DE1764236A1 - Kanalverstaerkungsvorrichtung fuer Elektronen und Elektronenroehre zur Anwendung einer solchen Vorrichtung - Google Patents
Kanalverstaerkungsvorrichtung fuer Elektronen und Elektronenroehre zur Anwendung einer solchen VorrichtungInfo
- Publication number
- DE1764236A1 DE1764236A1 DE19681764236 DE1764236A DE1764236A1 DE 1764236 A1 DE1764236 A1 DE 1764236A1 DE 19681764236 DE19681764236 DE 19681764236 DE 1764236 A DE1764236 A DE 1764236A DE 1764236 A1 DE1764236 A1 DE 1764236A1
- Authority
- DE
- Germany
- Prior art keywords
- channel
- photocathode
- electrons
- electrode
- layer
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 230000002787 reinforcement Effects 0.000 title claims description 3
- 239000000463 material Substances 0.000 claims description 3
- 239000000344 soap Substances 0.000 claims 1
- 229920002994 synthetic fiber Polymers 0.000 claims 1
- 230000000694 effects Effects 0.000 description 8
- 239000011159 matrix material Substances 0.000 description 5
- 230000035515 penetration Effects 0.000 description 5
- 230000001133 acceleration Effects 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- 241001465754 Metazoa Species 0.000 description 2
- 229910052804 chromium Inorganic materials 0.000 description 2
- 239000011651 chromium Substances 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 239000011521 glass Substances 0.000 description 2
- 239000010931 gold Substances 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- 230000005855 radiation Effects 0.000 description 2
- 239000011669 selenium Substances 0.000 description 2
- XQDQRCRASHAZBA-UHFFFAOYSA-N 2,4-dinitro-1-thiocyanatobenzene Chemical compound [O-][N+](=O)C1=CC=C(SC#N)C([N+]([O-])=O)=C1 XQDQRCRASHAZBA-UHFFFAOYSA-N 0.000 description 1
- 241000251468 Actinopterygii Species 0.000 description 1
- 101100133992 Amycolatopsis sp Aaar gene Proteins 0.000 description 1
- VVNCNSJFMMFHPL-VKHMYHEASA-N D-penicillamine Chemical compound CC(C)(S)[C@@H](N)C(O)=O VVNCNSJFMMFHPL-VKHMYHEASA-N 0.000 description 1
- LFVLUOAHQIVABZ-UHFFFAOYSA-N Iodofenphos Chemical compound COP(=S)(OC)OC1=CC(Cl)=C(I)C=C1Cl LFVLUOAHQIVABZ-UHFFFAOYSA-N 0.000 description 1
- 206010051246 Photodermatosis Diseases 0.000 description 1
- 241000139306 Platt Species 0.000 description 1
- BUGBHKTXTAQXES-UHFFFAOYSA-N Selenium Chemical compound [Se] BUGBHKTXTAQXES-UHFFFAOYSA-N 0.000 description 1
- 230000003679 aging effect Effects 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 230000003321 amplification Effects 0.000 description 1
- 238000013459 approach Methods 0.000 description 1
- 230000000712 assembly Effects 0.000 description 1
- 238000000429 assembly Methods 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 238000010276 construction Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 229940075911 depen Drugs 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 239000007772 electrode material Substances 0.000 description 1
- 239000003623 enhancer Substances 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- PCHJSUWPFVWCPO-UHFFFAOYSA-N gold Chemical compound [Au] PCHJSUWPFVWCPO-UHFFFAOYSA-N 0.000 description 1
- 229910052737 gold Inorganic materials 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- 229940028444 muse Drugs 0.000 description 1
- 238000003199 nucleic acid amplification method Methods 0.000 description 1
- 230000000149 penetrating effect Effects 0.000 description 1
- 230000008845 photoaging Effects 0.000 description 1
- GMVPRGQOIOIIMI-DWKJAMRDSA-N prostaglandin E1 Chemical compound CCCCC[C@H](O)\C=C\[C@H]1[C@H](O)CC(=O)[C@@H]1CCCCCCC(O)=O GMVPRGQOIOIIMI-DWKJAMRDSA-N 0.000 description 1
