DE1225960B - Verfahren zur Herstellung eines anorganischen Photoleiters - Google Patents
Verfahren zur Herstellung eines anorganischen PhotoleitersInfo
- Publication number
- DE1225960B DE1225960B DEU7529A DEU0007529A DE1225960B DE 1225960 B DE1225960 B DE 1225960B DE U7529 A DEU7529 A DE U7529A DE U0007529 A DEU0007529 A DE U0007529A DE 1225960 B DE1225960 B DE 1225960B
- Authority
- DE
- Germany
- Prior art keywords
- temperature
- vessel
- atomic percent
- heated
- room temperature
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 12
- 238000004519 manufacturing process Methods 0.000 title claims description 7
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 11
- 229910052717 sulfur Inorganic materials 0.000 claims description 11
- 239000011593 sulfur Substances 0.000 claims description 11
- 229910052738 indium Inorganic materials 0.000 claims description 6
- APFVFJFRJDLVQX-UHFFFAOYSA-N indium atom Chemical compound [In] APFVFJFRJDLVQX-UHFFFAOYSA-N 0.000 claims description 6
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 claims description 5
- 229910052802 copper Inorganic materials 0.000 claims description 5
- 239000010949 copper Substances 0.000 claims description 5
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 4
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 claims description 4
- 229910052718 tin Inorganic materials 0.000 claims description 4
- 239000000460 chlorine Substances 0.000 claims description 3
- 238000002844 melting Methods 0.000 claims description 3
- 230000008018 melting Effects 0.000 claims description 3
- 239000000203 mixture Substances 0.000 claims description 3
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 claims description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 2
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 2
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 claims description 2
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 claims description 2
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 claims description 2
- 229910052787 antimony Inorganic materials 0.000 claims description 2
- WATWJIUSRGPENY-UHFFFAOYSA-N antimony atom Chemical compound [Sb] WATWJIUSRGPENY-UHFFFAOYSA-N 0.000 claims description 2
- 229910052785 arsenic Inorganic materials 0.000 claims description 2
- RQNWIZPPADIBDY-UHFFFAOYSA-N arsenic atom Chemical compound [As] RQNWIZPPADIBDY-UHFFFAOYSA-N 0.000 claims description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 2
- 229910052794 bromium Inorganic materials 0.000 claims description 2
- 229910052793 cadmium Inorganic materials 0.000 claims description 2
- BDOSMKKIYDKNTQ-UHFFFAOYSA-N cadmium atom Chemical compound [Cd] BDOSMKKIYDKNTQ-UHFFFAOYSA-N 0.000 claims description 2
- 229910052801 chlorine Inorganic materials 0.000 claims description 2
- 150000001875 compounds Chemical class 0.000 claims description 2
- 229910052731 fluorine Inorganic materials 0.000 claims description 2
- 239000011737 fluorine Substances 0.000 claims description 2
- 229910052732 germanium Inorganic materials 0.000 claims description 2
- GNPVGFCGXDBREM-UHFFFAOYSA-N germanium atom Chemical compound [Ge] GNPVGFCGXDBREM-UHFFFAOYSA-N 0.000 claims description 2
- PCHJSUWPFVWCPO-UHFFFAOYSA-N gold Chemical compound [Au] PCHJSUWPFVWCPO-UHFFFAOYSA-N 0.000 claims description 2
- 229910052737 gold Inorganic materials 0.000 claims description 2
- 239000010931 gold Substances 0.000 claims description 2
- 229910052740 iodine Inorganic materials 0.000 claims description 2
- 239000011630 iodine Substances 0.000 claims description 2
- 239000011133 lead Substances 0.000 claims description 2
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 claims description 2
- 229910052753 mercury Inorganic materials 0.000 claims description 2
- 229910052757 nitrogen Inorganic materials 0.000 claims description 2
- 229910052698 phosphorus Inorganic materials 0.000 claims description 2
- 239000011574 phosphorus Substances 0.000 claims description 2
- 229910052709 silver Inorganic materials 0.000 claims description 2
- 239000004332 silver Substances 0.000 claims description 2
- 239000011135 tin Substances 0.000 claims description 2
- 229910052725 zinc Inorganic materials 0.000 claims description 2
- 239000011701 zinc Substances 0.000 claims description 2
- 239000000126 substance Substances 0.000 claims 1
- GKCNVZWZCYIBPR-UHFFFAOYSA-N sulfanylideneindium Chemical compound [In]=S GKCNVZWZCYIBPR-UHFFFAOYSA-N 0.000 description 18
- 239000013078 crystal Substances 0.000 description 9
- RKTYLMNFRDHKIL-UHFFFAOYSA-N copper;5,10,15,20-tetraphenylporphyrin-22,24-diide Chemical compound [Cu+2].C1=CC(C(=C2C=CC([N-]2)=C(C=2C=CC=CC=2)C=2C=CC(N=2)=C(C=2C=CC=CC=2)C2=CC=C3[N-]2)C=2C=CC=CC=2)=NC1=C3C1=CC=CC=C1 RKTYLMNFRDHKIL-UHFFFAOYSA-N 0.000 description 5
- 239000010453 quartz Substances 0.000 description 5
