DE1297095B - Verfahren zur Herstellung von sulfenylierten Carbamidsaeurefluoriden - Google Patents
Verfahren zur Herstellung von sulfenylierten CarbamidsaeurefluoridenInfo
- Publication number
- DE1297095B DE1297095B DEF52861A DEF0052861A DE1297095B DE 1297095 B DE1297095 B DE 1297095B DE F52861 A DEF52861 A DE F52861A DE F0052861 A DEF0052861 A DE F0052861A DE 1297095 B DE1297095 B DE 1297095B
- Authority
- DE
- Germany
- Prior art keywords
- cof
- carbamic acid
- halogen
- alkyl
- optionally substituted
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- PVXRCPDNJSFYBV-UHFFFAOYSA-N carbamoyl fluoride Chemical class NC(F)=O PVXRCPDNJSFYBV-UHFFFAOYSA-N 0.000 title claims description 5
- 238000000034 method Methods 0.000 title claims description 5
- -1 aromatic Radical Chemical class 0.000 claims description 19
- 239000000460 chlorine Chemical group 0.000 claims description 8
- 229910052736 halogen Inorganic materials 0.000 claims description 8
- 150000002367 halogens Chemical group 0.000 claims description 8
- 229910052801 chlorine Inorganic materials 0.000 claims description 6
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical group [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 5
- 125000000217 alkyl group Chemical group 0.000 claims description 5
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 4
- 239000012442 inert solvent Substances 0.000 claims description 3
- RVEZZJVBDQCTEF-UHFFFAOYSA-N sulfenic acid Chemical compound SO RVEZZJVBDQCTEF-UHFFFAOYSA-N 0.000 claims description 3
- 150000003512 tertiary amines Chemical class 0.000 claims description 3
- 125000001931 aliphatic group Chemical group 0.000 claims description 2
- 150000005840 aryl radicals Chemical group 0.000 claims description 2
- 125000003107 substituted aryl group Chemical group 0.000 claims description 2
- 125000001188 haloalkyl group Chemical group 0.000 claims 1
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 12
- 239000002253 acid Substances 0.000 description 9
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- KRHYYFGTRYWZRS-UHFFFAOYSA-M Fluoride anion Chemical compound [F-] KRHYYFGTRYWZRS-UHFFFAOYSA-M 0.000 description 5
- KRHYYFGTRYWZRS-UHFFFAOYSA-N Fluorane Chemical compound F KRHYYFGTRYWZRS-UHFFFAOYSA-N 0.000 description 4
- 125000004432 carbon atom Chemical group C* 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- PXJJSXABGXMUSU-UHFFFAOYSA-N disulfur dichloride Chemical compound ClSSCl PXJJSXABGXMUSU-UHFFFAOYSA-N 0.000 description 3
- 229910052731 fluorine Inorganic materials 0.000 description 3
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- KXDHJXZQYSOELW-UHFFFAOYSA-N carbonic acid monoamide Natural products NC(O)=O KXDHJXZQYSOELW-UHFFFAOYSA-N 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 239000011737 fluorine Substances 0.000 description 2
- 150000002222 fluorine compounds Chemical class 0.000 description 2
- 125000005843 halogen group Chemical group 0.000 description 2
- 239000012948 isocyanate Substances 0.000 description 2
- 150000002513 isocyanates Chemical class 0.000 description 2
- WRBUEDBPGZVHJQ-UHFFFAOYSA-N n-methylcarbamoyl fluoride Chemical compound CNC(F)=O WRBUEDBPGZVHJQ-UHFFFAOYSA-N 0.000 description 2
- FWMUJAIKEJWSSY-UHFFFAOYSA-N sulfur dichloride Chemical compound ClSCl FWMUJAIKEJWSSY-UHFFFAOYSA-N 0.000 description 2
