DE1495912A1 - Verfahren zur Herstellung linearer Mischpolyester - Google Patents
Verfahren zur Herstellung linearer MischpolyesterInfo
- Publication number
- DE1495912A1 DE1495912A1 DE19581495912 DE1495912A DE1495912A1 DE 1495912 A1 DE1495912 A1 DE 1495912A1 DE 19581495912 DE19581495912 DE 19581495912 DE 1495912 A DE1495912 A DE 1495912A DE 1495912 A1 DE1495912 A1 DE 1495912A1
- Authority
- DE
- Germany
- Prior art keywords
- acid
- production
- carbonyl halide
- linear mixed
- tertiary amine
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 18
- 229920000728 polyester Polymers 0.000 title claims description 8
- 238000004519 manufacturing process Methods 0.000 title claims description 5
- 239000002253 acid Substances 0.000 claims description 17
- -1 carbonyl halide Chemical class 0.000 claims description 17
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 claims description 10
- 238000006243 chemical reaction Methods 0.000 claims description 10
- 150000003512 tertiary amines Chemical class 0.000 claims description 10
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 claims description 8
- 150000002989 phenols Chemical class 0.000 claims description 6
- 239000003960 organic solvent Substances 0.000 claims description 5
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 claims description 5
- 150000001735 carboxylic acids Chemical class 0.000 claims description 3
- 239000007864 aqueous solution Substances 0.000 claims description 2
- 125000005587 carbonate group Chemical group 0.000 claims description 2
- 150000007942 carboxylates Chemical class 0.000 claims description 2
- 150000001875 compounds Chemical class 0.000 claims description 2
- IISBACLAFKSPIT-UHFFFAOYSA-N bisphenol A Chemical compound C=1C=C(O)C=CC=1C(C)(C)C1=CC=C(O)C=C1 IISBACLAFKSPIT-UHFFFAOYSA-N 0.000 description 13
- 229920001634 Copolyester Polymers 0.000 description 12
- WNLRTRBMVRJNCN-UHFFFAOYSA-N adipic acid Chemical compound OC(=O)CCCCC(O)=O WNLRTRBMVRJNCN-UHFFFAOYSA-N 0.000 description 8
- 239000002904 solvent Substances 0.000 description 7
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 6
- 229940106691 bisphenol a Drugs 0.000 description 6
- QQVIHTHCMHWDBS-UHFFFAOYSA-N isophthalic acid Chemical compound OC(=O)C1=CC=CC(C(O)=O)=C1 QQVIHTHCMHWDBS-UHFFFAOYSA-N 0.000 description 6
- 125000002947 alkylene group Chemical group 0.000 description 5
- 239000000243 solution Substances 0.000 description 5
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 4
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 4
- ATUOYWHBWRKTHZ-UHFFFAOYSA-N Propane Chemical compound CCC ATUOYWHBWRKTHZ-UHFFFAOYSA-N 0.000 description 4
- 235000011037 adipic acid Nutrition 0.000 description 4
- 239000001361 adipic acid Substances 0.000 description 4
- 125000001118 alkylidene group Chemical group 0.000 description 4
- 125000003118 aryl group Chemical group 0.000 description 4
- KKEYFWRCBNTPAC-UHFFFAOYSA-N benzene-dicarboxylic acid Natural products OC(=O)C1=CC=C(C(O)=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-N 0.000 description 4
