DE1292383B - Verfahren zur Herstellung von festen Polyolefinen - Google Patents
Verfahren zur Herstellung von festen PolyolefinenInfo
- Publication number
- DE1292383B DE1292383B DEG22594A DEG0022594A DE1292383B DE 1292383 B DE1292383 B DE 1292383B DE G22594 A DEG22594 A DE G22594A DE G0022594 A DEG0022594 A DE G0022594A DE 1292383 B DE1292383 B DE 1292383B
- Authority
- DE
- Germany
- Prior art keywords
- catalyst
- boron
- boron fluoride
- added
- aluminum
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 19
- 230000008569 process Effects 0.000 title claims description 12
- 239000007787 solid Substances 0.000 title claims description 5
- 229920000098 polyolefin Polymers 0.000 title claims description 3
- 238000004519 manufacturing process Methods 0.000 title description 5
- 239000003054 catalyst Substances 0.000 claims description 63
- -1 boron halide Chemical class 0.000 claims description 45
- WTEOIRVLGSZEPR-UHFFFAOYSA-N boron trifluoride Chemical compound FB(F)F WTEOIRVLGSZEPR-UHFFFAOYSA-N 0.000 claims description 33
- 229910015900 BF3 Inorganic materials 0.000 claims description 32
- 229910052796 boron Inorganic materials 0.000 claims description 23
- 150000001875 compounds Chemical class 0.000 claims description 16
- 229930195733 hydrocarbon Natural products 0.000 claims description 11
- 239000004215 Carbon black (E152) Substances 0.000 claims description 10
- 229910052723 transition metal Inorganic materials 0.000 claims description 6
- 150000003624 transition metals Chemical class 0.000 claims description 6
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 5
- 230000000737 periodic effect Effects 0.000 claims description 5
- 150000001336 alkenes Chemical class 0.000 claims description 4
- 125000005843 halogen group Chemical group 0.000 claims description 3
- 150000003623 transition metal compounds Chemical class 0.000 claims description 3
- 230000000379 polymerizing effect Effects 0.000 claims description 2
- 229920000642 polymer Polymers 0.000 description 21
- 238000006243 chemical reaction Methods 0.000 description 20
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 18
- 239000005977 Ethylene Substances 0.000 description 18
- 238000006116 polymerization reaction Methods 0.000 description 18
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 17
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 12
- 239000002904 solvent Substances 0.000 description 12
- 239000007788 liquid Substances 0.000 description 11
- 229910052782 aluminium Inorganic materials 0.000 description 10
- 238000002474 experimental method Methods 0.000 description 10
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 9
- 239000000203 mixture Substances 0.000 description 8
- 230000000694 effects Effects 0.000 description 7
- 239000004698 Polyethylene Substances 0.000 description 6
- 229920000573 polyethylene Polymers 0.000 description 6
- XJDNKRIXUMDJCW-UHFFFAOYSA-J titanium tetrachloride Chemical class Cl[Ti](Cl)(Cl)Cl XJDNKRIXUMDJCW-UHFFFAOYSA-J 0.000 description 6
- 238000005727 Friedel-Crafts reaction Methods 0.000 description 5
- MCULRUJILOGHCJ-UHFFFAOYSA-N triisobutylaluminium Chemical compound CC(C)C[Al](CC(C)C)CC(C)C MCULRUJILOGHCJ-UHFFFAOYSA-N 0.000 description 5
- 230000032683 aging Effects 0.000 description 4
- 150000004820 halides Chemical class 0.000 description 4
- 239000012429 reaction media Substances 0.000 description 4
