DE1809386A1 - Verfahren zur Herstellung von 1,5-disubstituierten 4-Cyanopyrazolen - Google Patents
Verfahren zur Herstellung von 1,5-disubstituierten 4-CyanopyrazolenInfo
- Publication number
- DE1809386A1 DE1809386A1 DE19681809386 DE1809386A DE1809386A1 DE 1809386 A1 DE1809386 A1 DE 1809386A1 DE 19681809386 DE19681809386 DE 19681809386 DE 1809386 A DE1809386 A DE 1809386A DE 1809386 A1 DE1809386 A1 DE 1809386A1
- Authority
- DE
- Germany
- Prior art keywords
- alcohol
- acid
- radical
- hydrazine
- carboxylic acids
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- -1 1,5-disubstituted 4-cyanopyrazoles Chemical class 0.000 title claims description 39
- 238000000034 method Methods 0.000 title claims description 14
- 238000002360 preparation method Methods 0.000 title claims description 8
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 claims description 55
- 238000006243 chemical reaction Methods 0.000 claims description 16
- 150000001735 carboxylic acids Chemical class 0.000 claims description 11
- 125000003545 alkoxy group Chemical group 0.000 claims description 6
- 239000002253 acid Substances 0.000 claims description 5
- 125000004432 carbon atom Chemical group C* 0.000 claims description 5
- 150000003254 radicals Chemical class 0.000 claims description 5
- NUGZBVBZIDWZAD-UHFFFAOYSA-N 1h-pyrazole-4-carbonitrile Chemical class N#CC=1C=NNC=1 NUGZBVBZIDWZAD-UHFFFAOYSA-N 0.000 claims description 3
- 150000007513 acids Chemical class 0.000 claims description 3
- 125000003282 alkyl amino group Chemical group 0.000 claims description 3
- 125000003107 substituted aryl group Chemical group 0.000 claims description 3
- 125000001931 aliphatic group Chemical group 0.000 claims description 2
- 125000001769 aryl amino group Chemical group 0.000 claims description 2
- 239000012442 inert solvent Substances 0.000 claims description 2
- 125000001183 hydrocarbyl group Chemical group 0.000 claims 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 31
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 22
- 229960000583 acetic acid Drugs 0.000 description 19
- 239000000203 mixture Substances 0.000 description 18
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 15
- 239000013078 crystal Substances 0.000 description 14
- OAKJQQAXSVQMHS-UHFFFAOYSA-N hydrazine Substances NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 14
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 12
- 239000002904 solvent Substances 0.000 description 11
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 10
- 239000000047 product Substances 0.000 description 10
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 9
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 9
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 9
- HDZGCSFEDULWCS-UHFFFAOYSA-N monomethylhydrazine Chemical compound CNN HDZGCSFEDULWCS-UHFFFAOYSA-N 0.000 description 9
- 241000233866 Fungi Species 0.000 description 7
- 238000001953 recrystallisation Methods 0.000 description 7
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 6
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 6
- 239000002609 medium Substances 0.000 description 6
- 239000004480 active ingredient Substances 0.000 description 5
- 150000002084 enol ethers Chemical class 0.000 description 5
- 239000012362 glacial acetic acid Substances 0.000 description 5