- 229920000642 polymer Polymers 0.000 description 4
- 239000000376 reactant Substances 0.000 description 4
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 3
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 125000000896 monocarboxylic acid group Chemical group 0.000 description 3
- 229910052717 sulfur Inorganic materials 0.000 description 3
- 239000011593 sulfur Substances 0.000 description 3
- QPFMBZIOSGYJDE-UHFFFAOYSA-N 1,1,2,2-tetrachloroethane Chemical compound ClC(Cl)C(Cl)Cl QPFMBZIOSGYJDE-UHFFFAOYSA-N 0.000 description 2
- BKOOMYPCSUNDGP-UHFFFAOYSA-N 2-methylbut-2-ene Chemical group CC=C(C)C BKOOMYPCSUNDGP-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical compound C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 description 2
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 2
- UCKMPCXJQFINFW-UHFFFAOYSA-N Sulphide Chemical compound [S-2] UCKMPCXJQFINFW-UHFFFAOYSA-N 0.000 description 2
- RAHZWNYVWXNFOC-UHFFFAOYSA-N Sulphur dioxide Chemical compound O=S=O RAHZWNYVWXNFOC-UHFFFAOYSA-N 0.000 description 2
- DZBUGLKDJFMEHC-UHFFFAOYSA-N acridine Chemical compound C1=CC=CC2=CC3=CC=CC=C3N=C21 DZBUGLKDJFMEHC-UHFFFAOYSA-N 0.000 description 2
- 125000001931 aliphatic group Chemical group 0.000 description 2
- NIDNOXCRFUCAKQ-UHFFFAOYSA-N bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylic acid Chemical compound C1C2C=CC1C(C(=O)O)C2C(O)=O NIDNOXCRFUCAKQ-UHFFFAOYSA-N 0.000 description 2
- 230000001588 bifunctional effect Effects 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- 229910052736 halogen Inorganic materials 0.000 description 2
- 150000002367 halogens Chemical class 0.000 description 2
- 150000002440 hydroxy compounds Chemical class 0.000 description 2
- BDJRBEYXGGNYIS-UHFFFAOYSA-N nonanedioic acid Chemical compound OC(=O)CCCCCCCC(O)=O BDJRBEYXGGNYIS-UHFFFAOYSA-N 0.000 description 2
- XNGIFLGASWRNHJ-UHFFFAOYSA-N phthalic acid Chemical compound OC(=O)C1=CC=CC=C1C(O)=O XNGIFLGASWRNHJ-UHFFFAOYSA-N 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 239000001294 propane Substances 0.000 description 2
- 229910052710 silicon Inorganic materials 0.000 description 2
- 239000010703 silicon Substances 0.000 description 2
- 150000003457 sulfones Chemical class 0.000 description 2
- 150000003462 sulfoxides Chemical class 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- HCNHNBLSNVSJTJ-UHFFFAOYSA-N 1,1-Bis(4-hydroxyphenyl)ethane Chemical compound C=1C=C(O)C=CC=1C(C)C1=CC=C(O)C=C1 HCNHNBLSNVSJTJ-UHFFFAOYSA-N 0.000 description 1
- KNKRKFALVUDBJE-UHFFFAOYSA-N 1,2-dichloropropane Chemical compound CC(Cl)CCl KNKRKFALVUDBJE-UHFFFAOYSA-N 0.000 description 1
- YJTKZCDBKVTVBY-UHFFFAOYSA-N 1,3-Diphenylbenzene Chemical group C1=CC=CC=C1C1=CC=CC(C=2C=CC=CC=2)=C1 YJTKZCDBKVTVBY-UHFFFAOYSA-N 0.000 description 1
- MQCPOLNSJCWPGT-UHFFFAOYSA-N 2,2'-Bisphenol F Chemical compound OC1=CC=CC=C1CC1=CC=CC=C1O MQCPOLNSJCWPGT-UHFFFAOYSA-N 0.000 description 1
- JHOPNNNTBHXSHY-UHFFFAOYSA-N 2-(4-hydroxyphenyl)phenol Chemical group C1=CC(O)=CC=C1C1=CC=CC=C1O JHOPNNNTBHXSHY-UHFFFAOYSA-N 0.000 description 1