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- WQZGKKKJIJFFOK-QTVWNMPRSA-N D-mannopyranose Chemical compound OC[C@H]1OC(O)[C@@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-QTVWNMPRSA-N 0.000 description 1
- QMMFVYPAHWMCMS-UHFFFAOYSA-N Dimethyl sulfide Chemical compound CSC QMMFVYPAHWMCMS-UHFFFAOYSA-N 0.000 description 1
- 238000005684 Liebig rearrangement reaction Methods 0.000 description 1
- KDRSHFSCTSFYGH-UHFFFAOYSA-N [dichloro(fluoro)methyl] thiohypochlorite Chemical compound FC(Cl)(Cl)SCl KDRSHFSCTSFYGH-UHFFFAOYSA-N 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 125000004414 alkyl thio group Chemical group 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- CSKNSYBAZOQPLR-UHFFFAOYSA-N benzenesulfonyl chloride Chemical compound ClS(=O)(=O)C1=CC=CC=C1 CSKNSYBAZOQPLR-UHFFFAOYSA-N 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- XLJMAIOERFSOGZ-UHFFFAOYSA-M cyanate Chemical compound [O-]C#N XLJMAIOERFSOGZ-UHFFFAOYSA-M 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 125000004184 methoxymethyl group Chemical group [H]C([H])([H])OC([H])([H])* 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- PFZUSDQRLQDKAR-UHFFFAOYSA-N n-(4-chlorophenyl)-n-[dichloro(fluoro)methyl]sulfanylcarbamoyl fluoride Chemical compound FC(Cl)(Cl)SN(C(=O)F)C1=CC=C(Cl)C=C1 PFZUSDQRLQDKAR-UHFFFAOYSA-N 0.000 description 1
- DZXAINSCQJRLEG-UHFFFAOYSA-N n-phenylcarbamoyl fluoride Chemical compound FC(=O)NC1=CC=CC=C1 DZXAINSCQJRLEG-UHFFFAOYSA-N 0.000 description 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 1
- RYFZYYUIAZYQLC-UHFFFAOYSA-N perchloromethyl mercaptan Chemical compound ClSC(Cl)(Cl)Cl RYFZYYUIAZYQLC-UHFFFAOYSA-N 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000000446 sulfanediyl group Chemical group *S* 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- KJAMZCVTJDTESW-UHFFFAOYSA-N tiracizine Chemical compound C1CC2=CC=CC=C2N(C(=O)CN(C)C)C2=CC(NC(=O)OCC)=CC=C21 KJAMZCVTJDTESW-UHFFFAOYSA-N 0.000 description 1
- ILWRPSCZWQJDMK-UHFFFAOYSA-N triethylazanium;chloride Chemical compound Cl.CCN(CC)CC ILWRPSCZWQJDMK-UHFFFAOYSA-N 0.000 description 1
- 150000003672 ureas Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C271/00—Derivatives of carbamic acids, i.e. compounds containing any of the groups, the nitrogen atom not being part of nitro or nitroso groups
- C07C271/02—Carbamic acids; Salts of carbamic acids
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
Priority Applications (7)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEF52861A DE1297095B (de) | 1967-07-05 | 1967-07-05 | Verfahren zur Herstellung von sulfenylierten Carbamidsaeurefluoriden |
| IL30121A IL30121A (en) | 1967-07-05 | 1968-06-04 | Sulphenylated carbamic acid fluorides |
| CH828468A CH498104A (de) | 1967-07-05 | 1968-06-04 | Verfahren zur Herstellung von Carbamidsäurefluoriden |
| US742176A US3639471A (en) | 1967-07-05 | 1968-07-03 | Process for the preparation of sulfenylated carbamic acid fluoride |
| BE717705D BE717705A (show.php) | 1967-07-05 | 1968-07-05 | |
| FR1578225D FR1578225A (show.php) | 1967-07-05 | 1968-07-05 | |
| GB32247/68A GB1189915A (en) | 1967-07-05 | 1968-07-05 | Carbamic Acid Fluorides |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEF52861A DE1297095B (de) | 1967-07-05 | 1967-07-05 | Verfahren zur Herstellung von sulfenylierten Carbamidsaeurefluoriden |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1297095B true DE1297095B (de) | 1969-06-12 |