- 239000003921 oil Substances 0.000 description 5
- 239000002002 slurry Substances 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Chemical compound CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 4
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 4
- 230000002464 fungitoxic effect Effects 0.000 description 4
- 150000002429 hydrazines Chemical class 0.000 description 4
- 238000002844 melting Methods 0.000 description 4
- 230000008018 melting Effects 0.000 description 4
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 4
- 150000002825 nitriles Chemical class 0.000 description 4
- 239000007787 solid Substances 0.000 description 4
- 239000007858 starting material Substances 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- HYAWDLBJWKHMET-UHFFFAOYSA-N 2-benzoyl-3-ethoxyprop-2-enenitrile Chemical compound CCOC=C(C#N)C(=O)C1=CC=CC=C1 HYAWDLBJWKHMET-UHFFFAOYSA-N 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- WTKZEGDFNFYCGP-UHFFFAOYSA-N Pyrazole Chemical compound C=1C=NNC=1 WTKZEGDFNFYCGP-UHFFFAOYSA-N 0.000 description 3
- 230000001476 alcoholic effect Effects 0.000 description 3
- 125000000217 alkyl group Chemical group 0.000 description 3
- 239000003795 chemical substances by application Substances 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 150000002081 enamines Chemical class 0.000 description 3
- 238000001704 evaporation Methods 0.000 description 3
- 230000008020 evaporation Effects 0.000 description 3
- 231100000162 fungitoxic Toxicity 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 239000000155 melt Substances 0.000 description 3
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- 235000015097 nutrients Nutrition 0.000 description 3
- 239000003208 petroleum Substances 0.000 description 3
- 235000019260 propionic acid Nutrition 0.000 description 3
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 3
- 239000011877 solvent mixture Substances 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 2
- NOWGUHWINCHCMC-UHFFFAOYSA-N 1,5-diphenylpyrazole-4-carbonitrile Chemical compound N#CC=1C=NN(C=2C=CC=CC=2)C=1C1=CC=CC=C1 NOWGUHWINCHCMC-UHFFFAOYSA-N 0.000 description 2
- UJVDTYCBOCTZBK-UHFFFAOYSA-N 2-(4-chlorobenzoyl)-3-ethoxyprop-2-enenitrile Chemical compound CCOC=C(C#N)C(=O)C1=CC=C(Cl)C=C1 UJVDTYCBOCTZBK-UHFFFAOYSA-N 0.000 description 2
- VIHRIIARIFUQLC-UHFFFAOYSA-N 3-hydrazinylpropanenitrile Chemical compound NNCCC#N VIHRIIARIFUQLC-UHFFFAOYSA-N 0.000 description 2
- 229920001817 Agar Polymers 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 2
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 2
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 101150046432 Tril gene Proteins 0.000 description 2
- 235000010419 agar Nutrition 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- ZJRCIQAMTAINCB-UHFFFAOYSA-N benzoylacetonitrile Chemical compound N#CCC(=O)C1=CC=CC=C1 ZJRCIQAMTAINCB-UHFFFAOYSA-N 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 239000012043 crude product Substances 0.000 description 2
- 125000004093 cyano group Chemical group *C#N 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 238000011156 evaluation Methods 0.000 description 2
- 125000002541 furyl group Chemical group 0.000 description 2
- 239000001963 growth medium Substances 0.000 description 2