- CVWOYHDMNIZZMP-UHFFFAOYSA-N 2-[(2-hydroxy-5-nitrophenyl)methyl]-4-nitrophenol Chemical compound OC1=CC=C([N+]([O-])=O)C=C1CC1=CC([N+]([O-])=O)=CC=C1O CVWOYHDMNIZZMP-UHFFFAOYSA-N 0.000 description 1
- RKSBPFMNOJWYSB-UHFFFAOYSA-N 3,3-Bis(4-hydroxyphenyl)pentane Chemical compound C=1C=C(O)C=CC=1C(CC)(CC)C1=CC=C(O)C=C1 RKSBPFMNOJWYSB-UHFFFAOYSA-N 0.000 description 1
- CGFCKPWPXHKFPU-UHFFFAOYSA-N 3-chloro-4-[1-(2-chloro-4-hydroxyphenyl)ethyl]phenol Chemical compound C=1C=C(O)C=C(Cl)C=1C(C)C1=CC=C(O)C=C1Cl CGFCKPWPXHKFPU-UHFFFAOYSA-N 0.000 description 1
- NZGQHKSLKRFZFL-UHFFFAOYSA-N 4-(4-hydroxyphenoxy)phenol Chemical compound C1=CC(O)=CC=C1OC1=CC=C(O)C=C1 NZGQHKSLKRFZFL-UHFFFAOYSA-N 0.000 description 1
- ACEMPBSQAVZNEJ-UHFFFAOYSA-N 4-[(4-hydroxy-3-methoxy-2,6-dimethylphenyl)methyl]-2-methoxy-3,5-dimethylphenol Chemical compound C1=C(O)C(OC)=C(C)C(CC=2C(=C(OC)C(O)=CC=2C)C)=C1C ACEMPBSQAVZNEJ-UHFFFAOYSA-N 0.000 description 1
- RSSGMIIGVQRGDS-UHFFFAOYSA-N 4-[(4-hydroxyphenyl)-phenylmethyl]phenol Chemical compound C1=CC(O)=CC=C1C(C=1C=CC(O)=CC=1)C1=CC=CC=C1 RSSGMIIGVQRGDS-UHFFFAOYSA-N 0.000 description 1
- GUTXHCCMQDOMQG-UHFFFAOYSA-N 4-[1-(4-hydroxy-2,5-dimethylphenyl)ethyl]-2,5-dimethylphenol Chemical compound C=1C(C)=C(O)C=C(C)C=1C(C)C1=CC(C)=C(O)C=C1C GUTXHCCMQDOMQG-UHFFFAOYSA-N 0.000 description 1
- IJWIRZQYWANBMP-UHFFFAOYSA-N 4-[2-(4-hydroxy-3-propan-2-ylphenyl)propan-2-yl]-2-propan-2-ylphenol Chemical compound C1=C(O)C(C(C)C)=CC(C(C)(C)C=2C=C(C(O)=CC=2)C(C)C)=C1 IJWIRZQYWANBMP-UHFFFAOYSA-N 0.000 description 1
- LCYRQNBSGYQLKY-UHFFFAOYSA-N 4-[2-(4-hydroxynaphthalen-1-yl)propan-2-yl]naphthalen-1-ol Chemical compound C1=CC=C2C(C(C)(C=3C4=CC=CC=C4C(O)=CC=3)C)=CC=C(O)C2=C1 LCYRQNBSGYQLKY-UHFFFAOYSA-N 0.000 description 1
- ZZXOXJAAKGCFNH-UHFFFAOYSA-N 4-[2-(4-hydroxyphenyl)-1,2-diphenylpropyl]phenol Chemical compound C=1C=CC=CC=1C(C=1C=CC(O)=CC=1)(C)C(C=1C=CC(O)=CC=1)C1=CC=CC=C1 ZZXOXJAAKGCFNH-UHFFFAOYSA-N 0.000 description 1
- DUKMWXLEZOCRSO-UHFFFAOYSA-N 4-[2-(4-hydroxyphenyl)-1-phenylpropan-2-yl]phenol Chemical compound C=1C=C(O)C=CC=1C(C=1C=CC(O)=CC=1)(C)CC1=CC=CC=C1 DUKMWXLEZOCRSO-UHFFFAOYSA-N 0.000 description 1
- XHQYAMKBTLODDV-UHFFFAOYSA-N 4-[2-(4-hydroxyphenyl)heptan-2-yl]phenol Chemical compound C=1C=C(O)C=CC=1C(C)(CCCCC)C1=CC=C(O)C=C1 XHQYAMKBTLODDV-UHFFFAOYSA-N 0.000 description 1
- KSYGTCNPCHQRKM-UHFFFAOYSA-N 4-[2-(4-hydroxyphenyl)propan-2-yl]phenol Chemical compound C=1C=C(O)C=CC=1C(C)(C)C1=CC=C(O)C=C1.C=1C=C(O)C=CC=1C(C)(C)C1=CC=C(O)C=C1 KSYGTCNPCHQRKM-UHFFFAOYSA-N 0.000 description 1
- YZYGDZRBLOLVDY-UHFFFAOYSA-N 4-[cyclohexyl-(4-hydroxyphenyl)methyl]phenol Chemical compound C1=CC(O)=CC=C1C(C=1C=CC(O)=CC=1)C1CCCCC1 YZYGDZRBLOLVDY-UHFFFAOYSA-N 0.000 description 1
- 125000004203 4-hydroxyphenyl group Chemical group [H]OC1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- UGFAIRIUMAVXCW-UHFFFAOYSA-N Carbon monoxide Chemical compound [O+]#[C-] UGFAIRIUMAVXCW-UHFFFAOYSA-N 0.000 description 1
