DE1618663C - - Google Patents
Info
- Publication number
- DE1618663C DE1618663C DE19671618663 DE1618663A DE1618663C DE 1618663 C DE1618663 C DE 1618663C DE 19671618663 DE19671618663 DE 19671618663 DE 1618663 A DE1618663 A DE 1618663A DE 1618663 C DE1618663 C DE 1618663C
- Authority
- DE
- Germany
- Prior art keywords
- fluorophenyl
- hydroxy
- benzoic acid
- fluoro
- acid
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- -1 biphenyl compound Chemical class 0.000 claims description 29
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N diphenyl Chemical class C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 claims description 15
- 239000004305 biphenyl Substances 0.000 claims description 10
- 235000010290 biphenyl Nutrition 0.000 claims description 10
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 5
- 231100000252 nontoxic Toxicity 0.000 claims description 5
- 230000003000 nontoxic effect Effects 0.000 claims description 5
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 28
- 150000001875 compounds Chemical class 0.000 description 22
- 239000001257 hydrogen Substances 0.000 description 19
- 229910052739 hydrogen Inorganic materials 0.000 description 19
- 238000006243 chemical reaction Methods 0.000 description 18
- 239000000203 mixture Substances 0.000 description 18
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 17
- UHOVQNZJYSORNB-UHFFFAOYSA-N monobenzene Natural products C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 16
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 15
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 15
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 15
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 13
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 12
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 12
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 11
- WPYMKLBDIGXBTP-UHFFFAOYSA-N Benzoic acid Natural products OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 10
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 10
- 239000011541 reaction mixture Substances 0.000 description 10
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 9
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 9
- RDOXTESZEPMUJZ-UHFFFAOYSA-N anisole Chemical compound COC1=CC=CC=C1 RDOXTESZEPMUJZ-UHFFFAOYSA-N 0.000 description 8
- 239000003054 catalyst Substances 0.000 description 8
- 238000000034 method Methods 0.000 description 8
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 8
- AZNKKZHZGDZSIF-UHFFFAOYSA-N 1-fluoro-2-methoxy-4-nitrobenzene Chemical compound COC1=CC([N+]([O-])=O)=CC=C1F AZNKKZHZGDZSIF-UHFFFAOYSA-N 0.000 description 7
- 241000700159 Rattus Species 0.000 description 7
- 230000003110 anti-inflammatory effect Effects 0.000 description 7
- 239000000047 product Substances 0.000 description 7
- QSJNKJGPJVOGPK-UHFFFAOYSA-N 4-(4-fluorophenyl)phenol Chemical compound C1=CC(O)=CC=C1C1=CC=C(F)C=C1 QSJNKJGPJVOGPK-UHFFFAOYSA-N 0.000 description 6
- CUXSCHTUWINJSV-UHFFFAOYSA-N 5-(4-fluorophenyl)-2-hydroxybenzoic acid Chemical compound C1=C(O)C(C(=O)O)=CC(C=2C=CC(F)=CC=2)=C1 CUXSCHTUWINJSV-UHFFFAOYSA-N 0.000 description 6
- 239000005711 Benzoic acid Substances 0.000 description 6
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 6
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 6
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 6
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 6
- 239000002253 acid Substances 0.000 description 6
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 6
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 6
