DE1418708A1 - Neue Naphthalinverbindungen - Google Patents
Neue NaphthalinverbindungenInfo
- Publication number
- DE1418708A1 DE1418708A1 DE19601418708 DE1418708A DE1418708A1 DE 1418708 A1 DE1418708 A1 DE 1418708A1 DE 19601418708 DE19601418708 DE 19601418708 DE 1418708 A DE1418708 A DE 1418708A DE 1418708 A1 DE1418708 A1 DE 1418708A1
- Authority
- DE
- Germany
- Prior art keywords
- tetrahydro
- acid
- oxo
- groups
- naphthalene
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 150000002790 naphthalenes Chemical class 0.000 title 1
- 239000002253 acid Substances 0.000 claims description 41
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 claims description 26
- -1 methylenedioxy groups Chemical group 0.000 claims description 11
- 125000000217 alkyl group Chemical group 0.000 claims description 10
- 150000003839 salts Chemical class 0.000 claims description 10
- 150000001875 compounds Chemical class 0.000 claims description 7
- 229910052739 hydrogen Inorganic materials 0.000 claims description 7
- 239000001257 hydrogen Substances 0.000 claims description 7
- 150000001408 amides Chemical class 0.000 claims description 6
- 150000007513 acids Chemical class 0.000 claims description 5
- 125000004043 oxo group Chemical group O=* 0.000 claims description 5
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 4
- 229910052760 oxygen Inorganic materials 0.000 claims description 4
- 239000001301 oxygen Substances 0.000 claims description 4
- 125000003545 alkoxy group Chemical group 0.000 claims description 3
- 125000003118 aryl group Chemical group 0.000 claims description 3
- 125000005843 halogen group Chemical group 0.000 claims description 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 3
- 238000004519 manufacturing process Methods 0.000 claims description 3
- 229910052757 nitrogen Inorganic materials 0.000 claims description 3
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 3
- 150000003863 ammonium salts Chemical class 0.000 claims description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims 3
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims 2
- 125000004414 alkyl thio group Chemical group 0.000 claims 2
- 229910052717 sulfur Inorganic materials 0.000 claims 2
- 125000004434 sulfur atom Chemical group 0.000 claims 2
- 150000003857 carboxamides Chemical class 0.000 claims 1
- 239000000825 pharmaceutical preparation Substances 0.000 claims 1
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 27
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 22
- 238000000034 method Methods 0.000 description 14
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 13
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 12
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 12
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 12
- 239000013078 crystal Substances 0.000 description 10
- QGJOPFRUJISHPQ-UHFFFAOYSA-N Carbon disulfide Chemical compound S=C=S QGJOPFRUJISHPQ-UHFFFAOYSA-N 0.000 description 9
- 150000002148 esters Chemical class 0.000 description 8
- NDKBVBUGCNGSJJ-UHFFFAOYSA-M benzyltrimethylammonium hydroxide Chemical compound [OH-].C[N+](C)(C)CC1=CC=CC=C1 NDKBVBUGCNGSJJ-UHFFFAOYSA-M 0.000 description 7
- 238000001816 cooling Methods 0.000 description 7
- 239000007858 starting material Substances 0.000 description 7
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 6
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 6
- 239000003921 oil Substances 0.000 description 6
- CTSLXHKWHWQRSH-UHFFFAOYSA-N oxalyl chloride Chemical compound ClC(=O)C(Cl)=O CTSLXHKWHWQRSH-UHFFFAOYSA-N 0.000 description 6
- 239000003208 petroleum Substances 0.000 description 6
- 238000009835 boiling Methods 0.000 description 5
- 239000000047 product Substances 0.000 description 5
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 4
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 4
- 239000002585 base Substances 0.000 description 4
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 4
- 239000007788 liquid Substances 0.000 description 4