- JLTDJTHDQAWBAV-UHFFFAOYSA-N N,N-dimethylaniline Chemical compound CN(C)C1=CC=CC=C1 JLTDJTHDQAWBAV-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- BLRPTPMANUNPDV-UHFFFAOYSA-N Silane Chemical compound [SiH4] BLRPTPMANUNPDV-UHFFFAOYSA-N 0.000 description 1
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical group [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 description 1
- 239000006096 absorbing agent Substances 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- IMHDGJOMLMDPJN-UHFFFAOYSA-N biphenyl-2,2'-diol Chemical group OC1=CC=CC=C1C1=CC=CC=C1O IMHDGJOMLMDPJN-UHFFFAOYSA-N 0.000 description 1
- VCCBEIPGXKNHFW-UHFFFAOYSA-N biphenyl-4,4'-diol Chemical group C1=CC(O)=CC=C1C1=CC=C(O)C=C1 VCCBEIPGXKNHFW-UHFFFAOYSA-N 0.000 description 1
- 125000002529 biphenylenyl group Chemical group C1(=CC=CC=2C3=CC=CC=C3C12)* 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 229910002091 carbon monoxide Inorganic materials 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 241001233037 catfish Species 0.000 description 1
- 229920001577 copolymer Polymers 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 150000005205 dihydroxybenzenes Chemical class 0.000 description 1
- GWZCCUDJHOGOSO-UHFFFAOYSA-N diphenic acid Chemical compound OC(=O)C1=CC=CC=C1C1=CC=CC=C1C(O)=O GWZCCUDJHOGOSO-UHFFFAOYSA-N 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 239000000835 fiber Substances 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 150000002430 hydrocarbons Chemical group 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- MNZMMCVIXORAQL-UHFFFAOYSA-N naphthalene-2,6-diol Chemical compound C1=C(O)C=CC2=CC(O)=CC=C21 MNZMMCVIXORAQL-UHFFFAOYSA-N 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
- 239000011356 non-aqueous organic solvent Substances 0.000 description 1
- 125000001820 oxy group Chemical group [*:1]O[*:2] 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 125000000843 phenylene group Chemical group C1(=C(C=CC=C1)*)* 0.000 description 1
- 229920002492 poly(sulfone) Polymers 0.000 description 1
- 238000006116 polymerization reaction Methods 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 150000003222 pyridines Chemical class 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 238000007086 side reaction Methods 0.000 description 1
- 229910000077 silane Inorganic materials 0.000 description 1
- 125000005374 siloxide group Chemical group 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 125000000383 tetramethylene group Chemical group [H]C([H])([*:1])C([H])([H])C([H])([H])C([H])([H])[*:2] 0.000 description 1
- UVZICZIVKIMRNE-UHFFFAOYSA-N thiodiacetic acid Chemical compound OC(=O)CSCC(O)=O UVZICZIVKIMRNE-UHFFFAOYSA-N 0.000 description 1
- IMFACGCPASFAPR-UHFFFAOYSA-N tributylamine Chemical compound CCCCN(CCCC)CCCC IMFACGCPASFAPR-UHFFFAOYSA-N 0.000 description 1
- YFTHZRPMJXBUME-UHFFFAOYSA-N tripropylamine Chemical compound CCCN(CCC)CCC YFTHZRPMJXBUME-UHFFFAOYSA-N 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G63/00—Macromolecular compounds obtained by reactions forming a carboxylic ester link in the main chain of the macromolecule
