DE1294948B - Verfahren zur Herstellung von AEthyl-(6-oxy-3, 5-dinitrobenzyl)-aether - Google Patents
Verfahren zur Herstellung von AEthyl-(6-oxy-3, 5-dinitrobenzyl)-aetherInfo
- Publication number
- DE1294948B DE1294948B DED53404A DED0053404A DE1294948B DE 1294948 B DE1294948 B DE 1294948B DE D53404 A DED53404 A DE D53404A DE D0053404 A DED0053404 A DE D0053404A DE 1294948 B DE1294948 B DE 1294948B
- Authority
- DE
- Germany
- Prior art keywords
- oxy
- dinitrobenzyl
- ether
- reaction
- ethyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 title claims description 11
- 238000000034 method Methods 0.000 title claims description 4
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 11
- ZHNUHDYFZUAESO-UHFFFAOYSA-N Formamide Chemical compound NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 claims description 11
- 235000019441 ethanol Nutrition 0.000 claims description 6
- QQZWEECEMNQSTG-UHFFFAOYSA-N Ethyl nitrite Chemical compound CCON=O QQZWEECEMNQSTG-UHFFFAOYSA-N 0.000 claims description 5
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 5
- 239000012442 inert solvent Substances 0.000 claims description 2
- 238000006243 chemical reaction Methods 0.000 description 10
- HIXDQWDOVZUNNA-UHFFFAOYSA-N 2-(3,4-dimethoxyphenyl)-5-hydroxy-7-methoxychromen-4-one Chemical compound C=1C(OC)=CC(O)=C(C(C=2)=O)C=1OC=2C1=CC=C(OC)C(OC)=C1 HIXDQWDOVZUNNA-UHFFFAOYSA-N 0.000 description 7
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- 238000002844 melting Methods 0.000 description 3
- 230000008018 melting Effects 0.000 description 3
- 229910052708 sodium Inorganic materials 0.000 description 3
- 239000011734 sodium Substances 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- 239000000376 reactant Substances 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- BTJIUGUIPKRLHP-UHFFFAOYSA-N 4-nitrophenol Chemical compound OC1=CC=C([N+]([O-])=O)C=C1 BTJIUGUIPKRLHP-UHFFFAOYSA-N 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 150000001350 alkyl halides Chemical class 0.000 description 1
- 150000001555 benzenes Chemical class 0.000 description 1
- 125000004218 chloromethyl group Chemical group [H]C([H])(Cl)* 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 125000005909 ethyl alcohol group Chemical group 0.000 description 1
- QFXZANXYUCUTQH-UHFFFAOYSA-N ethynol Chemical compound OC#C QFXZANXYUCUTQH-UHFFFAOYSA-N 0.000 description 1
- 238000007429 general method Methods 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 238000006396 nitration reaction Methods 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 239000012495 reaction gas Substances 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C43/00—Ethers; Compounds having groups, groups or groups
- C07C43/02—Ethers
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Priority Applications (5)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DED53404A DE1294948B (de) | 1967-06-22 | 1967-06-22 | Verfahren zur Herstellung von AEthyl-(6-oxy-3, 5-dinitrobenzyl)-aether |
| FR1571688D FR1571688A (ref) | 1967-06-22 | 1968-06-20 | |
| LU56304D LU56304A1 (ref) | 1967-06-22 | 1968-06-20 | |
| BE716980D BE716980A (ref) | 1967-06-22 | 1968-06-21 | |
| NL6808764A NL6808764A (ref) | 1967-06-22 | 1968-06-21 |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DED53404A DE1294948B (de) | 1967-06-22 | 1967-06-22 | Verfahren zur Herstellung von AEthyl-(6-oxy-3, 5-dinitrobenzyl)-aether |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1294948B true DE1294948B (de) | 1969-05-14 |
