DE1570774A1 - Verfahren zur Polymerisation von Laurinlactam - Google Patents
Verfahren zur Polymerisation von LaurinlactamInfo
- Publication number
- DE1570774A1 DE1570774A1 DE19641570774 DE1570774A DE1570774A1 DE 1570774 A1 DE1570774 A1 DE 1570774A1 DE 19641570774 DE19641570774 DE 19641570774 DE 1570774 A DE1570774 A DE 1570774A DE 1570774 A1 DE1570774 A1 DE 1570774A1
- Authority
- DE
- Germany
- Prior art keywords
- laurolactam
- hours
- polymerization
- pressure
- carried out
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- JHWNWJKBPDFINM-UHFFFAOYSA-N Laurolactam Chemical compound O=C1CCCCCCCCCCCN1 JHWNWJKBPDFINM-UHFFFAOYSA-N 0.000 title claims description 17
- 238000006116 polymerization reaction Methods 0.000 title claims description 8
- 238000000034 method Methods 0.000 title claims description 7
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Chemical compound O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 8
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 claims description 4
- -1 caprylic lactam Chemical class 0.000 claims description 3
- 238000004519 manufacturing process Methods 0.000 claims description 3
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 claims description 3
- 229910000147 aluminium phosphate Inorganic materials 0.000 claims description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 2
- 150000003951 lactams Chemical class 0.000 claims description 2
- 239000001301 oxygen Substances 0.000 claims description 2
- 229910052760 oxygen Inorganic materials 0.000 claims description 2
- 238000007334 copolymerization reaction Methods 0.000 claims 1
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 10
- 239000000155 melt Substances 0.000 description 9
- JBKVHLHDHHXQEQ-UHFFFAOYSA-N epsilon-caprolactam Chemical compound O=C1CCCCCN1 JBKVHLHDHHXQEQ-UHFFFAOYSA-N 0.000 description 6
- 229910052757 nitrogen Inorganic materials 0.000 description 5
- 229920000299 Nylon 12 Polymers 0.000 description 4
- 239000002253 acid Substances 0.000 description 4
- RLSSMJSEOOYNOY-UHFFFAOYSA-N m-cresol Chemical compound CC1=CC=CC(O)=C1 RLSSMJSEOOYNOY-UHFFFAOYSA-N 0.000 description 4
- 238000002844 melting Methods 0.000 description 4
- 230000008018 melting Effects 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- 238000009833 condensation Methods 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 239000011261 inert gas Substances 0.000 description 2
- 229920000642 polymer Polymers 0.000 description 2
- BPFOQVIYHIFVRD-UHFFFAOYSA-N 1-decyl-1-oxidopiperidin-1-ium Chemical compound CCCCCCCCCC[N+]1([O-])CCCCC1 BPFOQVIYHIFVRD-UHFFFAOYSA-N 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- YDLSUFFXJYEVHW-UHFFFAOYSA-N azonan-2-one Chemical compound O=C1CCCCCCCN1 YDLSUFFXJYEVHW-UHFFFAOYSA-N 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 150000003841 chloride salts Chemical class 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 150000001991 dicarboxylic acids Chemical class 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 230000007717 exclusion Effects 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 239000004611 light stabiliser Substances 0.000 description 1
- 239000006224 matting agent Substances 0.000 description 1
- 230000035699 permeability Effects 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 229920000768 polyamine Polymers 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G69/00—Macromolecular compounds obtained by reactions forming a carboxylic amide link in the main chain of the macromolecule
- C08G69/02—Polyamides derived from amino-carboxylic acids or from polyamines and polycarboxylic acids
