DE1668604C - - Google Patents
Info
- Publication number
- DE1668604C DE1668604C DE1668604C DE 1668604 C DE1668604 C DE 1668604C DE 1668604 C DE1668604 C DE 1668604C
- Authority
- DE
- Germany
- Prior art keywords
- tetrahydrofuran
- water
- abs
- stirring
- reaction mixture
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 230000009467 reduction Effects 0.000 claims description 23
- 239000003638 chemical reducing agent Substances 0.000 claims description 22
- -1 lithium aluminum hydride Chemical compound 0.000 claims description 21
- 239000012280 lithium aluminium hydride Substances 0.000 claims description 15
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical group OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 claims description 10
- 238000000034 method Methods 0.000 claims description 10
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims description 9
- 229910052739 hydrogen Inorganic materials 0.000 claims description 7
- 239000001257 hydrogen Substances 0.000 claims description 7
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 6
- 125000004432 carbon atom Chemical group C* 0.000 claims description 4
- 125000000962 organic group Chemical group 0.000 claims description 4
- 239000002904 solvent Substances 0.000 claims description 4
- 230000000707 stereoselective effect Effects 0.000 claims description 4
- 125000000217 alkyl group Chemical group 0.000 claims description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 3
- 125000002252 acyl group Chemical group 0.000 claims description 2
- 125000000304 alkynyl group Chemical group 0.000 claims description 2
- 229910052799 carbon Inorganic materials 0.000 claims description 2
- 238000002360 preparation method Methods 0.000 claims description 2
- 125000001424 substituent group Chemical group 0.000 claims description 2
- 125000003342 alkenyl group Chemical group 0.000 claims 1
- 125000001183 hydrocarbyl group Chemical group 0.000 claims 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims 1
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 93
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 44
- 238000003756 stirring Methods 0.000 description 37
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 34
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 28
- 239000011541 reaction mixture Substances 0.000 description 26
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 21
- 239000000047 product Substances 0.000 description 20
- 239000002244 precipitate Substances 0.000 description 16
- 239000000203 mixture Substances 0.000 description 14
- 239000012299 nitrogen atmosphere Substances 0.000 description 12
- 229960000583 acetic acid Drugs 0.000 description 10
- 235000019441 ethanol Nutrition 0.000 description 10
- 239000000706 filtrate Substances 0.000 description 10
- 150000002009 diols Chemical class 0.000 description 9
- 239000012362 glacial acetic acid Substances 0.000 description 9
- 229960004719 nandrolone Drugs 0.000 description 9
- YWEUIGNSBFLMFL-UHFFFAOYSA-N diphosphonate Chemical compound O=P(=O)OP(=O)=O YWEUIGNSBFLMFL-UHFFFAOYSA-N 0.000 description 7
- DLYUQMMRRRQYAE-UHFFFAOYSA-N phosphorus pentoxide Inorganic materials O1P(O2)(=O)OP3(=O)OP1(=O)OP2(=O)O3 DLYUQMMRRRQYAE-UHFFFAOYSA-N 0.000 description 7
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 6
- MUMGGOZAMZWBJJ-DYKIIFRCSA-N Testostosterone Chemical compound O=C1CC[C@]2(C)[C@H]3CC[C@](C)([C@H](CC4)O)[C@@H]4[C@@H]3CCC2=C1 MUMGGOZAMZWBJJ-DYKIIFRCSA-N 0.000 description 6
- 239000007795 chemical reaction product Substances 0.000 description 5
- 150000001875 compounds Chemical class 0.000 description 5
- VLKZOEOYAKHREP-UHFFFAOYSA-N hexane Substances CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 5
- 150000003431 steroids Chemical class 0.000 description 5