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 3
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 3
- 230000000052 comparative effect Effects 0.000 description 3
- 239000000470 constituent Substances 0.000 description 3
- 229910052739 hydrogen Inorganic materials 0.000 description 3
- 239000001257 hydrogen Substances 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- 230000009467 reduction Effects 0.000 description 3
- 150000003839 salts Chemical class 0.000 description 3
- 229910052719 titanium Inorganic materials 0.000 description 3
- 239000010936 titanium Substances 0.000 description 3
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- KAKZBPTYRLMSJV-UHFFFAOYSA-N Butadiene Chemical compound C=CC=C KAKZBPTYRLMSJV-UHFFFAOYSA-N 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- RRHGJUQNOFWUDK-UHFFFAOYSA-N Isoprene Chemical compound CC(=C)C=C RRHGJUQNOFWUDK-UHFFFAOYSA-N 0.000 description 2
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 description 2
- MCMNRKCIXSYSNV-UHFFFAOYSA-N Zirconium dioxide Chemical compound O=[Zr]=O MCMNRKCIXSYSNV-UHFFFAOYSA-N 0.000 description 2
- 230000004913 activation Effects 0.000 description 2
- 239000012190 activator Substances 0.000 description 2
- 229910001385 heavy metal Inorganic materials 0.000 description 2
- 150000002430 hydrocarbons Chemical class 0.000 description 2
- 230000006872 improvement Effects 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- 150000002739 metals Chemical class 0.000 description 2
- 150000003254 radicals Chemical class 0.000 description 2
- KPZGRMZPZLOPBS-UHFFFAOYSA-N 1,3-dichloro-2,2-bis(chloromethyl)propane Chemical compound ClCC(CCl)(CCl)CCl KPZGRMZPZLOPBS-UHFFFAOYSA-N 0.000 description 1
- VPMNDMFOJRJQFL-UHFFFAOYSA-M 2-methylpropyl(pentyl)alumanylium chloride Chemical compound [Cl-].C(CCCC)[Al+]CC(C)C VPMNDMFOJRJQFL-UHFFFAOYSA-M 0.000 description 1
- ZSLUVFAKFWKJRC-IGMARMGPSA-N 232Th Chemical compound [232Th] ZSLUVFAKFWKJRC-IGMARMGPSA-N 0.000 description 1
- YHQXBTXEYZIYOV-UHFFFAOYSA-N 3-methylbut-1-ene Chemical compound CC(C)C=C YHQXBTXEYZIYOV-UHFFFAOYSA-N 0.000 description 1
- ZOXJGFHDIHLPTG-UHFFFAOYSA-N Boron Chemical compound [B] ZOXJGFHDIHLPTG-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- SNRUBQQJIBEYMU-UHFFFAOYSA-N Dodecane Natural products CCCCCCCCCCCC SNRUBQQJIBEYMU-UHFFFAOYSA-N 0.000 description 1
- KRHYYFGTRYWZRS-UHFFFAOYSA-M Fluoride anion Chemical compound [F-] KRHYYFGTRYWZRS-UHFFFAOYSA-M 0.000 description 1
- 241001481828 Glyptocephalus cynoglossus Species 0.000 description 1
- 241001026509 Kata Species 0.000 description 1
- 241000158147 Sator Species 0.000 description 1
- 229910052776 Thorium Inorganic materials 0.000 description 1
- 150000001242 acetic acid derivatives Chemical class 0.000 description 1
- 125000005595 acetylacetonate group Chemical group 0.000 description 1
- 150000001335 aliphatic alkanes Chemical class 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- BXILREUWHCQFES-UHFFFAOYSA-K aluminum;trichloride;hydrochloride Chemical compound [Al+3].Cl.[Cl-].[Cl-].[Cl-] BXILREUWHCQFES-UHFFFAOYSA-K 0.000 description 1
- 150000001450 anions Chemical class 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 150000005840 aryl radicals Chemical class 0.000 description 1
