DE1785531A1 - Verfahren zum Stauchkraeuseln von Garn - Google Patents
Verfahren zum Stauchkraeuseln von GarnInfo
- Publication number
- DE1785531A1 DE1785531A1 DE19621785531 DE1785531A DE1785531A1 DE 1785531 A1 DE1785531 A1 DE 1785531A1 DE 19621785531 DE19621785531 DE 19621785531 DE 1785531 A DE1785531 A DE 1785531A DE 1785531 A1 DE1785531 A1 DE 1785531A1
- Authority
- DE
- Germany
- Prior art keywords
- plug
- feed rollers
- yarn
- obstacle
- oarn
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 13
- 238000002788 crimping Methods 0.000 title 1
- 238000010438 heat treatment Methods 0.000 claims description 12
- 230000006835 compression Effects 0.000 claims description 7
- 238000007906 compression Methods 0.000 claims description 7
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 claims 3
- 230000005540 biological transmission Effects 0.000 description 5
- 239000002184 metal Substances 0.000 description 3
- 239000003921 oil Substances 0.000 description 3
- 238000009987 spinning Methods 0.000 description 3
- 241000152447 Hades Species 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- FMFKNGWZEQOWNK-UHFFFAOYSA-N 1-butoxypropan-2-yl 2-(2,4,5-trichlorophenoxy)propanoate Chemical compound CCCCOCC(C)OC(=O)C(C)OC1=CC(Cl)=C(Cl)C=C1Cl FMFKNGWZEQOWNK-UHFFFAOYSA-N 0.000 description 1
- 241000251730 Chondrichthyes Species 0.000 description 1
- 239000004952 Polyamide Substances 0.000 description 1
- 239000004743 Polypropylene Substances 0.000 description 1
- 241001122767 Theaceae Species 0.000 description 1
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 230000002238 attenuated effect Effects 0.000 description 1
- 230000008602 contraction Effects 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- ZQPPMHVWECSIRJ-KTKRTIGZSA-N oleic acid group Chemical group C(CCCCCCC\C=C/CCCCCCCC)(=O)O ZQPPMHVWECSIRJ-KTKRTIGZSA-N 0.000 description 1
- 230000002093 peripheral effect Effects 0.000 description 1
- 238000005554 pickling Methods 0.000 description 1
- 229920002647 polyamide Polymers 0.000 description 1
- -1 polypropylene Polymers 0.000 description 1
- 229920001155 polypropylene Polymers 0.000 description 1
- 230000000644 propagated effect Effects 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- 238000007790 scraping Methods 0.000 description 1
- 230000007704 transition Effects 0.000 description 1
- 238000004804 winding Methods 0.000 description 1
Classifications
-
- D—TEXTILES; PAPER
- D02—YARNS; MECHANICAL FINISHING OF YARNS OR ROPES; WARPING OR BEAMING
- D02G—CRIMPING OR CURLING FIBRES, FILAMENTS, THREADS, OR YARNS; YARNS OR THREADS
- D02G1/00—Producing crimped or curled fibres, filaments, yarns, or threads, giving them latent characteristics
- D02G1/12—Producing crimped or curled fibres, filaments, yarns, or threads, giving them latent characteristics using stuffer boxes
Landscapes
- Engineering & Computer Science (AREA)
- Mechanical Engineering (AREA)
- Textile Engineering (AREA)
- Yarns And Mechanical Finishing Of Yarns Or Ropes (AREA)
- Resistance Heating (AREA)
Applications Claiming Priority (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB4272661 | 1961-11-29 | ||
| GB4272861 | 1961-11-29 | ||
| GB13030/62A GB1035935A (en) | 1961-11-29 | 1962-04-04 | Improvements in or relating to apparatus for crimping yarn |
