DE1645496A1 - Verfahren zur Herstellung von aromatischen Polyestern - Google Patents
Verfahren zur Herstellung von aromatischen PolyesternInfo
- Publication number
- DE1645496A1 DE1645496A1 DE19661645496 DE1645496A DE1645496A1 DE 1645496 A1 DE1645496 A1 DE 1645496A1 DE 19661645496 DE19661645496 DE 19661645496 DE 1645496 A DE1645496 A DE 1645496A DE 1645496 A1 DE1645496 A1 DE 1645496A1
- Authority
- DE
- Germany
- Prior art keywords
- reaction
- polyester
- ester
- compound
- acid
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 229920000728 polyester Polymers 0.000 title claims description 52
- 238000000034 method Methods 0.000 title claims description 23
- 125000003118 aryl group Chemical group 0.000 title claims description 8
- 238000004519 manufacturing process Methods 0.000 title claims description 7
- 238000006243 chemical reaction Methods 0.000 claims description 49
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 claims description 48
- -1 aliphatic ester Chemical class 0.000 claims description 37
- 238000006068 polycondensation reaction Methods 0.000 claims description 21
- 229910052698 phosphorus Inorganic materials 0.000 claims description 17
- 239000011574 phosphorus Substances 0.000 claims description 16
- 150000002148 esters Chemical class 0.000 claims description 14
- 150000002604 lanthanum compounds Chemical class 0.000 claims description 14
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 claims description 12
- 239000002253 acid Substances 0.000 claims description 11
- 150000001875 compounds Chemical class 0.000 claims description 9
- WOZVHXUHUFLZGK-UHFFFAOYSA-N dimethyl terephthalate Chemical compound COC(=O)C1=CC=C(C(=O)OC)C=C1 WOZVHXUHUFLZGK-UHFFFAOYSA-N 0.000 claims description 8
- 229910052684 Cerium Inorganic materials 0.000 claims description 7
- ZMIGMASIKSOYAM-UHFFFAOYSA-N cerium Chemical compound [Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce] ZMIGMASIKSOYAM-UHFFFAOYSA-N 0.000 claims description 7
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 claims description 7
- KKEYFWRCBNTPAC-UHFFFAOYSA-N Terephthalic acid Chemical compound OC(=O)C1=CC=C(C(O)=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-N 0.000 claims description 4
- 229910052739 hydrogen Inorganic materials 0.000 claims description 4
- 239000001257 hydrogen Substances 0.000 claims description 4
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims description 4
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 3
- 229910052746 lanthanum Inorganic materials 0.000 claims description 3
- FZLIPJUXYLNCLC-UHFFFAOYSA-N lanthanum atom Chemical compound [La] FZLIPJUXYLNCLC-UHFFFAOYSA-N 0.000 claims description 3
- 125000000217 alkyl group Chemical group 0.000 claims description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 2
- 125000004432 carbon atom Chemical group C* 0.000 claims description 2
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 claims description 2
- 150000004820 halides Chemical class 0.000 claims description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 claims description 2
- 125000000286 phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 claims description 2
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 claims 1
- 150000007942 carboxylates Chemical class 0.000 claims 1
- 125000004437 phosphorous atom Chemical group 0.000 claims 1
- 239000003054 catalyst Substances 0.000 description 23
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 10
- 239000003381 stabilizer Substances 0.000 description 10
- ADCOVFLJGNWWNZ-UHFFFAOYSA-N antimony trioxide Chemical compound O=[Sb]O[Sb]=O ADCOVFLJGNWWNZ-UHFFFAOYSA-N 0.000 description 8
- 239000007795 chemical reaction product Substances 0.000 description 8
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 7
- 239000000203 mixture Substances 0.000 description 7
- 239000000047 product Substances 0.000 description 7
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- 230000015572 biosynthetic process Effects 0.000 description 6
