DE1296943B - Desintegrator - Google Patents
DesintegratorInfo
- Publication number
- DE1296943B DE1296943B DES103913A DES0103913A DE1296943B DE 1296943 B DE1296943 B DE 1296943B DE S103913 A DES103913 A DE S103913A DE S0103913 A DES0103913 A DE S0103913A DE 1296943 B DE1296943 B DE 1296943B
- Authority
- DE
- Germany
- Prior art keywords
- blades
- disintegrator
- blade
- disintegrator according
- ring
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 239000000463 material Substances 0.000 claims description 19
- 239000011241 protective layer Substances 0.000 claims description 14
- 239000004576 sand Substances 0.000 claims description 8
- 239000000203 mixture Substances 0.000 claims description 7
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 claims description 4
- 238000005299 abrasion Methods 0.000 claims description 4
- 238000005520 cutting process Methods 0.000 claims description 4
- 229910052742 iron Inorganic materials 0.000 claims description 2
- 238000012360 testing method Methods 0.000 description 11
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 9
- 230000000694 effects Effects 0.000 description 7
- 230000015572 biosynthetic process Effects 0.000 description 5
- 239000004571 lime Substances 0.000 description 4
- 235000008733 Citrus aurantifolia Nutrition 0.000 description 3
- 235000011941 Tilia x europaea Nutrition 0.000 description 3
- 239000010410 layer Substances 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- 239000004566 building material Substances 0.000 description 2
- 230000000052 comparative effect Effects 0.000 description 2
- 230000003247 decreasing effect Effects 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 238000012423 maintenance Methods 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 238000005259 measurement Methods 0.000 description 2
- 230000002787 reinforcement Effects 0.000 description 2
- 230000003014 reinforcing effect Effects 0.000 description 2
- 229910000851 Alloy steel Inorganic materials 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- AXCZMVOFGPJBDE-UHFFFAOYSA-L calcium dihydroxide Chemical compound [OH-].[OH-].[Ca+2] AXCZMVOFGPJBDE-UHFFFAOYSA-L 0.000 description 1
- 239000000920 calcium hydroxide Substances 0.000 description 1
- 229910001861 calcium hydroxide Inorganic materials 0.000 description 1
- 235000011116 calcium hydroxide Nutrition 0.000 description 1
- 229910052681 coesite Inorganic materials 0.000 description 1
- 229910052906 cristobalite Inorganic materials 0.000 description 1
- 230000001627 detrimental effect Effects 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 238000000227 grinding Methods 0.000 description 1
- 238000003754 machining Methods 0.000 description 1
- 230000014759 maintenance of location Effects 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- 238000005457 optimization Methods 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 238000012545 processing Methods 0.000 description 1
- 238000010079 rubber tapping Methods 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 235000012239 silicon dioxide Nutrition 0.000 description 1
- 238000005549 size reduction Methods 0.000 description 1
- 239000007779 soft material Substances 0.000 description 1
- 125000006850 spacer group Chemical group 0.000 description 1
- 229910052682 stishovite Inorganic materials 0.000 description 1
- 229910052905 tridymite Inorganic materials 0.000 description 1
