DE1291697B - Frottierwebstuhl - Google Patents
FrottierwebstuhlInfo
- Publication number
- DE1291697B DE1291697B DEC43399A DEC0043399A DE1291697B DE 1291697 B DE1291697 B DE 1291697B DE C43399 A DEC43399 A DE C43399A DE C0043399 A DEC0043399 A DE C0043399A DE 1291697 B DE1291697 B DE 1291697B
- Authority
- DE
- Germany
- Prior art keywords
- roller
- terry
- gear
- take
- rotations
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 239000004744 fabric Substances 0.000 claims description 42
- 230000033001 locomotion Effects 0.000 claims description 36
- 235000014676 Phragmites communis Nutrition 0.000 claims description 21
- 238000010009 beating Methods 0.000 claims 1
- 238000009941 weaving Methods 0.000 description 14
- 239000011248 coating agent Substances 0.000 description 5
- 238000000576 coating method Methods 0.000 description 5
- 238000003780 insertion Methods 0.000 description 5
- 230000037431 insertion Effects 0.000 description 5
- 241000272165 Charadriidae Species 0.000 description 4
- 238000010276 construction Methods 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 230000010355 oscillation Effects 0.000 description 2
- 101100450705 Caenorhabditis elegans hif-1 gene Proteins 0.000 description 1
- 206010038743 Restlessness Diseases 0.000 description 1
- 230000002159 abnormal effect Effects 0.000 description 1
- 230000005540 biological transmission Effects 0.000 description 1
- 210000000481 breast Anatomy 0.000 description 1
- 238000006073 displacement reaction Methods 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- 238000009434 installation Methods 0.000 description 1
- 210000003127 knee Anatomy 0.000 description 1
- WIIZEEPFHXAUND-UHFFFAOYSA-N n-[[4-[2-(dimethylamino)ethoxy]phenyl]methyl]-3,4,5-trimethoxybenzamide;hydron;chloride Chemical compound Cl.COC1=C(OC)C(OC)=CC(C(=O)NCC=2C=CC(OCCN(C)C)=CC=2)=C1 WIIZEEPFHXAUND-UHFFFAOYSA-N 0.000 description 1
- 230000002093 peripheral effect Effects 0.000 description 1
- 108090000623 proteins and genes Proteins 0.000 description 1
- 230000002040 relaxant effect Effects 0.000 description 1
- 238000004804 winding Methods 0.000 description 1
Classifications
-
- D—TEXTILES; PAPER
- D03—WEAVING
- D03D—WOVEN FABRICS; METHODS OF WEAVING; LOOMS
- D03D27/00—Woven pile fabrics
- D03D27/02—Woven pile fabrics wherein the pile is formed by warp or weft
- D03D27/06—Warp pile fabrics
- D03D27/08—Terry fabrics
-
- D—TEXTILES; PAPER
- D03—WEAVING
- D03C—SHEDDING MECHANISMS; PATTERN CARDS OR CHAINS; PUNCHING OF CARDS; DESIGNING PATTERNS
- D03C3/00—Jacquards
- D03C3/06—Double-lift jacquards
-
- D—TEXTILES; PAPER
- D03—WEAVING
- D03D—WOVEN FABRICS; METHODS OF WEAVING; LOOMS
- D03D39/00—Pile-fabric looms
- D03D39/22—Terry looms
- D03D39/223—Cloth control
Landscapes
- Engineering & Computer Science (AREA)
- Textile Engineering (AREA)
- Looms (AREA)
- Sheet Holders (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US624365A US3351096A (en) | 1967-03-20 | 1967-03-20 | Terry loom with fell shifting means |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1291697B true DE1291697B (de) | 1969-03-27 |
Family
ID=24501719