- 239000004576 sand Substances 0.000 description 1
- 229910052711 selenium Inorganic materials 0.000 description 1
- 238000007740 vapor deposition Methods 0.000 description 1
- 230000004304 visual acuity Effects 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01J—ELECTRIC DISCHARGE TUBES OR DISCHARGE LAMPS
- H01J43/00—Secondary-emission tubes; Electron-multiplier tubes
- H01J43/04—Electron multipliers
- H01J43/06—Electrode arrangements
- H01J43/18—Electrode arrangements using essentially more than one dynode
- H01J43/24—Dynodes having potential gradient along their surfaces
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01J—ELECTRIC DISCHARGE TUBES OR DISCHARGE LAMPS
- H01J31/00—Cathode ray tubes; Electron beam tubes
- H01J31/08—Cathode ray tubes; Electron beam tubes having a screen on or from which an image or pattern is formed, picked up, converted, or stored
- H01J31/50—Image-conversion or image-amplification tubes, i.e. having optical, X-ray, or analogous input, and optical output
- H01J31/506—Image-conversion or image-amplification tubes, i.e. having optical, X-ray, or analogous input, and optical output tubes using secondary emission effect
- H01J31/507—Image-conversion or image-amplification tubes, i.e. having optical, X-ray, or analogous input, and optical output tubes using secondary emission effect using a large number of channels, e.g. microchannel plates
Landscapes
- Image-Pickup Tubes, Image-Amplification Tubes, And Storage Tubes (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB22339/67A GB1154515A (en) | 1967-05-15 | 1967-05-15 | Improvements in or relating to Image Intensifiers |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1764236A1 true DE1764236A1 (de) | 1971-07-01 |
Family
ID=10177803
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19681764236 Pending DE1764236A1 (de) | 1967-05-15 | 1968-04-29 | Kanalverstaerkungsvorrichtung fuer Elektronen und Elektronenroehre zur Anwendung einer solchen Vorrichtung |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US3497759A (enExample) |
| AT (1) | AT281142B (enExample) |
| DE (1) | DE1764236A1 (enExample) |
| FR (1) | FR1565868A (enExample) |
| GB (1) | GB1154515A (enExample) |
| NL (1) | NL6806736A (enExample) |
| SE (1) | SE339058B (enExample) |
Families Citing this family (16)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL7002072A (enExample) * | 1969-02-24 | 1970-08-26 | ||
| US3863094A (en) * | 1969-04-08 | 1975-01-28 | Itt | Image intensifier and method of making an electron multiplier therefor |
| US3974411A (en) * | 1970-09-20 | 1976-08-10 | Rca Corporation | Channel plate electron multiplier tube having reduced astigmatism |
| US3870917A (en) * | 1971-05-10 | 1975-03-11 | Itt | Discharge device including channel type electron multiplier having ion adsorptive layer |
| GB1402549A (en) * | 1971-12-23 | 1975-08-13 | Mullard Ltd | Electron multipliers |
| US3902240A (en) * | 1972-11-22 | 1975-09-02 | Us Army | Integrated cathode and channel plate multiplier |
| GB1417643A (en) * | 1973-01-19 | 1975-12-10 | Mullard Ltd | Electron multipliers |
| GB1434053A (en) * | 1973-04-06 | 1976-04-28 | Mullard Ltd | Electron multipliers |
| GB1464863A (en) * | 1973-05-21 | 1977-02-16 | Agfa Gevaert | Production of electrostatic images |
| FR2260863B1 (enExample) * | 1974-02-13 | 1977-09-16 | Labo Electronique Physique | |
| GB2118358B (en) * | 1982-04-05 | 1986-01-02 | Philips Electronic Associated | Channel plate electron multipliers |
| GB2144902A (en) * | 1983-07-08 | 1985-03-13 | Philips Electronic Associated | Cathode ray tube with electron multiplier |