- MTPVUVINMAGMJL-UHFFFAOYSA-N trimethyl(1,1,2,2,2-pentafluoroethyl)silane Chemical compound C[Si](C)(C)C(F)(F)C(F)(F)F MTPVUVINMAGMJL-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B02—CRUSHING, PULVERISING, OR DISINTEGRATING; PREPARATORY TREATMENT OF GRAIN FOR MILLING
- B02C—CRUSHING, PULVERISING, OR DISINTEGRATING IN GENERAL; MILLING GRAIN
- B02C13/00—Disintegrating by mills having rotary beater elements ; Hammer mills
- B02C13/20—Disintegrating by mills having rotary beater elements ; Hammer mills with two or more co-operating rotors
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B02—CRUSHING, PULVERISING, OR DISINTEGRATING; PREPARATORY TREATMENT OF GRAIN FOR MILLING
- B02C—CRUSHING, PULVERISING, OR DISINTEGRATING IN GENERAL; MILLING GRAIN
- B02C13/00—Disintegrating by mills having rotary beater elements ; Hammer mills
- B02C13/20—Disintegrating by mills having rotary beater elements ; Hammer mills with two or more co-operating rotors
- B02C13/205—Disintegrating by mills having rotary beater elements ; Hammer mills with two or more co-operating rotors arranged concentrically
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B02—CRUSHING, PULVERISING, OR DISINTEGRATING; PREPARATORY TREATMENT OF GRAIN FOR MILLING
- B02C—CRUSHING, PULVERISING, OR DISINTEGRATING IN GENERAL; MILLING GRAIN
- B02C13/00—Disintegrating by mills having rotary beater elements ; Hammer mills
- B02C13/26—Details
- B02C13/28—Shape or construction of beater elements
- B02C13/2804—Shape or construction of beater elements the beater elements being rigidly connected to the rotor
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B28—WORKING CEMENT, CLAY, OR STONE
- B28C—PREPARING CLAY; PRODUCING MIXTURES CONTAINING CLAY OR CEMENTITIOUS MATERIAL, e.g. PLASTER
- B28C5/00—Apparatus or methods for producing mixtures of cement with other substances, e.g. slurries, mortars, porous or fibrous compositions
- B28C5/08—Apparatus or methods for producing mixtures of cement with other substances, e.g. slurries, mortars, porous or fibrous compositions using driven mechanical means affecting the mixing
- B28C5/0881—Apparatus or methods for producing mixtures of cement with other substances, e.g. slurries, mortars, porous or fibrous compositions using driven mechanical means affecting the mixing having a stator-rotor system with intermeshing teeth or cages
Landscapes
- Engineering & Computer Science (AREA)
- Food Science & Technology (AREA)
- Mechanical Engineering (AREA)
- Structural Engineering (AREA)
- Crushing And Pulverization Processes (AREA)
- Mixers Of The Rotary Stirring Type (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| IT1199965 | 1965-05-29 | ||
| IT1527165 | 1965-07-08 | ||
| IT443766 | 1966-02-28 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1296943B true DE1296943B (de) | 1969-06-04 |
Family
ID=27272618
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DES103913A Pending DE1296943B (de) | 1965-05-29 | 1966-05-21 | Desintegrator |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US3411724A (enExample) |
| BE (1) | BE681130A (enExample) |
| CH (1) | CH450122A (enExample) |
| DE (1) | DE1296943B (enExample) |
| DK (1) | DK120220B (enExample) |
| ES (1) | ES327632A1 (enExample) |
| FR (1) | FR1542461A (enExample) |
| GB (1) | GB1141892A (enExample) |
| IL (1) | IL25777A (enExample) |
| NL (1) | NL6606502A (enExample) |
| NO (1) | NO117102B (enExample) |
Cited By (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2431387A1 (de) * | 1973-07-05 | 1975-01-23 | Patent Anst Baustoffe | Desintegrator |
