DE1497054C3 - Elektrofotografisches Aufzeichnungsmaterial - Google Patents
Elektrofotografisches AufzeichnungsmaterialInfo
- Publication number
- DE1497054C3 DE1497054C3 DE1497054A DE1497054A DE1497054C3 DE 1497054 C3 DE1497054 C3 DE 1497054C3 DE 1497054 A DE1497054 A DE 1497054A DE 1497054 A DE1497054 A DE 1497054A DE 1497054 C3 DE1497054 C3 DE 1497054C3
- Authority
- DE
- Germany
- Prior art keywords
- photoconductor
- recording material
- binder
- glass
- electrophotographic
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000000463 material Substances 0.000 title claims description 56
- 239000011521 glass Substances 0.000 claims description 62
- 239000011230 binding agent Substances 0.000 claims description 55
- XLOMVQKBTHCTTD-UHFFFAOYSA-N zinc oxide Inorganic materials [Zn]=O XLOMVQKBTHCTTD-UHFFFAOYSA-N 0.000 claims description 24
- 239000002245 particle Substances 0.000 claims description 19
- 239000000758 substrate Substances 0.000 claims description 14
- 238000000034 method Methods 0.000 claims description 9
- YEXPOXQUZXUXJW-UHFFFAOYSA-N oxolead Chemical compound [Pb]=O YEXPOXQUZXUXJW-UHFFFAOYSA-N 0.000 claims description 7
- 229910000464 lead oxide Inorganic materials 0.000 claims description 6
- 229910003439 heavy metal oxide Inorganic materials 0.000 claims description 4
- 230000008569 process Effects 0.000 claims description 4
- UHYPYGJEEGLRJD-UHFFFAOYSA-N cadmium(2+);selenium(2-) Chemical compound [Se-2].[Cd+2] UHYPYGJEEGLRJD-UHFFFAOYSA-N 0.000 claims 1
- SBIBMFFZSBJNJF-UHFFFAOYSA-N selenium;zinc Chemical compound [Se]=[Zn] SBIBMFFZSBJNJF-UHFFFAOYSA-N 0.000 claims 1
- 239000010410 layer Substances 0.000 description 39
- 229910052782 aluminium Inorganic materials 0.000 description 33
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 33
- 210000003298 dental enamel Anatomy 0.000 description 30
- 239000000049 pigment Substances 0.000 description 23
- 229910052980 cadmium sulfide Inorganic materials 0.000 description 17
- 238000002844 melting Methods 0.000 description 17
- 230000008018 melting Effects 0.000 description 16
- BUGBHKTXTAQXES-UHFFFAOYSA-N Selenium Chemical compound [Se] BUGBHKTXTAQXES-UHFFFAOYSA-N 0.000 description 12
- 239000011669 selenium Substances 0.000 description 12
- 239000000203 mixture Substances 0.000 description 11
- 229910052711 selenium Inorganic materials 0.000 description 11
- 239000011787 zinc oxide Substances 0.000 description 11
- WUPHOULIZUERAE-UHFFFAOYSA-N 3-(oxolan-2-yl)propanoic acid Chemical compound OC(=O)CCC1CCCO1 WUPHOULIZUERAE-UHFFFAOYSA-N 0.000 description 10
- ODINCKMPIJJUCX-UHFFFAOYSA-N Calcium oxide Chemical compound [Ca]=O ODINCKMPIJJUCX-UHFFFAOYSA-N 0.000 description 9
- 238000000576 coating method Methods 0.000 description 9
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 9
- 239000011248 coating agent Substances 0.000 description 8
- 230000035945 sensitivity Effects 0.000 description 8
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 7
- PGWFQHBXMJMAPN-UHFFFAOYSA-N ctk4b5078 Chemical compound [Cd].OS(=O)(=O)[Se]S(O)(=O)=O PGWFQHBXMJMAPN-UHFFFAOYSA-N 0.000 description 7
- 238000004519 manufacturing process Methods 0.000 description 6
- 239000011734 sodium Substances 0.000 description 6
- 229910004298 SiO 2 Inorganic materials 0.000 description 5
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 5
- CXKCTMHTOKXKQT-UHFFFAOYSA-N cadmium oxide Inorganic materials [Cd]=O CXKCTMHTOKXKQT-UHFFFAOYSA-N 0.000 description 5