- XKSAJZSJKURQRX-UHFFFAOYSA-N 2-acetyloxy-5-(4-fluorophenyl)benzoic acid Chemical compound C1=C(C(O)=O)C(OC(=O)C)=CC=C1C1=CC=C(F)C=C1 XKSAJZSJKURQRX-UHFFFAOYSA-N 0.000 description 5
- 229910052783 alkali metal Inorganic materials 0.000 description 5
- 235000010233 benzoic acid Nutrition 0.000 description 5
- 239000001569 carbon dioxide Substances 0.000 description 5
- 229910002092 carbon dioxide Inorganic materials 0.000 description 5
- 239000011737 fluorine Substances 0.000 description 5
- 229910052731 fluorine Inorganic materials 0.000 description 5
- 238000002844 melting Methods 0.000 description 5
- 230000008018 melting Effects 0.000 description 5
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 5
- 229910052753 mercury Inorganic materials 0.000 description 5
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 5
- 150000003839 salts Chemical class 0.000 description 5
- 239000007858 starting material Substances 0.000 description 5
- 239000000725 suspension Substances 0.000 description 5
- FNMIEFSTWXHDLF-UHFFFAOYSA-N 4-(4-fluorophenyl)-2-methylphenol Chemical compound C1=C(O)C(C)=CC(C=2C=CC(F)=CC=2)=C1 FNMIEFSTWXHDLF-UHFFFAOYSA-N 0.000 description 4
- PXQNHLSBUFXIRN-UHFFFAOYSA-N 5-(4-fluorophenyl)-2-hydroxy-3-methylbenzoic acid Chemical compound OC(=O)C1=C(O)C(C)=CC(C=2C=CC(F)=CC=2)=C1 PXQNHLSBUFXIRN-UHFFFAOYSA-N 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 4
- BSYNRYMUTXBXSQ-UHFFFAOYSA-N Aspirin Chemical compound CC(=O)OC1=CC=CC=C1C(O)=O BSYNRYMUTXBXSQ-UHFFFAOYSA-N 0.000 description 4
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 4
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 4
- 206010030113 Oedema Diseases 0.000 description 4
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 4
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 4
- WNHLKDZSGFHPGE-UHFFFAOYSA-N [4-(4-fluorophenyl)-2-methylphenyl] acetate Chemical compound C1=C(C)C(OC(=O)C)=CC=C1C1=CC=C(F)C=C1 WNHLKDZSGFHPGE-UHFFFAOYSA-N 0.000 description 4
- 229960001138 acetylsalicylic acid Drugs 0.000 description 4
- 239000000460 chlorine Substances 0.000 description 4
- 239000012043 crude product Substances 0.000 description 4
- 239000012954 diazonium Substances 0.000 description 4
- 210000002683 foot Anatomy 0.000 description 4
- 239000007789 gas Substances 0.000 description 4
- 150000002431 hydrogen Chemical class 0.000 description 4
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 4
- UZKWTJUDCOPSNM-UHFFFAOYSA-N methoxybenzene Substances CCCCOC=C UZKWTJUDCOPSNM-UHFFFAOYSA-N 0.000 description 4
- 229910000027 potassium carbonate Inorganic materials 0.000 description 4
- 238000002360 preparation method Methods 0.000 description 4
- 150000003254 radicals Chemical class 0.000 description 4
- 229910052708 sodium Inorganic materials 0.000 description 4
- 239000011734 sodium Substances 0.000 description 4
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 4
- CXILAOBEGVDMBB-UHFFFAOYSA-N 4-(4-fluorophenyl)-2-(hydroxymethyl)phenol Chemical compound FC1=CC=C(C=C1)C1=CC(=C(C=C1)O)CO CXILAOBEGVDMBB-UHFFFAOYSA-N 0.000 description 3
- DARMHTVGCSDMFK-UHFFFAOYSA-N 4-fluoro-2-methoxy-1-(4-nitrophenyl)benzene Chemical group COC1=CC(F)=CC=C1C1=CC=C([N+]([O-])=O)C=C1 DARMHTVGCSDMFK-UHFFFAOYSA-N 0.000 description 3
- XAACOEWSHBIFGJ-UHFFFAOYSA-N 4-fluoro-3-methoxyaniline Chemical compound COC1=CC(N)=CC=C1F XAACOEWSHBIFGJ-UHFFFAOYSA-N 0.000 description 3
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N N-phenyl amine Natural products NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- BBTUVQLIPJLWGC-UHFFFAOYSA-N [2-acetyloxy-5-(4-fluorophenyl)phenyl]methyl acetate Chemical compound C(C)(=O)OC1=C(C=C(C=C1)C1=CC=C(C=C1)F)COC(C)=O BBTUVQLIPJLWGC-UHFFFAOYSA-N 0.000 description 3