| GB4413562 | 1962-11-22 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1785531A1 true DE1785531A1 (de) | 1971-07-08 |
Family
ID=27448171
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19621435516 Pending DE1435516A1 (de) | 1961-11-29 | 1962-11-28 | Verfahren und Vorrichtung zum Kraeuseln von Garnen |
| DE19621785531 Pending DE1785531A1 (de) | 1961-11-29 | 1962-11-28 | Verfahren zum Stauchkraeuseln von Garn |
Family Applications Before (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19621435516 Pending DE1435516A1 (de) | 1961-11-29 | 1962-11-28 | Verfahren und Vorrichtung zum Kraeuseln von Garnen |
Country Status (7)
| Country | Link |
|---|---|
| US (2) | US3212157A (enrdf_load_stackoverflow) |
| BE (2) | BE630540A (enrdf_load_stackoverflow) |
| CH (2) | CH448365A (enrdf_load_stackoverflow) |
| DE (2) | DE1435516A1 (enrdf_load_stackoverflow) |
| ES (1) | ES282896A1 (enrdf_load_stackoverflow) |
| GB (2) | GB1035935A (enrdf_load_stackoverflow) |
| SE (1) | SE302174B (enrdf_load_stackoverflow) |
Families Citing this family (26)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3348283A (en) * | 1964-03-04 | 1967-10-24 | Techniservice Corp | Method for crimping textile strands |
| GB1074141A (en) * | 1962-12-03 | 1967-06-28 | Klinger Mfg Co Ltd | Improvements in or relating to apparatus for and methods of false-twist-crimping of yarn |
| GB1051722A (enrdf_load_stackoverflow) * | 1963-05-10 | |||
| US3388440A (en) * | 1963-07-10 | 1968-06-18 | Techniservice Corp | Strand windup treatment apparatus |
| US3280444A (en) * | 1963-07-10 | 1966-10-25 | Robert K Stanley | Strand windup treatment |
| GB1116238A (en) * | 1964-10-26 | 1968-06-06 | Bancroft & Sons Co J | Method and apparatus for crimping yarn |
| US3292231A (en) * | 1964-11-04 | 1966-12-20 | Epstein Herman | Stuffer crimping apparatus |
| US3300830A (en) * | 1965-06-29 | 1967-01-31 | Fiber Industries Inc | Apparatus for uniformly crimping filaments |
| DE1660295C3 (de) * | 1965-09-29 | 1975-06-26 | Bayer Ag, 5090 Leverkusen | Vorrichtung zur Herstellung von synthetischen, thermoplastischen Fäden mit fixierter Kräuselung |
| GB1165697A (en) * | 1965-10-23 | 1969-10-01 | Klinger Mfg Co Ltd | Crimping Yarn |
| US3454998A (en) * | 1966-03-08 | 1969-07-15 | Klinger Mfg Co Ltd | Yarn treating apparatus and method |
| US3501819A (en) * | 1966-10-13 | 1970-03-24 | Klinger Mfg Co Ltd | Yarn processing method and apparatus |
| US3503104A (en) * | 1966-10-19 | 1970-03-31 | Klinger Mfg Co Ltd | Yarn and method and apparatus for producing the same |
| US3461521A (en) * | 1967-11-24 | 1969-08-19 | American Enka Corp | Process for manufacture of yarns |
| NL7200110A (enrdf_load_stackoverflow) * | 1968-09-19 | 1972-04-25 | ||
| DE2000555A1 (de) * | 1969-01-20 | 1970-07-23 | Elitex Zd Y Textilniho Strojir | Vorrichtung zur automatischen Regelung der Garnlieferung in einen Garnvorratsbehaelter auf Textilmaschinen,bei denen eine Unterbrechung des verarbeiteten Garnes ohne Unterbrechung des Arbeitsganges der Maschine beseitigt wird |
| US3641637A (en) * | 1969-08-04 | 1972-02-15 | Spinn Und Zwirnerei Maschinenb | Stuffing box crimping device |
| US3798718A (en) * | 1970-05-26 | 1974-03-26 | Bancroft & Sons Co J | Apparatus for stuffer-crimping yarn |
| JPS512993B1 (enrdf_load_stackoverflow) * | 1970-10-05 | 1976-01-30 | ||