- 239000000292 calcium oxide Substances 0.000 description 5
- 239000002002 slurry Substances 0.000 description 5
- 150000004763 sulfides Chemical class 0.000 description 5
- 239000000037 vitreous enamel Substances 0.000 description 5
- 229910052725 zinc Inorganic materials 0.000 description 5
- 239000011701 zinc Substances 0.000 description 5
- CPLXHLVBOLITMK-UHFFFAOYSA-N Magnesium oxide Chemical compound [Mg]=O CPLXHLVBOLITMK-UHFFFAOYSA-N 0.000 description 4
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 4
- 230000002378 acidificating effect Effects 0.000 description 4
- 238000004458 analytical method Methods 0.000 description 4
- 239000012153 distilled water Substances 0.000 description 4
- 238000007496 glass forming Methods 0.000 description 4
- HTUMBQDCCIXGCV-UHFFFAOYSA-N lead oxide Chemical compound [O-2].[Pb+2] HTUMBQDCCIXGCV-UHFFFAOYSA-N 0.000 description 4
- 239000007788 liquid Substances 0.000 description 4
- 150000004771 selenides Chemical class 0.000 description 4
- 229910000679 solder Inorganic materials 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- PFNQVRZLDWYSCW-UHFFFAOYSA-N (fluoren-9-ylideneamino) n-naphthalen-1-ylcarbamate Chemical compound C12=CC=CC=C2C2=CC=CC=C2C1=NOC(=O)NC1=CC=CC2=CC=CC=C12 PFNQVRZLDWYSCW-UHFFFAOYSA-N 0.000 description 3
- 229910018072 Al 2 O 3 Inorganic materials 0.000 description 3
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 3
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 3
- 239000005083 Zinc sulfide Substances 0.000 description 3
- 239000012190 activator Substances 0.000 description 3
- 239000002585 base Substances 0.000 description 3
- AQCDIIAORKRFCD-UHFFFAOYSA-N cadmium selenide Chemical compound [Cd]=[Se] AQCDIIAORKRFCD-UHFFFAOYSA-N 0.000 description 3
- CFEAAQFZALKQPA-UHFFFAOYSA-N cadmium(2+);oxygen(2-) Chemical compound [O-2].[Cd+2] CFEAAQFZALKQPA-UHFFFAOYSA-N 0.000 description 3
- 150000001875 compounds Chemical class 0.000 description 3
- 238000011161 development Methods 0.000 description 3
- 230000002349 favourable effect Effects 0.000 description 3
- 229910052751 metal Inorganic materials 0.000 description 3
- 239000002184 metal Substances 0.000 description 3
- 229910021645 metal ion Inorganic materials 0.000 description 3
- 150000002739 metals Chemical class 0.000 description 3
- 230000005855 radiation Effects 0.000 description 3
- 239000000377 silicon dioxide Substances 0.000 description 3
- 230000003595 spectral effect Effects 0.000 description 3
- XOLBLPGZBRYERU-UHFFFAOYSA-N tin dioxide Chemical compound O=[Sn]=O XOLBLPGZBRYERU-UHFFFAOYSA-N 0.000 description 3
- 229910001887 tin oxide Inorganic materials 0.000 description 3
- 229910052984 zinc sulfide Inorganic materials 0.000 description 3
- UQMZPFKLYHOJDL-UHFFFAOYSA-N zinc;cadmium(2+);disulfide Chemical compound [S-2].[S-2].[Zn+2].[Cd+2] UQMZPFKLYHOJDL-UHFFFAOYSA-N 0.000 description 3
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 2
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Natural products CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 2
- 238000005299 abrasion Methods 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 230000000903 blocking effect Effects 0.000 description 2
- KGBXLFKZBHKPEV-UHFFFAOYSA-N boric acid Chemical compound OB(O)O KGBXLFKZBHKPEV-UHFFFAOYSA-N 0.000 description 2
- 239000004327 boric acid Substances 0.000 description 2