Family
ID=7105797
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEF52861A Pending DE1297095B (de) | 1967-07-05 | 1967-07-05 | Verfahren zur Herstellung von sulfenylierten Carbamidsaeurefluoriden |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US3639471A (show.php) |
| BE (1) | BE717705A (show.php) |
| CH (1) | CH498104A (show.php) |
| DE (1) | DE1297095B (show.php) |
| FR (1) | FR1578225A (show.php) |
| GB (1) | GB1189915A (show.php) |
| IL (1) | IL30121A (show.php) |
Cited By (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2311662A1 (de) * | 1973-03-09 | 1974-09-12 | Bayer Ag | Verfahren zur herstellung von bishalogencarbonylanilinen |
| US4127605A (en) * | 1978-04-24 | 1978-11-28 | E. I. Du Pont De Nemours And Company | Substituted carbamate intermediate |
| US4225615A (en) * | 1978-04-24 | 1980-09-30 | E. I. Du Pont De Nemours And Company | Insecticidal and nematicidal carbamates |
| US4268520A (en) | 1978-04-24 | 1981-05-19 | E. I. Du Pont De Nemours And Company | Insecticidal and nematicidal carbamates |
| US4338450A (en) * | 1975-12-01 | 1982-07-06 | Union Carbide Corporation | Carbamate-sulfenyl-carbamoyl fluoride compounds |
| US4595769A (en) * | 1975-12-01 | 1986-06-17 | Union Carbide Corporation | Carbamate-sulfenyl-carbamoyl fluoride compounds |
Families Citing this family (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4012436A (en) * | 1972-12-21 | 1977-03-15 | Chevron Research Company | Carbamoyl chlorides |
| US4058549A (en) * | 1976-06-30 | 1977-11-15 | Union Carbide Corporation | N-substituted cyanoalkane-sulfenyl (and thiosulfenyl)-N-alkyl carbamoyl halides |
| US4304735A (en) * | 1976-08-02 | 1981-12-08 | Union Carbide Corporation | N-[4-(Tert-butyl)phenylsulfenyl]-N-alkylcarbamoyl fluoride compounds |
| US4156731A (en) * | 1976-09-29 | 1979-05-29 | Union Carbide Corporation | Heterocyclic oxime compounds and carbamoyloxime derivatives |
| US4234580A (en) * | 1977-03-28 | 1980-11-18 | Union Carbide Corporation | Carbamate thiosulfenylcarbamoyl fluoride compounds |
| DE2754492A1 (de) * | 1977-12-07 | 1979-06-13 | Bayer Ag | N-sulfenylierte carbamoyl-verbindungen, verfahren zu ihrer herstellung und ihre fungizide verwendung |
| US4255353A (en) * | 1979-10-22 | 1981-03-10 | E. I. Du Pont De Nemours And Company | Sulfinyl-bis carbamoyl fluorides |
| WO1982001650A1 (en) * | 1980-11-10 | 1982-05-27 | Shamrock Corp Diamond | Biologically active heterobicyclic hydroximidates and thiolhydroximidates and carbamate ester derivatives thereof |
| US4424213A (en) | 1980-11-10 | 1984-01-03 | Sds Biotech Corporation | Biologically active heterobicyclic hydroximidates and thiolhydroximidates and carbamate ester derivatives thereof |
-
1967
- 1967-07-05 DE DEF52861A patent/DE1297095B/de active Pending
-
1968
- 1968-06-04 IL IL30121A patent/IL30121A/xx unknown
- 1968-06-04 CH CH828468A patent/CH498104A/de not_active IP Right Cessation
- 1968-07-03 US US742176A patent/US3639471A/en not_active Expired - Lifetime
- 1968-07-05 BE BE717705D patent/BE717705A/xx unknown
- 1968-07-05 FR FR1578225D patent/FR1578225A/fr not_active Expired
- 1968-07-05 GB GB32247/68A patent/GB1189915A/en not_active Expired
Non-Patent Citations (1)
| Title |
|---|
| None * |