- 150000001340 alkali metals Chemical class 0.000 description 3
- 238000009835 boiling Methods 0.000 description 3
- IJGRMHOSHXDMSA-UHFFFAOYSA-O diazynium Chemical compound [NH+]#N IJGRMHOSHXDMSA-UHFFFAOYSA-O 0.000 description 3
- 230000005764 inhibitory process Effects 0.000 description 3
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 3
- 235000019341 magnesium sulphate Nutrition 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- 239000000741 silica gel Substances 0.000 description 3
- 229910002027 silica gel Inorganic materials 0.000 description 3
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 3
- 235000017557 sodium bicarbonate Nutrition 0.000 description 3
- 235000010288 sodium nitrite Nutrition 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- KJVBJICWGQIMOZ-UHFFFAOYSA-N 2-fluoro-5-nitroaniline Chemical compound NC1=CC([N+]([O-])=O)=CC=C1F KJVBJICWGQIMOZ-UHFFFAOYSA-N 0.000 description 2
- WFRLFZAMCVAQLN-UHFFFAOYSA-N 2-fluoro-5-nitrophenol Chemical compound OC1=CC([N+]([O-])=O)=CC=C1F WFRLFZAMCVAQLN-UHFFFAOYSA-N 0.000 description 2
- HLFNTBOBHLRCOS-UHFFFAOYSA-N 2-hydroxy-5-(2,3,4,5,6-pentafluorophenyl)benzoic acid Chemical compound C1=C(O)C(C(=O)O)=CC(C=2C(=C(F)C(F)=C(F)C=2F)F)=C1 HLFNTBOBHLRCOS-UHFFFAOYSA-N 0.000 description 2
- IAHMUPKNJUUCHO-UHFFFAOYSA-N 4-(4-fluoro-2-methoxyphenyl)aniline Chemical compound COC1=CC(F)=CC=C1C1=CC=C(N)C=C1 IAHMUPKNJUUCHO-UHFFFAOYSA-N 0.000 description 2
- LFRHISOKBMDTDQ-UHFFFAOYSA-N 5-(2-fluorophenyl)-2-hydroxybenzoic acid Chemical compound C1=C(O)C(C(=O)O)=CC(C=2C(=CC=CC=2)F)=C1 LFRHISOKBMDTDQ-UHFFFAOYSA-N 0.000 description 2
- IGUSMAQARLWHHZ-UHFFFAOYSA-N 5-(3-fluorophenyl)-2-hydroxybenzoic acid Chemical compound C1=C(O)C(C(=O)O)=CC(C=2C=C(F)C=CC=2)=C1 IGUSMAQARLWHHZ-UHFFFAOYSA-N 0.000 description 2
- AYUFGEHQAPDFIQ-UHFFFAOYSA-N 5-(4-fluoro-2-methoxyphenyl)-2-hydroxybenzoic acid Chemical compound COC1=CC(F)=CC=C1C1=CC=C(O)C(C(O)=O)=C1 AYUFGEHQAPDFIQ-UHFFFAOYSA-N 0.000 description 2
- WVDDGKGOMKODPV-UHFFFAOYSA-N Benzyl alcohol Chemical compound OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- 229960000583 acetic acid Drugs 0.000 description 2
- 229910052782 aluminium Inorganic materials 0.000 description 2
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 2
- 238000004458 analytical method Methods 0.000 description 2
- 229960004217 benzyl alcohol Drugs 0.000 description 2
- LLEMOWNGBBNAJR-UHFFFAOYSA-N biphenyl-2-ol Chemical compound OC1=CC=CC=C1C1=CC=CC=C1 LLEMOWNGBBNAJR-UHFFFAOYSA-N 0.000 description 2
- 230000037396 body weight Effects 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- OEYIOHPDSNJKLS-UHFFFAOYSA-N choline Chemical compound C[N+](C)(C)CCO OEYIOHPDSNJKLS-UHFFFAOYSA-N 0.000 description 2
- 229960001231 choline Drugs 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 238000002425 crystallisation Methods 0.000 description 2
- 230000008025 crystallization Effects 0.000 description 2
- HUPFGZXOMWLGNK-UHFFFAOYSA-N diflunisal Chemical compound C1=C(O)C(C(=O)O)=CC(C=2C(=CC(F)=CC=2)F)=C1 HUPFGZXOMWLGNK-UHFFFAOYSA-N 0.000 description 2
- 201000010099 disease Diseases 0.000 description 2
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 239000000284 extract Substances 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 239000012362 glacial acetic acid Substances 0.000 description 2
- 150000004820 halides Chemical class 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 2
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 2