- 229910052736 halogen Inorganic materials 0.000 description 2
- 150000002367 halogens Chemical class 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- FUZZWVXGSFPDMH-UHFFFAOYSA-N hexanoic acid Chemical compound CCCCCC(O)=O FUZZWVXGSFPDMH-UHFFFAOYSA-N 0.000 description 2
- 229910052500 inorganic mineral Inorganic materials 0.000 description 2
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 2
- 239000011707 mineral Substances 0.000 description 2
- 235000010755 mineral Nutrition 0.000 description 2
- 230000017066 negative regulation of growth Effects 0.000 description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 2
- 239000012074 organic phase Substances 0.000 description 2
- 235000006408 oxalic acid Nutrition 0.000 description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 2
- HKOOXMFOFWEVGF-UHFFFAOYSA-N phenylhydrazine Chemical compound NNC1=CC=CC=C1 HKOOXMFOFWEVGF-UHFFFAOYSA-N 0.000 description 2
- 229940067157 phenylhydrazine Drugs 0.000 description 2
- 230000003032 phytopathogenic effect Effects 0.000 description 2
- 150000003217 pyrazoles Chemical class 0.000 description 2
- 239000001632 sodium acetate Substances 0.000 description 2
- 235000017281 sodium acetate Nutrition 0.000 description 2
- 125000005420 sulfonamido group Chemical group S(=O)(=O)(N*)* 0.000 description 2
- 238000005292 vacuum distillation Methods 0.000 description 2
- NQPDZGIKBAWPEJ-UHFFFAOYSA-N valeric acid Chemical compound CCCCC(O)=O NQPDZGIKBAWPEJ-UHFFFAOYSA-N 0.000 description 2
- 229940005605 valeric acid Drugs 0.000 description 2
- 239000003039 volatile agent Substances 0.000 description 2
- 238000010626 work up procedure Methods 0.000 description 2
- 239000008096 xylene Substances 0.000 description 2
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 2
- NWZSZGALRFJKBT-KNIFDHDWSA-N (2s)-2,6-diaminohexanoic acid;(2s)-2-hydroxybutanedioic acid Chemical class OC(=O)[C@@H](O)CC(O)=O.NCCCC[C@H](N)C(O)=O NWZSZGALRFJKBT-KNIFDHDWSA-N 0.000 description 1
- JFILLLZWNHOVHV-UHFFFAOYSA-N (3-nitrophenyl)hydrazine Chemical compound NNC1=CC=CC([N+]([O-])=O)=C1 JFILLLZWNHOVHV-UHFFFAOYSA-N 0.000 description 1
- XAMBIJWZVIZZOG-UHFFFAOYSA-N (4-methylphenyl)hydrazine Chemical compound CC1=CC=C(NN)C=C1 XAMBIJWZVIZZOG-UHFFFAOYSA-N 0.000 description 1
- TVWDRSJRFMTIPQ-UHFFFAOYSA-N 1-(4-chlorophenyl)butane-1,3-dione Chemical compound CC(=O)CC(=O)C1=CC=C(Cl)C=C1 TVWDRSJRFMTIPQ-UHFFFAOYSA-N 0.000 description 1
- JHZLNSXXZZKSMK-UHFFFAOYSA-N 1-methyl-5-phenylpyrazole-4-carbonitrile Chemical compound CN1N=CC(=C1C1=CC=CC=C1)C#N JHZLNSXXZZKSMK-UHFFFAOYSA-N 0.000 description 1
- JVVRJMXHNUAPHW-UHFFFAOYSA-N 1h-pyrazol-5-amine Chemical compound NC=1C=CNN=1 JVVRJMXHNUAPHW-UHFFFAOYSA-N 0.000 description 1
- HORQAOAYAYGIBM-UHFFFAOYSA-N 2,4-dinitrophenylhydrazine Chemical compound NNC1=CC=C([N+]([O-])=O)C=C1[N+]([O-])=O HORQAOAYAYGIBM-UHFFFAOYSA-N 0.000 description 1
- RNHKXHKUKJXLAU-UHFFFAOYSA-N 2-(4-methylphenyl)acetonitrile Chemical compound CC1=CC=C(CC#N)C=C1 RNHKXHKUKJXLAU-UHFFFAOYSA-N 0.000 description 1
- JRMAQQQTXDJDNC-UHFFFAOYSA-N 2-ethoxy-2-oxoacetic acid Chemical compound CCOC(=O)C(O)=O JRMAQQQTXDJDNC-UHFFFAOYSA-N 0.000 description 1
- 125000002941 2-furyl group Chemical group O1C([*])=C([H])C([H])=C1[H] 0.000 description 1
