DE1905598A1 - Verwendung von Harnstoffen als selektive Herbizide - Google Patents
Verwendung von Harnstoffen als selektive HerbizideInfo
- Publication number
- DE1905598A1 DE1905598A1 DE19691905598 DE1905598A DE1905598A1 DE 1905598 A1 DE1905598 A1 DE 1905598A1 DE 19691905598 DE19691905598 DE 19691905598 DE 1905598 A DE1905598 A DE 1905598A DE 1905598 A1 DE1905598 A1 DE 1905598A1
- Authority
- DE
- Germany
- Prior art keywords
- alkoxy
- formula
- radical
- compounds
- alkyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 150000003672 ureas Chemical class 0.000 title description 4
- 235000013877 carbamide Nutrition 0.000 title description 3
- 239000004009 herbicide Substances 0.000 title description 2
- 125000003545 alkoxy group Chemical group 0.000 claims description 28
- 125000000217 alkyl group Chemical group 0.000 claims description 28
- -1 alkyl radical Chemical class 0.000 claims description 27
- 239000000460 chlorine Substances 0.000 claims description 26
- 150000001875 compounds Chemical class 0.000 claims description 24
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 18
- 241000196324 Embryophyta Species 0.000 claims description 14
- 125000004414 alkyl thio group Chemical group 0.000 claims description 14
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical compound BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 14
- 229910052731 fluorine Inorganic materials 0.000 claims description 14
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 13
- 239000011737 fluorine Substances 0.000 claims description 13
- 125000001188 haloalkyl group Chemical group 0.000 claims description 12
- 125000004644 alkyl sulfinyl group Chemical group 0.000 claims description 11
- 125000004390 alkyl sulfonyl group Chemical group 0.000 claims description 11
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 claims description 10
- 229910052740 iodine Inorganic materials 0.000 claims description 10
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 10
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 9
- 229910052794 bromium Inorganic materials 0.000 claims description 8
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 7
- 229910052739 hydrogen Inorganic materials 0.000 claims description 7
- 239000001257 hydrogen Substances 0.000 claims description 7
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 7
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 claims description 6
- 235000013339 cereals Nutrition 0.000 claims description 6
- 229910052801 chlorine Inorganic materials 0.000 claims description 6
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 claims description 5
- 235000007164 Oryza sativa Nutrition 0.000 claims description 5
- 240000008042 Zea mays Species 0.000 claims description 5
- GRVDJDISBSALJP-UHFFFAOYSA-N methyloxidanyl Chemical compound [O]C GRVDJDISBSALJP-UHFFFAOYSA-N 0.000 claims description 5
- 235000009566 rice Nutrition 0.000 claims description 5
- 240000000111 Saccharum officinarum Species 0.000 claims description 4
- 235000007201 Saccharum officinarum Nutrition 0.000 claims description 4
- 235000016383 Zea mays subsp huehuetenangensis Nutrition 0.000 claims description 4
- 235000002017 Zea mays subsp mays Nutrition 0.000 claims description 4
- 235000009973 maize Nutrition 0.000 claims description 4
- WCYWZMWISLQXQU-UHFFFAOYSA-N methyl Chemical compound [CH3] WCYWZMWISLQXQU-UHFFFAOYSA-N 0.000 claims description 4
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 3
- 235000021374 legumes Nutrition 0.000 claims description 3
- 240000007594 Oryza sativa Species 0.000 claims 1
- 239000004480 active ingredient Substances 0.000 description 14