- 238000001953 recrystallisation Methods 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- JIGUQPWFLRLWPJ-UHFFFAOYSA-N Ethyl acrylate Chemical compound CCOC(=O)C=C JIGUQPWFLRLWPJ-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- 125000004494 ethyl ester group Chemical group 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- RCPPTZGHLZLDMB-UHFFFAOYSA-N 4-ethyl-3,4-dihydro-2h-naphthalen-1-one Chemical compound C1=CC=C2C(CC)CCC(=O)C2=C1 RCPPTZGHLZLDMB-UHFFFAOYSA-N 0.000 description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 2
- 239000005635 Caprylic acid (CAS 124-07-2) Substances 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- 229920000742 Cotton Polymers 0.000 description 2
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 2
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 125000002947 alkylene group Chemical group 0.000 description 2
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 2
- 229910021529 ammonia Inorganic materials 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- 229960002446 octanoic acid Drugs 0.000 description 2
- PNJWIWWMYCMZRO-UHFFFAOYSA-N pent‐4‐en‐2‐one Natural products CC(=O)CC=C PNJWIWWMYCMZRO-UHFFFAOYSA-N 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 238000007127 saponification reaction Methods 0.000 description 2
- 229910052938 sodium sulfate Inorganic materials 0.000 description 2
- 235000011152 sodium sulphate Nutrition 0.000 description 2
- 238000000859 sublimation Methods 0.000 description 2
- 230000008022 sublimation Effects 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- 230000001988 toxicity Effects 0.000 description 2
- 231100000419 toxicity Toxicity 0.000 description 2
- NQPDZGIKBAWPEJ-UHFFFAOYSA-N valeric acid Chemical compound CCCCC(O)=O NQPDZGIKBAWPEJ-UHFFFAOYSA-N 0.000 description 2
- 229940005605 valeric acid Drugs 0.000 description 2
- VDLWTJCSPSUGOA-UHFFFAOYSA-N 1,2,3,4-tetrahydronaphthalene-1-carboxylic acid Chemical class C1=CC=C2C(C(=O)O)CCCC2=C1 VDLWTJCSPSUGOA-UHFFFAOYSA-N 0.000 description 1
- LAXPZFZORZNNBN-UHFFFAOYSA-N 1-ethyl-4-oxo-2,3-dihydronaphthalene-1-carboxamide Chemical compound C(N)(=O)C1(CCC(C2=CC=CC=C12)=O)CC LAXPZFZORZNNBN-UHFFFAOYSA-N 0.000 description 1
- CPOQXAYHQYYHHU-UHFFFAOYSA-N 2-(4-chlorophenyl)butanenitrile Chemical compound CCC(C#N)C1=CC=C(Cl)C=C1 CPOQXAYHQYYHHU-UHFFFAOYSA-N 0.000 description 1
- VMHIJHHGGBELNG-UHFFFAOYSA-N 2-cyano-2-ethylhexanoic acid Chemical compound C(C)C(C(=O)O)(C#N)CCCC VMHIJHHGGBELNG-UHFFFAOYSA-N 0.000 description 1
- CVKMFSAVYPAZTQ-UHFFFAOYSA-N 2-methylhexanoic acid Chemical compound CCCCC(C)C(O)=O CVKMFSAVYPAZTQ-UHFFFAOYSA-N 0.000 description 1
- SPQZSMGSABRCLW-UHFFFAOYSA-N CCC(CCC(Cl)=O)(C1=CC=CC=C1)C#N Chemical compound CCC(CCC(Cl)=O)(C1=CC=CC=C1)C#N SPQZSMGSABRCLW-UHFFFAOYSA-N 0.000 description 1
- UXVMQQNJUSDDNG-UHFFFAOYSA-L Calcium chloride Chemical compound [Cl-].[Cl-].[Ca+2] UXVMQQNJUSDDNG-UHFFFAOYSA-L 0.000 description 1
- 241001137251 Corvidae Species 0.000 description 1
- 241000751119 Mila <angiosperm> Species 0.000 description 1
- GZMYLSJUNSCMTD-MOPGFXCFSA-N OC[C@@H](C)NC1=NC(=CC(=C1)C=1C=C(C=CC=1C)NC(=O)N1C[C@@H](CC1)CC(F)(F)F)N1CCOCC1 Chemical compound OC[C@@H](C)NC1=NC(=CC(=C1)C=1C=C(C=CC=1C)NC(=O)N1C[C@@H](CC1)CC(F)(F)F)N1CCOCC1 GZMYLSJUNSCMTD-MOPGFXCFSA-N 0.000 description 1
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 1
- 229960000583 acetic acid Drugs 0.000 description 1
- 150000008065 acid anhydrides Chemical class 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 125000003368 amide group Chemical group 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 150000001555 benzenes Chemical class 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000001110 calcium chloride Substances 0.000 description 1
- 229910001628 calcium chloride Inorganic materials 0.000 description 1