- 229910052793 cadmium Inorganic materials 0.000 description 2
- BDOSMKKIYDKNTQ-UHFFFAOYSA-N cadmium atom Chemical compound [Cd] BDOSMKKIYDKNTQ-UHFFFAOYSA-N 0.000 description 2
- YKYOUMDCQGMQQO-UHFFFAOYSA-L cadmium dichloride Chemical compound Cl[Cd]Cl YKYOUMDCQGMQQO-UHFFFAOYSA-L 0.000 description 2
- 229910052802 copper Inorganic materials 0.000 description 2
- 239000010949 copper Substances 0.000 description 2
- 238000005336 cracking Methods 0.000 description 2
- 238000004132 cross linking Methods 0.000 description 2
- 238000010304 firing Methods 0.000 description 2
- 150000002222 fluorine compounds Chemical class 0.000 description 2
- 239000000156 glass melt Substances 0.000 description 2
- 239000012535 impurity Substances 0.000 description 2
- 150000002484 inorganic compounds Chemical class 0.000 description 2
- 229910010272 inorganic material Inorganic materials 0.000 description 2
- 150000002500 ions Chemical class 0.000 description 2
- ZPPSOOVFTBGHBI-UHFFFAOYSA-N lead(2+);oxido(oxo)borane Chemical compound [Pb+2].[O-]B=O.[O-]B=O ZPPSOOVFTBGHBI-UHFFFAOYSA-N 0.000 description 2
- 238000004020 luminiscence type Methods 0.000 description 2
- 239000000395 magnesium oxide Substances 0.000 description 2
- 230000007935 neutral effect Effects 0.000 description 2
- 229910052759 nickel Inorganic materials 0.000 description 2
- 231100000614 poison Toxicity 0.000 description 2
- 239000003380 propellant Substances 0.000 description 2
- NTHWMYGWWRZVTN-UHFFFAOYSA-N sodium silicate Chemical compound [Na+].[Na+].[O-][Si]([O-])=O NTHWMYGWWRZVTN-UHFFFAOYSA-N 0.000 description 2
- 238000001228 spectrum Methods 0.000 description 2
- 238000010183 spectrum analysis Methods 0.000 description 2
- 238000005507 spraying Methods 0.000 description 2
- YPMOSINXXHVZIL-UHFFFAOYSA-N sulfanylideneantimony Chemical compound [Sb]=S YPMOSINXXHVZIL-UHFFFAOYSA-N 0.000 description 2
- 239000008399 tap water Substances 0.000 description 2
- 235000020679 tap water Nutrition 0.000 description 2
- XPDICGYEJXYUDW-UHFFFAOYSA-N tetraarsenic tetrasulfide Chemical compound S1[As]2S[As]3[As]1S[As]2S3 XPDICGYEJXYUDW-UHFFFAOYSA-N 0.000 description 2
- 229910015902 Bi 2 O 3 Inorganic materials 0.000 description 1
- BTBUEUYNUDRHOZ-UHFFFAOYSA-N Borate Chemical compound [O-]B([O-])[O-] BTBUEUYNUDRHOZ-UHFFFAOYSA-N 0.000 description 1
- 229910001369 Brass Inorganic materials 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical group CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 239000002879 Lewis base Substances 0.000 description 1
- 229910018068 Li 2 O Inorganic materials 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 206010034972 Photosensitivity reaction Diseases 0.000 description 1
- 239000006004 Quartz sand Substances 0.000 description 1
- XEHUYCFKGDBCDL-UHFFFAOYSA-N S(=O)(=O)(O)[Se]S(=O)(=O)O.[Zn] Chemical compound S(=O)(=O)(O)[Se]S(=O)(=O)O.[Zn] XEHUYCFKGDBCDL-UHFFFAOYSA-N 0.000 description 1
- 229910006404 SnO 2 Inorganic materials 0.000 description 1
- 239000004115 Sodium Silicate Substances 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- UCKMPCXJQFINFW-UHFFFAOYSA-N Sulphide Chemical compound [S-2] UCKMPCXJQFINFW-UHFFFAOYSA-N 0.000 description 1
- 229910010413 TiO 2 Inorganic materials 0.000 description 1
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 description 1
- 238000002441 X-ray diffraction Methods 0.000 description 1