- 239000012298 atmosphere Substances 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- SIPUZPBQZHNSDW-UHFFFAOYSA-N bis(2-methylpropyl)aluminum Chemical compound CC(C)C[Al]CC(C)C SIPUZPBQZHNSDW-UHFFFAOYSA-N 0.000 description 1
- ILAHWRKJUDSMFH-UHFFFAOYSA-N boron tribromide Chemical compound BrB(Br)Br ILAHWRKJUDSMFH-UHFFFAOYSA-N 0.000 description 1
- 150000001649 bromium compounds Chemical class 0.000 description 1
- HKZIBCOTDNVXOJ-UHFFFAOYSA-M bromo(cyclohexyl)alumane Chemical compound C1(CCCCC1)[AlH]Br HKZIBCOTDNVXOJ-UHFFFAOYSA-M 0.000 description 1
- SVOZEWXYCOBNAY-UHFFFAOYSA-M bromo(dioctyl)alumane Chemical compound [Br-].CCCCCCCC[Al+]CCCCCCCC SVOZEWXYCOBNAY-UHFFFAOYSA-M 0.000 description 1
- JKFJJYOIWGFQGI-UHFFFAOYSA-M bromo-bis(2-methylpropyl)alumane Chemical compound [Br-].CC(C)C[Al+]CC(C)C JKFJJYOIWGFQGI-UHFFFAOYSA-M 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- AADZNFQUVNJLBE-UHFFFAOYSA-N cyclohexyl(dipropyl)alumane Chemical compound CCC[Al](CCC)C1CCCCC1 AADZNFQUVNJLBE-UHFFFAOYSA-N 0.000 description 1
- WAUAJTBCLLNWQZ-UHFFFAOYSA-L dibromo(2-methylpropyl)alumane Chemical compound [Br-].[Br-].CC(C)C[Al+2] WAUAJTBCLLNWQZ-UHFFFAOYSA-L 0.000 description 1
- VJRUISVXILMZSL-UHFFFAOYSA-M dibutylalumanylium;chloride Chemical compound CCCC[Al](Cl)CCCC VJRUISVXILMZSL-UHFFFAOYSA-M 0.000 description 1
- 150000001993 dienes Chemical class 0.000 description 1
- GNPSMYTXIPVJDU-UHFFFAOYSA-N dioctylalumane Chemical compound C(CCCCCCC)[AlH]CCCCCCCC GNPSMYTXIPVJDU-UHFFFAOYSA-N 0.000 description 1
- ZMXPNWBFRPIZFV-UHFFFAOYSA-M dipropylalumanylium;chloride Chemical compound [Cl-].CCC[Al+]CCC ZMXPNWBFRPIZFV-UHFFFAOYSA-M 0.000 description 1
- YDFXTLSJZBYFPR-UHFFFAOYSA-N ditert-butyl(phenyl)alumane Chemical compound C(C)(C)(C)[Al](C1=CC=CC=C1)C(C)(C)C YDFXTLSJZBYFPR-UHFFFAOYSA-N 0.000 description 1
- 125000003438 dodecyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 125000000816 ethylene group Chemical class [H]C([H])([*:1])C([H])([H])[*:2] 0.000 description 1
- 210000003608 fece Anatomy 0.000 description 1
- 150000002222 fluorine compounds Chemical class 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 230000000977 initiatory effect Effects 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 150000004694 iodide salts Chemical class 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 239000010871 livestock manure Substances 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 150000002736 metal compounds Chemical class 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 150000002823 nitrates Chemical class 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 150000002894 organic compounds Chemical class 0.000 description 1
- 150000003891 oxalate salts Chemical class 0.000 description 1
- 125000004817 pentamethylene group Chemical class [H]C([H])([*:2])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[*:1] 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- GEJUFTHBORQCNQ-UHFFFAOYSA-N phenylalumane Chemical compound [AlH2]c1ccccc1 GEJUFTHBORQCNQ-UHFFFAOYSA-N 0.000 description 1
- 125000000286 phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- 239000006187 pill Substances 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 239000000243 solution Substances 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 125000000383 tetramethylene group Chemical group [H]C([H])([*:1])C([H])([H])C([H])([H])C([H])([H])[*:2] 0.000 description 1
- 150000003568 thioethers Chemical class 0.000 description 1
