DE1643650B - - Google Patents
Info
- Publication number
- DE1643650B DE1643650B DE1643650B DE 1643650 B DE1643650 B DE 1643650B DE 1643650 B DE1643650 B DE 1643650B
- Authority
- DE
- Germany
- Prior art keywords
- dimethyl
- percent
- weight
- parts
- acid monoester
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000006243 chemical reaction Methods 0.000 claims description 14
- 239000002253 acid Substances 0.000 claims description 12
- 238000000034 method Methods 0.000 claims description 10
- 229910001861 calcium hydroxide Inorganic materials 0.000 claims description 7
- 229910001863 barium hydroxide Inorganic materials 0.000 claims description 4
- 238000007323 disproportionation reaction Methods 0.000 claims description 4
- UUCCCPNEFXQJEL-UHFFFAOYSA-L strontium dihydroxide Chemical compound [OH-].[OH-].[Sr+2] UUCCCPNEFXQJEL-UHFFFAOYSA-L 0.000 claims description 4
- 229910001866 strontium hydroxide Inorganic materials 0.000 claims description 4
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium atom Chemical compound [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 claims description 3
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 claims description 2
- 239000011575 calcium Substances 0.000 claims description 2
- 238000002360 preparation method Methods 0.000 claims description 2
- JJMOMMLADQPZNY-UHFFFAOYSA-N 3-hydroxy-2,2-dimethylpropanal Chemical compound OCC(C)(C)C=O JJMOMMLADQPZNY-UHFFFAOYSA-N 0.000 description 13
- 239000000203 mixture Substances 0.000 description 12
- 239000003054 catalyst Substances 0.000 description 11
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 9
- 229910052740 iodine Inorganic materials 0.000 description 9
- 239000011630 iodine Substances 0.000 description 9
- AXCZMVOFGPJBDE-UHFFFAOYSA-L calcium dihydroxide Chemical class [OH-].[OH-].[Ca+2] AXCZMVOFGPJBDE-UHFFFAOYSA-L 0.000 description 6
- 235000011116 calcium hydroxide Nutrition 0.000 description 6
- 238000003756 stirring Methods 0.000 description 6
- CZZVAVMGKRNEAT-UHFFFAOYSA-N 2,2-dimethylpropane-1,3-diol;3-hydroxy-2,2-dimethylpropanoic acid Chemical compound OCC(C)(C)CO.OCC(C)(C)C(O)=O CZZVAVMGKRNEAT-UHFFFAOYSA-N 0.000 description 5
- RDFQSFOGKVZWKF-UHFFFAOYSA-N 3-hydroxy-2,2-dimethylpropanoic acid Chemical compound OCC(C)(C)C(O)=O RDFQSFOGKVZWKF-UHFFFAOYSA-N 0.000 description 5
- 239000000920 calcium hydroxide Substances 0.000 description 5
- 229920000728 polyester Polymers 0.000 description 5
- 239000011541 reaction mixture Substances 0.000 description 5
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- AMIMRNSIRUDHCM-UHFFFAOYSA-N Isopropylaldehyde Chemical compound CC(C)C=O AMIMRNSIRUDHCM-UHFFFAOYSA-N 0.000 description 4
- 239000007795 chemical reaction product Substances 0.000 description 4
- 238000004587 chromatography analysis Methods 0.000 description 4
- 239000000706 filtrate Substances 0.000 description 4
- 239000007789 gas Substances 0.000 description 4
- YPFDHNVEDLHUCE-UHFFFAOYSA-N 1,3-propanediol Substances OCCCO YPFDHNVEDLHUCE-UHFFFAOYSA-N 0.000 description 3
- 229940035437 1,3-propanediol Drugs 0.000 description 3
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 3
- 238000009835 boiling Methods 0.000 description 3
- 150000001875 compounds Chemical class 0.000 description 3
- 150000002148 esters Chemical class 0.000 description 3
- FPYJFEHAWHCUMM-UHFFFAOYSA-N maleic anhydride Chemical compound O=C1OC(=O)C=C1 FPYJFEHAWHCUMM-UHFFFAOYSA-N 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 229920000166 polytrimethylene carbonate Polymers 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- HNWHVVWRJAXEEC-UHFFFAOYSA-N (3-hydroxy-2,2-dimethylpropyl) 2-methylpropanoate Chemical compound CC(C)C(=O)OCC(C)(C)CO HNWHVVWRJAXEEC-UHFFFAOYSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- RQPZNWPYLFFXCP-UHFFFAOYSA-L barium dihydroxide Chemical compound [OH-].[OH-].[Ba+2] RQPZNWPYLFFXCP-UHFFFAOYSA-L 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 238000009833 condensation Methods 0.000 description 2
- 230000005494 condensation Effects 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- 238000006136 alcoholysis reaction Methods 0.000 description 1
- 150000001447 alkali salts Chemical class 0.000 description 1
- 229910052788 barium Inorganic materials 0.000 description 1
- 238000004508 fractional distillation Methods 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 229910000000 metal hydroxide Inorganic materials 0.000 description 1