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEC43399A Pending DE1291697B (de) | 1967-03-20 | 1967-09-21 | Frottierwebstuhl |
Country Status (12)
| Country | Link |
|---|---|
| US (1) | US3351096A (OSRAM) |
| AT (1) | AT273837B (OSRAM) |
| BE (1) | BE704550A (OSRAM) |
| BR (1) | BR6793046D0 (OSRAM) |
| CH (1) | CH459915A (OSRAM) |
| DE (1) | DE1291697B (OSRAM) |
| DK (1) | DK131479B (OSRAM) |
| ES (1) | ES345102A1 (OSRAM) |
| GB (1) | GB1168308A (OSRAM) |
| NL (1) | NL6713261A (OSRAM) |
| NO (1) | NO121654B (OSRAM) |
| SE (1) | SE331460B (OSRAM) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3422860A (en) * | 1967-07-18 | 1969-01-21 | Callaway Mills Co | Unidirectional braking means for terry loom pile warp let-off mechanism |
| US3521676A (en) * | 1968-02-15 | 1970-07-28 | Fieldcrest Mills Inc | Gripper loom for weaving pile fabrics and method |
| US3570547A (en) * | 1969-06-19 | 1971-03-16 | Cannon Mills Co | Ground warp shifting means for terry looms |
| CN103437044B (zh) * | 2013-08-02 | 2015-04-22 | 经纬纺织机械股份有限公司 | 一种具备机械自锁功能的毛巾织机起毛圈机构及织造方法 |
Citations (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE223491C (OSRAM) * | ||||
| DE285603C (OSRAM) * | ||||
| US1833884A (en) * | 1931-02-26 | 1931-11-24 | Draper Corp | Loom for weaving thick and thin striped fabrics |
| US1833046A (en) * | 1931-02-26 | 1931-11-24 | Draper Corp | Loom for weaving thick and thin striped fabric |
| CH169008A (de) * | 1933-03-14 | 1934-05-15 | Rueti Ag Maschf | Verfahren und Vorrichtung zur Herstellung von Frottiergeweben. |
Family Cites Families (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US1737688A (en) * | 1929-12-03 | Setts | ||
| US847608A (en) * | 1906-01-17 | 1907-03-19 | Draper Co | Take-up mechanism for looms. |
| US953664A (en) * | 1909-05-13 | 1910-03-29 | Crompton & Knowles Loom Works | Let-off mechanism for looms. |
| US1257706A (en) * | 1916-01-18 | 1918-02-26 | Draper Corp | Take-up mechanism for looms. |
| US1266267A (en) * | 1917-04-14 | 1918-05-14 | Herman L Hohlfeld | Terry-loom. |
| US1595289A (en) * | 1924-12-30 | 1926-08-10 | Crompton & Knowles Loom Works | Terry-pile-fabric loom |
| US1940366A (en) * | 1932-07-13 | 1933-12-19 | Bibb Mfg Company | Loom |
| US1963808A (en) * | 1933-09-18 | 1934-06-19 | Draper Corp | Loom take-up mechanism |
| US2021432A (en) * | 1934-08-07 | 1935-11-19 | Crompton & Knowles Loom Works | Loom take-up mechanism |
| US2951508A (en) * | 1958-08-21 | 1960-09-06 | Bruce B Purdy | Beat line control for looms |
| US3130756A (en) * | 1961-01-05 | 1964-04-28 | Fieldcrest Mills Inc | Terry motion for looms |
| US3168115A (en) * | 1962-09-20 | 1965-02-02 | Raymond Dev Ind Inc | Warp control mechanism for looms |
| US3160177A (en) * | 1963-05-10 | 1964-12-08 | Southern Machinery Co | Irregular warp feed mechanism |
-
1967
- 1967-03-20 US US624365A patent/US3351096A/en not_active Expired - Lifetime
- 1967-08-15 GB GB37441/67A patent/GB1168308A/en not_active Expired
- 1967-08-28 NO NO169528A patent/NO121654B/no unknown
- 1967-09-01 AT AT805667A patent/AT273837B/de active
- 1967-09-15 ES ES345102A patent/ES345102A1/es not_active Expired