- 125000004432 carbon atom Chemical group C* 0.000 description 11
- 241000209140 Triticum Species 0.000 description 7
- 235000021307 Triticum Nutrition 0.000 description 7
- 241000209094 Oryza Species 0.000 description 6
- 230000000694 effects Effects 0.000 description 6
- 241000132025 Calendula Species 0.000 description 5
- 235000003880 Calendula Nutrition 0.000 description 5
- 241000209117 Panicum Species 0.000 description 5
- 235000006443 Panicum miliaceum subsp. miliaceum Nutrition 0.000 description 5
- 235000009037 Panicum miliaceum subsp. ruderale Nutrition 0.000 description 5
- 238000009331 sowing Methods 0.000 description 5
- AJBZENLMTKDAEK-UHFFFAOYSA-N 3a,5a,5b,8,8,11a-hexamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysene-4,9-diol Chemical compound CC12CCC(O)C(C)(C)C1CCC(C1(C)CC3O)(C)C2CCC1C1C3(C)CCC1C(=C)C AJBZENLMTKDAEK-UHFFFAOYSA-N 0.000 description 4
- 235000017896 Digitaria Nutrition 0.000 description 4
- 241001303487 Digitaria <clam> Species 0.000 description 4
- 241001101998 Galium Species 0.000 description 4
- 241000209219 Hordeum Species 0.000 description 4
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 4
- 241000209072 Sorghum Species 0.000 description 4
- 235000011684 Sorghum saccharatum Nutrition 0.000 description 4
- 239000013256 coordination polymer Substances 0.000 description 4
- 239000000839 emulsion Substances 0.000 description 4
- 238000000034 method Methods 0.000 description 4
- 241000743985 Alopecurus Species 0.000 description 3
- 241000723353 Chrysanthemum Species 0.000 description 3
- 235000007516 Chrysanthemum Nutrition 0.000 description 3
- 235000010469 Glycine max Nutrition 0.000 description 3
- 235000021506 Ipomoea Nutrition 0.000 description 3
- 241000207783 Ipomoea Species 0.000 description 3
- 241000208204 Linum Species 0.000 description 3
- 230000006378 damage Effects 0.000 description 3
- 238000011156 evaluation Methods 0.000 description 3
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 3
- 150000003254 radicals Chemical class 0.000 description 3
- 239000005995 Aluminium silicate Substances 0.000 description 2
- 244000075850 Avena orientalis Species 0.000 description 2
- 235000011331 Brassica Nutrition 0.000 description 2
- 241000219198 Brassica Species 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 2
- 244000068988 Glycine max Species 0.000 description 2
- 241000209510 Liliopsida Species 0.000 description 2
- 240000006694 Stellaria media Species 0.000 description 2
- 235000012211 aluminium silicate Nutrition 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 239000012141 concentrate Substances 0.000 description 2
- 239000000377 silicon dioxide Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- XVIRIXVOLLJIPF-UHFFFAOYSA-N 1-nitro-2-(2-nitrophenoxy)benzene Chemical class [O-][N+](=O)C1=CC=CC=C1OC1=CC=CC=C1[N+]([O-])=O XVIRIXVOLLJIPF-UHFFFAOYSA-N 0.000 description 1
- WNTGYJSOUMFZEP-UHFFFAOYSA-N 2-(4-chloro-2-methylphenoxy)propanoic acid Chemical compound OC(=O)C(C)OC1=CC=C(Cl)C=C1C WNTGYJSOUMFZEP-UHFFFAOYSA-N 0.000 description 1
- IIVWHGMLFGNMOW-UHFFFAOYSA-N 2-methylpropane Chemical compound C[C](C)C IIVWHGMLFGNMOW-UHFFFAOYSA-N 0.000 description 1
- UPMXNNIRAGDFEH-UHFFFAOYSA-N 3,5-dibromo-4-hydroxybenzonitrile Chemical compound OC1=C(Br)C=C(C#N)C=C1Br UPMXNNIRAGDFEH-UHFFFAOYSA-N 0.000 description 1
- ISAVYTVYFVQUDY-UHFFFAOYSA-N 4-tert-Octylphenol Chemical compound CC(C)(C)CC(C)(C)C1=CC=C(O)C=C1 ISAVYTVYFVQUDY-UHFFFAOYSA-N 0.000 description 1
- 241000219318 Amaranthus Species 0.000 description 1
- 235000017060 Arachis glabrata Nutrition 0.000 description 1
- 244000105624 Arachis hypogaea Species 0.000 description 1