| US3781951A (en) * | 1971-08-30 | 1974-01-01 | Textured Yarn Co | Method and apparatus for compressively crimping textile strands |
| GB1391273A (en) * | 1972-01-31 | 1975-04-16 | Platt International Ltd | Textile machines |
| US3977058A (en) * | 1973-05-24 | 1976-08-31 | Phillips Petroleum Company | Method and apparatus for controlling yarn plug length |
| USRE31783E (en) * | 1973-05-24 | 1985-01-01 | Phillips Petroleum Company | Method and apparatus for controlling yarn plug length |
| US3879819A (en) * | 1973-12-28 | 1975-04-29 | Chevron Res | Heat-setting means in a thermoplastic yarn rebound texturizing apparatus |
| US4067092A (en) * | 1976-06-16 | 1978-01-10 | Roberts John S | Compression crimping apparatus |
| US7585442B2 (en) * | 2004-06-25 | 2009-09-08 | Celanese Acetate, Llc | Process for making cellulose acetate tow |
Family Cites Families (24)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL164588B (nl) * | 1949-10-14 | Uniroyal | Werkwijze voor de bereiding van een verwerkbaar thermo- plastisch mengsel en gevormd voortbrengsel daaruit. | |
| NL79301C (enrdf_load_stackoverflow) * | 1950-10-04 | |||
| NL78597C (enrdf_load_stackoverflow) * | 1953-05-28 | |||
| US2914835A (en) * | 1954-03-04 | 1959-12-01 | Owens Corning Fiberglass Corp | Method of crimping fibrous glass strand |
| US2751661A (en) * | 1955-08-17 | 1956-06-26 | Alexander Smith Inc | Yarn crimping apparatus |
| US2862279A (en) * | 1956-04-10 | 1958-12-02 | Allied Chem | Tow crimping apparatus |
| US3022545A (en) * | 1956-09-06 | 1962-02-27 | British Celanese | Process for crimping cellulose triacetate fibers |
| BE562720A (enrdf_load_stackoverflow) * | 1956-11-27 | |||
| BE563224A (enrdf_load_stackoverflow) * | 1956-12-24 | |||
| US2917784A (en) * | 1957-06-05 | 1959-12-22 | Dow Chemical Co | Crimping fibers |
| NL228434A (enrdf_load_stackoverflow) * | 1957-06-05 | |||
| GB873368A (en) * | 1957-07-16 | 1961-07-26 | British Celanese | Improvements relating to the crimping of textile fibres |
| GB857974A (en) * | 1958-11-25 | 1961-01-04 | Scragg & Sons | Improvements in apparatus for crimping textile yarns |
| US3111740A (en) * | 1959-02-02 | 1963-11-26 | Techniservice Corp | Method and apparatus for strand crimping |
| US3090096A (en) * | 1959-05-13 | 1963-05-21 | Techniservice Corp | Strand-crimping apparatus |
| NL251708A (enrdf_load_stackoverflow) * | 1959-05-18 | |||
| US2924001A (en) * | 1959-06-26 | 1960-02-09 | Crimp setting device | |
| US3096558A (en) * | 1959-09-23 | 1963-07-09 | Bancroft & Sons Co J | Crimping apparatus |
| US2974392A (en) * | 1959-09-28 | 1961-03-14 | Chemstrand Corp | Apparatus for crimping yarn |
| US3110076A (en) * | 1959-12-08 | 1963-11-12 | Bancroft & Sons Co J | Stuffer crimping apparatus |
| NL123317C (enrdf_load_stackoverflow) * | 1960-05-23 | |||
| NL108711C (enrdf_load_stackoverflow) * | 1960-05-30 | |||
| US3076250A (en) * | 1960-12-05 | 1963-02-05 | Monsanto Chemicals | Tow crimping apparatus |
| US3153272A (en) * | 1961-07-13 | 1964-10-20 | Klinger Mfg Co Ltd | Apparatus for the production of crimped or bulk yarn |
-
0
- GB GB1051721D patent/GB1051721A/en active Active
- BE BE625420D patent/BE625420A/xx unknown
- BE BE630540D patent/BE630540A/xx unknown
-
1962
- 1962-04-04 GB GB13030/62A patent/GB1035935A/en not_active Expired