- C08G69/08—Polyamides derived from amino-carboxylic acids or from polyamines and polycarboxylic acids derived from amino-carboxylic acids
- C08G69/14—Lactams
- C08G69/16—Preparatory processes
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Polyamides (AREA)
- Addition Polymer Or Copolymer, Post-Treatments, Or Chemical Modifications (AREA)
- Treating Waste Gases (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH106964A CH430206A (de) | 1964-01-30 | 1964-01-30 | Verfahren zur Polymerisation von Laurinlactam |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1570774A1 true DE1570774A1 (de) | 1972-03-30 |
Family
ID=4201711
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19641570774 Pending DE1570774A1 (de) | 1964-01-30 | 1964-12-23 | Verfahren zur Polymerisation von Laurinlactam |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US3410832A (instruction) |
| AT (1) | AT247607B (instruction) |
| BE (1) | BE658861A (instruction) |
| CH (1) | CH430206A (instruction) |
| DE (1) | DE1570774A1 (instruction) |
| DK (1) | DK111309B (instruction) |
| ES (1) | ES307663A1 (instruction) |
| FI (1) | FI42141B (instruction) |
| FR (1) | FR1421879A (instruction) |
| GB (1) | GB1083915A (instruction) |
| IL (1) | IL22687A (instruction) |
| NL (1) | NL6415158A (instruction) |
| SE (1) | SE337475B (instruction) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0250761A1 (de) * | 1986-06-28 | 1988-01-07 | Hüls Aktiengesellschaft | Verfahren zur Herstellung eines präpolymeren Amids aus einem C12-Aminocarbonsäurelactam |
Families Citing this family (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3515702A (en) * | 1966-02-11 | 1970-06-02 | Plate Gmbh Chem Fab Dr | Laurolactam copolyamide shaped articles having highly adhesive surfaces |
| US3883608A (en) * | 1970-11-30 | 1975-05-13 | Aquitaine Total Organico | Process for the polymerization of dodecalactam in the presence of potassium carbonate |
| DE2152194C3 (de) * | 1971-10-20 | 1984-09-20 | Chemische Werke Hüls AG, 4370 Marl | Verfahren zur Herstellung von Polylaurinlactam |
| US3846357A (en) * | 1971-10-21 | 1974-11-05 | Aquitaine Total Organico | Process for the polymerization of lactames allowing substances affected by high temperatures to be added during polymerization |
| GB1442749A (en) * | 1972-12-18 | 1976-07-14 | Ici Ltd | Catalytic polymerisation of dodecanolactam |
| CH582729A5 (instruction) * | 1974-05-21 | 1976-12-15 | Inventa Ag | |
| US4172161A (en) * | 1977-07-13 | 1979-10-23 | Chemische Werke Huls Ag | Pulverulent copolyamides for the coating of glass bottles |
| US7261849B2 (en) * | 2002-04-30 | 2007-08-28 | Solutia, Inc. | Tacky polymer melt spinning process |
| EP2123635B1 (en) * | 2007-02-09 | 2013-06-05 | National University Corporation Nagoya University | Method for production of laurolactam |
| EP2223911B1 (en) * | 2007-11-29 | 2014-09-24 | Ube Industries, Ltd. | Method for production of laurolactam |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA582517A (en) * | 1959-09-01 | E. Gronich Harry | Lactam polymerization | |
| DE748253C (de) * | 1938-06-10 | 1944-10-30 | Verfahren zur Herstellung verformbarer hochmolekularer Polyamide | |
| IT574882A (instruction) * | 1956-08-18 | |||
| US3017392A (en) * | 1956-12-13 | 1962-01-16 | Monsanto Chemicals | Polymerization of higher lactams |
| DE1067587B (de) * | 1957-07-20 | 1959-10-22 | Basf Ag | Verfahren zur einstufigen Herstellung von Polyamid-Formkoerpern |
| NL134637C (instruction) * | 1961-06-21 | |||
| DE1495147A1 (de) * | 1963-10-18 | 1969-01-30 | Basf Ag | Verfahren zum Herstellen von Polylaurinlactam |