- 150000003018 phosphorus compounds Chemical class 0.000 description 6
- 229920000642 polymer Polymers 0.000 description 6
- 230000003197 catalytic effect Effects 0.000 description 5
- 230000000694 effects Effects 0.000 description 5
- 238000005886 esterification reaction Methods 0.000 description 5
- 238000006116 polymerization reaction Methods 0.000 description 5
- 239000004408 titanium dioxide Substances 0.000 description 5
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 4
- 238000004040 coloring Methods 0.000 description 4
- AIPRAPZUGUTQKX-UHFFFAOYSA-N diethoxyphosphorylmethylbenzene Chemical compound CCOP(=O)(OCC)CC1=CC=CC=C1 AIPRAPZUGUTQKX-UHFFFAOYSA-N 0.000 description 4
- 238000002474 experimental method Methods 0.000 description 4
- JLRJWBUSTKIQQH-UHFFFAOYSA-K lanthanum(3+);triacetate Chemical compound [La+3].CC([O-])=O.CC([O-])=O.CC([O-])=O JLRJWBUSTKIQQH-UHFFFAOYSA-K 0.000 description 4
- 239000011541 reaction mixture Substances 0.000 description 4
- 150000003839 salts Chemical class 0.000 description 4
- 150000001785 cerium compounds Chemical class 0.000 description 3
- 230000032050 esterification Effects 0.000 description 3
- UEZVMMHDMIWARA-UHFFFAOYSA-M phosphonate Chemical compound [O-]P(=O)=O UEZVMMHDMIWARA-UHFFFAOYSA-M 0.000 description 3
- 230000035484 reaction time Effects 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- KKEYFWRCBNTPAC-UHFFFAOYSA-L terephthalate(2-) Chemical compound [O-]C(=O)C1=CC=C(C([O-])=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-L 0.000 description 3
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 2
- 239000005977 Ethylene Substances 0.000 description 2
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 2
- WNLRTRBMVRJNCN-UHFFFAOYSA-N adipic acid Chemical compound OC(=O)CCCCC(O)=O WNLRTRBMVRJNCN-UHFFFAOYSA-N 0.000 description 2
- QMKYBPDZANOJGF-UHFFFAOYSA-N benzene-1,3,5-tricarboxylic acid Chemical compound OC(=O)C1=CC(C(O)=O)=CC(C(O)=O)=C1 QMKYBPDZANOJGF-UHFFFAOYSA-N 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- 235000010290 biphenyl Nutrition 0.000 description 2
- 239000004305 biphenyl Substances 0.000 description 2
- 125000006267 biphenyl group Chemical group 0.000 description 2
- VSGNNIFQASZAOI-UHFFFAOYSA-L calcium acetate Chemical compound [Ca+2].CC([O-])=O.CC([O-])=O VSGNNIFQASZAOI-UHFFFAOYSA-L 0.000 description 2
- 239000001639 calcium acetate Substances 0.000 description 2
- 235000011092 calcium acetate Nutrition 0.000 description 2
- 229960005147 calcium acetate Drugs 0.000 description 2
- 238000002845 discoloration Methods 0.000 description 2
- 125000000524 functional group Chemical group 0.000 description 2
- QQVIHTHCMHWDBS-UHFFFAOYSA-N isophthalic acid Chemical compound OC(=O)C1=CC=CC(C(O)=O)=C1 QQVIHTHCMHWDBS-UHFFFAOYSA-N 0.000 description 2
- 230000004048 modification Effects 0.000 description 2
- 238000012986 modification Methods 0.000 description 2
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N phenylbenzene Natural products C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 2
- 239000002685 polymerization catalyst Substances 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 150000003254 radicals Chemical class 0.000 description 2
- 230000036647 reaction Effects 0.000 description 2
- CXMXRPHRNRROMY-UHFFFAOYSA-N sebacic acid Chemical compound OC(=O)CCCCCCCCC(O)=O CXMXRPHRNRROMY-UHFFFAOYSA-N 0.000 description 2
- 239000010802 sludge Substances 0.000 description 2
- 239000002002 slurry Substances 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Chemical compound O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- ZTLMGGCERZEQCS-UHFFFAOYSA-N (2,4-dimethyl-3-phenylpentan-3-yl)phosphonic acid Chemical compound CC(C)C(C1=CC=CC=C1)(C(C)C)P(=O)(O)O ZTLMGGCERZEQCS-UHFFFAOYSA-N 0.000 description 1
- HIIOYVOBADMCAS-UHFFFAOYSA-N (4-methylphenyl)methylphosphonic acid Chemical compound CC1=CC=C(CP(O)(O)=O)C=C1 HIIOYVOBADMCAS-UHFFFAOYSA-N 0.000 description 1
- ISPYQTSUDJAMAB-UHFFFAOYSA-N 2-chlorophenol Chemical compound OC1=CC=CC=C1Cl ISPYQTSUDJAMAB-UHFFFAOYSA-N 0.000 description 1
