DE1228717B - Hochdruck-Entladungslampe - Google Patents
Hochdruck-EntladungslampeInfo
- Publication number
- DE1228717B DE1228717B DEN23103A DEN0023103A DE1228717B DE 1228717 B DE1228717 B DE 1228717B DE N23103 A DEN23103 A DE N23103A DE N0023103 A DEN0023103 A DE N0023103A DE 1228717 B DE1228717 B DE 1228717B
- Authority
- DE
- Germany
- Prior art keywords
- discharge lamp
- pressure discharge
- discharge
- patents
- tin dioxide
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- XOLBLPGZBRYERU-UHFFFAOYSA-N tin dioxide Chemical compound O=[Sn]=O XOLBLPGZBRYERU-UHFFFAOYSA-N 0.000 claims description 16
- 230000005855 radiation Effects 0.000 claims description 14
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 claims description 8
- 229910052753 mercury Inorganic materials 0.000 claims description 7
- 229910052751 metal Inorganic materials 0.000 claims description 4
- 239000002184 metal Substances 0.000 claims description 4
- 229910001511 metal iodide Inorganic materials 0.000 claims description 4
- 229910052756 noble gas Inorganic materials 0.000 claims description 4
- -1 metals Iodides Chemical class 0.000 claims description 2
- 229910006404 SnO 2 Inorganic materials 0.000 description 3
- 150000004694 iodide salts Chemical class 0.000 description 3
- 238000001228 spectrum Methods 0.000 description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 229910052738 indium Inorganic materials 0.000 description 2
- APFVFJFRJDLVQX-UHFFFAOYSA-N indium atom Chemical compound [In] APFVFJFRJDLVQX-UHFFFAOYSA-N 0.000 description 2
- 238000005259 measurement Methods 0.000 description 2
- 150000002739 metals Chemical class 0.000 description 2
- 238000009877 rendering Methods 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 229910052716 thallium Inorganic materials 0.000 description 2
- BKVIYDNLLOSFOA-UHFFFAOYSA-N thallium Chemical compound [Tl] BKVIYDNLLOSFOA-UHFFFAOYSA-N 0.000 description 2
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- GYHNNYVSQQEPJS-UHFFFAOYSA-N Gallium Chemical compound [Ga] GYHNNYVSQQEPJS-UHFFFAOYSA-N 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- 229910052788 barium Inorganic materials 0.000 description 1
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium atom Chemical compound [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 description 1
- 230000005540 biological transmission Effects 0.000 description 1
- 229910017052 cobalt Inorganic materials 0.000 description 1
- 239000010941 cobalt Substances 0.000 description 1
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 1
- 230000004907 flux Effects 0.000 description 1
- 229910052733 gallium Inorganic materials 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- QKEOZZYXWAIQFO-UHFFFAOYSA-M mercury(1+);iodide Chemical class [Hg]I QKEOZZYXWAIQFO-UHFFFAOYSA-M 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- 150000002835 noble gases Chemical class 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01J—ELECTRIC DISCHARGE TUBES OR DISCHARGE LAMPS
- H01J61/00—Gas-discharge or vapour-discharge lamps
- H01J61/82—Lamps with high-pressure unconstricted discharge having a cold pressure > 400 Torr
- H01J61/827—Metal halide arc lamps
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01J—ELECTRIC DISCHARGE TUBES OR DISCHARGE LAMPS
- H01J61/00—Gas-discharge or vapour-discharge lamps
- H01J61/02—Details
- H01J61/12—Selection of substances for gas fillings; Specified operating pressure or temperature
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01J—ELECTRIC DISCHARGE TUBES OR DISCHARGE LAMPS
- H01J61/00—Gas-discharge or vapour-discharge lamps
- H01J61/02—Details
- H01J61/12—Selection of substances for gas fillings; Specified operating pressure or temperature
- H01J61/125—Selection of substances for gas fillings; Specified operating pressure or temperature having an halogenide as principal component