Cited By (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2311662A1 (de) * | 1973-03-09 | 1974-09-12 | Bayer Ag | Verfahren zur herstellung von bishalogencarbonylanilinen |
| US4338450A (en) * | 1975-12-01 | 1982-07-06 | Union Carbide Corporation | Carbamate-sulfenyl-carbamoyl fluoride compounds |
| US4595769A (en) * | 1975-12-01 | 1986-06-17 | Union Carbide Corporation | Carbamate-sulfenyl-carbamoyl fluoride compounds |
| US4127605A (en) * | 1978-04-24 | 1978-11-28 | E. I. Du Pont De Nemours And Company | Substituted carbamate intermediate |
| US4225615A (en) * | 1978-04-24 | 1980-09-30 | E. I. Du Pont De Nemours And Company | Insecticidal and nematicidal carbamates |
| US4268520A (en) | 1978-04-24 | 1981-05-19 | E. I. Du Pont De Nemours And Company | Insecticidal and nematicidal carbamates |
Also Published As
| Publication number | Publication date |
|---|---|
| GB1189915A (en) | 1970-04-29 |
| US3639471A (en) | 1972-02-01 |
| BE717705A (show.php) | 1969-01-06 |
| CH498104A (de) | 1970-10-31 |
| FR1578225A (show.php) | 1969-08-14 |
| IL30121A0 (en) | 1968-08-22 |
| IL30121A (en) | 1972-10-29 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1297095B (de) | Verfahren zur Herstellung von sulfenylierten Carbamidsaeurefluoriden | |
| EP1208082B1 (de) | Verbessertes verfahren zur herstellung von mono- und oligoisocyanaten | |
| DE1918113A1 (de) | Phenylharnstoffe,ihre Herstellung und Verwendung als Herbizide | |
| DE2257344C2 (de) | Verfahren zur Herstellung von N-Chlorformyl-kohlensäureamiden | |
| TW201627277A (zh) | 異氰酸酯化合物的製造方法 | |
| DE848811C (de) | Verfahren zur Herstellung organischer Chlorthiophosphorsaeureester | |
| DE2045440C3 (de) | Verfahren zur Herstellung von trisubstituierten Chlorsulfenylharnstoffen | |
| DE1154089B (de) | Verfahren zur Herstellung N-substituierter Imino-halogen-kohlensaeurethioester | |
| DE2210285B2 (de) | Verfahren zur Herstellung von Isocyanaten | |
| DE2530278C3 (de) | Carbamoylhalogenidverbindungen und Verfahren zu deren Herstellung | |
| DE1161262B (de) | Verfahren zur Herstellung N-trifluormethylierter Sulfenamide | |
| DE3313718A1 (de) | N-sulfenylierte phenethylsulfonamide | |
| EP0009158B1 (de) | Verfahren zur Herstellung von N-(3-Hydroxyphenyl)-(thiol)-carbamaten | |
| EP0055430B1 (de) | N-(Sulfenamido)-acylisocyanate, Verfahren zu ihrer Herstellung und ihre Verwendung als Zwischenprodukte | |
| CH528861A (de) | Verwendung von Phenylharnstoffen zum selektiven Bekämpfen von Unkräutern in Kulturen von Nutzpflanzen | |
| EP0023976A1 (de) | N-Aryl-N'-acryloyl-ureide, Verfahren zu ihrer Herstellung sowie ihre Verwendung als Mikrobizide | |
| DE1167331B (de) | Verfahren zur Herstellung von Isothiocyanaten | |
| DE1188588B (de) | Verfahren zur Herstellung von N-5, 6-Dihydrodicyclopentadienyl-6-N', N'-di-n-propylharnstoff | |
| EP0507277B1 (de) | Verfahren zur Herstellung von Sulfonylharnstoffen | |
| DE2311662A1 (de) | Verfahren zur herstellung von bishalogencarbonylanilinen | |
| DE1670960A1 (de) | Verfahren zur Herstellung von salzartigen heterocyclischen Verbindungen | |
| EP0156198A2 (de) | Verfahren zur Herstellung von Isocyanaten | |
| DE2210882A1 (de) | Spezielles verfahren zur herstellung von 4,5-bis-trifluormethylimino-derivaten von thiazolidinen | |
| DE1795076A1 (de) | Verfahren zur Herstellung von neuen Isoharnstoff-Derivaten | |
| DE1928130A1 (de) | Iminokohlsaeureesterhalogenidderivate |