- BYDYILQCRDXHLB-UHFFFAOYSA-N 3,5-dimethylpyridine-2-carbaldehyde Chemical compound CC1=CN=C(C=O)C(C)=C1 BYDYILQCRDXHLB-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- OGBVRMYSNSKIEF-UHFFFAOYSA-N Benzylphosphonic acid Chemical compound OP(O)(=O)CC1=CC=CC=C1 OGBVRMYSNSKIEF-UHFFFAOYSA-N 0.000 description 1
- BTBUEUYNUDRHOZ-UHFFFAOYSA-N Borate Chemical compound [O-]B([O-])[O-] BTBUEUYNUDRHOZ-UHFFFAOYSA-N 0.000 description 1
- 101100462138 Brassica napus OlnB1 gene Proteins 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- 229910002651 NO3 Inorganic materials 0.000 description 1
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 1
- JMKATISBVVWRSS-UHFFFAOYSA-N OP(O)=O.CC1=CC=CC=C1 Chemical compound OP(O)=O.CC1=CC=CC=C1 JMKATISBVVWRSS-UHFFFAOYSA-N 0.000 description 1
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 101150048735 POL3 gene Proteins 0.000 description 1
- ABLZXFCXXLZCGV-UHFFFAOYSA-N Phosphorous acid Chemical compound OP(O)=O ABLZXFCXXLZCGV-UHFFFAOYSA-N 0.000 description 1
- 150000001242 acetic acid derivatives Chemical class 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000001361 adipic acid Substances 0.000 description 1
- 235000011037 adipic acid Nutrition 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 150000001339 alkali metal compounds Chemical class 0.000 description 1
- 150000001450 anions Chemical class 0.000 description 1
- 229910052787 antimony Inorganic materials 0.000 description 1
- WATWJIUSRGPENY-UHFFFAOYSA-N antimony atom Chemical compound [Sb] WATWJIUSRGPENY-UHFFFAOYSA-N 0.000 description 1
- 150000005840 aryl radicals Chemical class 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- KSBFFOYIOAYXEH-UHFFFAOYSA-N benzoic acid;2-hydroxypropane-1,2,3-tricarboxylic acid Chemical compound OC(=O)C1=CC=CC=C1.OC(=O)CC(O)(C(O)=O)CC(O)=O KSBFFOYIOAYXEH-UHFFFAOYSA-N 0.000 description 1
- VYLVYHXQOHJDJL-UHFFFAOYSA-K cerium trichloride Chemical compound Cl[Ce](Cl)Cl VYLVYHXQOHJDJL-UHFFFAOYSA-K 0.000 description 1
- VGBWDOLBWVJTRZ-UHFFFAOYSA-K cerium(3+);triacetate Chemical compound [Ce+3].CC([O-])=O.CC([O-])=O.CC([O-])=O VGBWDOLBWVJTRZ-UHFFFAOYSA-K 0.000 description 1
- 239000007809 chemical reaction catalyst Substances 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- WVIIMZNLDWSIRH-UHFFFAOYSA-N cyclohexylcyclohexane Chemical group C1CCCCC1C1CCCCC1 WVIIMZNLDWSIRH-UHFFFAOYSA-N 0.000 description 1
- 230000006866 deterioration Effects 0.000 description 1
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- VNGOYPQMJFJDLV-UHFFFAOYSA-N dimethyl benzene-1,3-dicarboxylate Chemical compound COC(=O)C1=CC=CC(C(=O)OC)=C1 VNGOYPQMJFJDLV-UHFFFAOYSA-N 0.000 description 1
- 239000000835 fiber Substances 0.000 description 1
- 238000011049 filling Methods 0.000 description 1
- 229930182470 glycoside Natural products 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 238000011835 investigation Methods 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 229910052747 lanthanoid Inorganic materials 0.000 description 1
- 150000002602 lanthanoids Chemical class 0.000 description 1
- FYDKNKUEBJQCCN-UHFFFAOYSA-N lanthanum(3+);trinitrate Chemical compound [La+3].[O-][N+]([O-])=O.[O-][N+]([O-])=O.[O-][N+]([O-])=O FYDKNKUEBJQCCN-UHFFFAOYSA-N 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 150000002736 metal compounds Chemical class 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 239000000178 monomer Substances 0.000 description 1
- KYTZHLUVELPASH-UHFFFAOYSA-N naphthalene-1,2-dicarboxylic acid Chemical compound C1=CC=CC2=C(C(O)=O)C(C(=O)O)=CC=C21 KYTZHLUVELPASH-UHFFFAOYSA-N 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- WXZMFSXDPGVJKK-UHFFFAOYSA-N pentaerythritol Chemical compound OCC(CO)(CO)CO WXZMFSXDPGVJKK-UHFFFAOYSA-N 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- BSMFIANCGKWVPR-UHFFFAOYSA-N phosphoric acid propylbenzene Chemical compound P(O)(O)(O)=O.C(CC)C1=CC=CC=C1 BSMFIANCGKWVPR-UHFFFAOYSA-N 0.000 description 1