- IBELBRDFPCFICX-UHFFFAOYSA-N 2-methoxyethylhydrazine Chemical compound COCCNN IBELBRDFPCFICX-UHFFFAOYSA-N 0.000 description 1
- HSNWUXWZCSDJPL-UHFFFAOYSA-N 3-(4-bromophenyl)-3-oxopropanenitrile Chemical compound BrC1=CC=C(C(=O)CC#N)C=C1 HSNWUXWZCSDJPL-UHFFFAOYSA-N 0.000 description 1
- JYOUFPNYTOFCSJ-UHFFFAOYSA-N 3-(4-chlorophenyl)-3-oxopropanenitrile Chemical compound ClC1=CC=C(C(=O)CC#N)C=C1 JYOUFPNYTOFCSJ-UHFFFAOYSA-N 0.000 description 1
- LOJBBLDAJBJVBZ-UHFFFAOYSA-N 3-(4-fluorophenyl)-3-oxopropanenitrile Chemical compound FC1=CC=C(C(=O)CC#N)C=C1 LOJBBLDAJBJVBZ-UHFFFAOYSA-N 0.000 description 1
- DXYPCBNFJFSXFY-UHFFFAOYSA-N 3-(4-nitrophenyl)-3-oxopropanenitrile Chemical compound [O-][N+](=O)C1=CC=C(C(=O)CC#N)C=C1 DXYPCBNFJFSXFY-UHFFFAOYSA-N 0.000 description 1
- RZNSHBXVTAHWPP-UHFFFAOYSA-N 3-(furan-2-yl)-3-oxopropanenitrile Chemical compound N#CCC(=O)C1=CC=CO1 RZNSHBXVTAHWPP-UHFFFAOYSA-N 0.000 description 1
- KYDQQHGITCDRQV-UHFFFAOYSA-N 3-anilino-2-benzoylprop-2-enenitrile Chemical compound C=1C=CC=CC=1C(=O)C(C#N)=CNC1=CC=CC=C1 KYDQQHGITCDRQV-UHFFFAOYSA-N 0.000 description 1
- DBRMLHRCVYDCRF-UHFFFAOYSA-N 3-ethoxy-2-(4-methoxybenzoyl)prop-2-enenitrile Chemical compound C(C)OC=C(C#N)C(C1=CC=C(C=C1)OC)=O DBRMLHRCVYDCRF-UHFFFAOYSA-N 0.000 description 1
- PPBAZOANEQPCKG-UHFFFAOYSA-N 3-oxo-3-pyridin-4-ylpropanenitrile Chemical compound N#CCC(=O)C1=CC=NC=C1 PPBAZOANEQPCKG-UHFFFAOYSA-N 0.000 description 1
- XWWUQBHVRILEPB-UHFFFAOYSA-N 3-oxo-3-thiophen-2-ylpropanenitrile Chemical group N#CCC(=O)C1=CC=CS1 XWWUQBHVRILEPB-UHFFFAOYSA-N 0.000 description 1
- XXNOGQJZAOXWAQ-UHFFFAOYSA-N 4-chlorophenylhydrazine Chemical compound NNC1=CC=C(Cl)C=C1 XXNOGQJZAOXWAQ-UHFFFAOYSA-N 0.000 description 1
- DZUUSHCOMPROCJ-UHFFFAOYSA-N 4-hydrazinylbenzonitrile Chemical compound NNC1=CC=C(C#N)C=C1 DZUUSHCOMPROCJ-UHFFFAOYSA-N 0.000 description 1
- CJYPDGRCXRPJLB-UHFFFAOYSA-N 5-phenyl-1h-pyrazole-4-carbonitrile Chemical compound N#CC1=CNN=C1C1=CC=CC=C1 CJYPDGRCXRPJLB-UHFFFAOYSA-N 0.000 description 1
- KNIUHBNRWZGIQQ-UHFFFAOYSA-N 7-diethoxyphosphinothioyloxy-4-methylchromen-2-one Chemical compound CC1=CC(=O)OC2=CC(OP(=S)(OCC)OCC)=CC=C21 KNIUHBNRWZGIQQ-UHFFFAOYSA-N 0.000 description 1
- 241000235349 Ascomycota Species 0.000 description 1
- 241000221198 Basidiomycota Species 0.000 description 1
- 241000123650 Botrytis cinerea Species 0.000 description 1
- 241001155433 Centrarchus macropterus Species 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- YCKRFDGAMUMZLT-UHFFFAOYSA-N Fluorine atom Chemical compound [F] YCKRFDGAMUMZLT-UHFFFAOYSA-N 0.000 description 1
- 241000206672 Gelidium Species 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
- 241000308483 Phialophora cinerescens Species 0.000 description 1
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 1
- 241000184297 Pseudocercospora musae Species 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- 241001617088 Thanatephorus sasakii Species 0.000 description 1
- 241001123669 Verticillium albo-atrum Species 0.000 description 1
- SIILNUCRHAEFQZ-UHFFFAOYSA-N [4-chloro-2-(trifluoromethyl)phenyl]hydrazine Chemical compound NNC1=CC=C(Cl)C=C1C(F)(F)F SIILNUCRHAEFQZ-UHFFFAOYSA-N 0.000 description 1
- 239000008272 agar Substances 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 125000003342 alkenyl group Chemical group 0.000 description 1