| DE3034849A1 (de) * | 1980-09-16 | 1982-04-29 | Kasa-Forschungs- und Entwicklungs-Gesellschaft mbH & Co KG für Verfahrenstechnik, 6000 Frankfurt | Desintegrator und verfahren zum betrieb des desintegrators |
| DE3242950A1 (de) * | 1982-11-20 | 1984-05-24 | Eggeling, Ernst, 4600 Dortmund | Vorrichtung fuer die prallzerkleinerung von mahlgut |
| DE3242951A1 (de) * | 1982-11-20 | 1984-05-24 | Eggeling, Ernst, 4600 Dortmund | Vorrichtung fuer die prallzerkleinerung von mahlgut |
| DE3610974A1 (de) * | 1986-04-02 | 1987-10-08 | Bhs Bayerische Berg | Horizontal-schleudermuehle, insbesondere zum zerkleinern von abrasivem gestein |
| DE3802260A1 (de) * | 1988-01-27 | 1989-08-10 | Kasa Technoplan | Rotierende desintegrationsvorrichtung |
| US5165609A (en) * | 1991-09-05 | 1992-11-24 | Technalum Research, Inc. | Method of producing thermally reactive powders using consumable disintegrator disks |
| US5302182A (en) * | 1991-09-05 | 1994-04-12 | Technalum Research, Inc. | Method of preparing particles with a controlled narrow distribution |
| WO1999030580A1 (de) * | 1997-12-16 | 1999-06-24 | Upt Dr Snyckers Gmbh | Verfahren und vorrichtung zur verbesserung der wirksamkeit von wirkstoffen, die mindestens aus mineralstoffen bestehen |
| US20210282329A1 (en) * | 2020-03-12 | 2021-09-16 | Dean Mayerle | Weed Seed Destruction with Improved Wear Characterisitics |
Families Citing this family (26)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3817460A (en) * | 1972-04-07 | 1974-06-18 | Silver Lining Inc | Pulverizing apparatus |
| CH588895A5 (enExample) * | 1975-04-24 | 1977-06-15 | Fahrni Peter | |
| DE2926042C2 (de) * | 1979-06-28 | 1983-03-17 | Eggeling, Ernst, 4600 Dortmund | Desintegrator zur trockenen Zerkleinerung von Kohle bis auf Kristallkorngröße |
| NL8303825A (nl) * | 1982-11-20 | 1984-06-18 | Nickel Heinrich | Inrichting voor het door stootwerking verkleinen van te malen materiaal. |
| FR2583656A1 (fr) * | 1985-06-25 | 1986-12-26 | Collin Jean Claude | Machine de dechiquetage de matieres ligneuses en vrac de grand volume |
| US6196284B1 (en) | 1994-03-07 | 2001-03-06 | Dana Lequin | Wood pulverizer with improved grates and grate components |
| US5597127A (en) * | 1995-08-04 | 1997-01-28 | Brown David K | Ultrafines coal pulverizer |
| WO1999051352A1 (fr) * | 1998-04-03 | 1999-10-14 | Kontyaev Alexei Vyacheslavovic | Procede et dispositif de broyage de materiaux |
| US6286771B1 (en) * | 1998-08-25 | 2001-09-11 | Charles Kepler Brown, Jr. | Two-stage micronizer for reducing oversize particles |
| WO2000027533A1 (en) * | 1998-11-09 | 2000-05-18 | Brown Charles Kepler Jr | Coal grinding, cleaning and drying processor |
| RU2169617C2 (ru) * | 1999-05-12 | 2001-06-27 | Ивановская государственная архитектурно-строительная академия | Устройство для измельчения |
| RU2217470C1 (ru) * | 2002-07-30 | 2003-11-27 | Теляшев Эльшад Гумерович | Дезинтегратор |
| RU2295390C2 (ru) * | 2005-04-25 | 2007-03-20 | Федеральное Государственное Унитарное предприятие "Научно-производственное предприятие "Мотор" (ФГУП "НПП "Мотор") | Способ и устройство для измельчения материалов |
| RU2306179C2 (ru) * | 2005-10-19 | 2007-09-20 | Федеральное Государственное Унитарное предприятие "Научно-производственное предприятие "Мотор" (ФГУП "НПП "Мотор") | Устройство для измельчения материалов |
| RU2341330C1 (ru) * | 2007-03-29 | 2008-12-20 | Открытое Акционерное Общество "Нептун" | Устройство для дробления зерна |