- 239000004110 Zinc silicate Substances 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 230000003213 activating effect Effects 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- WATWJIUSRGPENY-UHFFFAOYSA-N antimony atom Chemical compound [Sb] WATWJIUSRGPENY-UHFFFAOYSA-N 0.000 description 1
- 229910000410 antimony oxide Inorganic materials 0.000 description 1
- 229910052785 arsenic Inorganic materials 0.000 description 1
- 229910000413 arsenic oxide Inorganic materials 0.000 description 1
- -1 arsenic selenide Chemical class 0.000 description 1
- QVQLCTNNEUAWMS-UHFFFAOYSA-N barium oxide Inorganic materials [Ba]=O QVQLCTNNEUAWMS-UHFFFAOYSA-N 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 229910052796 boron Inorganic materials 0.000 description 1
- 229910052810 boron oxide Inorganic materials 0.000 description 1
- 239000010951 brass Substances 0.000 description 1
- 230000001680 brushing effect Effects 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- BRPQOXSCLDDYGP-UHFFFAOYSA-N calcium oxide Chemical compound [O-2].[Ca+2] BRPQOXSCLDDYGP-UHFFFAOYSA-N 0.000 description 1
- LJLWNMFUZWUGPO-UHFFFAOYSA-N calcium strontium disulfide Chemical compound [S--].[S--].[Ca++].[Sr++] LJLWNMFUZWUGPO-UHFFFAOYSA-N 0.000 description 1
- 239000000919 ceramic Substances 0.000 description 1
- 150000004770 chalcogenides Chemical class 0.000 description 1
- 238000001311 chemical methods and process Methods 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 239000002131 composite material Substances 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 230000000254 damaging effect Effects 0.000 description 1
- 230000007812 deficiency Effects 0.000 description 1
- JKWMSGQKBLHBQQ-UHFFFAOYSA-N diboron trioxide Chemical compound O=BOB=O JKWMSGQKBLHBQQ-UHFFFAOYSA-N 0.000 description 1
- ZZEMEJKDTZOXOI-UHFFFAOYSA-N digallium;selenium(2-) Chemical compound [Ga+3].[Ga+3].[Se-2].[Se-2].[Se-2] ZZEMEJKDTZOXOI-UHFFFAOYSA-N 0.000 description 1
- 238000007598 dipping method Methods 0.000 description 1
- UQGFMSUEHSUPRD-UHFFFAOYSA-N disodium;3,7-dioxido-2,4,6,8,9-pentaoxa-1,3,5,7-tetraborabicyclo[3.3.1]nonane Chemical compound [Na+].[Na+].O1B([O-])OB2OB([O-])OB1O2 UQGFMSUEHSUPRD-UHFFFAOYSA-N 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 238000007786 electrostatic charging Methods 0.000 description 1
- 238000004534 enameling Methods 0.000 description 1
- 230000004907 flux Effects 0.000 description 1
- 230000006870 function Effects 0.000 description 1
- 238000000227 grinding Methods 0.000 description 1
- 238000009499 grossing Methods 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 229910001385 heavy metal Inorganic materials 0.000 description 1
- 238000001027 hydrothermal synthesis Methods 0.000 description 1
- 238000007654 immersion Methods 0.000 description 1
- 230000001771 impaired effect Effects 0.000 description 1
- 229910003437 indium oxide Inorganic materials 0.000 description 1
- PJXISJQVUVHSOJ-UHFFFAOYSA-N indium(iii) oxide Chemical compound [O-2].[O-2].[O-2].[In+3].[In+3] PJXISJQVUVHSOJ-UHFFFAOYSA-N 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 239000011810 insulating material Substances 0.000 description 1
- 238000009413 insulation Methods 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 229910052981 lead sulfide Inorganic materials 0.000 description 1
- 229940056932 lead sulfide Drugs 0.000 description 1
- 150000007527 lewis bases Chemical class 0.000 description 1