- XNGIFLGASWRNHJ-UHFFFAOYSA-L phthalate(2-) Chemical compound [O-]C(=O)C1=CC=CC=C1C([O-])=O XNGIFLGASWRNHJ-UHFFFAOYSA-L 0.000 description 1
- 229920000139 polyethylene terephthalate Polymers 0.000 description 1
- 239000005020 polyethylene terephthalate Substances 0.000 description 1
- 229910052761 rare earth metal Inorganic materials 0.000 description 1
- 238000010517 secondary reaction Methods 0.000 description 1
- 238000004904 shortening Methods 0.000 description 1
- 230000000087 stabilizing effect Effects 0.000 description 1
- 238000010186 staining Methods 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 238000012360 testing method Methods 0.000 description 1
- 150000003609 titanium compounds Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G63/00—Macromolecular compounds obtained by reactions forming a carboxylic ester link in the main chain of the macromolecule
- C08G63/78—Preparation processes
- C08G63/82—Preparation processes characterised by the catalyst used
- C08G63/84—Boron, aluminium, gallium, indium, thallium, rare-earth metals, or compounds thereof
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G63/00—Macromolecular compounds obtained by reactions forming a carboxylic ester link in the main chain of the macromolecule
- C08G63/78—Preparation processes
- C08G63/82—Preparation processes characterised by the catalyst used
- C08G63/87—Non-metals or inter-compounds thereof
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Polyesters Or Polycarbonates (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP5096465 | 1965-08-21 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1645496A1 true DE1645496A1 (de) | 1970-05-14 |
Family
ID=12873486
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19661645496 Pending DE1645496A1 (de) | 1965-08-21 | 1966-08-22 | Verfahren zur Herstellung von aromatischen Polyestern |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US3489722A (enExample) |
| CH (1) | CH473849A (enExample) |
| DE (1) | DE1645496A1 (enExample) |
| GB (1) | GB1155005A (enExample) |
| NL (1) | NL146856B (enExample) |
Families Citing this family (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3689623A (en) * | 1969-12-17 | 1972-09-05 | Asahi Chemical Ind | Method for preparing fibers of polyethylene-1,2-diphenoxyethane-4,4{40 -dicarboxylate |
| US3692867A (en) * | 1971-03-10 | 1972-09-19 | Allied Chem | Filament comprising a polymer blend of polyester and polyanide containing an organic phosphorus compound |
| JPS5273996A (en) * | 1975-12-18 | 1977-06-21 | Teijin Ltd | Preparation of polyesters |
| CH594006A5 (enExample) * | 1976-02-02 | 1977-12-30 | Ciba Geigy Ag | |
| US4101326A (en) * | 1976-02-09 | 1978-07-18 | Eastman Kodak Company | Process for making stabilized polyesters used in radiation-sensitive compositions for lithographic plates having improved wear life including hindered phenols and phosphoric acid esters |
| JPS5379935A (en) * | 1976-12-24 | 1978-07-14 | Adeka Argus Chem Co Ltd | Stabilized synthetic resin composition |
| CH635814A5 (de) * | 1978-09-29 | 1983-04-29 | Ciba Geigy Ag | Umesterungsverfahren. |
| JPS573825A (en) * | 1980-06-09 | 1982-01-09 | Unitika Ltd | Production of heat-stable polyester |
| FR2566395B1 (fr) * | 1984-06-25 | 1986-11-21 | Rhone Poulenc Spec Chim | Procede d'obtention de composes organiques a groupe alkoxyalkylidene |
| US5747606A (en) * | 1993-04-21 | 1998-05-05 | Ciba Specialty Chemicals Corporation | Increasing the molecular weight of polyesters and premix useful for this process |
| US5840957A (en) * | 1998-03-16 | 1998-11-24 | E. I. Du Pont De Nemours And Company | Transesterification process using lanthanum compound catalyst |
| US20090186177A1 (en) * | 2008-01-22 | 2009-07-23 | Eastman Chemical Company | Polyester melt phase products and process for making the same |
| JP6600440B2 (ja) * | 2012-06-29 | 2019-10-30 | エフアールエックス ポリマーズ、インク. | ポリエステルコ−ホスホネート |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2643989A (en) * | 1949-09-20 | 1953-06-30 | Du Pont | Cerium esterification catalyst |
