DE1420682A1 - Verfahren zur Herstellung von Polyamiden - Google Patents
Verfahren zur Herstellung von PolyamidenInfo
- Publication number
- DE1420682A1 DE1420682A1 DE19581420682 DE1420682A DE1420682A1 DE 1420682 A1 DE1420682 A1 DE 1420682A1 DE 19581420682 DE19581420682 DE 19581420682 DE 1420682 A DE1420682 A DE 1420682A DE 1420682 A1 DE1420682 A1 DE 1420682A1
- Authority
- DE
- Germany
- Prior art keywords
- aromatic
- parts
- diamine
- organic solvent
- solution
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 29
- 239000004952 Polyamide Substances 0.000 title description 17
- 229920002647 polyamide Polymers 0.000 title description 17
- 238000004519 manufacturing process Methods 0.000 title description 7
- 125000003118 aryl group Chemical group 0.000 claims description 50
- 239000000243 solution Substances 0.000 claims description 43
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 claims description 34
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 claims description 24
- -1 sodium carbonate Chemical compound 0.000 claims description 22
- 238000006243 chemical reaction Methods 0.000 claims description 19
- 150000004820 halides Chemical class 0.000 claims description 18
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 claims description 17
- 239000002253 acid Substances 0.000 claims description 15
- 150000004985 diamines Chemical class 0.000 claims description 15
- 239000002904 solvent Substances 0.000 claims description 15
- 238000003756 stirring Methods 0.000 claims description 14
- 150000004984 aromatic diamines Chemical class 0.000 claims description 13
- 125000004432 carbon atom Chemical group C* 0.000 claims description 12
- 229910000029 sodium carbonate Inorganic materials 0.000 claims description 12
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 claims description 11
- 125000004122 cyclic group Chemical group 0.000 claims description 9
- 239000003960 organic solvent Substances 0.000 claims description 9
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 claims description 8
- 239000004760 aramid Substances 0.000 claims description 7
- 229920003235 aromatic polyamide Polymers 0.000 claims description 7
- 125000003277 amino group Chemical group 0.000 claims description 5
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 claims description 4
- 238000002360 preparation method Methods 0.000 claims description 4
- HXJUTPCZVOIRIF-UHFFFAOYSA-N sulfolane Chemical compound O=S1(=O)CCCC1 HXJUTPCZVOIRIF-UHFFFAOYSA-N 0.000 claims description 4
- WKFQMDFSDQFAIC-UHFFFAOYSA-N 2,4-dimethylthiolane 1,1-dioxide Chemical compound CC1CC(C)S(=O)(=O)C1 WKFQMDFSDQFAIC-UHFFFAOYSA-N 0.000 claims description 3
- 239000007864 aqueous solution Substances 0.000 claims description 3
- 239000011541 reaction mixture Substances 0.000 claims description 3
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 claims description 2
- 150000001491 aromatic compounds Chemical class 0.000 claims description 2
- 150000004292 cyclic ethers Chemical class 0.000 claims description 2
- 150000003997 cyclic ketones Chemical class 0.000 claims 1
- 239000011877 solvent mixture Substances 0.000 claims 1
- 150000003457 sulfones Chemical group 0.000 claims 1
- 229920000642 polymer Polymers 0.000 description 55
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 25
- FDQSRULYDNDXQB-UHFFFAOYSA-N benzene-1,3-dicarbonyl chloride Chemical compound ClC(=O)C1=CC=CC(C(Cl)=O)=C1 FDQSRULYDNDXQB-UHFFFAOYSA-N 0.000 description 21
- 150000001875 compounds Chemical class 0.000 description 18
- 239000000203 mixture Substances 0.000 description 18
- 125000000217 alkyl group Chemical group 0.000 description 17