| RU2380160C1 (ru) * | 2008-07-01 | 2010-01-27 | Петр Алексеевич Ефимов | Установка для тонкого и сверхтонкого измельчения материалов |
| RU2382676C1 (ru) * | 2008-08-29 | 2010-02-27 | Юрий Васильевич Баранов | Устройство для измельчения зерна |
| BE1018129A3 (fr) * | 2008-09-19 | 2010-05-04 | Magotteaux Int | Impacteur composite pour concasseurs a percussion. |
| FI20105383A7 (fi) * | 2010-04-14 | 2011-10-15 | Oy Chemec Ab | Menetelmä puulastuja käsittävän levyn valmistamiseksi |
| EP2608887B1 (en) * | 2010-08-23 | 2018-02-28 | Lambano Trading Limited | Device for micronization of solid materials and its use |
| US9723790B2 (en) * | 2013-02-19 | 2017-08-08 | Grains Research & Development Corporation | Weed seed devitalization arrangement |
| DE102013217164A1 (de) * | 2013-08-28 | 2015-03-05 | Panel Board Holding Bv | Zerkleinerungsvorrichtung |
| CN104827568B (zh) * | 2015-04-24 | 2017-06-16 | 洛阳理工学院 | 一种卧式砂浆搅拌机 |
| CN108187812B (zh) * | 2018-01-25 | 2024-01-26 | 宁夏天地奔牛实业集团有限公司 | 内置液压马达驱动破碎齿辊 |
| CN109702891B (zh) * | 2019-01-29 | 2020-04-03 | 中联重科股份有限公司 | 轴端密封用的转毂、转毂的制备方法及搅拌机 |
| CN115870548A (zh) * | 2022-11-24 | 2023-03-31 | 云南国钛金属股份有限公司 | 一种海绵钛的破碎方法 |
Citations (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB291957A (en) * | 1927-06-13 | 1928-06-14 | Cyril Percy Walker | Improvements in, or relating to centrifugal mills for the grinding, mixing, emulsification and incorporation of solids and liquids or, liquids |
| FR899440A (fr) * | 1942-11-05 | 1945-05-30 | Barres pour désintégrateurs, particulièrement pour désintégrateurs laveurs de gaz |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE267293C (enExample) * | ||||
| GB285830A (en) * | 1927-02-22 | 1929-05-14 | Bronislaw Bialy | Improvements in and relating to disintegrating, husking, grinding and threshing machines |
| US1772974A (en) * | 1928-08-21 | 1930-08-12 | White William Albert | Pulverizer |
-
1966
- 1966-05-12 NL NL6606502A patent/NL6606502A/xx unknown
- 1966-05-15 IL IL25777A patent/IL25777A/xx unknown
- 1966-05-16 BE BE681130D patent/BE681130A/xx unknown
- 1966-05-16 US US550360A patent/US3411724A/en not_active Expired - Lifetime
- 1966-05-16 GB GB21679/66A patent/GB1141892A/en not_active Expired
- 1966-05-21 DE DES103913A patent/DE1296943B/de active Pending
- 1966-05-25 NO NO163164A patent/NO117102B/no unknown
- 1966-05-26 ES ES0327632A patent/ES327632A1/es not_active Expired
- 1966-05-26 DK DK271566AA patent/DK120220B/da unknown
- 1966-05-27 CH CH775266A patent/CH450122A/de unknown
- 1966-05-27 FR FR63383A patent/FR1542461A/fr not_active Expired
Patent Citations (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB291957A (en) * | 1927-06-13 | 1928-06-14 | Cyril Percy Walker | Improvements in, or relating to centrifugal mills for the grinding, mixing, emulsification and incorporation of solids and liquids or, liquids |
| FR899440A (fr) * | 1942-11-05 | 1945-05-30 | Barres pour désintégrateurs, particulièrement pour désintégrateurs laveurs de gaz |
Cited By (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2431387A1 (de) * | 1973-07-05 | 1975-01-23 | Patent Anst Baustoffe | Desintegrator |
| DE3034849A1 (de) * | 1980-09-16 | 1982-04-29 | Kasa-Forschungs- und Entwicklungs-Gesellschaft mbH & Co KG für Verfahrenstechnik, 6000 Frankfurt | Desintegrator und verfahren zum betrieb des desintegrators |
| EP0048012A3 (en) * | 1980-09-16 | 1983-03-30 | Kasa - Forschungs- Und Entwicklungs Gmbh & Co. Kommanditgesellschaft Fur Verfahrenstechnik | Disintegrating apparatus and its operation method |