- 239000012442 inert solvent Substances 0.000 description 2
- OWFXIOWLTKNBAP-UHFFFAOYSA-N isoamyl nitrite Chemical compound CC(C)CCON=O OWFXIOWLTKNBAP-UHFFFAOYSA-N 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 239000000155 melt Substances 0.000 description 2
- CDIIKUBOHXOKOT-UHFFFAOYSA-N methyl 5-(4-fluorophenyl)-2-hydroxybenzoate Chemical compound C1=C(O)C(C(=O)OC)=CC(C=2C=CC(F)=CC=2)=C1 CDIIKUBOHXOKOT-UHFFFAOYSA-N 0.000 description 2
- JZMJDSHXVKJFKW-UHFFFAOYSA-M methyl sulfate(1-) Chemical compound COS([O-])(=O)=O JZMJDSHXVKJFKW-UHFFFAOYSA-M 0.000 description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 2
- KDLHZDBZIXYQEI-UHFFFAOYSA-N palladium Substances [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 2
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 238000001256 steam distillation Methods 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 239000008399 tap water Substances 0.000 description 2
- 235000020679 tap water Nutrition 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- RILZRCJGXSFXNE-UHFFFAOYSA-N 2-[4-(trifluoromethoxy)phenyl]ethanol Chemical compound OCCC1=CC=C(OC(F)(F)F)C=C1 RILZRCJGXSFXNE-UHFFFAOYSA-N 0.000 description 1
- GVBHRNIWBGTNQA-UHFFFAOYSA-N 2-methoxy-4-nitroaniline Chemical compound COC1=CC([N+]([O-])=O)=CC=C1N GVBHRNIWBGTNQA-UHFFFAOYSA-N 0.000 description 1
- XNLWJFYYOIRPIO-UHFFFAOYSA-N 3-phenylbenzoic acid Chemical compound OC(=O)C1=CC=CC(C=2C=CC=CC=2)=C1 XNLWJFYYOIRPIO-UHFFFAOYSA-N 0.000 description 1
- LEYVXEFGLPUKQT-UHFFFAOYSA-N 4-(2,3,4,5,6-pentafluorophenyl)phenol Chemical compound C1=CC(O)=CC=C1C1=C(F)C(F)=C(F)C(F)=C1F LEYVXEFGLPUKQT-UHFFFAOYSA-N 0.000 description 1
- ASOVDRYKVVVCIA-UHFFFAOYSA-N 4-(2,4-difluorophenyl)phenol Chemical compound C1=CC(O)=CC=C1C1=CC=C(F)C=C1F ASOVDRYKVVVCIA-UHFFFAOYSA-N 0.000 description 1
- KLYFGAULJGJKIU-UHFFFAOYSA-N 4-(2-chloro-4-fluorophenyl)phenol Chemical compound C1=CC(O)=CC=C1C1=CC=C(F)C=C1Cl KLYFGAULJGJKIU-UHFFFAOYSA-N 0.000 description 1
- FEHGAYLOAATVGN-UHFFFAOYSA-N 4-(2-fluorophenyl)phenol Chemical compound C1=CC(O)=CC=C1C1=CC=CC=C1F FEHGAYLOAATVGN-UHFFFAOYSA-N 0.000 description 1
- JIHMKTVYWHTJCD-UHFFFAOYSA-N 4-(3-chloro-4-fluorophenyl)phenol Chemical compound C1=CC(O)=CC=C1C1=CC=C(F)C(Cl)=C1 JIHMKTVYWHTJCD-UHFFFAOYSA-N 0.000 description 1
- FJMDMKNUDRMOCB-UHFFFAOYSA-N 4-(3-fluorophenyl)phenol Chemical compound C1=CC(O)=CC=C1C1=CC=CC(F)=C1 FJMDMKNUDRMOCB-UHFFFAOYSA-N 0.000 description 1
- VKWLGZRQBJHLIU-UHFFFAOYSA-N 4-(4-fluoro-2-methylphenyl)phenol Chemical compound CC1=CC(F)=CC=C1C1=CC=C(O)C=C1 VKWLGZRQBJHLIU-UHFFFAOYSA-N 0.000 description 1
- HTRVALPKPVGOSZ-UHFFFAOYSA-N 4-(4-fluorophenyl)aniline Chemical compound C1=CC(N)=CC=C1C1=CC=C(F)C=C1 HTRVALPKPVGOSZ-UHFFFAOYSA-N 0.000 description 1
- BNRRMRUVYDETQC-UHFFFAOYSA-N 4-fluoro-2-methoxyaniline Chemical compound COC1=CC(F)=CC=C1N BNRRMRUVYDETQC-UHFFFAOYSA-N 0.000 description 1
- UZURFHIRRDUVCX-UHFFFAOYSA-N 4-fluoro-3-methoxyaniline;hydrochloride Chemical compound Cl.COC1=CC(N)=CC=C1F UZURFHIRRDUVCX-UHFFFAOYSA-N 0.000 description 1
- PIBMDXJGZMRHDJ-UHFFFAOYSA-N 5-(2-chloro-4-fluorophenyl)-2-hydroxybenzoic acid Chemical compound C1=C(O)C(C(=O)O)=CC(C=2C(=CC(F)=CC=2)Cl)=C1 PIBMDXJGZMRHDJ-UHFFFAOYSA-N 0.000 description 1
- NJLCOEANIIZXKB-UHFFFAOYSA-N 5-(3-chloro-4-fluorophenyl)-2-hydroxy-3-methylbenzoic acid Chemical compound OC(=O)C1=C(O)C(C)=CC(C=2C=C(Cl)C(F)=CC=2)=C1 NJLCOEANIIZXKB-UHFFFAOYSA-N 0.000 description 1
- FBLOIEVRGCIBIE-UHFFFAOYSA-N 5-(3-chloro-4-fluorophenyl)-2-hydroxybenzoic acid Chemical compound C1=C(O)C(C(=O)O)=CC(C=2C=C(Cl)C(F)=CC=2)=C1 FBLOIEVRGCIBIE-UHFFFAOYSA-N 0.000 description 1