- 235000010777 Arachis hypogaea Nutrition 0.000 description 1
- 235000018262 Arachis monticola Nutrition 0.000 description 1
- 235000005781 Avena Nutrition 0.000 description 1
- 235000007320 Avena fatua Nutrition 0.000 description 1
- 241000209764 Avena fatua Species 0.000 description 1
- 235000007319 Avena orientalis Nutrition 0.000 description 1
- 229910001369 Brass Inorganic materials 0.000 description 1
- 239000005489 Bromoxynil Substances 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- 241000209210 Dactylis Species 0.000 description 1
- 241000208175 Daucus Species 0.000 description 1
- 239000005533 Fluometuron Substances 0.000 description 1
- 241000219823 Medicago Species 0.000 description 1
- CCGPUGMWYLICGL-UHFFFAOYSA-N Neburon Chemical compound CCCCN(C)C(=O)NC1=CC=C(Cl)C(Cl)=C1 CCGPUGMWYLICGL-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 241000219833 Phaseolus Species 0.000 description 1
- 241000209048 Poa Species 0.000 description 1
- 241000209149 Zea Species 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 230000000274 adsorptive effect Effects 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 239000010951 brass Substances 0.000 description 1
- OOCMUZJPDXYRFD-UHFFFAOYSA-L calcium;2-dodecylbenzenesulfonate Chemical compound [Ca+2].CCCCCCCCCCCCC1=CC=CC=C1S([O-])(=O)=O.CCCCCCCCCCCCC1=CC=CC=C1S([O-])(=O)=O OOCMUZJPDXYRFD-UHFFFAOYSA-L 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 239000004927 clay Substances 0.000 description 1
- 125000004983 dialkoxyalkyl group Chemical group 0.000 description 1
- 238000007865 diluting Methods 0.000 description 1
- 235000021186 dishes Nutrition 0.000 description 1
- 238000010410 dusting Methods 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- RZILCCPWPBTYDO-UHFFFAOYSA-N fluometuron Chemical compound CN(C)C(=O)NC1=CC=CC(C(F)(F)F)=C1 RZILCCPWPBTYDO-UHFFFAOYSA-N 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 239000012948 isocyanate Substances 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- DSRNRYQBBJQVCW-UHFFFAOYSA-N metoxuron Chemical compound COC1=CC=C(NC(=O)N(C)C)C=C1Cl DSRNRYQBBJQVCW-UHFFFAOYSA-N 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- VTWKXBJHBHYJBI-UHFFFAOYSA-N n-benzylidenehydroxylamine Chemical compound ON=CC1=CC=CC=C1 VTWKXBJHBHYJBI-UHFFFAOYSA-N 0.000 description 1
- 125000004370 n-butenyl group Chemical group [H]\C([H])=C(/[H])C([H])([H])C([H])([H])* 0.000 description 1
- 235000020232 peanut Nutrition 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 230000009528 severe injury Effects 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- 150000003918 triazines Chemical class 0.000 description 1
- 244000045561 useful plants Species 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
- 239000004563 wettable powder Substances 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N47/00—Biocides, pest repellants or attractants, or plant growth regulators containing organic compounds containing a carbon atom not being member of a ring and having no bond to a carbon or hydrogen atom, e.g. derivatives of carbonic acid
- A01N47/08—Biocides, pest repellants or attractants, or plant growth regulators containing organic compounds containing a carbon atom not being member of a ring and having no bond to a carbon or hydrogen atom, e.g. derivatives of carbonic acid the carbon atom having one or more single bonds to nitrogen atoms
- A01N47/28—Ureas or thioureas containing the groups >N—CO—N< or >N—CS—N<
- A01N47/30—Derivatives containing the group >N—CO—N aryl or >N—CS—N—aryl
Landscapes
- Life Sciences & Earth Sciences (AREA)
- Agronomy & Crop Science (AREA)
- Pest Control & Pesticides (AREA)