- 125000002490 anilino group Chemical group [H]N(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 230000000845 anti-microbial effect Effects 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 150000005840 aryl radicals Chemical class 0.000 description 1
- CUBCNYWQJHBXIY-UHFFFAOYSA-N benzoic acid;2-hydroxybenzoic acid Chemical compound OC(=O)C1=CC=CC=C1.OC(=O)C1=CC=CC=C1O CUBCNYWQJHBXIY-UHFFFAOYSA-N 0.000 description 1
- 150000001559 benzoic acids Chemical class 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- NHOWLEZFTHYCTP-UHFFFAOYSA-N benzylhydrazine Chemical compound NNCC1=CC=CC=C1 NHOWLEZFTHYCTP-UHFFFAOYSA-N 0.000 description 1
- 125000004799 bromophenyl group Chemical group 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical class OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 description 1
- 150000001733 carboxylic acid esters Chemical class 0.000 description 1
- 150000001734 carboxylic acid salts Chemical class 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 241001233037 catfish Species 0.000 description 1
- 239000003610 charcoal Substances 0.000 description 1
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 239000012230 colorless oil Substances 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- KQFYFHDJWYCPDS-UHFFFAOYSA-N cyclohexen-1-ylhydrazine Chemical compound NNC1=CCCCC1 KQFYFHDJWYCPDS-UHFFFAOYSA-N 0.000 description 1
- LHQRDAIAWDPZGH-UHFFFAOYSA-N cyclohexylhydrazine Chemical compound NNC1CCCCC1 LHQRDAIAWDPZGH-UHFFFAOYSA-N 0.000 description 1
- NXHFZUVHADJHDW-UHFFFAOYSA-N cyclopentylhydrazine Chemical compound NNC1CCCC1 NXHFZUVHADJHDW-UHFFFAOYSA-N 0.000 description 1
- 238000006114 decarboxylation reaction Methods 0.000 description 1
- 150000001991 dicarboxylic acids Chemical class 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 239000012153 distilled water Substances 0.000 description 1
- OKMQERWDFNIGLL-UHFFFAOYSA-N dodecylhydrazine Chemical compound CCCCCCCCCCCCNN OKMQERWDFNIGLL-UHFFFAOYSA-N 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 238000004049 embossing Methods 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- WHRIKZCFRVTHJH-UHFFFAOYSA-N ethylhydrazine Chemical compound CCNN WHRIKZCFRVTHJH-UHFFFAOYSA-N 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 230000002538 fungal effect Effects 0.000 description 1
- 238000004817 gas chromatography Methods 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 230000009036 growth inhibition Effects 0.000 description 1
- 125000001188 haloalkyl group Chemical group 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine monohydrate Substances O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 description 1
- 150000002430 hydrocarbons Chemical group 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000004310 lactic acid Substances 0.000 description 1
- 235000014655 lactic acid Nutrition 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 239000012452 mother liquor Substances 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 238000010915 one-step procedure Methods 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- NHEFPUCRUDGNLK-UHFFFAOYSA-N oxolan-2-ylmethylhydrazine Chemical compound NNCC1CCCO1 NHEFPUCRUDGNLK-UHFFFAOYSA-N 0.000 description 1
- 230000003071 parasitic effect Effects 0.000 description 1
- 239000000575 pesticide Substances 0.000 description 1