- UBDUVQFTPZZVKD-UHFFFAOYSA-N 5-(4-fluoro-2-methylphenyl)-2-hydroxybenzoic acid Chemical compound CC1=CC(F)=CC=C1C1=CC=C(O)C(C(O)=O)=C1 UBDUVQFTPZZVKD-UHFFFAOYSA-N 0.000 description 1
- GPPUHWMWQURBNW-UHFFFAOYSA-N 5-(4-fluoro-3-methoxyphenyl)-2-hydroxybenzoic acid Chemical compound C1=C(F)C(OC)=CC(C=2C=C(C(O)=CC=2)C(O)=O)=C1 GPPUHWMWQURBNW-UHFFFAOYSA-N 0.000 description 1
- BSYNRYMUTXBXSQ-FOQJRBATSA-N 59096-14-9 Chemical compound CC(=O)OC1=CC=CC=C1[14C](O)=O BSYNRYMUTXBXSQ-FOQJRBATSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- 208000010201 Exanthema Diseases 0.000 description 1
- 206010018691 Granuloma Diseases 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- IOVCWXUNBOPUCH-UHFFFAOYSA-N Nitrous acid Chemical compound ON=O IOVCWXUNBOPUCH-UHFFFAOYSA-N 0.000 description 1
- 238000006085 Schmidt reaction Methods 0.000 description 1
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 1
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 1
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical group [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- 239000000908 ammonium hydroxide Substances 0.000 description 1
- 230000000202 analgesic effect Effects 0.000 description 1
- 210000003423 ankle Anatomy 0.000 description 1
- 230000001754 anti-pyretic effect Effects 0.000 description 1
- 239000002221 antipyretic Substances 0.000 description 1
- 239000007900 aqueous suspension Substances 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 235000010418 carrageenan Nutrition 0.000 description 1
- 229920001525 carrageenan Polymers 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 238000013375 chromatographic separation Methods 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 239000000084 colloidal system Substances 0.000 description 1
- 150000001989 diazonium salts Chemical class 0.000 description 1
- 238000006073 displacement reaction Methods 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 238000010828 elution Methods 0.000 description 1
- 230000032050 esterification Effects 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- 201000005884 exanthem Diseases 0.000 description 1
- 125000001153 fluoro group Chemical group F* 0.000 description 1
- 125000000524 functional group Chemical group 0.000 description 1
- 230000002496 gastric effect Effects 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 210000000548 hind-foot Anatomy 0.000 description 1
- 239000012456 homogeneous solution Substances 0.000 description 1
- 150000004678 hydrides Chemical class 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 150000002440 hydroxy compounds Chemical class 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 230000002757 inflammatory effect Effects 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 150000007529 inorganic bases Chemical class 0.000 description 1
- 239000011872 intimate mixture Substances 0.000 description 1
- 239000012280 lithium aluminium hydride Substances 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- SYSQUGFVNFXIIT-UHFFFAOYSA-N n-[4-(1,3-benzoxazol-2-yl)phenyl]-4-nitrobenzenesulfonamide Chemical class C1=CC([N+](=O)[O-])=CC=C1S(=O)(=O)NC1=CC=C(C=2OC3=CC=CC=C3N=2)C=C1 SYSQUGFVNFXIIT-UHFFFAOYSA-N 0.000 description 1
- 150000005181 nitrobenzenes Chemical class 0.000 description 1
- MUMZUERVLWJKNR-UHFFFAOYSA-N oxoplatinum Chemical compound [Pt]=O MUMZUERVLWJKNR-UHFFFAOYSA-N 0.000 description 1
- 125000001820 oxy group Chemical group [*:1]O[*:2] 0.000 description 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 1
- 230000020477 pH reduction Effects 0.000 description 1