- C08G63/64—Polyesters containing both carboxylic ester groups and carbonate groups
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Polyesters Or Polycarbonates (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US679747A US3030331A (en) | 1957-08-22 | 1957-08-22 | Process for preparing copolyesters comprising reacting a carbonyl halide with a dicarboxylic acid and a dihydroxy compound in the presence of a tertiary amine |
| US124265A US3220976A (en) | 1957-08-22 | 1961-06-15 | Process for the preparation of copolyesters comprising reacting a bishaloformate of a dihydroxy compound with a difunctional carboxylic acid in a solution containing tertiary amine |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1495912A1 true DE1495912A1 (de) | 1969-05-22 |
Family
ID=26822368
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19581495912 Pending DE1495912A1 (de) | 1957-08-22 | 1958-08-21 | Verfahren zur Herstellung linearer Mischpolyester |
| DE19581420476 Pending DE1420476A1 (de) | 1957-08-22 | 1958-08-21 | Verfahren zur Herstellung von Blockmischpolyester |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19581420476 Pending DE1420476A1 (de) | 1957-08-22 | 1958-08-21 | Verfahren zur Herstellung von Blockmischpolyester |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US3220976A (enExample) |
| BE (1) | BE570530A (enExample) |
| DE (2) | DE1495912A1 (enExample) |
| FR (1) | FR1211559A (enExample) |
| GB (1) | GB870096A (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5408027A (en) * | 1993-03-05 | 1995-04-18 | Bayer Aktiengesellschaft | Process for the production of aliphatic-aromatic polycarbonates |
Families Citing this family (25)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3312659A (en) * | 1967-04-04 | Catalytic preparation of polycarbon- ates from bisphenol and a carbonate precursor | ||
| DE1181844B (de) * | 1960-07-30 | 1964-11-19 | Bayer Ag | Lackloesungen |
| US3207814A (en) * | 1961-01-03 | 1965-09-21 | Gen Electric | Carbonate-polyester copolymer resinous compositions |
| US3355414A (en) * | 1961-09-14 | 1967-11-28 | Eastman Kodak Co | Thermosetting polyesters |
| US3312660A (en) * | 1962-07-03 | 1967-04-04 | Union Carbide Corp | Process for preparing polycarbonates by self-condensation of bisphenol dichloroformate |
| US3312662A (en) * | 1962-07-03 | 1967-04-04 | Union Carbide Corp | Catalytic process for preparing polycarbonates by self-condensation of bisphenol dichloroformate |
| US3312661A (en) * | 1962-07-03 | 1967-04-04 | Union Carbide Corp | Process for preparing polycarbonates by self-condensation of bisphenol dichloroformate |
| JPS5928226B2 (ja) * | 1975-11-10 | 1984-07-11 | アデカ ア−ガスカガク カブシキガイシヤ | アンテイカサレタゴウセイジユシソセイブツ |
| DE2651639A1 (de) * | 1976-11-12 | 1978-05-24 | Bayer Ag | Verfahren zur herstellung von kohlensaeureestern von polyesterpolyolen |
| US4216298A (en) * | 1976-11-12 | 1980-08-05 | Bayer Aktiengesellschaft | Process for the preparation of carbonic acid bis-diphenol esters of polyester-diols and their use for the preparation of high-molecular segmented polyester/polycarbonates which can be processed as thermoplastics |