- KYWJZCSJMOILIZ-UHFFFAOYSA-N 3-methylhexan-3-ol Chemical compound CCCC(C)(O)CC KYWJZCSJMOILIZ-UHFFFAOYSA-N 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 4
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 4
- 238000004519 manufacturing process Methods 0.000 description 4
- 229960003604 testosterone Drugs 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 3
- 229910052698 phosphorus Inorganic materials 0.000 description 3
- 239000011574 phosphorus Substances 0.000 description 3
- 239000012279 sodium borohydride Substances 0.000 description 3
- 229910000033 sodium borohydride Inorganic materials 0.000 description 3
- 238000004090 dissolution Methods 0.000 description 2
- 229910052987 metal hydride Inorganic materials 0.000 description 2
- 150000004681 metal hydrides Chemical class 0.000 description 2
- NPAGDVCDWIYMMC-IZPLOLCNSA-N nandrolone Chemical compound O=C1CC[C@@H]2[C@H]3CC[C@](C)([C@H](CC4)O)[C@@H]4[C@@H]3CCC2=C1 NPAGDVCDWIYMMC-IZPLOLCNSA-N 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 150000003509 tertiary alcohols Chemical class 0.000 description 2
- PPTXVXKCQZKFBN-UHFFFAOYSA-N (S)-(-)-1,1'-Bi-2-naphthol Chemical compound C1=CC=C2C(C3=C4C=CC=CC4=CC=C3O)=C(O)C=CC2=C1 PPTXVXKCQZKFBN-UHFFFAOYSA-N 0.000 description 1
- MWCMKTVYZSKEDS-UHFFFAOYSA-N 1-(3-methoxy-4-phenylmethoxyphenyl)piperazine Chemical compound COC1=CC(N2CCNCC2)=CC=C1OCC1=CC=CC=C1 MWCMKTVYZSKEDS-UHFFFAOYSA-N 0.000 description 1
- BUCJHJXFXUZJHL-UHFFFAOYSA-N 1-ethylcyclohexan-1-ol Chemical compound CCC1(O)CCCCC1 BUCJHJXFXUZJHL-UHFFFAOYSA-N 0.000 description 1
- GCKMFJBGXUYNAG-UHFFFAOYSA-N 17alpha-methyltestosterone Natural products C1CC2=CC(=O)CCC2(C)C2C1C1CCC(C)(O)C1(C)CC2 GCKMFJBGXUYNAG-UHFFFAOYSA-N 0.000 description 1
- RFZHJHSNHYIRNE-UHFFFAOYSA-N 2,3-dimethylpentan-3-ol Chemical compound CCC(C)(O)C(C)C RFZHJHSNHYIRNE-UHFFFAOYSA-N 0.000 description 1
- WFRBDWRZVBPBDO-UHFFFAOYSA-N 2-methyl-2-pentanol Chemical compound CCCC(C)(C)O WFRBDWRZVBPBDO-UHFFFAOYSA-N 0.000 description 1
- MSXVEPNJUHWQHW-UHFFFAOYSA-N 2-methylbutan-2-ol Chemical compound CCC(C)(C)O MSXVEPNJUHWQHW-UHFFFAOYSA-N 0.000 description 1
- XKIRHOWVQWCYBT-UHFFFAOYSA-N 3-ethylpentan-3-ol Chemical compound CCC(O)(CC)CC XKIRHOWVQWCYBT-UHFFFAOYSA-N 0.000 description 1
- QNVAUOOHLRHGAV-UHFFFAOYSA-N C(C)(C)(C)O[AlH2].[Li] Chemical compound C(C)(C)(C)O[AlH2].[Li] QNVAUOOHLRHGAV-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- GCKMFJBGXUYNAG-HLXURNFRSA-N Methyltestosterone Chemical compound C1CC2=CC(=O)CC[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@](C)(O)[C@@]1(C)CC2 GCKMFJBGXUYNAG-HLXURNFRSA-N 0.000 description 1
- AMQJEAYHLZJPGS-UHFFFAOYSA-N N-Pentanol Chemical compound CCCCCO AMQJEAYHLZJPGS-UHFFFAOYSA-N 0.000 description 1
- JFBZPFYRPYOZCQ-UHFFFAOYSA-N [Li].[Al] Chemical compound [Li].[Al] JFBZPFYRPYOZCQ-UHFFFAOYSA-N 0.000 description 1
- YUWBVKYVJWNVLE-UHFFFAOYSA-N [N].[P] Chemical compound [N].[P] YUWBVKYVJWNVLE-UHFFFAOYSA-N 0.000 description 1
- 230000021736 acetylation Effects 0.000 description 1
- 238000006640 acetylation reaction Methods 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- BTANRVKWQNVYAZ-UHFFFAOYSA-N butan-2-ol Chemical compound CCC(C)O BTANRVKWQNVYAZ-UHFFFAOYSA-N 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 229960000445 ethisterone Drugs 0.000 description 1
- 125000002534 ethynyl group Chemical group [H]C#C* 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 229940088597 hormone Drugs 0.000 description 1
- 239000005556 hormone Substances 0.000 description 1
- 150000002430 hydrocarbons Chemical group 0.000 description 1
- 150000002431 hydrogen Chemical class 0.000 description 1
- 150000002440 hydroxy compounds Chemical class 0.000 description 1
- 238000009776 industrial production Methods 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- 238000011835 investigation Methods 0.000 description 1