- FAQYAMRNWDIXMY-UHFFFAOYSA-N trichloroborane Chemical compound ClB(Cl)Cl FAQYAMRNWDIXMY-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F10/00—Homopolymers and copolymers of unsaturated aliphatic hydrocarbons having only one carbon-to-carbon double bond
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Transition And Organic Metals Composition Catalysts For Addition Polymerization (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US610267A US2922782A (en) | 1956-09-17 | 1956-09-17 | Olefin polymerization process using catalyst obtained by mixing a reducible heavy metal compound and a reducing metal-containing compound and promoted by a boron halide |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1292383B true DE1292383B (de) | 1969-04-10 |
Family
ID=24444360
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEG22594A Pending DE1292383B (de) | 1956-09-17 | 1957-07-20 | Verfahren zur Herstellung von festen Polyolefinen |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US2922782A (enPDFPhase) |
| BE (1) | BE559368A (enPDFPhase) |
| DE (1) | DE1292383B (enPDFPhase) |
| FR (1) | FR1178670A (enPDFPhase) |
| GB (1) | GB839398A (enPDFPhase) |
| NL (2) | NL106201C (enPDFPhase) |
Families Citing this family (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH392891A (de) * | 1959-03-04 | 1965-05-31 | Dynamit Nobel Ag | Verfahren zum Polymerisieren von Monoolefinen zu hochmolekularen kunststoffartigen Polymerisaten unter Verwendung eines Dreikomponentenkatalysators |
| US3196138A (en) * | 1961-09-05 | 1965-07-20 | Firestone Tire & Rubber Co | Three-component catalyst for olefin polymerization containing alkali metal sulfide, titanium halide and tetrakis (dihydrocarbonamino) silane |
| US3303239A (en) * | 1963-12-23 | 1967-02-07 | Phillips Petroleum Co | Olefin polymerization |
| US3444153A (en) * | 1965-08-16 | 1969-05-13 | Phillips Petroleum Co | Polymerization process and catalyst for olefins |
| DE1745019B1 (de) * | 1966-12-26 | 1972-01-05 | Japan Synthetic Rubber Co Ltd | Verfahren zur herstellung von cis 1,4 polyisopren von hohem molekulargewicht |
| US4379758A (en) * | 1980-12-24 | 1983-04-12 | Union Carbide Corporation | Catalyst composition for polymerizing ethylene |
| CA1193798A (en) * | 1981-12-31 | 1985-09-17 | Frederick J. Karol | Process for copolymerizing ethylene |
| US4508842A (en) * | 1983-03-29 | 1985-04-02 | Union Carbide Corporation | Ethylene polymerization using supported vanadium catalyst |
| US5254629A (en) * | 1988-11-30 | 1993-10-19 | Shell Oil Company | Polymerization of cyclic olefins |
| US5369195A (en) * | 1988-11-30 | 1994-11-29 | Shell Oil Company | Polymerization of cyclic olefins |
| JP3383998B2 (ja) * | 1992-08-06 | 2003-03-10 | 東ソー株式会社 | ポリオレフィンの製造方法 |
| US6613712B1 (en) * | 1999-11-24 | 2003-09-02 | Phillips Petroleum Company | Organometal catalyst compositions with solid oxide supports treated with fluorine and boron |
Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE543941A (enPDFPhase) * | 1954-12-24 |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2404788A (en) * | 1941-10-22 | 1946-07-30 | Standard Oil Co | Polymerizing olefins |
| DE973626C (de) * | 1953-11-17 | 1960-04-14 | Karl Dr Dr E H Ziegler | Verfahren zur Herstellung von hochmolekularen Polyaethylenen |
-
0
- NL NL218674D patent/NL218674A/xx unknown