- 150000004692 metal hydroxides Chemical class 0.000 description 1
- 239000000178 monomer Substances 0.000 description 1
- IUGYQRQAERSCNH-UHFFFAOYSA-N pivalic acid Chemical compound CC(C)(C)C(O)=O IUGYQRQAERSCNH-UHFFFAOYSA-N 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 239000004014 plasticizer Substances 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- ULWHHBHJGPPBCO-UHFFFAOYSA-N propane-1,1-diol Chemical compound CCC(O)O ULWHHBHJGPPBCO-UHFFFAOYSA-N 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 238000007086 side reaction Methods 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 229910052712 strontium Inorganic materials 0.000 description 1
- CIOAGBVUUVVLOB-UHFFFAOYSA-N strontium atom Chemical compound [Sr] CIOAGBVUUVVLOB-UHFFFAOYSA-N 0.000 description 1
- 229920003002 synthetic resin Polymers 0.000 description 1
- 239000000057 synthetic resin Substances 0.000 description 1
- 239000002966 varnish Substances 0.000 description 1
- 239000002023 wood Substances 0.000 description 1
Family
ID=
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2500311A1 (de) * | 1975-01-07 | 1976-07-08 | Basf Ag | Verfahren zur herstellung von propandiol-(1,3)-mono-(3'-hydroxy)-propionaten |
| DE2500312A1 (de) * | 1975-01-07 | 1976-07-08 | Basf Ag | Verfahren zur herstellung von butandiol-(1,3)-3-mono-(3'-hydroxybutyraten) |
| DE2500310A1 (de) * | 1975-01-07 | 1976-07-08 | Basf Ag | Verfahren zur herstellung von butandiol-(1,3)-1-mono-(3'-hydroxybutyraten) |
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2500311A1 (de) * | 1975-01-07 | 1976-07-08 | Basf Ag | Verfahren zur herstellung von propandiol-(1,3)-mono-(3'-hydroxy)-propionaten |
| DE2500312A1 (de) * | 1975-01-07 | 1976-07-08 | Basf Ag | Verfahren zur herstellung von butandiol-(1,3)-3-mono-(3'-hydroxybutyraten) |
| DE2500310A1 (de) * | 1975-01-07 | 1976-07-08 | Basf Ag | Verfahren zur herstellung von butandiol-(1,3)-1-mono-(3'-hydroxybutyraten) |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2507461C3 (de) | Verfahren zur Herstellung von 2,2- Dimethylolalkanalen | |
| DE2533920C2 (de) | Verfahren zur Herstellung von Resorcinen | |
| DE2155495A1 (de) | Verfahren zur herstellung von benzylidenverbindungen | |
| EP0005471B1 (de) | Verfahren zur Herstellung von 3-Hydroxy-2,2,4-trimethylpentylisobutyrat | |
| DE1643650C (OSRAM) | ||
| DE102006009838A1 (de) | Verfahren zur Hydrierung von Methylolalkanalen | |
| EP0100019A1 (de) | Verfahren zur Herstellung von alpha-substituierten beta-Dicarbonyl-, beta-Cyancarbonyl- und beta-Dicyanverbindungen | |
| DE2812365A1 (de) | Verfahren zur herstellung von estern von m-phenoxybenzylalkohol und von alpha- cyano- und alpha-aethinylderivaten davon mit carbonsaeuren | |
| EP0763517B1 (de) | Verfahren zur Herstellung von Hydroxypivalinsäureneopentylglykolester | |
| DE1958463C3 (de) | Verfahren zur Herstellung von 2,2-Dimethyl-1,3-propandiol-hy droxypivalinsäuremonoester | |
| EP0395984A2 (de) | Verfahren zur Herstellung von 2-Cyan-3,3-diarylacrylsäureestern | |
| DE1643650A1 (de) | Verfahren zur Herstellung von 2,2-Dimethyl-1,3-propandiolhydroxypivalinsaeuremonoester | |
| EP0561213B1 (de) | Verfahren zur Herstellung von Hydroxypivalinsäureneopentylglykolester | |
| EP0155506B1 (de) | Verbessertes Verfahren zur Herstellung von Riboflavin | |
| EP0004405B1 (de) | Verfahren zur Herstellung von hochreinem Tetrahydrophthalsäureanhydrid | |
| DE2305629C2 (de) | Verfahren zur Herstellung von Isopiperitenol | |
| DE2233897C3 (de) | Verfahren zur Herstellung von 2,2-Dimethyl-13-propandiolhydroxy-pivalinsäuremonoester | |
| DE1127888B (de) | Verfahren zur Herstellung von Vinylestern hoeherer Carbonsaeuren | |
| DE2108926C3 (de) | Verfahren zur Herstellung von 3-Acyl-4-hydroxy-buten-(2)-saurelactonen | |
| DE2425845C2 (de) | Verfahren zur Herstellung von 4- Acetoxybutyraldehyd und/oder 4-Acetoxybutanol | |
| DE19813338A1 (de) | Verfahren zur Herstellung von Hydroxybenzoesäureestern von Oxoalkoholen | |
| DE1643670C3 (de) | Verfahren zur Reinigung von 2,2-Dimethyl-1,3-propandiol-monohydroxypivalinsäureester | |
| DE2921220C2 (de) | Verfahren zur Herstellung von 2.3.4.4.-Tetrachlor-3-butensäurealkylestern | |
| DE2000872A1 (de) | Verfahren zur Herstellung von 2,2-Dimethylpropandiol-1,3 | |
| DE1768306C (de) | Verfahren zur Herstellung von Estern des 2-Hydroxymethyl-norbornen-(5) |