- FUJCRWPEOMXPAD-UHFFFAOYSA-N lithium oxide Chemical compound [Li+].[Li+].[O-2] FUJCRWPEOMXPAD-UHFFFAOYSA-N 0.000 description 1
- 229910001947 lithium oxide Inorganic materials 0.000 description 1
- PNHVEGMHOXTHMW-UHFFFAOYSA-N magnesium;zinc;oxygen(2-) Chemical compound [O-2].[O-2].[Mg+2].[Zn+2] PNHVEGMHOXTHMW-UHFFFAOYSA-N 0.000 description 1
- 239000011159 matrix material Substances 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 229910000474 mercury oxide Inorganic materials 0.000 description 1
- UKWHYYKOEPRTIC-UHFFFAOYSA-N mercury(ii) oxide Chemical compound [Hg]=O UKWHYYKOEPRTIC-UHFFFAOYSA-N 0.000 description 1
- 229910044991 metal oxide Inorganic materials 0.000 description 1
- 150000004706 metal oxides Chemical class 0.000 description 1
- 230000005012 migration Effects 0.000 description 1
- 238000013508 migration Methods 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 235000021317 phosphate Nutrition 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- 230000036211 photosensitivity Effects 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 239000002574 poison Substances 0.000 description 1
- 230000000607 poisoning effect Effects 0.000 description 1
- 230000007096 poisonous effect Effects 0.000 description 1
- 238000005498 polishing Methods 0.000 description 1
- CHWRSCGUEQEHOH-UHFFFAOYSA-N potassium oxide Chemical class [O-2].[K+].[K+] CHWRSCGUEQEHOH-UHFFFAOYSA-N 0.000 description 1
- 229910001950 potassium oxide Inorganic materials 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 238000007639 printing Methods 0.000 description 1
- 238000010791 quenching Methods 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 230000000717 retained effect Effects 0.000 description 1
- 238000012552 review Methods 0.000 description 1
- 230000035807 sensation Effects 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 229910052709 silver Inorganic materials 0.000 description 1
- 239000004332 silver Substances 0.000 description 1
- 229910001948 sodium oxide Inorganic materials 0.000 description 1
- 229910052911 sodium silicate Inorganic materials 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 229910001220 stainless steel Inorganic materials 0.000 description 1
- 239000010935 stainless steel Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- GKCNVZWZCYIBPR-UHFFFAOYSA-N sulfanylideneindium Chemical compound [In]=S GKCNVZWZCYIBPR-UHFFFAOYSA-N 0.000 description 1
- QXKXDIKCIPXUPL-UHFFFAOYSA-N sulfanylidenemercury Chemical compound [Hg]=S QXKXDIKCIPXUPL-UHFFFAOYSA-N 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 239000002344 surface layer Substances 0.000 description 1
- 238000012360 testing method Methods 0.000 description 1
- POWFTOSLLWLEBN-UHFFFAOYSA-N tetrasodium;silicate Chemical compound [Na+].[Na+].[Na+].[Na+].[O-][Si]([O-])([O-])[O-] POWFTOSLLWLEBN-UHFFFAOYSA-N 0.000 description 1
- 229920001187 thermosetting polymer Polymers 0.000 description 1
- 239000004408 titanium dioxide Substances 0.000 description 1
- OGIDPMRJRNCKJF-UHFFFAOYSA-N titanium oxide Inorganic materials [Ti]=O OGIDPMRJRNCKJF-UHFFFAOYSA-N 0.000 description 1
- NWJUKFMMXJODIL-UHFFFAOYSA-N zinc cadmium(2+) selenium(2-) Chemical compound [Zn+2].[Se-2].[Se-2].[Cd+2] NWJUKFMMXJODIL-UHFFFAOYSA-N 0.000 description 1
- XSMMCTCMFDWXIX-UHFFFAOYSA-N zinc silicate Chemical compound [Zn+2].[O-][Si]([O-])=O XSMMCTCMFDWXIX-UHFFFAOYSA-N 0.000 description 1
- 235000019352 zinc silicate Nutrition 0.000 description 1