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01J—ELECTRIC DISCHARGE TUBES OR DISCHARGE LAMPS
- H01J61/00—Gas-discharge or vapour-discharge lamps
- H01J61/02—Details
- H01J61/12—Selection of substances for gas fillings; Specified operating pressure or temperature
- H01J61/18—Selection of substances for gas fillings; Specified operating pressure or temperature having a metallic vapour as the principal constituent
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01J—ELECTRIC DISCHARGE TUBES OR DISCHARGE LAMPS
- H01J61/00—Gas-discharge or vapour-discharge lamps
- H01J61/02—Details
- H01J61/30—Vessels; Containers
- H01J61/35—Vessels; Containers provided with coatings on the walls thereof; Selection of materials for the coatings
Landscapes
- Discharge Lamp (AREA)
- Discharge Lamps And Accessories Thereof (AREA)
- Physical Or Chemical Processes And Apparatus (AREA)
- Vessels And Coating Films For Discharge Lamps (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| NL277952 | 1962-05-02 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1228717B true DE1228717B (de) | 1966-11-17 |
Family
ID=19753795
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEN23103A Pending DE1228717B (de) | 1962-05-02 | 1963-04-27 | Hochdruck-Entladungslampe |
| DEN14905U Expired DE1963512U (de) | 1962-05-02 | 1963-04-27 | Strahlenquelle mit einer gasentladungslampe. |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEN14905U Expired DE1963512U (de) | 1962-05-02 | 1963-04-27 | Strahlenquelle mit einer gasentladungslampe. |
Country Status (7)
| Country | Link |
|---|---|
| BE (1) | BE631753A (enExample) |
| CH (1) | CH427080A (enExample) |
| DE (2) | DE1228717B (enExample) |
| ES (1) | ES287551A1 (enExample) |
| GB (1) | GB1012574A (enExample) |
| NL (1) | NL277952A (enExample) |
| OA (1) | OA00845A (enExample) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3331982A (en) * | 1964-10-20 | 1967-07-18 | Sylvania Electric Prod | High pressure electric discharge device having a fill including vanadium |
| US4109175A (en) * | 1976-03-19 | 1978-08-22 | Matsushita Electronics Corporation | High pressure sodium vapor discharge lamp |
| DE2926938A1 (de) | 1979-07-04 | 1981-01-22 | Rau Swf Autozubehoer | Schaltanordnung zum antrieb eines beweglichen elementes, insbesondere zum antrieb von scheiben o.dgl. in kraftfahrzeugen |
| EP1632985B1 (de) | 2004-09-07 | 2014-06-25 | OSRAM GmbH | Hochdruckentladungslampe |
Citations (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE134732C (enExample) * | ||||
| CH165991A (de) * | 1931-09-19 | 1933-12-15 | Philips Nv | Elektrische Entladungsröhre zum Aussenden von Lichtstrahlen. |
| GB415613A (en) * | 1932-11-15 | 1934-08-30 | Philips Nv | Improvements in or relating to devices comprising at least one electric discharge lamp |
| DE684577C (de) * | 1936-10-29 | 1939-12-01 | Patra Patent Treuhand | Einsockelige elektrische Metalldampfentladungslampe mit umschliessendem Waermeschutzmantel |
| CH208846A (de) * | 1938-03-11 | 1940-02-29 | Patent Treuhand Ges Fuer Elektrische Gluehlampen Mbh | Elektrische Hochdruck-Quecksilberdampflampe mit festen Glühelektroden. |
| DE902528C (de) * | 1935-11-19 | 1954-01-25 | Ulrich W Doering | Elektrische Hochdruckentladungsleuchtroehre |
| DE948897C (de) * | 1951-10-20 | 1956-09-06 | Dr Franz Skaupy | Gasentladungsfluoreszenzlampe |
| DE967658C (de) * | 1949-09-04 | 1957-12-05 | Heraeus Gmbh W C | Dampfentladungslampe |
| GB852783A (en) * | 1958-06-03 | 1960-11-02 | Gen Electric Co Ltd | Improvements in or relating to high pressure mercury vapour electric discharge lamps |
| DE1166366B (de) | 1961-10-04 | 1964-03-26 | Philips Nv | Natriumdampfentladungslampe |
| DE1196787B (de) | 1962-04-12 | 1965-07-15 | Philips Nv | Dampfentladungslampe |
-
0
- BE BE631753D patent/BE631753A/xx unknown
- NL NL277952D patent/NL277952A/xx unknown
-
1963
- 1963-04-27 DE DEN23103A patent/DE1228717B/de active Pending