- 150000001805 chlorine compounds Chemical class 0.000 description 16
- 125000003545 alkoxy group Chemical group 0.000 description 14
- 238000002844 melting Methods 0.000 description 12
- 230000008018 melting Effects 0.000 description 12
- 125000001424 substituent group Chemical group 0.000 description 12
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 9
- 229910052736 halogen Inorganic materials 0.000 description 9
- 150000002367 halogens Chemical class 0.000 description 9
- 229940018564 m-phenylenediamine Drugs 0.000 description 9
- 239000000835 fiber Substances 0.000 description 8
- 238000006116 polymerization reaction Methods 0.000 description 8
- WZCQRUWWHSTZEM-UHFFFAOYSA-N 1,3-phenylenediamine Chemical group NC1=CC=CC(N)=C1 WZCQRUWWHSTZEM-UHFFFAOYSA-N 0.000 description 7
- 239000000370 acceptor Substances 0.000 description 6
- 125000005843 halogen group Chemical group 0.000 description 6
- LXEJRKJRKIFVNY-UHFFFAOYSA-N terephthaloyl chloride Chemical compound ClC(=O)C1=CC=C(C(Cl)=O)C=C1 LXEJRKJRKIFVNY-UHFFFAOYSA-N 0.000 description 6
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical group CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 5
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 4
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- 230000015572 biosynthetic process Effects 0.000 description 4
- 238000001035 drying Methods 0.000 description 4
- 239000000839 emulsion Substances 0.000 description 4
- 229920006158 high molecular weight polymer Polymers 0.000 description 4
- KWGKDLIKAYFUFQ-UHFFFAOYSA-M lithium chloride Chemical compound [Li+].[Cl-] KWGKDLIKAYFUFQ-UHFFFAOYSA-M 0.000 description 4
- RLSSMJSEOOYNOY-UHFFFAOYSA-N m-cresol Chemical compound CC1=CC=CC(O)=C1 RLSSMJSEOOYNOY-UHFFFAOYSA-N 0.000 description 4
- 150000004988 m-phenylenediamines Chemical class 0.000 description 4
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 4
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 4
- 239000000376 reactant Substances 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- HYYVCACCUFXMMU-UHFFFAOYSA-N 3-(7-azabicyclo[4.1.0]hepta-1,3,5-triene-7-carbonyl)benzamide Chemical compound NC(=O)C1=CC=CC(C(=O)N2C3=CC=CC=C32)=C1 HYYVCACCUFXMMU-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 3
- 229910052794 bromium Inorganic materials 0.000 description 3
- 229910052801 chlorine Inorganic materials 0.000 description 3
- 239000000460 chlorine Substances 0.000 description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 3
- 150000003254 radicals Chemical class 0.000 description 3
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 description 3
- 238000005406 washing Methods 0.000 description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- JCXJVPUVTGWSNB-UHFFFAOYSA-N Nitrogen dioxide Chemical class O=[N]=O JCXJVPUVTGWSNB-UHFFFAOYSA-N 0.000 description 2
- ATUOYWHBWRKTHZ-UHFFFAOYSA-N Propane Chemical compound CCC ATUOYWHBWRKTHZ-UHFFFAOYSA-N 0.000 description 2
- 239000006227 byproduct Substances 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 125000005521 carbonamide group Chemical group 0.000 description 2
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 2
- 125000001891 dimethoxy group Chemical group [H]C([H])([H])O* 0.000 description 2
- 230000007062 hydrolysis Effects 0.000 description 2
- 238000006460 hydrolysis reaction Methods 0.000 description 2
- 229910052740 iodine Inorganic materials 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 230000000704 physical effect Effects 0.000 description 2