- DRDVZXDWVBGGMH-UHFFFAOYSA-N zinc;sulfide Chemical compound [S-2].[Zn+2] DRDVZXDWVBGGMH-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03G—ELECTROGRAPHY; ELECTROPHOTOGRAPHY; MAGNETOGRAPHY
- G03G5/00—Recording members for original recording by exposure, e.g. to light, to heat, to electrons; Manufacture thereof; Selection of materials therefor
- G03G5/02—Charge-receiving layers
- G03G5/04—Photoconductive layers; Charge-generation layers or charge-transporting layers; Additives therefor; Binders therefor
- G03G5/08—Photoconductive layers; Charge-generation layers or charge-transporting layers; Additives therefor; Binders therefor characterised by the photoconductive material being inorganic
- G03G5/085—Photoconductive layers; Charge-generation layers or charge-transporting layers; Additives therefor; Binders therefor characterised by the photoconductive material being inorganic and being incorporated in an inorganic bonding material, e.g. glass-like layers
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10—TECHNICAL SUBJECTS COVERED BY FORMER USPC
- Y10S—TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10S101/00—Printing
- Y10S101/37—Printing employing electrostatic force
Landscapes
- Chemical & Material Sciences (AREA)
- Inorganic Chemistry (AREA)
- Physics & Mathematics (AREA)
- General Physics & Mathematics (AREA)
- Photoreceptors In Electrophotography (AREA)
- Developing Agents For Electrophotography (AREA)
- Glass Compositions (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US184594A US3151982A (en) | 1962-04-02 | 1962-04-02 | Xerographic plate |
| US363609A US3288603A (en) | 1962-04-02 | 1964-04-29 | Method of restoring xerographic properties to a glass binder plate |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE1497054A1 DE1497054A1 (de) | 1969-05-08 |
| DE1497054B2 DE1497054B2 (de) | 1974-12-19 |
| DE1497054C3 true DE1497054C3 (de) | 1975-08-07 |
Family
ID=26880297
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE1497054A Expired DE1497054C3 (de) | 1962-04-02 | 1963-03-28 | Elektrofotografisches Aufzeichnungsmaterial |
Country Status (9)
| Country | Link |
|---|---|
| US (2) | US3151982A (enExample) |
| BE (1) | BE630478A (enExample) |
| CH (1) | CH450173A (enExample) |
| DE (1) | DE1497054C3 (enExample) |
| DK (1) | DK116787B (enExample) |
| GB (3) | GB1049871A (enExample) |
| LU (2) | LU43461A1 (enExample) |
| NL (2) | NL139212B (enExample) |
| SE (1) | SE313998B (enExample) |
Families Citing this family (24)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL291000A (enExample) * | 1962-04-02 | |||
| US3288604A (en) * | 1964-09-03 | 1966-11-29 | Xerox Corp | Imaging method using an element having a glass overcoating |
| US3460476A (en) * | 1965-12-27 | 1969-08-12 | Xerox Corp | Imaging process |
| US3507646A (en) * | 1965-12-27 | 1970-04-21 | Xerox Corp | Electrophotographic process using a single phase photoconductive glass imaging layer |
| FR1515704A (fr) * | 1966-03-31 | 1968-03-01 | Rank Xerox Ltd | Cliché électrophotographique et son procédé de fabrication |
| US3510298A (en) * | 1966-05-13 | 1970-05-05 | Xerox Corp | Process of activating photoconductive material in glass binder |
| US3561358A (en) * | 1966-10-10 | 1971-02-09 | Xerox Corp | Gravure imaging system |
| GB1219329A (en) * | 1967-04-03 | 1971-01-13 | Rank Xerox Ltd | Process for fabricating a photoconductor glass xerographic plate |