- 1963-04-27 DE DEN14905U patent/DE1963512U/de not_active Expired
- 1963-04-29 CH CH534963A patent/CH427080A/de unknown
- 1963-04-29 GB GB16723/63A patent/GB1012574A/en not_active Expired
- 1963-04-30 ES ES287551A patent/ES287551A1/es not_active Expired
-
1964
- 1964-12-19 OA OA50931A patent/OA00845A/xx unknown
Patent Citations (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE134732C (enExample) * | ||||
| CH165991A (de) * | 1931-09-19 | 1933-12-15 | Philips Nv | Elektrische Entladungsröhre zum Aussenden von Lichtstrahlen. |
| GB415613A (en) * | 1932-11-15 | 1934-08-30 | Philips Nv | Improvements in or relating to devices comprising at least one electric discharge lamp |
| DE902528C (de) * | 1935-11-19 | 1954-01-25 | Ulrich W Doering | Elektrische Hochdruckentladungsleuchtroehre |
| DE684577C (de) * | 1936-10-29 | 1939-12-01 | Patra Patent Treuhand | Einsockelige elektrische Metalldampfentladungslampe mit umschliessendem Waermeschutzmantel |
| CH208846A (de) * | 1938-03-11 | 1940-02-29 | Patent Treuhand Ges Fuer Elektrische Gluehlampen Mbh | Elektrische Hochdruck-Quecksilberdampflampe mit festen Glühelektroden. |
| DE967658C (de) * | 1949-09-04 | 1957-12-05 | Heraeus Gmbh W C | Dampfentladungslampe |
| DE948897C (de) * | 1951-10-20 | 1956-09-06 | Dr Franz Skaupy | Gasentladungsfluoreszenzlampe |
| GB852783A (en) * | 1958-06-03 | 1960-11-02 | Gen Electric Co Ltd | Improvements in or relating to high pressure mercury vapour electric discharge lamps |
| DE1166366B (de) | 1961-10-04 | 1964-03-26 | Philips Nv | Natriumdampfentladungslampe |
| DE1196787B (de) | 1962-04-12 | 1965-07-15 | Philips Nv | Dampfentladungslampe |
Also Published As
| Publication number | Publication date |
|---|---|
| CH427080A (de) | 1966-12-31 |
| ES287551A1 (es) | 1963-07-16 |
| OA00845A (fr) | 1967-11-15 |
| DE1963512U (de) | 1967-07-06 |
| GB1012574A (en) | 1965-12-08 |
| BE631753A (enExample) | |
| NL277952A (enExample) |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3028405C2 (de) | Lampe mit einem Entladungsgefäß in einem äußeren Glaskolben und Verwendung dieser Lampe | |
| DE1464181A1 (de) | Elektrische Gasentladungslampe | |
| DE1940539A1 (de) | Quecksilberdampf-Hochdruckentladungslampe mit Metallhalogenidzusatz | |
| DE1217496B (de) | Quecksilberdampf-Hochdruckentladungslampe mit Metallhalogen-Zusatz | |
| DE2519377A1 (de) | Quecksilberdampf-hochdruckentladungslampe | |
| DE1764979A1 (de) | Quecksilber-Metallhalogenid-Dampflampe mit Regeneration | |
| DE2225308C3 (de) | Hochdruckgasentladungslampe | |
| DE2616893A1 (de) | Bestrahlungslampe | |
| DE2619674A1 (de) | Halogen-metalldampfentladungslampe | |
| DE1166366B (de) | Natriumdampfentladungslampe | |
| DE1228717B (de) | Hochdruck-Entladungslampe | |
| DE1489406C3 (de) | Hochdruck-Quecksilberdampf entladungslampe | |
| DE2639478A1 (de) | Hochdruckgasentladungslampe | |
| DE2106447A1 (de) | Quecksilberdampf-Hochdruckentladungslampe mit einem Zusatz von Metallhalogeniden | |
| DE2301465A1 (de) | Elektrische entladungslampe | |
| DE2225223C3 (de) | Ultraviolettlicht aussendende Quecksilberdampflampe | |
| DE1286637B (de) | Elektrische Hochdruck-Metalldampf-Entladungslampe | |
| DE3731134C2 (de) | Hochdruck-Metallhalogenidentladungslampe mit niedriger Farbtemperatur und guter Farbwiedergabe | |
| DE1001415B (de) | Entladungslampe mit farbkorrigierender Leuchtstoffschicht und Reflektor | |
| DE2722694A1 (de) | Quecksilberdampf-niederdruckentladungslampe | |
| AT233670B (de) | Lichtquelle mit einer Gasentladungsröhre | |
| DE729506C (de) | Analysenlampe mit einer ultraviolettdurchlaessigen, sichtbare Strahlen aber weitgehend abschirmenden Huelle | |
| DE2150740C3 (de) | Leuchtstofflampe hoher Intensität | |
| DE2903963A1 (de) | Entladungslampe und ihre verwendung | |
| DE975254C (de) | Leuchtstoffgemisch, insbesondere fuer eine im Strahlengang einer Hochdruckquecksilberdampfentladungslampe angeordnete Leuchtstoffschicht |