- NL NL106201D patent/NL106201C/xx active
- BE BE559368D patent/BE559368A/xx unknown
-
1956
- 1956-09-17 US US610267A patent/US2922782A/en not_active Expired - Lifetime
-
1957
- 1957-06-19 GB GB19288/57A patent/GB839398A/en not_active Expired
- 1957-07-05 FR FR1178670D patent/FR1178670A/fr not_active Expired
- 1957-07-20 DE DEG22594A patent/DE1292383B/de active Pending
Patent Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE543941A (enPDFPhase) * | 1954-12-24 |
Also Published As
| Publication number | Publication date |
|---|---|
| NL218674A (enPDFPhase) | |
| BE559368A (enPDFPhase) | |
| FR1178670A (fr) | 1959-05-13 |
| GB839398A (en) | 1960-06-29 |
| NL106201C (enPDFPhase) | |
| US2922782A (en) | 1960-01-26 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2802517C2 (enPDFPhase) | ||
| DE2707830C3 (de) | Verfahren zur Dimerisierung oder Codimerisierung von α -Olefinen | |
| DE2324766C2 (de) | Verfahren zur Niederdruckpolymerisation von α-Olefinen mit 2 bis 6 Kohlenstoffatomen | |
| DE2146685B2 (de) | Verfahren zur Polymerisation von Äthylen und Katalysator zur Durchführung dieses Verfahrens | |
| DE68921647T2 (de) | Katalysatorzusammensetzung zur Herstellung von Alpha-olefin-polymeren mit enger Molekulargewichtsverteilung. | |
| DE2231982A1 (de) | Verfahren zum polymerisieren von olefinen und hierfuer verwendeter katalysator | |
| DE2543437A1 (de) | Verfahren zur niederdruckpolymerisation von alpha-olefinen | |
| DE1292383B (de) | Verfahren zur Herstellung von festen Polyolefinen | |
| EP0002221A1 (de) | Verfahren zur Herstellung eines Mischkatalysators und seine Verwendung zur Polymerisation von 1-Olefinen | |
| DE2001549A1 (de) | Verfahren zur Herstellung von Olefinpolymerisaten | |
| DE2216357C2 (de) | Verfahren zur Herstellung von Katalysatoren für die Polymerisation und Copolymerisation von Olefinen und Verwendung dieser Katalysatoren zur Äthylenpolymerisation | |
| DE2703911C2 (de) | Verfahren zur Herstellung eines Katalysators, der in Kombination mit einem aluminiumorganischen Cokatalysator für die Polymersisation von α-Olefinen mit 2 bis 10 Kohlenstoffatomen geeignet ist | |
| DD232054A5 (de) | Verfahren zur olefinpolymerisation | |
| DE2146688C3 (de) | Verfahren zur Polymerisation von Äthylen und Katalysator zur Durchführung dieses Verfahrens | |
| DE1113311B (de) | Verfahren zur Polymerisation von Butadien | |
| DE2807361C2 (de) | Verfahren zur Herstellung von Katalysatoren für die Polymerisation von alpha-Olefinen | |
| DE2521662A1 (de) | Verfahren zur herstellung von polyolefinen | |
| DE1958585C3 (de) | Verfahren zur Herstellung von Äthylenhomopolymerisaten oder -copolymerisaten mit a-Olefinen | |
| DE69228200T2 (de) | Verfahren zur herstellung einer prokatalysator-zusammensetzung durch impregnieren eines trägers mit magnesium-alkoxid, titan-alkoxid und einer alkohollösung | |
| DE1957815A1 (de) | Verfahren zur Herstellung von linearem Polyaethylen | |
| DE10124955A1 (de) | Magnesiumchlorid-Alkohol-Träger und daraus hergestellte Olefin-Polymerisationskatalysator-Verbindungen | |
| DE2441625A1 (de) | Verfahren zur niederdruckpolymerisation von alpha-olefinen | |
| DE2115995A1 (de) | Verfahren zur Herstellung von Olefinpolymerisaten | |
| DE2024558A1 (de) | Verfahren zur Herstellung eines Katalysators für die Olefinpolymerisation | |
| DE2128760A1 (de) | Verfahren zur Polymerisation von Olefinen |