| US3537848A (en) * | 1967-10-20 | 1970-11-03 | Xerox Corp | Process of treating a xerographic glass binder plate and product |
| US3535133A (en) * | 1968-04-24 | 1970-10-20 | Transitron Electronic Corp | Alkali-free electronic glass and method of manufacture |
| GB1266151A (enExample) * | 1968-04-26 | 1972-03-08 | ||
| JPS556217B1 (enExample) * | 1970-01-16 | 1980-02-14 | ||
| USRE28626E (en) * | 1970-01-16 | 1975-11-25 | Electrophotograhic photosensitive zinc oxide powder mixture | |
| US3754965A (en) * | 1971-04-05 | 1973-08-28 | Varian Associates | A method for making an electrophotographic plate |
| US4053863A (en) * | 1971-06-03 | 1977-10-11 | Varian Associates, Inc. | Electrophotographic photoconductive plate and the method of making same |
| US3850647A (en) * | 1972-09-29 | 1974-11-26 | Ceramic Coating Co | Cermet protective coating |
| US4015984A (en) * | 1973-05-17 | 1977-04-05 | Kabushiki Kaisha Ricoh | Inorganic photoconductor in glass binds with glass overcoat layer |
| US3948656A (en) * | 1974-05-16 | 1976-04-06 | Xerox Corporation | Method for the preparation of photoconductive CdSSe |
| US4053309A (en) * | 1974-06-10 | 1977-10-11 | Varian Associates, Inc. | Electrophotographic imaging method |
| US4015029A (en) * | 1975-06-27 | 1977-03-29 | Xerox Corporation | Selenium and selenium alloy evaporation technique |
| US4061599A (en) * | 1976-02-06 | 1977-12-06 | Guy Anthony Marlor | Composition for preparation of a photoconductor surface for use in electrophotography |
| JPH06210987A (ja) * | 1993-01-19 | 1994-08-02 | Canon Inc | 非可視化情報記録媒体、非可視化情報検出装置並びに記録剤 |
| JP3053986B2 (ja) * | 1993-01-21 | 2000-06-19 | キヤノン株式会社 | 記録再生装置 |
| NZ516848A (en) * | 1997-06-20 | 2004-03-26 | Ciphergen Biosystems Inc | Retentate chromatography apparatus with applications in biology and medicine |
Family Cites Families (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US1667146A (en) * | 1928-04-24 | of toledo | ||
| US2930999A (en) * | 1960-03-29 | Photo-conductive device and method of | ||
| US2371486A (en) * | 1942-12-16 | 1945-03-13 | Alncin Inc | Optical device and method of making same |
| BE526684A (enExample) * | 1949-06-29 | |||
| US2901348A (en) * | 1953-03-17 | 1959-08-25 | Haloid Xerox Inc | Radiation sensitive photoconductive member |
| US2862815A (en) * | 1953-10-01 | 1958-12-02 | Rca Corp | Electrophotographic member |
| US2940951A (en) * | 1955-03-07 | 1960-06-14 | Union Carbide Corp | Metallo-ceramic preparations |
| US2844543A (en) * | 1955-03-18 | 1958-07-22 | Horizons Inc | Transparent photoconductive composition |
| US2886434A (en) * | 1955-06-06 | 1959-05-12 | Horizons Inc | Protected photoconductive element and method of making same |
| US2863768A (en) * | 1955-07-05 | 1958-12-09 | Haloid Xerox Inc | Xerographic plate |
| US2937353A (en) * | 1959-02-27 | 1960-05-17 | Sylvania Electric Prod | Photoconductive devices |
| US3077398A (en) * | 1959-05-14 | 1963-02-12 | Bell & Howell Co | Xerographic plate made by cast coating |
| NL291000A (enExample) * | 1962-04-02 |
-
0
- NL NL291000D patent/NL291000A/xx unknown
- LU LU17923D patent/LU17923A1/xx unknown
- BE BE630478D patent/BE630478A/xx unknown
-
1962
- 1962-04-02 US US184594A patent/US3151982A/en not_active Expired - Lifetime
-
1963
- 1963-03-28 DE DE1497054A patent/DE1497054C3/de not_active Expired
- 1963-04-01 DK DK149363AA patent/DK116787B/da unknown