- 229910000027 potassium carbonate Inorganic materials 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 230000005855 radiation Effects 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 125000003698 tetramethyl group Chemical group [H]C([H])([H])* 0.000 description 2
- YKYIFUROKBDHCY-ONEGZZNKSA-N (e)-4-ethoxy-1,1,1-trifluorobut-3-en-2-one Chemical group CCO\C=C\C(=O)C(F)(F)F YKYIFUROKBDHCY-ONEGZZNKSA-N 0.000 description 1
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 description 1
- GEYOCULIXLDCMW-UHFFFAOYSA-N 1,2-phenylenediamine Chemical compound NC1=CC=CC=C1N GEYOCULIXLDCMW-UHFFFAOYSA-N 0.000 description 1
- CBCKQZAAMUWICA-UHFFFAOYSA-N 1,4-phenylenediamine Chemical compound NC1=CC=C(N)C=C1 CBCKQZAAMUWICA-UHFFFAOYSA-N 0.000 description 1
- JEUAKJVLHISJDY-UHFFFAOYSA-N 2,3-dimethylthiolane 1,1-dioxide Chemical compound CC1CCS(=O)(=O)C1C JEUAKJVLHISJDY-UHFFFAOYSA-N 0.000 description 1
- NZUHAGMVTPMOIV-UHFFFAOYSA-N 3-(3-carbonochloridoylphenoxy)benzoyl chloride Chemical compound ClC(=O)C1=CC=CC(OC=2C=C(C=CC=2)C(Cl)=O)=C1 NZUHAGMVTPMOIV-UHFFFAOYSA-N 0.000 description 1
- NMTYZEFTDQDWBF-UHFFFAOYSA-N 3-(3-carbonochloridoylphenyl)sulfonylbenzoyl chloride Chemical compound ClC(=O)C1=CC=CC(S(=O)(=O)C=2C=C(C=CC=2)C(Cl)=O)=C1 NMTYZEFTDQDWBF-UHFFFAOYSA-N 0.000 description 1
- YCGKJPVUGMBDDS-UHFFFAOYSA-N 3-(6-azabicyclo[3.1.1]hepta-1(7),2,4-triene-6-carbonyl)benzamide Chemical compound NC(=O)C1=CC=CC(C(=O)N2C=3C=C2C=CC=3)=C1 YCGKJPVUGMBDDS-UHFFFAOYSA-N 0.000 description 1
- IVHRXFBIIZXYCI-UHFFFAOYSA-N 3-n-fluorobenzene-1,3-diamine Chemical compound NC1=CC=CC(NF)=C1 IVHRXFBIIZXYCI-UHFFFAOYSA-N 0.000 description 1
- VXISGCAONOYOFN-UHFFFAOYSA-N 3-n-propylbenzene-1,3-diamine Chemical class CCCNC1=CC=CC(N)=C1 VXISGCAONOYOFN-UHFFFAOYSA-N 0.000 description 1
- YBRVSVVVWCFQMG-UHFFFAOYSA-N 4,4'-diaminodiphenylmethane Chemical compound C1=CC(N)=CC=C1CC1=CC=C(N)C=C1 YBRVSVVVWCFQMG-UHFFFAOYSA-N 0.000 description 1
- IBMNARSXHOVILE-UHFFFAOYSA-N 4,6-diethoxybenzene-1,3-dicarbonyl chloride Chemical class C(C)OC1=CC(=C(C=C1C(=O)Cl)C(=O)Cl)OCC IBMNARSXHOVILE-UHFFFAOYSA-N 0.000 description 1
- DCSSXQMBIGEQGN-UHFFFAOYSA-N 4,6-dimethylbenzene-1,3-diamine Chemical compound CC1=CC(C)=C(N)C=C1N DCSSXQMBIGEQGN-UHFFFAOYSA-N 0.000 description 1
- YBDWNQKQXGUAOR-UHFFFAOYSA-N 4-ethyl-2-methylbenzene-1,3-diamine Chemical compound CCC1=CC=C(N)C(C)=C1N YBDWNQKQXGUAOR-UHFFFAOYSA-N 0.000 description 1
- OAPDPORYXWQVJE-UHFFFAOYSA-N 4-propylaniline Chemical compound CCCC1=CC=C(N)C=C1 OAPDPORYXWQVJE-UHFFFAOYSA-N 0.000 description 1
- PXKNNOCLRQNXHN-UHFFFAOYSA-N C(CC)C1=C(C(=O)Cl)C=CC=C1C(=O)Cl Chemical compound C(CC)C1=C(C(=O)Cl)C=CC=C1C(=O)Cl PXKNNOCLRQNXHN-UHFFFAOYSA-N 0.000 description 1
- PJBFAFQWOGGBQB-UHFFFAOYSA-N CCC1=C(CC)C(C(Cl)=O)=C(CC)C(C(Cl)=O)=C1CC Chemical class CCC1=C(CC)C(C(Cl)=O)=C(CC)C(C(Cl)=O)=C1CC PJBFAFQWOGGBQB-UHFFFAOYSA-N 0.000 description 1
- JPKQZCVGPMMWTK-UHFFFAOYSA-N CCCC1=CC(N)=C(C)C(N)=C1CC Chemical compound CCCC1=CC(N)=C(C)C(N)=C1CC JPKQZCVGPMMWTK-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 238000012695 Interfacial polymerization Methods 0.000 description 1
- HCWIRFVTISSTJA-UHFFFAOYSA-N O=C(C(C=CC(Cl)=C1C(Cl)=O)=C1F)Cl Chemical class O=C(C(C=CC(Cl)=C1C(Cl)=O)=C1F)Cl HCWIRFVTISSTJA-UHFFFAOYSA-N 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- 101150052863 THY1 gene Proteins 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 125000002947 alkylene group Chemical group 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 239000003125 aqueous solvent Substances 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 1
- 230000001588 bifunctional effect Effects 0.000 description 1