- JOVOSQBPPZZESK-UHFFFAOYSA-N phenylhydrazine hydrochloride Chemical compound Cl.NNC1=CC=CC=C1 JOVOSQBPPZZESK-UHFFFAOYSA-N 0.000 description 1
- 229940038531 phenylhydrazine hydrochloride Drugs 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- ZTILHLWDFSMCLZ-UHFFFAOYSA-N prop-2-enylhydrazine Chemical compound NNCC=C ZTILHLWDFSMCLZ-UHFFFAOYSA-N 0.000 description 1
- 125000003226 pyrazolyl group Chemical group 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 125000004076 pyridyl group Chemical group 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 238000006798 ring closing metathesis reaction Methods 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 238000007127 saponification reaction Methods 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 238000004659 sterilization and disinfection Methods 0.000 description 1
- PXQLVRUNWNTZOS-UHFFFAOYSA-N sulfanyl Chemical class [SH] PXQLVRUNWNTZOS-UHFFFAOYSA-N 0.000 description 1
- 229940124530 sulfonamide Drugs 0.000 description 1
- 150000003456 sulfonamides Chemical class 0.000 description 1
- 150000003460 sulfonic acids Chemical class 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 125000001544 thienyl group Chemical group 0.000 description 1
- 230000007704 transition Effects 0.000 description 1
- 238000001665 trituration Methods 0.000 description 1
- 239000011592 zinc chloride Substances 0.000 description 1
- 235000005074 zinc chloride Nutrition 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D231/00—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings
- C07D231/02—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings
- C07D231/10—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D231/12—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C255/00—Carboxylic acid nitriles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D231/00—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings
- C07D231/02—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings
- C07D231/10—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D231/14—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Plural Heterocyclic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Priority Applications (12)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19681809386 DE1809386A1 (de) | 1968-11-16 | 1968-11-16 | Verfahren zur Herstellung von 1,5-disubstituierten 4-Cyanopyrazolen |
| CH1532869A CH520682A (de) | 1968-11-16 | 1969-10-13 | Verfahren zur Herstellung von 1,5-disubstituierten 4-Cyanopyrazolen |
| IL33194A IL33194A0 (en) | 1968-11-16 | 1969-10-15 | Process for the preparation of 1,5-disubstituted 4-cyanopyrazoles |
| GB54243/69A GB1253931A (en) | 1968-11-16 | 1969-11-05 | Process for the preparation of 1,5-disubstituted 4-cyanopyrazoles |
| BR213986/69A BR6913986D0 (pt) | 1968-11-16 | 1969-11-07 | Processo para a producao de 4 ciano pirazois 1,5-di-substituidos |
| US875490A US3658838A (en) | 1968-11-16 | 1969-11-10 | Process for the preparation of 1 5-disubstituted-4-cyano-pyrazoles |
| DK595369AA DK120439B (da) | 1968-11-16 | 1969-11-11 | Fremgangsmåde til fremstilling af 1,5-disubstituerede 4-cyanopyrazoler. |
| AT1067269A AT289785B (de) | 1968-11-16 | 1969-11-14 | Verfahren zur Herstellung von 1,5-disubstituierten 4-Cyanopyrazolen |