| US4297455A (en) * | 1977-03-22 | 1981-10-27 | Bayer Aktiengesellschaft | Process for the preparation of carbonic acid aryl esters of polyester-diols lengthened via carbonate groups and their use for the preparation of polyester-diol bis-diphenol carbonates and polyester/polycarbonates |
| DE2712435A1 (de) * | 1977-03-22 | 1978-09-28 | Bayer Ag | Verfahren zur herstellung von kohlensaeurearylestern von ueber carbonat- gruppen-verlaengerten polyesterdiolen |
| DE2726416A1 (de) * | 1977-06-11 | 1978-12-21 | Bayer Ag | Verfahren zur herstellung von kohlensaeure-bis-diphenol-estern von ueber carbonat-gruppen-verlaengerten polyalkylenoxiddiolen und ihre verwendung zur herstellung von hochmolekularen, segmentierten, thermoplastisch verarbeitbaren polyaether-polycarbonaten |
| EP0004020B1 (de) * | 1978-03-10 | 1981-07-15 | Bayer Ag | Polycarbonat-Formmassen mit verbesserten zähelastischen Eigenschaften |
| US4374973A (en) * | 1978-11-30 | 1983-02-22 | Allied Corporation | Polycarbonates with suppressed aging characteristics |
| US4219635A (en) * | 1979-01-26 | 1980-08-26 | Allied Chemical Corporation | Process for poly (bisphenol A/terephthalate/carbonate) using pyridine reaction medium |
| US4255556A (en) * | 1979-04-12 | 1981-03-10 | Allied Chemical Corporation | Preparation of poly(ester carbonate) by interfacial method |
| US4233414A (en) | 1979-05-29 | 1980-11-11 | Argus Chemical Corporation | Polyhydric phenol coester stabilizers |
| DE3333864A1 (de) * | 1983-09-20 | 1985-04-04 | Bayer Ag, 5090 Leverkusen | Verfahren zur herstellung von aromatischen polyestercarbonaten |
| DE3333863A1 (de) * | 1983-09-20 | 1985-04-04 | Bayer Ag, 5090 Leverkusen | Phasengrenzflaechenverfahren zur herstellung vollaromatischer polyestercarbonate |
| US4476294A (en) * | 1983-12-16 | 1984-10-09 | General Electric Company | Copolyester-carbonate resins |
| US4851498A (en) * | 1987-12-16 | 1989-07-25 | General Electric Company | Thermoplastic molding resins having dicyclopentadienyl derivative radical in polymer backbone |
| US5045610A (en) * | 1989-08-31 | 1991-09-03 | The Dow Chemical Company | Blend of copolyestercarbonate polymer derived from diaryl dicarboxylic acid |
| KR950013539B1 (ko) * | 1991-11-13 | 1995-11-08 | 재단법인한국화학연구소 | 폴리이미드 공중합체 및 그 제조방법 |
| KR100322264B1 (ko) | 1999-12-31 | 2002-02-06 | 김윤 | 코폴리카보네이트 수지의 연속 제조방법 |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2517965A (en) * | 1948-03-23 | 1950-08-08 | Pittsburgh Plate Glass Co | Purification of carbonic acid esters |
| US2615914A (en) * | 1949-02-08 | 1952-10-28 | Chessie E Rehberg | Alkyl carbonates of lactates |
| DE890792C (de) * | 1951-09-07 | 1953-08-13 | Badische Anilin- & Soda-Fabrik Aktiengesellschaft, Ludwigshafen1 Rhein | Verfahren zur Herstellung von Carbonsäureestern |
| DE1101386B (de) * | 1956-12-04 | 1961-03-09 | Bayer Ag | Verfahren zur Herstellung monomerer Kohlensaeureester |
-
0
