DE1445446C - - Google Patents
Info
- Publication number
- DE1445446C DE1445446C DE1445446C DE 1445446 C DE1445446 C DE 1445446C DE 1445446 C DE1445446 C DE 1445446C
- Authority
- DE
- Germany
- Prior art keywords
- benzylpenicillin
- acetoxymethyl
- water
- ester
- product
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- NLOOMWLTUVBWAW-HLLBOEOZSA-N penamecillin Chemical compound N([C@H]1[C@@H]2N(C1=O)[C@H](C(S2)(C)C)C(=O)OCOC(=O)C)C(=O)CC1=CC=CC=C1 NLOOMWLTUVBWAW-HLLBOEOZSA-N 0.000 claims description 2
- 229960000596 penamecillin Drugs 0.000 claims description 2
- JGSARLDLIJGVTE-MBNYWOFBSA-N Penicillin G Chemical compound N([C@H]1[C@H]2SC([C@@H](N2C1=O)C(O)=O)(C)C)C(=O)CC1=CC=CC=C1 JGSARLDLIJGVTE-MBNYWOFBSA-N 0.000 description 10
- -1 acetoxymethyl halide Chemical class 0.000 description 9
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 6
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 5
- 229940056360 penicillin g Drugs 0.000 description 5
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- 229930182555 Penicillin Natural products 0.000 description 4
- 238000006243 chemical reaction Methods 0.000 description 4
- 230000008018 melting Effects 0.000 description 3
- 238000002844 melting Methods 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- 235000019371 penicillin G benzathine Nutrition 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical class CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 2
- 150000001408 amides Chemical class 0.000 description 2
- NHYXMAKLBXBVEO-UHFFFAOYSA-N bromomethyl acetate Chemical compound CC(=O)OCBr NHYXMAKLBXBVEO-UHFFFAOYSA-N 0.000 description 2
- 229940049954 penicillin Drugs 0.000 description 2
- 150000002960 penicillins Chemical class 0.000 description 2
- 229910052700 potassium Inorganic materials 0.000 description 2
- 239000011591 potassium Substances 0.000 description 2
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 229930040373 Paraformaldehyde Natural products 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 125000003668 acetyloxy group Chemical group [H]C([H])([H])C(=O)O[*] 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- IYNDLOXRXUOGIU-LQDWTQKMSA-M benzylpenicillin potassium Chemical compound [K+].N([C@H]1[C@H]2SC([C@@H](N2C1=O)C([O-])=O)(C)C)C(=O)CC1=CC=CC=C1 IYNDLOXRXUOGIU-LQDWTQKMSA-M 0.000 description 1
- 239000008280 blood Substances 0.000 description 1
- 210000004369 blood Anatomy 0.000 description 1
- 230000036765 blood level Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 239000008366 buffered solution Substances 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- ZPWVASYFFYYZEW-UHFFFAOYSA-L dipotassium hydrogen phosphate Chemical compound [K+].[K+].OP([O-])([O-])=O ZPWVASYFFYYZEW-UHFFFAOYSA-L 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 230000037406 food intake Effects 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 230000002779 inactivation Effects 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 210000000936 intestine Anatomy 0.000 description 1
- 229920002866 paraformaldehyde Polymers 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000000243 solution Substances 0.000 description 1
- 210000002784 stomach Anatomy 0.000 description 1
- 235000005074 zinc chloride Nutrition 0.000 description 1
- 239000011592 zinc chloride Substances 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2147023C3 (de) | Verfahren zur Herstellung von 1H- Tetrazol-Verbindungen | |
| DE2058248C3 (de) | imidazol-2,4-dion und ein Verfahren zu dessen Herstellung | |
| IL22302A (en) | Phenylcyclopropane derivatives | |
| DE1966850C3 (de) | Penicilline mit einer Sulfogruppe in a-Stellung des Acylrestes und Verfahren zu ihrer Herstellung | |
| DE2449492A1 (de) | Verfahren zur herstellung von optisch aktivem p-hydroxyphenylglycin | |
| DE1445446C (cg-RX-API-DMAC7.html) | ||
| US2319545A (en) | Resolution of racemic alpha-hydroxy-beta, beta-dimethyl-gamma-butyro lactone, and new compounds obtained by such resolution | |
| DE1518125C3 (de) | Asparaginsäure- und Glutaminsaureamide, Verfahren zu deren Herstellung und diese enthaltende Arzneimittel | |
| CH642365A5 (de) | Verfahren zur herstellung von 6-piperidino-2,4-diaminopyrimidin-3-oxid. | |
| DE1445446B (de) | Benzylpenicillin-acetoxymethylester und Verfahren zu seiner Herstellung | |
| DE2053886B2 (de) | Verfahren zur Herstellung von kristallinem Mononatrium- oder Monokaliumalpha-carboxybenzylpenicillin | |
| DE2265590C2 (de) | 7-Amino-3-[S-(1,2,3-triazol-5-yl)-thiomethyl]-3-cephem-4-carbonsäure und deren Verwendung | |
| DE1795129B2 (de) | Verfahren zur Herstellung von Alkalimetallsalzen des a-Aminobenzylpenicillins und seiner Epimeren | |
| DE2021073A1 (de) | alpha-Amino-2,4,6-cycloheptatrienyl-methylcephalosporine und Verfahren zu ihrer Herstellung | |
| DE2942643C2 (de) | Thienyl(2)-carbonylphenoxyessigsäureester, Verfahren zu ihrer Herstellung und diese Verbindungen enthaltende Arzneimittel | |
| AT219043B (de) | Verfahren zur Herstellung von neuen Phenthiazinderivaten | |
| DE1470083C (de) | Cinnamylpenicilline und Verfahren zu ihrer Herstellung | |
| AT354432B (de) | Verfahren zur herstellung von 3-indolylessig- saeuren | |
| DE1670117A1 (de) | Cephalosporansaeurederivate und Verfahren zu ihrer Herstellung | |
| DE1185190B (de) | Verfahren zur Herstellung von Penicillinen | |
| AT367749B (de) | Verfahren zur herstellung von estern von 3-indolylessigsaeuren | |
| CH411901A (de) | Verfahren zur Herstellung von heterocyclischen Verbindungen | |
| AT365598B (de) | Verfahren zur herstellung eines neuen formamidkomplexes von 7-beta-(d-2-phenylacetamido) -3-methylceph-3-emcarbonsaeure | |
| DE683571C (de) | Verfahren zur Herstellung von substituierten Phenolaethern | |
| AT275745B (de) | Verfahren zur Herstellung eines neuen Thiaminderivats |