- 1967-09-19 BR BR193046/67A patent/BR6793046D0/pt unknown
- 1967-09-21 DE DEC43399A patent/DE1291697B/de active Pending
- 1967-09-28 SE SE13362/67A patent/SE331460B/xx unknown
- 1967-09-28 DK DK481867AA patent/DK131479B/da unknown
- 1967-09-29 BE BE704550D patent/BE704550A/xx not_active IP Right Cessation
- 1967-09-29 NL NL6713261A patent/NL6713261A/xx unknown
- 1967-09-29 CH CH1362567A patent/CH459915A/de unknown
Patent Citations (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE223491C (OSRAM) * | ||||
| DE285603C (OSRAM) * | ||||
| US1833884A (en) * | 1931-02-26 | 1931-11-24 | Draper Corp | Loom for weaving thick and thin striped fabrics |
| US1833046A (en) * | 1931-02-26 | 1931-11-24 | Draper Corp | Loom for weaving thick and thin striped fabric |
| CH169008A (de) * | 1933-03-14 | 1934-05-15 | Rueti Ag Maschf | Verfahren und Vorrichtung zur Herstellung von Frottiergeweben. |
Also Published As
| Publication number | Publication date |
|---|---|
| GB1168308A (en) | 1969-10-22 |
| DK131479C (OSRAM) | 1975-12-08 |
| DK131479B (da) | 1975-07-21 |
| NL6713261A (OSRAM) | 1968-09-23 |
| SE331460B (OSRAM) | 1970-12-21 |
| AT273837B (de) | 1969-08-25 |
| NO121654B (OSRAM) | 1971-03-22 |
| BE704550A (OSRAM) | 1968-03-29 |
| ES345102A1 (es) | 1969-01-01 |
| US3351096A (en) | 1967-11-07 |
| CH459915A (de) | 1968-07-15 |
| BR6793046D0 (pt) | 1973-06-14 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2162396B2 (de) | Umlenkbaum für Kettfadenscharen in Webmaschinen | |
| DE1535645C3 (de) | Webmaschine | |
| DE1291697B (de) | Frottierwebstuhl | |
| DE1965832B2 (de) | Nadelwebmaschine | |
| DE1710357B2 (de) | Vorrichtung zum periodischen Spannen und Nachlassen von Kettfäden | |
| EP0615013B1 (de) | Projektil-Breitwebmaschine | |
| DE851028C (de) | Vorrichtung zum Weben von Frottiergeweben | |
| DE14410C (de) | Neuerungen an Webstühlen | |
| DE495299C (de) | Einrichtung zur Herstellung einer festen Gewebekante fuer Webstuehle mit feststehenden Schussspulen | |
| DE1933911B1 (de) | Webmaschine mit Gewebe-Breithalter | |
| AT117293B (de) | Verfahren und Maschine zur Herstellung einer Schußkettenwirkware. | |
| DE1535763C (de) | Einrichtung zum Bewegen des Blattes eines Frottierwebstuhles | |
| DE1953470A1 (de) | Einrichtung zum Verlagern der Grundkette bei Frottierwebstuehlen | |
| DE2644902A1 (de) | Vorrichtung zum wahlweisen einfuehren von einschussgarn in das webfach eines webstuhls | |
| DE1535383C3 (de) | Vorrichtung zum Herstellen von Kettenfransen auf einer schützenlosen Webmaschine | |
| DE3205227A1 (de) | Schuetzenlose doppelwebmaschine mit doppelgreifern | |
| DE62395C (de) | Schaftmaschine für Hochfach | |
| DE708407C (de) | Webstuhl zum Herstellen mehrerer Gewebe | |
| CH198674A (de) | Schaftmaschine. | |
| DE1710599A1 (de) | Mit hoher Geschwindigkeit arbeitende Netzknuepfmaschine | |
| DE1760847A1 (de) | Vorrichtung zum Erstellen von Fadenwicklungen | |
| CH260543A (de) | Geschlossenfach-Schaftmaschine. | |
| DE60926C (de) | Kettenfadenwächter für Webstühle | |
| DE677396C (de) | Vorrichtung an Drahtwebstuehlen zum Spannen des Schussdrahtes | |
| DE582431C (de) | Axminsterteppich-Webstuhl |