| US2998412A (en) * | 1953-02-27 | 1961-08-29 | Ici Ltd | Process for manufacture of polyethylene terephthalate with zinc acetateantimony trifluoride catalyst system |
| US2820023A (en) * | 1954-11-15 | 1958-01-14 | Du Pont | Ester interchange reaction using a lanthanum catalyst |
| US2916474A (en) * | 1955-12-16 | 1959-12-08 | Du Pont | Process of preparing polymeric terephthalic esters by interchange between a glycol and a dialkyl ester of terephthalic acid |
| US3028366A (en) * | 1956-06-26 | 1962-04-03 | Du Pont | Catalytic process for the preparation of substantially colorless polymeric glycol terephthalates |
| NL280017A (enExample) * | 1961-06-24 | |||
| US3110547A (en) * | 1961-07-26 | 1963-11-12 | Du Pont | Polymerization process |
| US3245959A (en) * | 1962-04-04 | 1966-04-12 | Socony Mobil Oil Co Inc | Catalytic copolyesterification |
| FR1370632A (fr) * | 1962-05-16 | 1964-08-28 | Du Pont | Préparation de polyesters linéaires polymères, en particulier d'esters téréphtaliques, en présence de composés organiques du phosphore |
-
1966
- 1966-08-15 US US572235A patent/US3489722A/en not_active Expired - Lifetime
- 1966-08-19 GB GB37345/66A patent/GB1155005A/en not_active Expired
- 1966-08-19 NL NL666611742A patent/NL146856B/xx unknown
- 1966-08-22 CH CH1207566A patent/CH473849A/de not_active IP Right Cessation
- 1966-08-22 DE DE19661645496 patent/DE1645496A1/de active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| CH473849A (de) | 1969-06-15 |
| NL146856B (nl) | 1975-08-15 |
| NL6611742A (enExample) | 1967-02-22 |
| US3489722A (en) | 1970-01-13 |
| GB1155005A (en) | 1969-06-11 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE69737259T2 (de) | Verfahren zur herstellung von copolyestern aus terephthalsaure, ethylenglycol und 1,4-cyclohexanedimethanol mit neutralen farbton, hoher klarheit und erhöhter helligkeit | |
| DE4205093C2 (de) | Verfahren zur Herstellung eines Polymers auf Polybutylenterephthalat-Basis | |
| EP0990007B1 (de) | Verfahren zur herstellung von polyestern und copolyestern | |
| DE2708790C2 (de) | Lineare Homo- oder Copolyester, Verfahren zur Herstellung der Polyester und ihre Verwendung | |
| DE1645496A1 (de) | Verfahren zur Herstellung von aromatischen Polyestern | |
| DE2646218B2 (de) | Phosphorhaltige Verbindungen, Verfahren zu deren Herstellung und Verwendung derselben zur Flammfestmachung | |
| DE2147835B2 (de) | Verfahren zur herstellung linearer polyester | |
| DE19705249A1 (de) | Verfahren zur Herstellung von Polypropylenterphthalat | |
| DE2346787A1 (de) | Schwer entflammbare lineare polyester, sowie geformte gebilde daraus | |
| DE2236037A1 (de) | Schwer entflammbare faeden und fasern aus polyester | |
| DE2454189A1 (de) | Verfahren zur herstellung schwer entflammbarer linearer polyester | |
| DE2434213A1 (de) | Verfahren zur herstellung von polyestern | |
| DE60008568T2 (de) | Verfahren zur herstellung von metallischen salzen von 5-sulfoisophthalatglykolatestern und oxysulfonierte polyester davon | |
| DE2724949A1 (de) | Polymerisationsverfahren | |
| DE2213500B2 (de) | Verfahren zur herstellung von linearen, hochmolekularen polyestern | |
| DE2600701A1 (de) | Flammwidrige polyester und ihre verwendung | |
| DE1301551C2 (de) | Verfahren zur herstellung von hochmolekularen polyestern | |
| DE69917661T2 (de) | Kristalline polyesterharze und verfahren zu ihrer herstellung | |
| DE2113442B2 (de) | Verfahren zur herstellung von im wesentlichen linearen, hochmolekularen polyestern | |
| AT259232B (de) | Verfahren zur Herstellung von faser und filmbildenden Polyestern | |
| DE4443648C2 (de) | Verfahren zur Herstellung von Polyestern und Copolyestern | |
| DE2802486B2 (de) | Verfahren zur Herstellung von fadenbildenden Polyestern | |
| DE69612709T2 (de) | Polyesterharz mit verbesserter Farbekarakteristik | |
| EP0424640B1 (de) | Verfahren zur Herstellung eines thermoplastisch verarbeitbaren, aromatischen Polyamids | |
| DE69921365T2 (de) | Katalysatormischung für die darstellung von polyestern |