| NL6917179A NL6917179A (OSRAM) | 1968-11-16 | 1969-11-14 | |
| FR6939250A FR2023474A1 (OSRAM) | 1968-11-16 | 1969-11-14 | |
| BE741712D BE741712A (OSRAM) | 1968-11-16 | 1969-11-14 | |
| ES373564A ES373564A1 (es) | 1968-11-16 | 1969-11-15 | Procedimiento para la obtencion de 4-cianopirazoles. |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19681809386 DE1809386A1 (de) | 1968-11-16 | 1968-11-16 | Verfahren zur Herstellung von 1,5-disubstituierten 4-Cyanopyrazolen |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1809386A1 true DE1809386A1 (de) | 1970-06-11 |
Family
ID=5713564
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19681809386 Pending DE1809386A1 (de) | 1968-11-16 | 1968-11-16 | Verfahren zur Herstellung von 1,5-disubstituierten 4-Cyanopyrazolen |
Country Status (12)
| Country | Link |
|---|---|
| US (1) | US3658838A (OSRAM) |
| AT (1) | AT289785B (OSRAM) |
| BE (1) | BE741712A (OSRAM) |
| BR (1) | BR6913986D0 (OSRAM) |
| CH (1) | CH520682A (OSRAM) |
| DE (1) | DE1809386A1 (OSRAM) |
| DK (1) | DK120439B (OSRAM) |
| ES (1) | ES373564A1 (OSRAM) |
| FR (1) | FR2023474A1 (OSRAM) |
| GB (1) | GB1253931A (OSRAM) |
| IL (1) | IL33194A0 (OSRAM) |
| NL (1) | NL6917179A (OSRAM) |
Families Citing this family (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2100973A1 (en) * | 1970-07-30 | 1972-03-24 | Yoshitomi Pharmaceutical | 5-Aminopyrazoles - with analgesic, antiinflammatory and muscle relaxant activity |
| US4021542A (en) * | 1973-06-01 | 1977-05-03 | Byk Gulden Lomberg Chemische Fabrik Gmbh | Derivatives of hydrazino-monosaccharides and aldohexoses which are useful as intermediates for preparing compounds or as compounds which lower the uric acid |
| US4173650A (en) * | 1978-11-03 | 1979-11-06 | American Cyanamid Company | Cis-2-benzoyl-3-hydroxy-2-alkenonitriles as anti-inflammatory agents |
| JPS55500866A (OSRAM) * | 1978-11-03 | 1980-10-30 | ||
| EP0035284B1 (en) * | 1978-11-03 | 1983-07-13 | American Cyanamid Company | Novel 2-benzoyl-3-substituted-2-alkenonitriles and process for their preparation |
| US4181677A (en) * | 1978-12-13 | 1980-01-01 | American Cyanamid Company | 2-Benzoyl-3-alkoxy-2-alkenonitriles |
| US4259256A (en) * | 1978-12-13 | 1981-03-31 | American Cyanamid Company | 2-Benzoyl-3-dimethylamino-2-alkenonitriles |
| US5656573A (en) * | 1989-09-11 | 1997-08-12 | Rhone-Poulenc Agriculture Ltd. | Herbicidal 4-substituted isoxazoles |
| US5650533A (en) * | 1989-09-11 | 1997-07-22 | Rhone-Poulenc Agriculture Ltd. | Intermediates to herbicidal 4-substituted isoxazoles |
| US5747424A (en) * | 1989-09-11 | 1998-05-05 | Rhone-Poulenc Agriculture Ltd. | Herbicidal 4-substituted isoxazol |
| GB8920519D0 (en) * | 1989-09-11 | 1989-10-25 | Rhone Poulenc Ltd | New compositions of matter |
| FR2690440B1 (fr) * | 1992-04-27 | 1995-05-19 | Rhone Poulenc Agrochimie | Arylpyrazoles fongicides. |
| GB201815699D0 (en) * | 2018-09-26 | 2018-11-07 | Mereo Biopharma 1 Ltd | Synthetic method |
| GB201815695D0 (en) * | 2018-09-26 | 2018-11-07 | Mereo Biopharma 1 Ltd | Synthetic method |
-
1968
- 1968-11-16 DE DE19681809386 patent/DE1809386A1/de active Pending
-
1969
- 1969-10-13 CH CH1532869A patent/CH520682A/de not_active IP Right Cessation
- 1969-10-15 IL IL33194A patent/IL33194A0/xx unknown
- 1969-11-05 GB GB54243/69A patent/GB1253931A/en not_active Expired
