DE1618384C - - Google Patents
Info
- Publication number
- DE1618384C DE1618384C DE1618384C DE 1618384 C DE1618384 C DE 1618384C DE 1618384 C DE1618384 C DE 1618384C
- Authority
- DE
- Germany
- Prior art keywords
- hydrogenation
- rhodium
- hydroformylation
- tricyclodecane
- dicyclopentadiene
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- 238000005984 hydrogenation reaction Methods 0.000 claims description 19
- 239000003054 catalyst Substances 0.000 claims description 17
- 239000010948 rhodium Substances 0.000 claims description 17
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 claims description 15
- 229910052703 rhodium Inorganic materials 0.000 claims description 15
- 238000007037 hydroformylation reaction Methods 0.000 claims description 14
- MHOVAHRLVXNVSD-UHFFFAOYSA-N rhodium atom Chemical compound [Rh] MHOVAHRLVXNVSD-UHFFFAOYSA-N 0.000 claims description 12
- HECLRDQVFMWTQS-RGOKHQFPSA-N 1755-01-7 Chemical compound C1[C@H]2[C@@H]3CC=C[C@@H]3[C@@H]1C=C2 HECLRDQVFMWTQS-RGOKHQFPSA-N 0.000 claims description 11
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 claims description 9
- 239000007789 gas Substances 0.000 claims description 8
- 238000000034 method Methods 0.000 claims description 8
- 239000000203 mixture Substances 0.000 claims description 7
- 239000001257 hydrogen Substances 0.000 claims description 5
- 229910052739 hydrogen Inorganic materials 0.000 claims description 5
- UGFAIRIUMAVXCW-UHFFFAOYSA-N Carbon monoxide Chemical compound [O+]#[C-] UGFAIRIUMAVXCW-UHFFFAOYSA-N 0.000 claims description 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 4
- 229910002091 carbon monoxide Inorganic materials 0.000 claims description 4
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 claims description 2
- 229910052799 carbon Inorganic materials 0.000 claims description 2
- 229910002090 carbon oxide Inorganic materials 0.000 claims description 2
- 150000002009 diols Chemical class 0.000 claims description 2
- 239000003701 inert diluent Substances 0.000 claims description 2
- 238000002360 preparation method Methods 0.000 claims description 2
- 238000000926 separation method Methods 0.000 claims description 2
- 230000015572 biosynthetic process Effects 0.000 description 5
- 238000006243 chemical reaction Methods 0.000 description 5
- 239000000047 product Substances 0.000 description 5
- 238000003786 synthesis reaction Methods 0.000 description 5
- ZNZYKNKBJPZETN-WELNAUFTSA-N Dialdehyde 11678 Chemical compound N1C2=CC=CC=C2C2=C1[C@H](C[C@H](/C(=C/O)C(=O)OC)[C@@H](C=C)C=O)NCC2 ZNZYKNKBJPZETN-WELNAUFTSA-N 0.000 description 4
- 150000001875 compounds Chemical class 0.000 description 3
- 239000012043 crude product Substances 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical class OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 229910017052 cobalt Inorganic materials 0.000 description 2
- 239000010941 cobalt Substances 0.000 description 2
- ZSWFCLXCOIISFI-UHFFFAOYSA-N cyclopentadiene Chemical compound C1C=CC=C1 ZSWFCLXCOIISFI-UHFFFAOYSA-N 0.000 description 2
- 150000002431 hydrogen Chemical class 0.000 description 2
- 230000007062 hydrolysis Effects 0.000 description 2
- 238000006460 hydrolysis reaction Methods 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- 229910002651 NO3 Inorganic materials 0.000 description 1
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 1
- 229910021604 Rhodium(III) chloride Inorganic materials 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- DHKHKXVYLBGOIT-UHFFFAOYSA-N acetaldehyde Diethyl Acetal Natural products CCOC(C)OCC DHKHKXVYLBGOIT-UHFFFAOYSA-N 0.000 description 1
