hexahydro-lHazepin)-1 -carbothiolate | |
| DE1667979B2 (de) | 1,3-benzodioxolcarbamate sowie verfahren zu deren herstellung und schaedlingsbekaempfungsmittel mit einem gehalt dieser verbindungen | |
| DE2019504C3 (de) | Oxim-N-acylcarbamate, Verfahren zu ihrer Herstellung und ihre Verwendung zur Schädlingsbekämpfung | |
| DE2557552C2 (de) | Diurethane und herbizide Mittel, enthaltend diese Verbindungen als Wirkstoffe | |
| DE2427270A1 (de) | Herbizide mittel | |
| DE1593551C3 (de) | N-substituierte O- eckige Klammer auf 3-Alkanoylaminophenyl eckige Klammer zu -carbamate und dieselben enthaltende Herbizide | |
| DE1116469B (de) | Selektive herbicide Mittel | |
| DE2512940C2 (de) | N-Benzoyl-N-halogenphenyl-2-aminopropionsäure-ester, Verfahren zu deren Herstellung und deren Verwendung | |
| DE1768296C3 (de) | Äthyl-N-cyclohexyl-N-propargylthiolcarbamat | |
| DE1278427B (de) | Verfahren zur Herstellung von Carbaminsaeureestern | |
| DE1770409A1 (de) | Chloralverbindungen | |
| DE2803662A1 (de) | Chloracetanilide, verfahren zur herstellung dieser verbindungen sowie diese enthaltende herbizide mittel | |
| DE1542702C (de) | Substituierte Säureanilide | |
| DE1468310C3 (de) | Selektive herbicide Mittel | |
| CH442862A (de) | Verfahren und Mittel zur Regelung des Pflanzenwachstums | |
| DE2712333A1 (de) | Dispirocyclopropancarbonsaeureester, verfahren zu ihrer herstellung und ihre verwendung zur schaedlingsbekaempfung | |
| DE2264983C3 (de) | N-4-Methyl-thiazolyl-(2)-cc- (2,4-dichlorphenoxy)propionsaureamid | |
| AT325892B (de) | Herbizid | |
| DD204023A5 (de) | Herbizide mittel | |
| DE2264982C3 (de) | N-4-Methyl-thiazolyl-(2H2-methyl-4-chlorphenoxy)-essigsaureamid | |
| DE2356158A1 (de) | Herbicide mittel und ihre verwendung | |
| DE2304789C3 (de) | Benzyliden-Semicarbazide, Verfahren zu deren Herstellung und diese enthaltende isektizide Mittel | |
| DE1642218C (de) | Substituierte Thiocarbamate und deren Verwendung |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) | ||
| 8330 | Complete renunciation |