- 1969-11-07 BR BR213986/69A patent/BR6913986D0/pt unknown
- 1969-11-10 US US875490A patent/US3658838A/en not_active Expired - Lifetime
- 1969-11-11 DK DK595369AA patent/DK120439B/da unknown
- 1969-11-14 NL NL6917179A patent/NL6917179A/xx unknown
- 1969-11-14 AT AT1067269A patent/AT289785B/de active
- 1969-11-14 FR FR6939250A patent/FR2023474A1/fr not_active Withdrawn
- 1969-11-14 BE BE741712D patent/BE741712A/xx unknown
- 1969-11-15 ES ES373564A patent/ES373564A1/es not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| US3658838A (en) | 1972-04-25 |
| NL6917179A (OSRAM) | 1970-05-20 |
| GB1253931A (en) | 1971-11-17 |
| FR2023474A1 (OSRAM) | 1970-08-21 |
| BR6913986D0 (pt) | 1973-04-17 |
| AT289785B (de) | 1971-05-10 |
| DK120439B (da) | 1971-06-01 |
| BE741712A (OSRAM) | 1970-05-14 |
| ES373564A1 (es) | 1972-02-01 |
| IL33194A0 (en) | 1969-12-31 |
| CH520682A (de) | 1972-03-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2458965A1 (de) | 3-amino-indazolcarbonsaeure-derivate, verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel | |
| DE1809386A1 (de) | Verfahren zur Herstellung von 1,5-disubstituierten 4-Cyanopyrazolen | |
| EP0039844A2 (de) | Verfahren zur Herstellung von O-substituierten Derivaten des (+)-Cyanidan-3-ols | |
| EP0380712B1 (de) | Verfahren zur Herstellung von 2,6-Dichlordiphenylaminessigsäurederivaten | |
| DE1025881B (de) | Verfahren zur Herstellung von Kondensationsprodukten | |
| DE2118315C3 (de) | 2-(1H)-Chinazolinonderivate, Verfahren zu ihrer Herstellung und diese Verbindungen enthaltende Arzneimittel | |
| DE2306918A1 (de) | Benzaldehyd-sulfonylhydrazone, verfahren zu ihrer herstellung und ihre verwendung zur bekaempfung von hasenartigen und nagetieren | |
| EP0854142B1 (de) | Verfahren zur Herstellung von 1-Alkyl-pyrazol-5-carbonsäureestern | |
| CH498854A (de) | Verfahren zur Herstellung von neuen Furazanderivaten | |
| DE3306996A1 (de) | Acrylsaeuremorpholide, ihre herstellung und verwendung | |
| DE1206879B (de) | Verfahren zur Herstellung von p-Aminoarylaldehyden | |
| DE3238804A1 (de) | Neue benzotriazole, ihre herstellung und ihre verwendung als biozide wirkstoffe | |
| DE1295560B (de) | Verfahren zur Herstellung von substituierten 5-Aminopyrazolen | |
| DE1595884A1 (de) | Verfahren zur Herstellung eines 2-Nitroimidazols | |
| CH432542A (de) | Verfahren zur Herstellung neuer Hydrazide | |
| DE955591C (de) | Verfahren zur Herstellung von 2-Methyl-4-cyclohexyl-6-dimethylaminomethylphenol | |
| AT200581B (de) | Verfahren zur Herstellung neuer Guanidinverbindungen | |
| DE1077222B (de) | Verfahren zur Herstellung von Benzimidazolylidenverbindungen | |
| AT218519B (de) | Verfahren zur Herstellung von neuen Pyrazol-Derivaten | |
| DE2536675A1 (de) | Neue 3-(4-thieno-bzw.-furo eckige klammer auf 3,2-c eckige klammer zu pyridinyloxy) -2- propanol-derivate, ihre verwendung und herstellung | |
| DE1620090B1 (de) | Verfahren zur Herstellung von Imidazolidinonderivaten und ihren Salzen | |
| DE1670160A1 (de) | Verfahren zur Herstellung von Triazolo-tetrazolo-pyridazin-derivaten | |
| DE1468817C3 (de) | Verfahren zur Herstellung von Bicycle- [2,2,2] -okt-2-en-l-carbonsäuren und deren Estern | |
| DE1445902C (de) | Verfahren zur Herstellung von 3-Aminoisoxazolen | |
| DE954332C (de) | Verfahren zur Herstellung neuer Ester |