| DE1495149B2 (de) * | 1963-10-26 | 1970-04-09 | Badische Anilin- & Soda-Fabrik AG, 67OO Ludwigshafen | Verfahren zur Herstellung von PoIylaurinlactam |
-
1964
- 1964-01-30 CH CH106964A patent/CH430206A/de unknown
- 1964-12-10 AT AT1045364A patent/AT247607B/de active
- 1964-12-12 FI FI2637/64A patent/FI42141B/fi active
- 1964-12-16 DK DK615864AA patent/DK111309B/da unknown
- 1964-12-23 DE DE19641570774 patent/DE1570774A1/de active Pending
- 1964-12-29 ES ES0307663A patent/ES307663A1/es not_active Expired
- 1964-12-29 NL NL6415158A patent/NL6415158A/xx unknown
- 1964-12-29 IL IL22687A patent/IL22687A/xx unknown
-
1965
- 1965-01-07 SE SE00131/65A patent/SE337475B/xx unknown
- 1965-01-20 GB GB2510/65A patent/GB1083915A/en not_active Expired
- 1965-01-21 FR FR2824A patent/FR1421879A/fr not_active Expired
- 1965-01-27 BE BE658861D patent/BE658861A/xx unknown
- 1965-01-29 US US429129A patent/US3410832A/en not_active Expired - Lifetime
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0250761A1 (de) * | 1986-06-28 | 1988-01-07 | Hüls Aktiengesellschaft | Verfahren zur Herstellung eines präpolymeren Amids aus einem C12-Aminocarbonsäurelactam |
Also Published As
| Publication number | Publication date |
|---|---|
| CH430206A (de) | 1967-02-15 |
| BE658861A (instruction) | 1965-05-17 |
| GB1083915A (en) | 1967-09-20 |
| NL6415158A (instruction) | 1965-08-02 |
| US3410832A (en) | 1968-11-12 |
| FI42141B (instruction) | 1970-02-02 |
| DK111309B (da) | 1968-07-22 |
| SE337475B (instruction) | 1971-08-09 |
| IL22687A (en) | 1968-05-30 |
| AT247607B (de) | 1966-06-27 |
| FR1421879A (fr) | 1965-12-17 |
| ES307663A1 (es) | 1965-05-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2932234C2 (de) | Verfahren zur Herstellung von Polyether(ester)amiden | |
| DE69609417T2 (de) | Verzweigtes sternförmiges polyamid | |
| DE2802989A1 (de) | Hydrolysebestaendige copolyaetheresteramide | |
| DE1645536B2 (de) | Verfahren zur Herstellung von wasserlöslichen, hitzehärtbaren Polymeren | |
| DE1570774A1 (de) | Verfahren zur Polymerisation von Laurinlactam | |
| CH684893A5 (de) | Verfahren zur Herstellung von amorphen teilaromatischen hochmolekularen Copolyamiden. | |
| DE3223823A1 (de) | Verfahren zur kontinuierlichen herstellung von polyamiden | |
| DE69213455T2 (de) | Copolyadipinamid das Trimethylhexamethylenadipinamideinheiten enthält und daraushergestelte Produkte | |
| CH280367A (de) | Verfahren zur Herstellung eines Mischpolyamids. | |
| DE1265412B (de) | Verfahren zur Herstellung von transparenten Copolyamiden | |
| DE1520924A1 (de) | Verfahren zur Herstellung von Polyamiden | |
| DE69213457T2 (de) | Copolyadipinamid, das Ethyltetramethylenadipinamid- Einheiten enthält und daraus hergestellte Produkte | |
| DE68919804T2 (de) | Thermoplastische aromatische Polyamide. | |
| DE1943251A1 (de) | Faserbildende Polyamide mit erhoehtem Aminogruppengehalt | |
| DE2737257A1 (de) | Transparente polyamide | |
| DE2359799A1 (de) | Verfahren zur herstellung von polyamiden | |
| DE2449664A1 (de) | Verfahren zur herstellung von polyamiden | |
| DE2119776A1 (de) | Hochmolekulare lineare Copolyamide | |
| DE2732928A1 (de) | Transparente polyamide | |
| DE69113177T2 (de) | Verfahren zur Herstellung von Polyätheramideblockpolymere für Spritzguss. | |
| DE2058414A1 (de) | Hochmolekulare lineare Copolyamide mit Oxamidgruppen | |
| DE10124580A1 (de) | Verfahren zur Behandlung von Oligoamiden und zur Herstellung von Polyamid | |
| DE917274C (de) | Verfahren zur Herstellung von vernetzten Polyamiden | |
| DE2060701A1 (de) | Glasklare Polyamide | |
| AT224912B (de) | Verfahren zur Polymerisation von Destillationsrückständen des Heißwasserextraktes von ɛ-Caprolactampolymeren |