DE1419483B - - Google Patents
Info
- Publication number
- DE1419483B DE1419483B DE1419483B DE 1419483 B DE1419483 B DE 1419483B DE 1419483 B DE1419483 B DE 1419483B
- Authority
- DE
- Germany
- Prior art keywords
- benzisothiazolone
- growth
- microorganisms
- aqueous
- formation
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- DMSMPAJRVJJAGA-UHFFFAOYSA-N benzo[d]isothiazol-3-one Chemical compound C1=CC=C2C(=O)NSC2=C1 DMSMPAJRVJJAGA-UHFFFAOYSA-N 0.000 claims description 16
- 244000005700 microbiome Species 0.000 claims description 10
- 150000003839 salts Chemical group 0.000 claims description 9
- 239000004753 textile Substances 0.000 claims description 9
- 230000015572 biosynthetic process Effects 0.000 claims description 8
- 239000003795 chemical substances by application Substances 0.000 claims description 8
- 239000000654 additive Substances 0.000 claims description 4
- 230000000996 additive effect Effects 0.000 claims description 4
- 125000005843 halogen group Chemical group 0.000 claims description 3
- 239000001257 hydrogen Substances 0.000 claims description 2
- 229910052739 hydrogen Inorganic materials 0.000 claims description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 2
- 239000000243 solution Substances 0.000 description 9
- 150000001875 compounds Chemical class 0.000 description 7
- 239000000835 fiber Substances 0.000 description 7
- -1 triethanolamine Chemical class 0.000 description 7
- 239000000314 lubricant Substances 0.000 description 6
- KANAPVJGZDNSCZ-UHFFFAOYSA-N 1,2-benzothiazole 1-oxide Chemical class C1=CC=C2S(=O)N=CC2=C1 KANAPVJGZDNSCZ-UHFFFAOYSA-N 0.000 description 4
- MVLVMROFTAUDAG-UHFFFAOYSA-N ethyl octadecanoate Chemical compound CCCCCCCCCCCCCCCCCC(=O)OCC MVLVMROFTAUDAG-UHFFFAOYSA-N 0.000 description 4
- 235000014113 dietary fatty acids Nutrition 0.000 description 3
- 150000002148 esters Chemical class 0.000 description 3
- 239000000194 fatty acid Substances 0.000 description 3
- 229930195729 fatty acid Natural products 0.000 description 3
- 150000004665 fatty acids Chemical class 0.000 description 3
- 239000000080 wetting agent Substances 0.000 description 3
- SEZYSUKQTKJYMC-UHFFFAOYSA-N 5,6-dichloro-3h-1,3-benzothiazol-2-one Chemical compound ClC1=C(Cl)C=C2SC(O)=NC2=C1 SEZYSUKQTKJYMC-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- 241000588724 Escherichia coli Species 0.000 description 2
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 2
- 229920002302 Nylon 6,6 Polymers 0.000 description 2
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 2
- 239000012736 aqueous medium Substances 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 239000006185 dispersion Substances 0.000 description 2
- 239000004744 fabric Substances 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 230000000813 microbial effect Effects 0.000 description 2
- 239000002480 mineral oil Substances 0.000 description 2
- 235000010446 mineral oil Nutrition 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- 239000003921 oil Substances 0.000 description 2
- 229920002239 polyacrylonitrile Polymers 0.000 description 2
- 229920000139 polyethylene terephthalate Polymers 0.000 description 2
- 239000005020 polyethylene terephthalate Substances 0.000 description 2
- 229920002451 polyvinyl alcohol Polymers 0.000 description 2
- 235000019422 polyvinyl alcohol Nutrition 0.000 description 2
- 230000002265 prevention Effects 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Chemical class O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- 239000001993 wax Substances 0.000 description 2
- VRVRGVPWCUEOGV-UHFFFAOYSA-N 2-aminothiophenol Chemical class NC1=CC=CC=C1S VRVRGVPWCUEOGV-UHFFFAOYSA-N 0.000 description 1
- IYFOEVOXKZUQPJ-UHFFFAOYSA-N 5-chloro-1,2-benzothiazol-3-one Chemical compound C1=C(Cl)C=C2C(O)=NSC2=C1 IYFOEVOXKZUQPJ-UHFFFAOYSA-N 0.000 description 1
- PUQHEPFUBPHTCG-UHFFFAOYSA-N 6-chloro-3h-1,3-benzothiazol-2-one Chemical compound C1=C(Cl)C=C2SC(O)=NC2=C1 PUQHEPFUBPHTCG-UHFFFAOYSA-N 0.000 description 1
- 244000063299 Bacillus subtilis Species 0.000 description 1
- 235000014469 Bacillus subtilis Nutrition 0.000 description 1
- 241000894006 Bacteria Species 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- 241000222120 Candida <Saccharomycetales> Species 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 229920000742 Cotton Polymers 0.000 description 1
- 241000233866 Fungi Species 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 241000588915 Klebsiella aerogenes Species 0.000 description 1
- 241000235395 Mucor Species 0.000 description 1
- 239000004677 Nylon Substances 0.000 description 1
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 1
- 239000004952 Polyamide Substances 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- 239000004743 Polypropylene Substances 0.000 description 1
- 239000004372 Polyvinyl alcohol Substances 0.000 description 1
- 241000588769 Proteus <enterobacteria> Species 0.000 description 1