- PHTQWCKDNZKARW-UHFFFAOYSA-N isoamylol Chemical compound CC(C)CCO PHTQWCKDNZKARW-UHFFFAOYSA-N 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical class C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 1
- 229960001566 methyltestosterone Drugs 0.000 description 1
- 238000005121 nitriding Methods 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 230000016087 ovulation Effects 0.000 description 1
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 1
- 238000012856 packing Methods 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 230000003637 steroidlike Effects 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 239000003053 toxin Substances 0.000 description 1
- 231100000765 toxin Toxicity 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1543273C3 (de) | 7 alpha-Methyl-Delta hoch 5(16) -steroide der Oestranreihe und Verfahren zu deren Herstellung | |
| DE1668604C (enExample) | ||
| DE1568308B2 (de) | Verfahren zur herstellung von delta hoch 4,9,11-trienen der 19-nor- androstanreihe, 17-oxygenierte 3-oxo- 7 alpha-methyl-delta hoch 4,9,11-19 nor- androstatriene und diese enthaltende pharmazeutische praeparate sowie 3-oxo-7 alpha -methyl-delta hoch 5 (10), 9 (11) -19-nor- androstadiene | |
| DE1668604B1 (de) | Verfahren zur Herstellung von 3ss-Hydroxy-gamma 4-Steroiden | |
| DE1250819B (de) | Verfahren zur Herstellung von 3-Hydroxy - (bzw. -Acyloxy)-7a-alkyl-19-nor-4androstenen | |
| DE1904586C3 (enExample) | ||
| DE1079040B (de) | Verfahren zur Herstellung stark androgen und anabol wirksamer ?-ungesaettigter 3, 17-Diole der Androstan-bzw. 19-Norandrostanreihe | |
| DE1568308C3 (de) | 10.09.65 Schweiz 12624-65 Verfahren zur Herstellung von Delta hoch 4,9,11-Trienen der 19-Norandrostanreihe, 17-oxygenierte 3-Oxo-7 alpha-methyl-Delta hoch 4,9,11-19 norandrostatriene und diese enthaltende pharmazeutische Präparate sowie 3-Oxo-7 alpha -methyl-Delta hoch 5 (10), 9 (11) -19-norandrostadiene | |
| DE3144049A1 (de) | 16(beta)-methyl-8(alpha)-oestradiole, verfahren zu ihrer herstellung und diese enthaltende pharmazeutische praeparate | |
| DE1618747C3 (de) | Verfahren zur Herstellung von Delta hoch 5(10) 3-Keto-19-nor-steroiden | |
| AT257060B (de) | Verfahren zur Herstellung von neuen 3-Enoläthern der 6-Methyl-3-oxo-Δ<4>-steroide der Androstan-, 19-Norandrostan-, Pregnan- und 19-Norpregnanreihe | |
| DE1493107C3 (de) | 13-Äthyl-17 a-Äthinylgon-5-en- 3 ß, 17beta diolester, Verfahren zu ihrer Herstellung und diese enthaltende Arzneimittel | |
| DE1543266A1 (de) | Verfahren zur Herstellung von Steroiden der OEstranreihe | |
| DE1618859C (de) | Verfahren zur Herstellung von 3 keto lObeta methyl llbeta hydroxy Delta hoch 4 steroiden | |
| DE1926043C3 (de) | Neue Östrogenäther und Verfahren zu ihrer Herstellung | |
| AT230027B (de) | Verfahren zur Herstellung von 4-Methyl-3-oxo-Δ<4>-steroiden | |
| DE1493163C3 (de) | nalpha-Äthinyl-ie-methyl-Delta hoch 4-östren-3 beta-17 betadiole, Verfahren zu deren Herstellung sowie diese enthaltende Mittel | |
| DE1274125B (de) | Verfahren zur Herstellung von gegebenenfalls ringsubstituierten und Ringdoppelbindungen aufweisenden 17ª‰-Acetoacetoxysteroiden | |
| AT220764B (de) | Verfahren zur Herstellung von neuen 3-Oxo-Δ<1,4>-6-methyl- und 3-Oxo-Δ<1,4,6>-6-methylsteroiden | |
| DE1593448C (de) | 13beta-Äthyl-gon-4-en-3-on-thioketale, deren Herstellung und diese enthaltendes Mittel | |
| DE1046044B (de) | Verfahren zur Herstellung von 11ª‰, 17ª‡-Dioxy-21-fluor-1,4-pregnadien-3,20-dion und17ª‡-Oxy-21-fluor-1,4-pregnadien-3,11,20-trion | |
| DE1618747B2 (de) | Verfahren zur Herstellung von Delta hoch 5(10) 3-Keto-19-nor-steroiden | |
| DE1668687A1 (de) | Neue 18-Methyl-5alpha-H-androstane | |
| DE1084261B (de) | Verfahren zur Herstellung neuer Cyclopentanophenanthrenderivate | |
| DE1199767B (de) | Verfahren zur Herstellung von 1alpha-Methyl-A2-5alpha-androsten-17beta-olen |