- 1963-04-01 SE SE3588/63A patent/SE313998B/xx unknown
- 1963-04-02 GB GB11901/63A patent/GB1049871A/en not_active Expired
- 1963-04-02 NL NL63291000A patent/NL139212B/xx not_active IP Right Cessation
- 1963-04-02 CH CH419663A patent/CH450173A/fr unknown
- 1963-04-02 GB GB25919/66A patent/GB1049872A/en not_active Expired
- 1963-04-02 LU LU43461D patent/LU43461A1/xx unknown
-
1964
- 1964-04-29 US US363609A patent/US3288603A/en not_active Expired - Lifetime
-
1965
- 1965-04-08 GB GB14901/65A patent/GB1088473A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| DE1497054A1 (de) | 1969-05-08 |
| DE1497201B2 (de) | 1975-10-09 |
| DE1497201A1 (de) | 1969-05-14 |
| DE1497054B2 (de) | 1974-12-19 |
| GB1049871A (en) | 1966-11-30 |
| US3151982A (en) | 1964-10-06 |
| NL291000A (enExample) | |
| DK116787B (da) | 1970-02-09 |
| SE313998B (enExample) | 1969-08-25 |
| BE630478A (enExample) | |
| NL139212B (nl) | 1973-06-15 |
| US3288603A (en) | 1966-11-29 |
| CH450173A (fr) | 1968-01-15 |
| LU17923A1 (enExample) | |
| GB1049872A (en) | 1966-11-30 |
| GB1088473A (en) | 1967-10-25 |
| LU43461A1 (enExample) | 1963-06-14 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1497054C3 (de) | Elektrofotografisches Aufzeichnungsmaterial | |
| DE69408609T2 (de) | Leitfähige Überzüge mit Silber | |
| DE1522711C3 (de) | Elektrophotographisches Aufzeichnungsmaterial | |
| DE60128167T2 (de) | Niedrigschmelzendes Glass zur Bekleidung eines Substrats | |
| DE60010977T2 (de) | Emailzusammensetzung, Verfahren zur Herstellung und erhaltene emaillierte Gegenstände | |
| DE2164141A1 (de) | Verfahren zur Herstellung eines photokonduktiven Pulvers | |
| DE602004009525T2 (de) | Rezyklisierbare emaillierte Verglasung | |
| AT247148B (de) | Xerographischer Bildträger | |
| DE1522598C3 (de) | Elektrophotographisches Aufzeichnungsmaterial | |
| DE1522713A1 (de) | Elektrophotographische Platte | |
| DE1572366C3 (de) | Verfahren zum Herstellen einer Glas als Bindemittel enthaltenden photoleitfähigen Schicht | |
| DE2360909C3 (de) | Verfahren zur Herstellung eines elektrophotographischen Aufzeichnungsmaterials | |
| DE2200061C3 (de) | Verfahren zur Herstellung eines pulverförmigen Photoleiters | |
| DE1522728B2 (de) | Verfahren zur herstellung einer elektrophotographischen platte | |
| DE3035438C2 (enExample) | ||
| DE1282807C2 (de) | Bildspeicher | |
| DE1572366B2 (de) | Verfahren zum Herstellen einer Glas als Bindemittel enthaltenden photoleitfähigen Schicht | |
| DE2028641C3 (de) | Verfahren zur Erzeugung eines Ladungsbildes und Aufzeichnungsmaterial zur Durchführung des Verfahrens | |
| DE3035298C2 (enExample) | ||
| DE1015964B (de) | Verfahren zur Herstellung eines elektroluminescierenden Pulvers | |
| DE1916609C3 (de) | Verwendung einer photoleitfähigen Platte mit einer gashaltigen Photoleiterschicht und Verfahren zu ihrer Herstellung | |
| EP0714966A1 (de) | Lumineszierender Schirm mit einer Leuchtstoffzusammensetzung | |
| DE2064247B2 (de) | Elektrophotographisches Aufzeichnungsmaterial | |
| DE1522603B2 (de) | Verfahren zur herstellung eines photoleiters bzw einer photoleitfaehigen schicht | |
| DE1522728C3 (de) | Verfahren zur Herstellung einer elektrophotographischen Platte |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| SH | Request for examination between 03.10.1968 and 22.04.1971 | ||
| C3 | Grant after two publication steps (3rd publication) | ||
| E77 | Valid patent as to the heymanns-index 1977 |