- Plant Pathology (AREA)
- Health & Medical Sciences (AREA)
- Engineering & Computer Science (AREA)
- Dentistry (AREA)
- General Health & Medical Sciences (AREA)
- Wood Science & Technology (AREA)
- Zoology (AREA)
- Environmental Sciences (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH210168A CH491600A (de) | 1968-02-13 | 1968-02-13 | Verwendung von Phenylharnstoffen als selektive Herbizide |
| CH1036468A CH507647A (de) | 1968-07-11 | 1968-07-11 | Selektives Herbizid |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1905598A1 true DE1905598A1 (de) | 1969-09-18 |
Family
ID=25689519
Family Applications (3)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19691905598 Pending DE1905598A1 (de) | 1968-02-13 | 1969-02-05 | Verwendung von Harnstoffen als selektive Herbizide |
| DE1966298A Expired DE1966298C3 (de) | 1968-02-13 | 1969-02-05 | Verwendung von l-(3-Chlor-4-methylphenyl)-33-dimethylhamstofi in Weizen und Gerste |
| DE1905599A Expired DE1905599C2 (de) | 1968-02-13 | 1969-02-05 | Verwendung von Harnstoffen als selektive Herbizide |
Family Applications After (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE1966298A Expired DE1966298C3 (de) | 1968-02-13 | 1969-02-05 | Verwendung von l-(3-Chlor-4-methylphenyl)-33-dimethylhamstofi in Weizen und Gerste |
| DE1905599A Expired DE1905599C2 (de) | 1968-02-13 | 1969-02-05 | Verwendung von Harnstoffen als selektive Herbizide |
Country Status (12)
| Country | Link |
|---|---|
| JP (1) | JPS556603B1 (https=) |
| BE (1) | BE728267A (https=) |
| CA (1) | CA926145A (https=) |
| DE (3) | DE1905598A1 (https=) |
| DK (1) | DK127364C (https=) |
| FR (2) | FR2001791A1 (https=) |
| GB (3) | GB1255258A (https=) |
| IE (1) | IE33347B1 (https=) |
| IL (3) | IL31574A0 (https=) |
| NL (1) | NL157192B (https=) |
| RO (1) | RO54743A (https=) |
| SE (1) | SE372407B (https=) |
Cited By (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2086501A1 (en) * | 1970-04-30 | 1971-12-31 | Ciba Geigy Ag | Herbicidal dihalophenyl-ureas |
| DE2329401A1 (de) * | 1972-06-09 | 1973-12-20 | Ciba Geigy Ag | Herbizide mischung |
| DE2440787A1 (de) * | 1973-08-31 | 1975-03-06 | Itt Ind Gmbh Deutsche | Verfahren zur selektiven bekaempfung von unkraut in kentucky-blaugras |
| DE2947073A1 (de) * | 1978-12-21 | 1980-06-04 | Lilly Industries Ltd | Herbizides mittel |
| EP2052609A1 (de) | 2007-10-24 | 2009-04-29 | Bayer CropScience AG | Herbizid-Kombination |
| DE102008037621A1 (de) | 2008-08-14 | 2010-02-18 | Bayer Cropscience Ag | Herbizid-Kombination mit Dimethoxytriazinyl-substituierten Difluormethansulfonylaniliden |
Families Citing this family (17)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| IL36218A0 (en) * | 1970-02-27 | 1971-04-28 | Ciba Geigy Ag | 4-isopropylphenylureas,their manufacture and use in combating pests |
| FR2104706B1 (https=) * | 1970-08-06 | 1974-03-22 | Pepro | |
| DE2039041C2 (https=) * | 1970-08-06 | 1991-08-01 | Hoechst Ag, 6230 Frankfurt, De | |
| FR2125240A1 (en) * | 1971-02-19 | 1972-09-29 | Pepro | N-(4-isopropylphenyl)-n'-methylurea - as selective herbicide |
| FR2126154A1 (en) * | 1971-02-25 | 1972-10-06 | Pepro | N-4-isopropylphenyl-n'-isoropyl-n'-methylurea - - a selective herbicide in cereal,carrot and groundnut crops |
| FR2128186A1 (en) * | 1971-03-03 | 1972-10-20 | Pepro | Herbicidal compsns contg n-(4-isopropyl phenyl)-n'-methyl - n'-allyl urea - for treatment of wheat barley rice and peas |
| FR2180619B1 (https=) * | 1972-04-21 | 1975-06-13 | Pepro | |
| US4295877A (en) * | 1977-06-24 | 1981-10-20 | Philagro | Selective herbicidal method in cotton and soybeans |