- 150000001649 bromium compounds Chemical class 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000002837 carbocyclic group Chemical group 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 230000001055 chewing effect Effects 0.000 description 1
- 238000010276 construction Methods 0.000 description 1
- 238000006731 degradation reaction Methods 0.000 description 1
- 125000000950 dibromo group Chemical group Br* 0.000 description 1
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 150000002222 fluorine compounds Chemical class 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 230000003301 hydrolyzing effect Effects 0.000 description 1
- 230000001771 impaired effect Effects 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 150000007529 inorganic bases Chemical class 0.000 description 1
- 239000011810 insulating material Substances 0.000 description 1
- 230000003993 interaction Effects 0.000 description 1
- 238000010406 interfacial reaction Methods 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 238000011068 loading method Methods 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 150000004989 p-phenylenediamines Chemical class 0.000 description 1
- 239000000575 pesticide Substances 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 150000004986 phenylenediamines Chemical class 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000001294 propane Substances 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 238000011084 recovery Methods 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 238000009987 spinning Methods 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 230000002459 sustained effect Effects 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G69/00—Macromolecular compounds obtained by reactions forming a carboxylic amide link in the main chain of the macromolecule
- C08G69/02—Polyamides derived from amino-carboxylic acids or from polyamines and polycarboxylic acids
- C08G69/26—Polyamides derived from amino-carboxylic acids or from polyamines and polycarboxylic acids derived from polyamines and polycarboxylic acids
- C08G69/32—Polyamides derived from amino-carboxylic acids or from polyamines and polycarboxylic acids derived from polyamines and polycarboxylic acids from aromatic diamines and aromatic dicarboxylic acids with both amino and carboxylic groups aromatically bound
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Polyamides (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US642941A US3006899A (en) | 1957-02-28 | 1957-02-28 | Polyamides from reaction of aromatic diacid halide dissolved in cyclic nonaromatic oxygenated organic solvent and an aromatic diamine |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1420682A1 true DE1420682A1 (de) | 1968-10-10 |
Family
ID=24578687
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19581420682 Pending DE1420682A1 (de) | 1957-02-28 | 1958-02-28 | Verfahren zur Herstellung von Polyamiden |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US3006899A (cg-RX-API-DMAC10.html) |
| BE (1) | BE565268A (cg-RX-API-DMAC10.html) |
| CH (1) | CH389243A (cg-RX-API-DMAC10.html) |
| DE (1) | DE1420682A1 (cg-RX-API-DMAC10.html) |
| FR (1) | FR1199460A (cg-RX-API-DMAC10.html) |
| GB (1) | GB871579A (cg-RX-API-DMAC10.html) |
| NL (1) | NL108880C (cg-RX-API-DMAC10.html) |
Families Citing this family (32)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3049518A (en) * | 1960-03-31 | 1962-08-14 | Du Pont | Polyamides from n, n'-bis (3-aminophenyl)-isophthalamide |
| US3197443A (en) * | 1960-07-13 | 1965-07-27 | Du Pont | Thermally stable polyamides from symmetrically substituted aromatic diamines |