| US4737013A (en) * | 1986-11-03 | 1988-04-12 | Litton Systems, Inc. | Microchannel plate having an etch limiting barrier |
| WO1992016960A1 (fr) * | 1991-03-15 | 1992-10-01 | Sovetsko-Amerikanskoe Sovmestnoe Predpriyatie Dialog | Procede et dispositif de detection de rayonnements |
| FR2688343A1 (fr) * | 1992-03-06 | 1993-09-10 | Thomson Tubes Electroniques | Tube intensificateur d'image notamment radiologique, du type a galette de microcanaux. |
| CN108054075B (zh) * | 2017-12-14 | 2024-05-14 | 中国科学院西安光学精密机械研究所 | 一种分幅变像管及分幅相机 |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB790416A (en) * | 1953-06-05 | 1958-02-12 | Emi Ltd | Improvements in or relating to electron discharge devices incorporating electron multipliers |
| BE536517A (enExample) * | 1954-03-17 | |||
| US3374380A (en) * | 1965-11-10 | 1968-03-19 | Bendix Corp | Apparatus for suppression of ion feedback in electron multipliers |
| US3407324A (en) * | 1967-06-21 | 1968-10-22 | Electro Mechanical Res Inc | Electron multiplier comprising wafer having secondary-emissive channels |
-
1967
- 1967-05-15 GB GB22339/67A patent/GB1154515A/en not_active Expired
-
1968
- 1968-04-29 DE DE19681764236 patent/DE1764236A1/de active Pending
- 1968-05-11 NL NL6806736A patent/NL6806736A/xx unknown
- 1968-05-13 AT AT458368A patent/AT281142B/de not_active IP Right Cessation
- 1968-05-13 SE SE06444/68A patent/SE339058B/xx unknown
- 1968-05-14 US US729126A patent/US3497759A/en not_active Expired - Lifetime
- 1968-05-15 FR FR1565868D patent/FR1565868A/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| SE339058B (enExample) | 1971-09-27 |
| FR1565868A (enExample) | 1969-05-02 |
| US3497759A (en) | 1970-02-24 |
| AT281142B (de) | 1970-05-11 |
| GB1154515A (en) | 1969-06-11 |
| NL6806736A (enExample) | 1968-11-18 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1764236A1 (de) | Kanalverstaerkungsvorrichtung fuer Elektronen und Elektronenroehre zur Anwendung einer solchen Vorrichtung | |
| DE3025945C2 (de) | Kaltkathodenstruktur mit mindestens einer Kaltkathode zur Erzeugung eines Elektronenstrahls und Verwendung der Kaltkathodenstruktur | |
| DE1957247C3 (de) | Bildröhre | |
| DE1126444B (de) | Kathodenstrahlroehre | |
| DE1022258B (de) | Kathodenstrahlroehre | |
| DE884652C (de) | Fernsehsenderoehre | |
| DE2418199A1 (de) | Elektronenvervielfacher | |
| DE1187740B (de) | Elektronenvervielfacherroehre | |
| DE699657C (de) | Fernsehsenderoehre | |
| DE838472C (de) | Elektronen-Entladungseinrichtung | |
| DE2048158A1 (de) | Nachbeschleunigungs Farbbildrohre | |
| DE2456596A1 (de) | Elektronen-entladeanordnung | |
| DE2825902A1 (de) | Flachanzeigevorrichtung | |
| DE2408601A1 (de) | Index-kathodenstrahlroehre | |
| DE2813218A1 (de) | Bildverstaerkerroehre | |
| DE1230453B (de) | Kathodenstrahlroehre zur Bildwiedergabe, insbesondere von Farbfernsehbildern | |
| AT149210B (de) | Elektrische Entladungsvorrichtung. | |
| DE2503821A1 (de) | Elektronenoptische bildroehre | |
| DE1489172C3 (de) | Bildwandler oder Bildverstärker mit einer der Elektronenvervielfachung dienenden Platte | |
| DE69603328T2 (de) | Eine in-line elektronenkanone enthaltende farbkathodenstrahlröhre | |
| DE2306575B2 (de) | Röntgenbildverstärker | |
| AT149280B (de) | Elektrische Entladungsröhre für die Übertragung von Bildern. | |
| DE2139902A1 (de) | Kathodenstrahlroehren mit bildschirm sowie vorrichtung und verfahren zur herstellung derselben | |
| AT262392B (de) | Farbenbildröhre und Verfahren zum Herstellen derselben | |
| AT211881B (de) | Vorrichtung mit einer Elektronenstrahlröhre und Elektronenstrahlröhre für eine solche Vorrichtung |