DE1468177C - - Google Patents
Info
- Publication number
- DE1468177C DE1468177C DE1468177C DE 1468177 C DE1468177 C DE 1468177C DE 1468177 C DE1468177 C DE 1468177C
- Authority
- DE
- Germany
- Prior art keywords
- methylpentane
- organic solvent
- hydrogen peroxide
- water
- methyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- MHAJPDPJQMAIIY-UHFFFAOYSA-N hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 claims description 10
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 7
- 230000002378 acidificating Effects 0.000 claims description 6
- 239000003960 organic solvent Substances 0.000 claims description 5
- 238000006243 chemical reaction Methods 0.000 claims description 3
- 230000000875 corresponding Effects 0.000 claims description 3
- 238000004821 distillation Methods 0.000 claims description 3
- 229920000642 polymer Polymers 0.000 claims description 3
- 150000002148 esters Chemical class 0.000 claims description 2
- 239000003456 ion exchange resin Substances 0.000 claims description 2
- 229920003303 ion-exchange polymer Polymers 0.000 claims description 2
- 238000000926 separation method Methods 0.000 claims description 2
- 239000003795 chemical substances by application Substances 0.000 claims 1
- 238000000034 method Methods 0.000 claims 1
- 238000002360 preparation method Methods 0.000 claims 1
- UHOVQNZJYSORNB-UHFFFAOYSA-N benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 10
- SVTBMSDMJJWYQN-UHFFFAOYSA-N 2-Methyl-2,4-pentanediol Chemical compound CC(O)CC(C)(C)O SVTBMSDMJJWYQN-UHFFFAOYSA-N 0.000 description 4
- PASDCCFISLVPSO-UHFFFAOYSA-N Benzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1 PASDCCFISLVPSO-UHFFFAOYSA-N 0.000 description 3
- 238000009835 boiling Methods 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 238000005917 acylation reaction Methods 0.000 description 2
- 238000000354 decomposition reaction Methods 0.000 description 2
- KWOLFJPFCHCOCG-UHFFFAOYSA-N methylphenylketone Chemical compound CC(=O)C1=CC=CC=C1 KWOLFJPFCHCOCG-UHFFFAOYSA-N 0.000 description 2
- -1 polyethylene Polymers 0.000 description 2
- 229920002379 silicone rubber Polymers 0.000 description 2
- 239000004945 silicone rubber Substances 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- XMNIXWIUMCBBBL-UHFFFAOYSA-N 2-(2-phenylpropan-2-ylperoxy)propan-2-ylbenzene Chemical compound C=1C=CC=CC=1C(C)(C)OOC(C)(C)C1=CC=CC=C1 XMNIXWIUMCBBBL-UHFFFAOYSA-N 0.000 description 1
- 229920000180 Alkyd Polymers 0.000 description 1
- 239000004698 Polyethylene (PE) Substances 0.000 description 1
- 239000004743 Polypropylene Substances 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- VEFXTGTZJOWDOF-UHFFFAOYSA-N benzene;hydrate Chemical compound O.C1=CC=CC=C1 VEFXTGTZJOWDOF-UHFFFAOYSA-N 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 238000005755 formation reaction Methods 0.000 description 1
- 229940051250 hexylene glycol Drugs 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 229910000039 hydrogen halide Inorganic materials 0.000 description 1
- 239000012433 hydrogen halide Substances 0.000 description 1
- 239000003999 initiator Substances 0.000 description 1
- 239000012263 liquid product Substances 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 229920000728 polyester Polymers 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 229920001155 polypropylene Polymers 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 230000004043 responsiveness Effects 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 125000003011 styrenyl group Chemical class [H]\C(*)=C(/[H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 150000003460 sulfonic acids Chemical class 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 1
- 150000003509 tertiary alcohols Chemical class 0.000 description 1
- 238000004073 vulcanization Methods 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE851496C (de) | Verfahren zur Herstellung symmetrischer oder unsymmetrischer aliphatischer, ditertiaerer Peroxyde | |
| DE1468177A1 (de) | Peroxyverbindungen des 2-Methylpentan-2,4-diols und Verfahren zu ihrer Herstellung | |
| DE2737302C3 (de) | Verfahren zur Herstellung von Resorcin | |
| DE2600541C3 (de) | Verfahren zur Herstellung von Phenylbrenztraubensäure oder Arylbrenztraubensäuren | |
| DE1468177C (xx) | ||
| DE2525295A1 (de) | Verfahren zur herstellung von azomethinen | |
| DE2616681A1 (de) | Verfahren zur reduktiven dehydrohalogenierung von alpha-halogenalkoholen | |
| DE2536504C3 (de) | Verfahren zur Herstellung von Halogendienen | |
| DE1301313B (de) | Verfahren zur Herstellung von Pyrryl-(2)-essigsaeureestern | |
| DE2241807A1 (de) | Verfahren zur herstellung von alkoholen | |
| DE2016108B2 (xx) | ||
| DE2613003C3 (xx) | ||
| DE1293771B (de) | Verfahren zur Herstellung von Peroxyketalen | |
| DE3633308A1 (de) | Verfahren zur herstellung von t-alkyl-t-aralkylperoxiden | |
| DE1232582B (de) | Verfahren zur Herstellung von 3, 3-Bis-(hydro-peroxy-tert.-butyl)-butan-1-carbonsaeureestern | |
| DE1543246A1 (de) | Neue Alkylidenperoxyde,Verfahren zu ihrer Herstellung und ihre Verwendung | |
| DE2062054A1 (xx) | ||
| DE19546920A1 (de) | Verfahren zur Herstellung synthetischer Pyrethroide durch azeotrope Veresterung | |
| DE1768642A1 (de) | Verfahren zur Herstellung von gegebenenfalls substituierten 1-Perfluoralkyl-2-Jodaethanen und 1-Perfluoralkyl-2-Jodaethenen | |
| EP0309915A1 (de) | Verfahren zur Entfernung von Formaldehyd aus wässrigen Lösungen von 2-Butindiol-1,4 | |
| DE1001259C2 (de) | Verfahren zur Herstellung von Derivaten des Nortricyclens | |
| DE1111616B (de) | Verfahren zur Herstellung von Perfluoralkylmethyl-vinylaethern | |
| EP0940384A1 (de) | Verfahren zur Herstellung von Cyclopropylalkylketonen | |
| AT262954B (de) | Verfahren zur Herstellung von ɛ-Caprolacton und seiner Alkylderivate | |
| DE68907758T2 (de) | Propanon-1,3-disulfonsäure als Veresterungskatalysator. |