| NL274763A (cg-RX-API-DMAC10.html) * | 1961-02-14 | |||
| BE637260A (cg-RX-API-DMAC10.html) * | 1962-09-11 | |||
| BE637258A (cg-RX-API-DMAC10.html) * | 1962-09-11 | |||
| US3379692A (en) * | 1963-08-08 | 1968-04-23 | Monsanto Co | Amide-urethane copolymers |
| US3359525A (en) * | 1964-10-14 | 1967-12-19 | Du Pont | Electric heating element |
| US3361697A (en) * | 1965-03-24 | 1968-01-02 | Du Pont | Plasticized polylactams containing cyclic saturated sulfone |
| USRE30352E (en) * | 1966-06-13 | 1980-07-29 | E. I. Du Pont De Nemours And Company | Optically anisotropic aromatic polyamide dopes |
| JPS5012006B1 (cg-RX-API-DMAC10.html) * | 1968-06-12 | 1975-05-08 | ||
| IL39188A (en) * | 1971-04-28 | 1976-02-29 | Du Pont | Poly(p-phenylene terephthalamide)fibers and their preparation |
| AU500143B2 (en) * | 1974-12-27 | 1979-05-10 | Teijin Ltd | Fiber or film-forming copolyamide |
| JPS5223198A (en) * | 1975-08-15 | 1977-02-21 | Hitachi Ltd | Preparation of aromatic polyether amide resin |
| JPS5910894B2 (ja) * | 1975-11-04 | 1984-03-12 | ユニチカ株式会社 | ホウコウゾクポリアミドハクマクノブツリテキセイシツノ カイリヨウホウ |
| US4178431A (en) * | 1976-05-28 | 1979-12-11 | Ube Industries, Ltd. | Aromatic copolyamide fiber from benzidine sulfone or diamino phenanthridone |
| US4219452A (en) * | 1978-05-19 | 1980-08-26 | Amsted Industries Incorporated | Composite friction element |
| US4856179A (en) * | 1983-04-21 | 1989-08-15 | Hoechst Celanese Corp. | Method of making an electrical device made of partially pyrolyzed polymer |
| JPS61226000A (ja) * | 1985-03-30 | 1986-10-07 | Totoku Electric Co Ltd | 超耐熱ボイスコイルの製造法 |
| CA1282923C (en) * | 1985-12-11 | 1991-04-16 | Hideo Matsui | High strength polymetaphenylene isophthalamide fiber and process for producing the same |
| JPS6479232A (en) * | 1987-06-09 | 1989-03-24 | Mitsui Toatsu Chemicals | Aromatic polyamide |
| US4885356A (en) * | 1988-06-28 | 1989-12-05 | Air Products And Chemicals, Inc. | High molecular weight poly(toluenediamine aramide) and a method for their preparation |
| US5066445A (en) * | 1990-04-12 | 1991-11-19 | E. I. Du Pont De Nemours And Company | Recovery and melt extrusion of aromatic/aliphatic copolyamides from lactam-plasticized polymer |
| EP0567998A1 (de) * | 1992-04-30 | 1993-11-03 | Hoechst Aktiengesellschaft | Verfahren zur Herstellung von Faserbildenden meta-Aramiden |
| US6063862A (en) * | 1998-03-11 | 2000-05-16 | Dainippon Ink And Chemicals, Inc. | Glass-polyamide composite and process for producing the same |
| ES2275649T3 (es) | 2000-02-16 | 2007-06-16 | Teijin Limited | Procedimiento para producir una fibra de poliamida completamente aromatica de tipo meta. |
| US7009028B2 (en) * | 2003-05-16 | 2006-03-07 | E. I. Du Pont De Nemours And Company | Continuous process for the production of polyamides |
| US8754139B2 (en) * | 2009-02-20 | 2014-06-17 | International Business Machines Corporation | Polyamide membranes with fluoroalcohol functionality |
| US20100216967A1 (en) * | 2009-02-20 | 2010-08-26 | International Business Machines Corporation | Interfacial polymerization methods for making fluoroalcohol-containing polyamides |
| US11633983B2 (en) | 2017-05-08 | 2023-04-25 | Pirelli Tyre S.P.A. | Tyre for bicycle wheels |
| CN109694475B (zh) * | 2017-10-24 | 2022-03-15 | 中国石油化工股份有限公司 | 还原性聚酰胺材料以及负载型纳米金属催化剂及其制备方法和应用 |
| US11633986B2 (en) | 2018-05-22 | 2023-04-25 | Pirelli Tyre S.P.A. | Tyre for bicycle wheels |
| CN110256667B (zh) * | 2019-06-27 | 2021-08-17 | 株洲时代新材料科技股份有限公司 | 一种芳纶胶黏剂及其制备方法和应用 |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2130948A (en) * | 1937-04-09 | 1938-09-20 | Du Pont | Synthetic fiber |