- 240000004808 Saccharomyces cerevisiae Species 0.000 description 1
- KSQXVLVXUFHGJQ-UHFFFAOYSA-M Sodium ortho-phenylphenate Chemical compound [Na+].[O-]C1=CC=CC=C1C1=CC=CC=C1 KSQXVLVXUFHGJQ-UHFFFAOYSA-M 0.000 description 1
- 241000191967 Staphylococcus aureus Species 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Triethanolamine Chemical compound OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 239000002216 antistatic agent Substances 0.000 description 1
- 239000007900 aqueous suspension Substances 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 229920002301 cellulose acetate Polymers 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 238000010276 construction Methods 0.000 description 1
- 150000001896 cresols Chemical class 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 150000002191 fatty alcohols Chemical class 0.000 description 1
- 230000002538 fungal effect Effects 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- 229920005615 natural polymer Polymers 0.000 description 1
- 229920001778 nylon Polymers 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 239000006072 paste Substances 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- 229920002647 polyamide Polymers 0.000 description 1
- 229920000728 polyester Polymers 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 229920001155 polypropylene Polymers 0.000 description 1
- 229920001451 polypropylene glycol Polymers 0.000 description 1
- 159000000001 potassium salts Chemical class 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 239000004627 regenerated cellulose Substances 0.000 description 1
- 238000004513 sizing Methods 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- HCJLVWUMMKIQIM-UHFFFAOYSA-M sodium;2,3,4,5,6-pentachlorophenolate Chemical compound [Na+].[O-]C1=C(Cl)C(Cl)=C(Cl)C(Cl)=C1Cl HCJLVWUMMKIQIM-UHFFFAOYSA-M 0.000 description 1
- YFPNAQYEHBHHHI-UHFFFAOYSA-M sodium;2,3,4-trichlorophenolate Chemical compound [Na+].[O-]C1=CC=C(Cl)C(Cl)=C1Cl YFPNAQYEHBHHHI-UHFFFAOYSA-M 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 150000003871 sulfonates Chemical class 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 229920002994 synthetic fiber Polymers 0.000 description 1
- 229920001059 synthetic polymer Polymers 0.000 description 1
- NBOMNTLFRHMDEZ-UHFFFAOYSA-N thiosalicylic acid Chemical compound OC(=O)C1=CC=CC=C1S NBOMNTLFRHMDEZ-UHFFFAOYSA-N 0.000 description 1
- 229940103494 thiosalicylic acid Drugs 0.000 description 1
- 238000009941 weaving Methods 0.000 description 1
- 210000002268 wool Anatomy 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP1194434B1 (de) | Antimikrobielle siloxanquat-formulierungen, deren herstellung und verwendung | |
| DE1419483A1 (de) | Verfahren zum Schutz von Textilbehandlungsfluessigkeiten gegen Mikroorganismen | |
| DE69300694T2 (de) | Desinfizierende Zusammensetzungen. | |
| DE4339374A1 (de) | Verfahren zum Herstellen einer antimikrobiellen Faser | |
| EP0467008B1 (de) | Lösung von Cellulose in Wasser und N-Methyl-morpholin-N-oxid | |
| DE4116853C2 (de) | Wirkstoff mit bakteriostatischer und bakteriozider Wirkung | |
| US2541816A (en) | Quaternary ammonium pentachlorophenates | |
| DE1236517B (de) | Verfahren zur Herstellung von waessrigen Loesungen von Oxyden tertiaerer aliphatischer Amine | |
| EP0094656B1 (de) | Verfahren zum gleichzeitigen Entschlichten und Bleichen von Textilmaterial aus Cellulosefasern | |
| DE1419483C (de) | Verhinderung des Wachstums von Mikro Organismen oder von Schleimbildung in wäßrigen Flotten von Textilbehandlungs mitteln | |
| DE1542739B2 (de) | Verwendung halogenierter Cyanacetamide zur Bekämpfung schleimbildender Mikroorganismen | |
| DE1419483B (enExample) | ||
| DE3248947T1 (de) | Derivate von N-Oxiranmethan-N,N,N-Trialkylammonium, sowie Verfahren zu deren Herstellung und deren Verwendung zur Behandlung von Polyhydroxyl- und Polyaminpolymeren | |
| DE1122537B (de) | Verfahren zur Herstellung von Impraegnierungsmitteln zur gleichzeitigen einbadigen Konservierung und Weichmachung von Textilien | |
| DE3328095C2 (enExample) | ||
| DE1141612B (de) | Verfahren zur chemischen Modifizierung von cellulosehaltigen Materialien | |
| DE1201778B (de) | Verfahren zur Bekaempfung von schleim-bildenden Mikroorganismen in Industriewaessern | |
| DE2345401A1 (de) | Weichmacherzusammensetzung fuer textilien | |
| DE1035849B (de) | Verfahren zur Herstellung von kuenstlichen Gebilden, wie Faeden, Filme oder Baendchen, aus Viscose | |
| AT231394B (de) | Verfahren zur Behandlung von Keratintextilfasern gegen das Verfilzen | |
| DE2356919C2 (de) | Verfahren zur Behandlung von Fasern | |
| DE2036755A1 (de) | Biostatika enthaltende Polymerkomposi tionen | |
| DE2034540A1 (de) | Mikrobizide Mittel | |
| AT333289B (de) | Verfahren zur herstellung neuer 1,2,4-benztriazin-1,4-di-n-oxidderivate | |
| DE1219631B (de) | Wasserloesliches, bakteriostates Mittel |