- BE BE570530D patent/BE570530A/xx unknown
-
1958
- 1958-07-31 GB GB24700/58A patent/GB870096A/en not_active Expired
- 1958-08-19 FR FR1211559D patent/FR1211559A/fr not_active Expired
- 1958-08-21 DE DE19581495912 patent/DE1495912A1/de active Pending
- 1958-08-21 DE DE19581420476 patent/DE1420476A1/de active Pending
-
1961
- 1961-06-15 US US124265A patent/US3220976A/en not_active Expired - Lifetime
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5408027A (en) * | 1993-03-05 | 1995-04-18 | Bayer Aktiengesellschaft | Process for the production of aliphatic-aromatic polycarbonates |
Also Published As
| Publication number | Publication date |
|---|---|
| US3220976A (en) | 1965-11-30 |
| BE570530A (enExample) | |
| FR1211559A (fr) | 1960-03-17 |
| DE1420476A1 (de) | 1968-10-03 |
| GB870096A (en) | 1961-06-14 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1495912A1 (de) | Verfahren zur Herstellung linearer Mischpolyester | |
| DE1420475A1 (de) | Verfahren zur Herstellung linearer Mischpolyester | |
| DE69028152T2 (de) | Verfahren zur Herstellung von Polycarbonat-Polysiloxan-Blockcopolymeren | |
| DE69525591T2 (de) | Autoklavenbeständige Zusammensetzungen aus Polyestercarbonat- und Polyetherimidharzen | |
| DE69914352T2 (de) | Witterungsbeständige blockcopolyestercarbonate und diese enthaltende polymerlegierungen | |
| DE3344911A1 (de) | Thermoplastische polysiloxan-polyester(carbonat)-blockcopolymere, ihre herstellung und verwendung | |
| DE2063052A1 (de) | Verseifungsbeständige Polycarbonate | |
| EP0013904B1 (de) | Verfahren zur Herstellung von Polycarbonaten | |
| DE69915275T2 (de) | Verzweigte polycarbonate hergestellt durch reaktive extrusion | |
| DE2202168A1 (de) | Verfahren zur Herstellung von Cyanaryloxy-Polymeren und die davon abgeleiteten Produkte | |
| DE69831714T2 (de) | Verzweigungsmittel für reaktive Extrusion | |
| DE1162559B (de) | Verwendung von Polycarbonaten zur Herstellung von Folien, Faeden und Fasern | |
| DE1595327A1 (de) | Neue lineare Polyester-Copolymere | |
| DE3638280C2 (de) | Thermoplastisches aromatisches Carbonatharz | |
| DE1420498A1 (de) | Neuartige Polycarbonat-Kunstharzmassen,die auch bei erhoehten Temperaturen ihre Biegsamkeit bewahren | |
| DE3783890T2 (de) | Harzmischungen mit schlagzaehigkeitseigenschaften. | |
| EP0201830B1 (de) | Verfahren zur Herstellung von Copolyphosphonaten mit hoher Kerbschlagzähigkeit | |
| DE69517926T2 (de) | Gammastrahlungsstabiler Blend von Polycarbonat mit Polyester | |
| DE69227813T2 (de) | Polycarbonatharzmasse | |
| EP0065728B1 (de) | Neue Copolyestercarbonate und deren Abmischung mit bekannten Polycarbonaten zu thermoplastischen Formmassen | |
| EP0368104B1 (de) | Thermoplastische Polyestercarbonat-Polysiloxan-Blockcopolymere | |
| EP0014412B1 (de) | Thermoplastische Massen und Verfahren zu ihrer Herstellung | |
| DE69228587T2 (de) | Verfahren zur Herstellung von matten thermoplastischen Harzzusammensetzungen | |
| DE3408709C2 (enExample) | ||
| DE3750328T2 (de) | Schlagmodifizierte Zusammensetzungen von aromatischem Karbonat. |