- 125000002777 acetyl group Chemical class [H]C([H])([H])C(*)=O 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 150000001299 aldehydes Chemical class 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 238000006555 catalytic reaction Methods 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 1
- 150000001869 cobalt compounds Chemical class 0.000 description 1
- 230000006735 deficit Effects 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 238000006471 dimerization reaction Methods 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 230000022244 formylation Effects 0.000 description 1
- 238000006170 formylation reaction Methods 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 239000003112 inhibitor Substances 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000012454 non-polar solvent Substances 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- -1 rhodium carbonyl compounds Chemical class 0.000 description 1
- 150000003284 rhodium compounds Chemical class 0.000 description 1
- SONJTKJMTWTJCT-UHFFFAOYSA-K rhodium(iii) chloride Chemical compound [Cl-].[Cl-].[Cl-].[Rh+3] SONJTKJMTWTJCT-UHFFFAOYSA-K 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3232557C2 (enExample) | ||
| DE10009207A1 (de) | Verbessertes Verfahren zur Hydroformylierung von Olefinen durch Reduzierung der Ameisensäurekonzentration | |
| DE3125228C2 (de) | Verfahren zur Herstellung von Ethylenglykol durch Hydrierung von Glykolaldehyd mit Wasserstoff | |
| EP1694621A1 (de) | Verfahren zur herstellung von tricyclodecandialdehyd | |
| DE2538364B2 (de) | Verfahren zur herstellung von butandiolen | |
| DE2533320A1 (de) | Verfahren zur herstellung von aldehyden | |
| DE4344064C1 (de) | Verfahren zur Herstellung von in alpha-Stellung durch einen Alkylrest substituierten Aldehyden | |
| DE102004027955B3 (de) | Verfahren zur Herstellung TCD-Alkohol DM | |
| EP0177912B1 (de) | Verfahren zur Herstellung von Alkandiolen | |
| DE1618384C (enExample) | ||
| DE2519011A1 (de) | Verfahren zur darstellung primaerer alkohole mit am c tief 2 -atom verzweigter alkylkette | |
| DE1618384B1 (de) | Verfahren zur Herstellung von Tricyclodecan-Dimethylolen durch Hydroformylierung von Dicyclopentadien über Rhodium enthaltenden Katalysatoren und anschliessende Hydrierung zu den entsprechenden Diolen | |
| DE2716288B1 (de) | Verfahren zur Herstellung von 23-Dimethylpentanal | |
| DE849548C (de) | Verfahren zur Herstellung von sauerstoffhaltigen Verbindungen | |
| DE10122758B4 (de) | Verfahren zur Herstellung von gemischten, sekundären Aminen | |
| DE4023255A1 (de) | Verfahren zur herstellung von glykolen, insbesondere propylenglykol aus formaldehyd | |
| DE2020550A1 (de) | Verfahren zur Herstellung von Aldehyden und Alkoholen | |
| DE1793017C (enExample) | ||
| EP0065294A1 (de) | Verfahren zur Herstellung von Formylcyannorbornan | |
| DE2236734A1 (de) | Verfahren zur herstellung von 2methyl-1,4-butandiol | |
| DE1618396B (de) | Verfahren zur Herstellung von Bicycloheptandimethylolen durch kata lytische Hydrierung des Reaktionsge misches aus der Hydroformylierung von Bicycloheptenmonoaldehyden zu den ent sprechenden Dicycloheptandialdehyden | |
| DE2219953C3 (de) | Verfahren zur Herstellung von beta-Phenyläthanol | |
| DE2504980B2 (de) | Verfahren zur herstellung von 2-acetoxypropionaldehyd | |
| DE1078107B (de) | Verfahren zur Reinigung von Aldehyden aus der Oxo-Synthese | |
| DE1468098C (de) | Verfahren zur Herstellung eines vorwiegend Monohydroxymethylcycloheptan enthaltenden Reaktionsproduktes |