- 1962-11-28 DE DE19621435516 patent/DE1435516A1/de active Pending
- 1962-11-28 DE DE19621785531 patent/DE1785531A1/de active Pending
- 1962-11-28 SE SE12814/62A patent/SE302174B/xx unknown
- 1962-11-28 ES ES282896A patent/ES282896A1/es not_active Expired
- 1962-11-28 US US240551A patent/US3212157A/en not_active Expired - Lifetime
- 1962-11-29 CH CH841063A patent/CH448365A/de unknown
- 1962-11-29 CH CH1398662A patent/CH413214A/de unknown
-
1963
- 1963-04-03 US US270448A patent/US3174206A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| GB1035935A (en) | 1966-07-13 |
| CH448365A (de) | 1967-12-15 |
| US3174206A (en) | 1965-03-23 |
| GB1051721A (enrdf_load_stackoverflow) | |
| ES282896A1 (es) | 1963-05-16 |
| CH413214A (de) | 1966-01-31 |
| US3212157A (en) | 1965-10-19 |
| BE625420A (enrdf_load_stackoverflow) | |
| DE1435516A1 (de) | 1968-11-21 |
| BE630540A (enrdf_load_stackoverflow) | |
| SE302174B (enrdf_load_stackoverflow) | 1968-07-08 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1785531A1 (de) | Verfahren zum Stauchkraeuseln von Garn | |
| DE69105117T2 (de) | Verbesserung in oder betreffend dentalfaden oder -band. | |
| DE2130759C2 (de) | Vorrichtung zum kontinuierlichen Behandeln, insbesondere Schrumpfen von textilem Faden- oder Garnmaterial | |
| CH635374A5 (de) | Vorrichtung zum herstellen eines garnes. | |
| DE1558669A1 (de) | Verfahren zur Herstellung von rostfreiem Stahldraht | |
| EP3371353B1 (de) | Fadenabzugsdüse mit radial zur düsenbohrung verlaufenden kerben | |
| DE1660223C3 (de) | Verfahren zur Herstellung endloser fadenartiger Gebilde mit thermoplastischen Kunststoffen | |
| EP3497271B2 (de) | Sägezahndraht für walzen von spinnereivorbereitungsmaschinen | |
| DE1410392A1 (de) | Verfahren und Vorrichtung zum Kraeuseln von Kunststoffgarn sowie danach hergestelltes Erzeugnis | |
| DE1660295C3 (de) | Vorrichtung zur Herstellung von synthetischen, thermoplastischen Fäden mit fixierter Kräuselung | |
| DE1660657A1 (de) | Verfahren und Vorrichtung zum Strecken synthetischer Faserstraenge | |
| EP0449068A2 (de) | Drallkörper, insbesondere für Flyerflügel an Vorspinnmaschine | |
| DE1660481B2 (de) | Vorrichtung zur Wärmebehandlung eines hochpolymeren Fadens im Anschluß an dessen StreckprozeB | |
| AT372415B (de) | Vorrichtung zum herstellen eines garnes | |
| AT253671B (de) | Verfahren zur Herstellung eines gekräuselten Garnes | |
| DE2009765A1 (de) | Fleier | |
| DE102021129786B4 (de) | Verfahren zur Behandlung des Kopfhaars einer Person | |
| AT398085B (de) | Vorrichtung zum herstellen eines garnes | |
| Tauchnitz | Optimal control problems with free right end point | |
| DE2527438B2 (de) | Vorrichtung zum begrenzen einer schaumbildung bei einer aus einer ausschankleitung fliessenden kohlensaeurehaltigen fluessigkeit | |
| AT226629B (de) | Verfahren und Vorrichtung zur Auflockerung und/oder Absprengung der Zunderschichten od. dgl. von warmverformtem Gut | |
| DE1510058A1 (de) | Verfahren zum Herstellen von verdichteten Litzen oder Seilen aus Kunststoff | |
| AT221219B (de) | Einrichtung zum Kräuseln von thermoplastischem Endlosfäden | |
| AT152823B (de) | Verfahren zur Herstellung dünner Gummifäden, -schnüre, -röhrchen od. dgl. | |
| DE1785029A1 (de) | Verfahren und Vorrichtung zum kontinuierlichen Verstrecken und Stauchkraeuseln von Endlosfadengarnen |