| US4406409A (en) | 1980-09-16 | 1983-09-27 | Joachim Durek | Disintegrator and method for the operation thereof |
| DE3242950A1 (de) * | 1982-11-20 | 1984-05-24 | Eggeling, Ernst, 4600 Dortmund | Vorrichtung fuer die prallzerkleinerung von mahlgut |
| DE3242951A1 (de) * | 1982-11-20 | 1984-05-24 | Eggeling, Ernst, 4600 Dortmund | Vorrichtung fuer die prallzerkleinerung von mahlgut |
| DE3610974A1 (de) * | 1986-04-02 | 1987-10-08 | Bhs Bayerische Berg | Horizontal-schleudermuehle, insbesondere zum zerkleinern von abrasivem gestein |
| DE3802260A1 (de) * | 1988-01-27 | 1989-08-10 | Kasa Technoplan | Rotierende desintegrationsvorrichtung |
| WO1989007012A1 (en) * | 1988-01-27 | 1989-08-10 | Kasa-Technoplan Gmbh | Rotary disintegrating device |
| US5009371A (en) * | 1988-01-27 | 1991-04-23 | Citadel Investments Limited | Rotary disintegrating device |
| US5165609A (en) * | 1991-09-05 | 1992-11-24 | Technalum Research, Inc. | Method of producing thermally reactive powders using consumable disintegrator disks |
| US5302182A (en) * | 1991-09-05 | 1994-04-12 | Technalum Research, Inc. | Method of preparing particles with a controlled narrow distribution |
| WO1999030580A1 (de) * | 1997-12-16 | 1999-06-24 | Upt Dr Snyckers Gmbh | Verfahren und vorrichtung zur verbesserung der wirksamkeit von wirkstoffen, die mindestens aus mineralstoffen bestehen |
| US20210282329A1 (en) * | 2020-03-12 | 2021-09-16 | Dean Mayerle | Weed Seed Destruction with Improved Wear Characterisitics |
| US12016271B2 (en) * | 2020-03-12 | 2024-06-25 | Tritana Intellectual Property Ltd. | Weed seed destruction with improved wear characterisitics |
Also Published As
| Publication number | Publication date |
|---|---|
| NO117102B (enExample) | 1969-06-30 |
| BE681130A (enExample) | 1966-10-31 |
| ES327632A1 (es) | 1967-08-16 |
| CH450122A (de) | 1968-01-15 |
| FR1542461A (fr) | 1968-10-18 |
| NL6606502A (enExample) | 1966-11-30 |
| IL25777A (en) | 1969-09-25 |
| GB1141892A (en) | 1969-02-05 |
| DK120220B (da) | 1971-04-26 |
| US3411724A (en) | 1968-11-19 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1296943B (de) | Desintegrator | |
| EP0048012B1 (de) | Desintegrator und Verfahren zum Betrieb des Desintegrators | |
| DE2605751C3 (de) | Schutzschilde für einen Hammerbrecherrotor | |
| DE2431387A1 (de) | Desintegrator | |
| DE2626757A1 (de) | Ruehrwerkmuehle, insbesondere kolloidmuehle | |
| CH630538A5 (de) | Zerkleinerungsmaschine. | |
| DE3406285C2 (enExample) | ||
| DE3426477C2 (enExample) | ||
| DE3414375A1 (de) | Meser zum zerkleinern von tierischen rohstoffen, vorzugsweise in fleischwoelfen | |
| DE19838023A1 (de) | Mehrflügeliges Messer für einen Fleischwolf | |
| DE588855C (de) | Rohrmuehle mit Mahlwalzen als Mahlkoerper | |
| DE2831690A1 (de) | Kuttermessersatz | |
| EP0403694B1 (de) | Durchlaufbrecher | |
| DE915294C (de) | Geblaesemuehle | |
| DE2207271C3 (de) | Käfigmühle | |
| AT364743B (de) | Granuliermaschine fuer eine anlage fuer die zerkleinerung von abfallmaterial | |
| DE2341408C2 (de) | Vorrichtung zum Zerkleinern von Büromaterial | |
| DE2833688C2 (de) | Desintegrator-Trommel | |
| EP0649680A1 (de) | Rotor für Trommelhacker resp. Shredder | |
| DE7310431U (de) | Gummischneider | |
| DE102024113489A1 (de) | Zerkleinerungsvorrichtung für Lebensmitteln und Trommel hierfür | |
| DE2313772C3 (enExample) | ||
| EP2926908B1 (de) | Schutzkappe für einen Rotor und Rotor | |
| DE560743C (de) | Schleudermuehle | |
| AT217337B (de) | Fleischwolf |