| DE2739349C3 (de) * | 1977-09-01 | 1980-03-13 | Basf Ag, 6700 Ludwigshafen | N-O-Alkyl-phenyD-N'-methyl-N·methoxyharnstoffe und diese enthaltende Herbizide |
| FR2435464A1 (fr) * | 1978-07-25 | 1980-04-04 | Rhone Poulenc Agrochimie | Nouvelle phenyluree substituee herbicide |
| FR2449672A1 (fr) * | 1979-02-26 | 1980-09-19 | Rhone Poulenc Agrochimie | Trifluoromethyl-3 ethyl-4 aniline |
| CA1201725A (en) * | 1979-12-06 | 1986-03-11 | Terence Gilkerson | Urea derivative, process for its preparation, herbicidal compositions containing it, and method of combating weeds using it |
| JPS61166972U (https=) * | 1985-04-04 | 1986-10-16 | ||
| DE3800269A1 (de) * | 1988-01-08 | 1989-07-20 | Bayer Ag | Difluorphenylharnstoffe |
| DE3942462A1 (de) * | 1989-12-22 | 1991-06-27 | Bayer Ag | Difluorphenylharnstoffe |
| FR2820136A1 (fr) * | 2001-01-26 | 2002-08-02 | Aventis Pharma Sa | Nouveaux derives de l'uree, leur procede de preparation, leur application a titre de medicaments, compositions pharmaceutiques et nouvelle utilisation |
| FR2885129B1 (fr) | 2005-04-29 | 2007-06-15 | Proskelia Sas | Nouveaux derives de l'ureee substituee parun thiazole ou benzothiazole, leur procede de preparation, leur application a titre de medicaments, les compositions pharmaceutiques les renfermant et utilisation. |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2655445A (en) * | 1949-12-06 | 1953-10-13 | Du Pont | 3-(halophenyl)-1-methyl-1-(methyl or ethyl) ureas and herbicidal compositions and methods employing same |
| NL236579A (https=) * | 1958-02-01 | |||
| US3228762A (en) * | 1960-10-03 | 1966-01-11 | Du Pont | Method of killing weeds |
| US3288586A (en) * | 1963-11-07 | 1966-11-29 | Du Pont | Herbicidal methods employing an addition compound of 3-(3, 4-dichlorophenyl)-1-methyl-1-methoxyurea and dodecylbenzenesulfonic acid |
| US3326663A (en) * | 1964-09-25 | 1967-06-20 | Shell Oil Co | Herbicidal phenylureas |
| DE1276400B (de) * | 1964-11-07 | 1968-08-29 | Basf Ag | Selektives Herbizid |
| DE1542688A1 (de) * | 1965-06-12 | 1970-07-02 | Basf Ag | Herbizide Mittel |
-
1968
- 1968-02-07 IL IL31574A patent/IL31574A0/xx unknown
-
1969
- 1969-02-05 DE DE19691905598 patent/DE1905598A1/de active Pending
- 1969-02-05 DE DE1966298A patent/DE1966298C3/de not_active Expired
- 1969-02-05 DE DE1905599A patent/DE1905599C2/de not_active Expired
- 1969-02-07 IL IL31573A patent/IL31573A/xx unknown
- 1969-02-10 IE IE167/69A patent/IE33347B1/xx unknown
- 1969-02-10 SE SE6901767A patent/SE372407B/xx unknown
- 1969-02-12 NL NL6902214.A patent/NL157192B/xx not_active IP Right Cessation
- 1969-02-12 FR FR6903235A patent/FR2001791A1/fr active Pending
- 1969-02-12 FR FR6903236A patent/FR2001792A1/fr active Pending
- 1969-02-12 BE BE728267D patent/BE728267A/xx not_active IP Right Cessation
- 1969-02-12 DK DK76169A patent/DK127364C/da not_active IP Right Cessation
- 1969-02-13 JP JP1012169A patent/JPS556603B1/ja active Pending
- 1969-02-13 GB GB7903/69A patent/GB1255258A/en not_active Expired
- 1969-02-13 GB GB15778/71A patent/GB1260460A/en not_active Expired
- 1969-02-13 GB GB1253143D patent/GB1253143A/en not_active Expired
- 1969-02-13 RO RO59072A patent/RO54743A/ro unknown
- 1969-11-07 IL IL31574A patent/IL31574A/xx unknown
-
1972
- 1972-05-02 CA CA141058A patent/CA926145A/en not_active Expired
Cited By (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2086501A1 (en) * | 1970-04-30 | 1971-12-31 | Ciba Geigy Ag | Herbicidal dihalophenyl-ureas |
| DE2329401A1 (de) * | 1972-06-09 | 1973-12-20 | Ciba Geigy Ag | Herbizide mischung |
| FR2187220A1 (https=) * | 1972-06-09 | 1974-01-18 | Ciba Geigy Ag | |
| DE2440787A1 (de) * | 1973-08-31 | 1975-03-06 | Itt Ind Gmbh Deutsche | Verfahren zur selektiven bekaempfung von unkraut in kentucky-blaugras |