- 125000006297 carbonyl amino group Chemical group [H]N([*:2])C([*:1])=O 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 239000012230 colorless oil Substances 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 235000013601 eggs Nutrition 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 230000007717 exclusion Effects 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 230000003301 hydrolyzing effect Effects 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- 150000004702 methyl esters Chemical class 0.000 description 1
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 1
- YOWLFTMCSSZGOE-UHFFFAOYSA-N n,n-dimethyl-1,2,3,4-tetrahydronaphthalene-1-carboxamide Chemical compound C1=CC=C2C(C(=O)N(C)C)CCCC2=C1 YOWLFTMCSSZGOE-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- RMHJJUOPOWPRBP-UHFFFAOYSA-N naphthalene-1-carboxamide Chemical compound C1=CC=C2C(C(=O)N)=CC=CC2=C1 RMHJJUOPOWPRBP-UHFFFAOYSA-N 0.000 description 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 238000006798 ring closing metathesis reaction Methods 0.000 description 1
- 238000007363 ring formation reaction Methods 0.000 description 1
- 239000000932 sedative agent Substances 0.000 description 1
- 230000001624 sedative effect Effects 0.000 description 1
- 229910052710 silicon Inorganic materials 0.000 description 1
- 239000010703 silicon Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- CXWXQJXEFPUFDZ-UHFFFAOYSA-N tetralin Chemical class C1=CC=C2CCCCC2=C1 CXWXQJXEFPUFDZ-UHFFFAOYSA-N 0.000 description 1
- 125000003396 thiol group Chemical group [H]S* 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C233/00—Carboxylic acid amides
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C255/00—Carboxylic acid nitriles
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH8049559A CH385831A (de) | 1959-11-12 | 1959-11-12 | Verfahren zur Herstellung neuer Naphthalinverbindungen |
| CH978960A CH432501A (de) | 1959-11-12 | 1960-08-30 | Verfahren zur Herstellung neuer Naphthalinverbindungen |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1418708A1 true DE1418708A1 (de) | 1968-10-03 |
Family
ID=25705335
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19601418708 Pending DE1418708A1 (de) | 1959-11-12 | 1960-11-03 | Neue Naphthalinverbindungen |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US3211739A (enExample) |
| CH (2) | CH402843A (enExample) |
| DE (1) | DE1418708A1 (enExample) |
| ES (1) | ES262352A1 (enExample) |
| FR (1) | FR1298917A (enExample) |
| GB (1) | GB898909A (enExample) |
| NL (1) | NL257849A (enExample) |
| SE (2) | SE308718B (enExample) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3781757A (en) * | 1972-12-04 | 1973-12-25 | Gen Electric | Grounding clip for plug-in surface heating unit |
| US4049717A (en) * | 1976-05-13 | 1977-09-20 | American Cyanamid Company | Novel 1,2,3,4-tetrahydro-4-oxo-(oxy)-1-naphthylamines and method of preparation thereof |
| US4041070A (en) * | 1976-07-14 | 1977-08-09 | American Cyanamid Company | Tetrahydro-4-imino-1-naphthylureas |
Family Cites Families (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2185237A (en) * | 1937-08-11 | 1940-01-02 | Merck & Co Inc | Process of preparing the nitriles of alpha-naphthyl substituted lower fatty acids |
| US2212056A (en) * | 1938-09-02 | 1940-08-20 | Du Pont | 6-chloro-diphenyl-methane-2-carboxylic acid compounds and a process for preparing the same |
| US2326222A (en) * | 1940-01-04 | 1943-08-10 | Hopff Heinrich | Aryl-substituted hydrogenated cyclic compound and the process of producing same |
| US2326229A (en) * | 1940-02-12 | 1943-08-10 | Du Pont | Process of producing carboxylic acid chlorides |
| US2290401A (en) * | 1941-07-23 | 1942-07-21 | Univ Ohio State Res Found | Method of preparing polycyclic aromatic carboxylic acids |
| US2541939A (en) * | 1948-02-19 | 1951-02-13 | Ferrosan Ab | Para nitro or acetylamino salicylic acid chlorides |
| US2551891A (en) * | 1948-04-09 | 1951-05-08 | Geigy Ag J R | Diethyl-chlorobenzamide |
| NL247377A (enExample) * | 1957-11-25 | |||
| US2948724A (en) * | 1958-04-21 | 1960-08-09 | Sahyun | Halogenated derivatives of tetrahydro-1-naphthyl cyclic amidines |