- 239000003973 paint Substances 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- 230000001575 pathological effect Effects 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 1
- 229910003446 platinum oxide Inorganic materials 0.000 description 1
- 108090000623 proteins and genes Proteins 0.000 description 1
- 206010037844 rash Diseases 0.000 description 1
- 229960004889 salicylic acid Drugs 0.000 description 1
- 239000004576 sand Substances 0.000 description 1
- 230000035945 sensitivity Effects 0.000 description 1
- 238000000638 solvent extraction Methods 0.000 description 1
- 238000013222 sprague-dawley male rat Methods 0.000 description 1
- 238000010561 standard procedure Methods 0.000 description 1
- 239000012258 stirred mixture Substances 0.000 description 1
- 238000010998 test method Methods 0.000 description 1
- 238000012360 testing method Methods 0.000 description 1
- 238000001665 trituration Methods 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US57781966 | 1966-09-08 | ||
| DEM0073026 | 1967-03-03 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1618663C true DE1618663C (enExample) | 1973-04-12 |
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1518528B2 (de) | Biphenylalkan- oder -alkenderivate und sie enthaltende therapeutische Zubereitungen mit antünflammatorischer, antipyretischer und analgetischer Wirkung | |
| CH460041A (de) | Verfahren zur Herstellung von 4-substituierten 4'-tert.-Aminoalkoxyphenylen | |
| DE1618465C3 (de) | Phenylessigsäureester, Verfahren zu ihrer Herstellung und diese Verbindungen enthaltende Arzneimittel | |
| DE1804691A1 (de) | Sulfonsaeure-Produkte | |
| DE1618663C (enExample) | ||
| DE2502967A1 (de) | Carbonsaeuren, verfahren zu ihrer herstellung und diese verbindungen enthaltende arzneimittel | |
| DE2253914C3 (de) | Chromon-3-acrylsaeuren, verfahren zu ihrer herstellung sowie diese verbindung enthaltende arzneimittel | |
| AT338257B (de) | Verfahren zur herstellung von neuen naphthalinderivaten | |
| DE1618663B1 (de) | Biphenylverbindungen und Verfahren zu ihrer Herstellung | |
| DE2323956A1 (de) | Substituierte naphthylanthranilsaeure | |
| DE2007700C2 (de) | Substituierte o-Anilino-phenäthylalkohole, Verfahren zu ihrer Herstellung und therapeutische Präparate | |
| DE1468283C (enExample) | ||
| CH638206A5 (en) | 5,6-Dihydroimidazo[5,1-a]isoquinoline derivatives and processes for their preparation | |
| DE1543185A1 (de) | Acylphenole und Verfahren zu deren Herstellung | |
| CH509307A (de) | Verfahren zur Herstellung von neuen, substituierten Phenäthylalkoholen | |
| AT277983B (de) | Verfahren zur Herstellung von neuen Biphenylcarbonsäuren und deren Derivaten | |
| DE2341506A1 (de) | Neue biphenylderivate und verfahren zu ihrer herstellung | |
| DE2157694C3 (de) | Phenylessigsäurederivate, Verfahren zu ihrer Herstellung und Phenylessigsäurederivate enthaltende pharmazeutische Zubereitungen | |
| DE2537204A1 (de) | Neue benzopyrane und verfahren zu ihrer herstellung | |
| AT324314B (de) | Verfahren zur herstellung von neuen 4-(m-benzoylphenyl)-butan (bzw. -buten-2)-sauren | |
| DE1921651A1 (de) | Verfahren zur Herstellung von neuen,substituierten Phenylalkansaeuren | |
| DE3420387A1 (de) | 2-(4-biphenylyl)-4-hexenonsaeure und ihre derivate mit entzuendungshemmender wirksamkeit | |
| DE1921655A1 (de) | Verfahren zur Herstellung von neuen 1,2-Oxazinderivaten | |
| CH524568A (de) | Verfahren zur Herstellung von neuen N-Phenylisopropyl-alkylaminen | |
| AT266075B (de) | Verfahren zur Herstellung von neuen Sulfonaniliden und deren Säureadditions- und Metallsalzen |