| DE2947073A1 (de) * | 1978-12-21 | 1980-06-04 | Lilly Industries Ltd | Herbizides mittel |
| EP2052609A1 (de) | 2007-10-24 | 2009-04-29 | Bayer CropScience AG | Herbizid-Kombination |
| DE102008037621A1 (de) | 2008-08-14 | 2010-02-18 | Bayer Cropscience Ag | Herbizid-Kombination mit Dimethoxytriazinyl-substituierten Difluormethansulfonylaniliden |
Also Published As
| Publication number | Publication date |
|---|---|
| CA926145A (en) | 1973-05-15 |
| IE33347L (en) | 1969-08-13 |
| DE1905599C2 (de) | 1986-02-27 |
| GB1260460A (en) | 1972-01-19 |
| NL157192B (nl) | 1978-07-17 |
| FR2001792A1 (https=) | 1969-10-03 |
| DK127364B (da) | 1973-10-29 |
| DE1966298B2 (de) | 1973-10-31 |
| NL6902214A (https=) | 1969-08-15 |
| DE1966298C3 (de) | 1978-06-01 |
| IE33347B1 (en) | 1974-05-29 |
| JPS556603B1 (https=) | 1980-02-18 |
| DE1966298A1 (de) | 1972-02-03 |
| IL31574A (en) | 1973-03-30 |
| BE728267A (https=) | 1969-08-12 |
| DE1905599A1 (de) | 1970-08-13 |
| GB1255258A (en) | 1971-12-01 |
| FR2001791A1 (https=) | 1969-10-03 |
| SE372407B (https=) | 1974-12-23 |
| IL31574A0 (en) | 1969-04-30 |
| IL31573A (en) | 1973-03-30 |
| DK127364C (da) | 1982-12-06 |
| GB1253143A (https=) | 1971-11-10 |
| RO54743A (https=) | 1973-02-17 |
| IL31573A0 (en) | 1969-04-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1905598A1 (de) | Verwendung von Harnstoffen als selektive Herbizide | |
| DE60012188T2 (de) | Fungizide | |
| DE2423536A1 (de) | 3-amino-phenylessigsaeure-derivate, verfahren zu ihrer herstellung sowie ihre verwendung als herbizide | |
| DE1918112C3 (de) | N-(3-Chlor-4-äthoxyphenyi)-N'-methyI-N'-methoxyharnstoff, Verfahren zu seiner Herstellung sowie diesen enthaltende herbizide Mittel | |
| DE1901501C3 (de) | m- Trifluormethylphenylharnstoffe und diese enthaltende herbizide Mittel | |
| EP0103537B1 (de) | N-Arylsulfonyl-N'-triazolylharnstoffe | |
| DE2822155A1 (de) | Substituierte carbonsaeureamide, verfahren zu ihrer herstellung und ihre verwendung als herbizide | |
| EP0061110A1 (de) | Neue Nitroaniline | |
| DE2108975B2 (de) | N-Acyl-Diurethane sowie diese enthaltendes herbizides Mittel | |
| EP0010163B1 (de) | N-Diazolylalkyl-chloracetanilide, Verfahren zu ihrer Herstellung sowie ihre Verwendung als Herbizide | |
| DE2831770A1 (de) | Neue ungesaettigte lactame | |
| EP0139182A2 (de) | Herbizide Mittel enthaltend Photosynthesehemmer-Herbizide in Kombination mit 1,4-disubstituierten Pyrazol-Derivaten | |
| EP0035972A2 (de) | Cyanoalkyl-Phenylharnstoffe mit selektiver herbizider Wirkung, deren Herstellung und sie enthaltende Mittel | |
| DE2725146A1 (de) | Diurethane und herbizide | |
| DE3419127A1 (de) | 1-heteroaryl-4-aryl-pyrazolin-5-one | |
| DE2210540A1 (de) | Cyanphenylcarbonate | |
| DE2310648C3 (de) | Diurethane, Verfahren zur Herstellung dieser Verbindungen sowie diese enthaltende selektive herbizide Mittel | |
| DE2028778A1 (en) | Thiadiazolyl-urea herbicides - 5 - substd by sulphinyl or sulphonyl | |
| DE2320362A1 (de) | Dichlorthiazolylharnstoffe, verfahren zu ihrer herstellung sowie ihre verwendung als herbizide | |
| CH634721A5 (de) | Benzothiadiazinverbindungen enthaltende herbizide. | |
| EP0016731B1 (de) | Meta-Cyanoalkoxy-Phenylharnstoffe mit herbizider Wirkung, deren Herstellung und sie enthaltende Mittel | |
| EP0035638A2 (de) | Halogenalkylamide, Verfahren zu deren Herstellung und deren Verwendung als Gegenmittel zum Schutz von Kulturpflanzen vor Schädigungen durch Herbizide | |
| DE1913043C3 (de) | Substituierte Phenylcarbamate | |
| AT363716B (de) | Herbizides mittel | |
| DE1929130C (de) | 1,2 Dithia 3 phenyhmino 4 chlor cyclopentene |