| US2244192A (en) * | 1939-09-08 | 1941-06-03 | Du Pont | Preparation of polyamides |
| US2404722A (en) * | 1942-06-17 | 1946-07-23 | Du Pont | Acrylonitrile polymer solutions |
| GB614625A (en) * | 1944-07-04 | 1948-12-20 | Geoffrey William Ison Sheavyn | Improvements in the production of condensation polymers |
| US2708617A (en) * | 1951-05-12 | 1955-05-17 | Du Pont | Formation of films and filament directly from polymer intermediates |
| US2831834A (en) * | 1951-05-12 | 1958-04-22 | Du Pont | Process for preparing polyamides |
| US2813776A (en) * | 1955-02-21 | 1957-11-19 | Du Pont | Process for forming films and filaments directly from polymer intermediates |
-
0
- NL NL108880D patent/NL108880C/xx active
- BE BE565268D patent/BE565268A/xx unknown
-
1957
- 1957-02-28 US US642941A patent/US3006899A/en not_active Expired - Lifetime
-
1958
- 1958-02-27 FR FR1199460D patent/FR1199460A/fr not_active Expired
- 1958-02-28 CH CH5646158A patent/CH389243A/de unknown
- 1958-02-28 GB GB6634/58A patent/GB871579A/en not_active Expired
- 1958-02-28 DE DE19581420682 patent/DE1420682A1/de active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| CH389243A (de) | 1965-03-15 |
| US3006899A (en) | 1961-10-31 |
| GB871579A (en) | 1961-06-28 |
| BE565268A (cg-RX-API-DMAC10.html) | |
| NL108880C (cg-RX-API-DMAC10.html) | |
| FR1199460A (fr) | 1959-12-14 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1420682A1 (de) | Verfahren zur Herstellung von Polyamiden | |
| DE2605531C2 (de) | Verfahren zur Herstellung von Poly-p-phenylenterephthalamid | |
| DE3517452C2 (cg-RX-API-DMAC10.html) | ||
| DE2642979C2 (de) | Semipermeable Membranen aus Polyamiden | |
| EP0332012B1 (de) | Hochtemperaturbeständige Polyarylethersulfon-/Polyaryletherketon-Formmassen mit verbesserter Phasenbindung | |
| DE1420681A1 (de) | Verfahren zur Herstellung aromatischer Polyamide | |
| DE2522919A1 (de) | Neue zusammensetzungen auf basis von arylaliphatischen copolymeren und daraus hergestellte erzeugnisse | |
| DE2636379A1 (de) | Polymerisationsverfahren zur herstellung von aethergruppen aufweisenden aromatischen polyamiden | |
| DE1765738C3 (de) | Isolierender Überzug auf einem elektrischen Leiter | |
| DE69122655T2 (de) | Verfahren zur Herstellung von aromatischem Polythiazol | |
| DE2313308A1 (de) | Verfahren zur herstellung von faeden, fasern und folien aus aromatischen polyamiden | |
| EP0604881B1 (de) | Homogene Polymerlegierungen auf der Basis von sulfonierten, aromatischen Polyetherketonen | |
| DE69013816T2 (de) | Polyamidpolykarbonatblockcopolymer. | |
| DE2162159A1 (de) | Verfahren zur Herstellung verstärkter Polyamid-Form- und Preßharze | |
| DE3707851A1 (de) | Permselektive membran | |
| DE69229694T2 (de) | Verbundwerkstoff | |
| DE69123906T2 (de) | Verfahren zur Herstellung eines molekularen Verbundmaterials | |
| DE69632558T2 (de) | Polyphthalamid-Harzzusammensetzungen | |
| DE69431649T2 (de) | Verfahren zur Herstellung von molekularen Verbundmaterialien, die ein steifes aromatisches Polymer enthalten | |
| DE1222674B (de) | Verfahren zur Herstellung von Polyamiden | |
| DE1494574A1 (de) | Verfahren zur Herstellung von Hohlfaeden aus Tetrafluoraethylenpolymeren | |
| DE2632416A1 (de) | Verfahren zur herstellung von poly-p-phenylenterephthalamid oder seiner copolymere | |
| DE2752683A1 (de) | Verfahren zur herstellung eines blockcopolyamids | |
| DE2347163A1 (de) | Film- und faedenbildende loesungen und daraus erhaltene endlosfaeden | |
| DE1953358C3 (de) | Aromatische Copolyamide |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| SH | Request for examination between 03.10.1968 and 22.04.1971 |