Family
ID=7054943
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DED53404A Pending DE1294948B (de) | 1967-06-22 | 1967-06-22 | Verfahren zur Herstellung von AEthyl-(6-oxy-3, 5-dinitrobenzyl)-aether |
Country Status (5)
| Country | Link |
|---|---|
| BE (1) | BE716980A (ref) |
| DE (1) | DE1294948B (ref) |
| FR (1) | FR1571688A (ref) |
| LU (1) | LU56304A1 (ref) |
| NL (1) | NL6808764A (ref) |
-
1967
- 1967-06-22 DE DED53404A patent/DE1294948B/de active Pending
-
1968
- 1968-06-20 FR FR1571688D patent/FR1571688A/fr not_active Expired
- 1968-06-20 LU LU56304D patent/LU56304A1/xx unknown
- 1968-06-21 NL NL6808764A patent/NL6808764A/xx unknown
- 1968-06-21 BE BE716980D patent/BE716980A/xx unknown
Non-Patent Citations (1)
| Title |
|---|
| None * |
Also Published As
| Publication number | Publication date |
|---|---|
| LU56304A1 (ref) | 1968-09-30 |
| BE716980A (ref) | 1968-12-02 |
| NL6808764A (ref) | 1968-12-23 |
| FR1571688A (ref) | 1969-06-20 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0001082A1 (de) | Verfahren zur Herstellung von Dialkylcarbonaten | |
| DE1173457B (de) | Verfahren zur Herstellung von Acetylenalkoholen | |
| DE3207746A1 (de) | Verfahren zur herstellung von trimethylolpropan | |
| CH620892A5 (en) | Process for the preparation of novel 3,6-dimethyl-hepten-1-yl esters | |
| DE1294948B (de) | Verfahren zur Herstellung von AEthyl-(6-oxy-3, 5-dinitrobenzyl)-aether | |
| DE2060218B2 (de) | Verfahren zur Herstellung von 1 -Phenyl-vinyl-1 -phosphonsäure | |
| DE2302843A1 (de) | Verfahren zur herstellung von biseckige klammer auf di(-halogenalkyl)phosphorsaeure eckige klammer zu -polyaethylenglykolestern | |
| DE69318188T3 (de) | Synthese von vinylestern | |
| DE2623836B2 (de) | Verfahren zur Herstellung von Quadratsäure | |
| DE919465C (de) | Verfahren zur Herstellung von Orthocarbonsaeureestern | |
| DE2345360A1 (de) | Verfahren zur herstellung von transchrysanthemummonocarbonsaeure und deren alkylestern | |
| DE2145660C3 (de) | Verfahren zur Herstellung von Acetondicarbonsäureestern | |
| DE2601782C3 (de) | Verfahren zur Herstellung von o-Dialkylaminomethylphenolen | |
| EP0110432A1 (de) | Verfahren zur Herstellung von Fluoren-9-carbonsäure | |
| DE2907773A1 (de) | Verfahren zur herstellung von diazinon | |
| DE1768869A1 (de) | Verfahren zur Herstellung von Perfluorpropan-2-sulfonylfluorid | |
| DE2345788A1 (de) | Verfahren zur herstellung eines alkylhalogennitrobenzoats in verbesserter ausbeute | |
| DE1940705C3 (de) | Verfahren zur Herstellung von Cyanacetylen aus Acrylnitril | |
| AT247297B (de) | Verfahren zur Herstellung von Alkinolen | |
| AT225359B (de) | Verfahren zur Herstellung des neuen 17-β-Oxy-17-α-methylandrostan-(3, 2, -c)-iso-oxazols | |
| DE912810C (de) | Verfahren zur Herstellung von monomeren Vinylestern | |
| AT276340B (de) | Verfahren zur Herstellung von neuen, gegebenenfalls verätherten Mono- und Dimethylolfluoralkanamiden | |
| DE954238C (de) | Verfahren zur Herstellung von Fluoralkanen durch chemische Reduktion von Dichlordifluormethan | |
| DE1670214B2 (de) | Verfahren zur herstellung von tris- (n-beta-hydroxyalkyl)-isocyanursaeuren | |
| DE2558148C2 (de) | Verfahren zur Herstellung von Bis-(N-acylaminomethyl)-äthern |