| US2913483A (en) * | 1958-05-08 | 1959-11-17 | Dow Chemical Co | Lower alkylphenyl 2, 4-dichloro-benzoates |
| US2914555A (en) * | 1958-07-02 | 1959-11-24 | Dow Chemical Co | 4-alkylphenyl esters of 4-chlorobenzoic acid |
-
1959
- 1959-11-12 CH CH1416564A patent/CH402843A/de unknown
-
1960
- 1960-08-30 CH CH978960A patent/CH432501A/de unknown
- 1960-11-03 DE DE19601418708 patent/DE1418708A1/de active Pending
- 1960-11-04 US US66925A patent/US3211739A/en not_active Expired - Lifetime
- 1960-11-07 FR FR843140A patent/FR1298917A/fr not_active Expired
- 1960-11-11 SE SE589/63A patent/SE308718B/xx unknown
- 1960-11-11 ES ES0262352A patent/ES262352A1/es not_active Expired
- 1960-11-11 GB GB38868/60A patent/GB898909A/en not_active Expired
- 1960-11-11 NL NL257849D patent/NL257849A/xx unknown
-
1963
- 1963-01-18 SE SE590/63A patent/SE309415B/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| SE308718B (enExample) | 1969-02-24 |
| US3211739A (en) | 1965-10-12 |
| NL257849A (enExample) | 1964-04-10 |
| GB898909A (en) | 1962-06-14 |
| CH402843A (de) | 1965-11-30 |
| ES262352A1 (es) | 1961-01-16 |
| SE309415B (enExample) | 1969-03-24 |
| CH432501A (de) | 1967-03-31 |
| FR1298917A (fr) | 1962-07-20 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2111071A1 (de) | Verfahren zur Herstellung neuer heterocyclischer Verbindungen | |
| EP0039844A2 (de) | Verfahren zur Herstellung von O-substituierten Derivaten des (+)-Cyanidan-3-ols | |
| DE2508045A1 (de) | Substituierte n-(1-benzylpyrrolidinyl-2-alkyl)-benzamide, verfahren zu deren herstellung und diese enthaltende arzneimittel | |
| DE2803651A1 (de) | M-sulfonamidobenzamid-derivate | |
| DE2718405A1 (de) | Neue n- eckige klammer auf 1-(3-benzoylpropyl)-4-piperidyl eckige klammer zu -sulfonsaeureamide und verfahren zu deren herstellung | |
| DE3308719A1 (de) | 1-substituierte n-(8(alpha)-ergolinyl)-n'.n'-diethylharnstoffe, ihre herstellung und pharmakologische verwendung | |
| AT200578B (de) | Verfahren zur Herstellung von neuen N-Aminoalkylderivaten von Azepinen | |
| EP0048345B1 (de) | Verfahren zur Herstellung eines alpha-L-Aspartyl-L-Phenylalanin-Alkyl-Esters | |
| DE1418708A1 (de) | Neue Naphthalinverbindungen | |
| DE2534962C3 (de) | cis-3,4-Ureylenthiophan-l,l-dioxid und Verfahren zu seiner Herstellung | |
| DE2454619A1 (de) | Verfahren zur herstellung neuer heterocyclischer verbindungen | |
| DE1935404C3 (de) | Verfahren zur Herstellung von Chinazoline nen | |
| DE1670186A1 (de) | Verfahren zur Herstellung von p-Alkoxypiperidin-amiden | |
| DE2624352B2 (de) | Dibenzo ecklige Klammer auf b,f] thiepine, Verfahren zu ihrer Herstellung und diese Verbindungen enthaltende entzündungshemmende Zubereitungen | |
| AT209895B (de) | Verfahren zur Herstellung von 3-Amino-2,4,6-trijodbenzoylverbindungen | |
| DE1812231B2 (de) | Verfahren zur herstellung von 3alkyl-5-phenyl-1,3-dihydro-2h-1,4benzodiazepin-2-onderivaten | |
| DE1493797A1 (de) | Verfahren zur Herstellung von neuen substituierten Malonsaeuremonohydraziden | |
| DE3887612T2 (de) | Salicylate, ihre Salze, diese enthaltende pharmazeutische Kompositionen und ihr Herstellungsverfahren. | |
| AT221515B (de) | Verfahren zur Herstellung neuer 4-Oxo-1,2,3,4-tetrahydronaphthalin-carbonsäureamide | |
| DE3204074C2 (enExample) | ||
| DE2412323C3 (de) | 1,2-Diphenyl-äthanderivate, Verfahren zu ihrer Herstellung und diese enthaltende Arzneimittel | |
| DE939633C (de) | Verfahren zur Herstellung kernsubstituierter Anilide niedrigmolekularer aliphatischer Aminocarbonsaeuren | |
| DE2235915C3 (de) | N-eckige Klammer auf 3-Pyrrolidinyliden-(2'-amino-2,4,6-trijodbenzoyl eckige Klammer zu - aminosäuren, deren Herstellung und Verwendung | |
| AT273940B (de) | Verfahren zur Herstellung von neuen ω-(2-Amino-5-halogenbenzylamino)-alkansäuren, deren Estern, Amiden und/oder Salzen | |
| CH451961A (de) | Verfahren zur Herstellung von Hydroxamsäureestern |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| SH | Request for examination between 03.10.1968 and 22.04.1971 |