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N silicon dioxide Inorganic materials O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 5
- 239000000654 additive Substances 0.000 description 4
- 239000000155 melt Substances 0.000 description 3
- 230000005855 radiation Effects 0.000 description 3
- 238000010438 heat treatment Methods 0.000 description 2
- 230000000996 additive effect Effects 0.000 description 1
- 239000003708 ampul Substances 0.000 description 1
- -1 copper cadmium arsenic antimony Phosphorus Chemical compound 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 238000001514 detection method Methods 0.000 description 1
- 238000010586 diagram Methods 0.000 description 1
- 238000004880 explosion Methods 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- 238000000265 homogenisation Methods 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000011159 matrix material Substances 0.000 description 1
- 230000035945 sensitivity Effects 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 150000003463 sulfur Chemical class 0.000 description 1
- 239000012808 vapor phase Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D241/00—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings
- C07D241/02—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings not condensed with other rings
- C07D241/06—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings not condensed with other rings having one or two double bonds between ring members or between ring members and non-ring members
- C07D241/08—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings not condensed with other rings having one or two double bonds between ring members or between ring members and non-ring members with oxygen atoms directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C01—INORGANIC CHEMISTRY
- C01G—COMPOUNDS CONTAINING METALS NOT COVERED BY SUBCLASSES C01D OR C01F
- C01G15/00—Compounds of gallium, indium or thallium
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Inorganic Chemistry (AREA)
- Crystals, And After-Treatments Of Crystals (AREA)
- Photoreceptors In Electrophotography (AREA)
- Light Receiving Elements (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US847707A US3135704A (en) | 1959-10-21 | 1959-10-21 | Photosensitive compositions and process for the production thereof |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1225960B true DE1225960B (de) | 1966-09-29 |
Family
ID=25301299
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEU7529A Pending DE1225960B (de) | 1959-10-21 | 1960-10-21 | Verfahren zur Herstellung eines anorganischen Photoleiters |
Country Status (4)
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2676111A (en) * | 1951-08-18 | 1954-04-20 | Cons Mining & Smelting Co | Phosphor composition containing indium and method of producing same |
| US2676112A (en) * | 1951-08-18 | 1954-04-20 | Cons Mining & Smelting Co | Phosphor product containing indium and method of producing same |
| US2916678A (en) * | 1954-06-23 | 1959-12-08 | Rca Corp | Single crystal photoconducting photocells and methods of preparation thereof |
| US2844543A (en) * | 1955-03-18 | 1958-07-22 | Horizons Inc | Transparent photoconductive composition |
| US2847329A (en) * | 1957-02-15 | 1958-08-12 | Lloyd E Schilberg | Sensitization of photoconductive cells by the use of indium vapor |
-
0
- NL NL257111D patent/NL257111A/xx unknown
- NL NL126722D patent/NL126722C/xx active
-
1959
- 1959-10-21 US US847707A patent/US3135704A/en not_active Expired - Lifetime
-
1960
- 1960-10-21 DE DEU7529A patent/DE1225960B/de active Pending
- 1960-10-21 GB GB36098/60A patent/GB938083A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| GB938083A (en) | 1963-09-25 |
| NL126722C (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | |
| US3135704A (en) | 1964-06-02 |
| NL257111A (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE69524458T2 (de) | Glasmatrix mit zur lumineszenz aktivierten nanokristallinen teilchen | |
| DE1290261B (de) | Szintillationskristall aus einem mit Europium aktivierten Erdalkalijodid | |
| DE1646592A1 (de) | Verfahren zur Herstellung eines temperaturempfindlichen Widerstandes auf Vanadiumoxydbasis | |
| DE3485997T2 (de) | Elektrochromes material. | |
| DE1259486B (de) | Szintillationskristall und Verfahren zu seiner Herstellung | |
| DE1619977C3 (de) | Zweifach dotiertes Galliumarsenid | |
| DE1225960B (de) | Verfahren zur Herstellung eines anorganischen Photoleiters | |
| DE2248054A1 (de) | Elektrophotographisches aufzeichnungsmaterial | |
| DE2064247C3 (de) | Elektrophotographisches Aufzeichnungsmaterial | |
| DE2141233A1 (de) | Photoleiter | |
| DE1764082C3 (de) | Verfahren zum Herstellen eines fotoleitfahigen Pulvers mit großem Dunkelwiderstand | |
| DE2923065A1 (de) | Elektrolumineszente und/oder lichterkennende dioden sowie verfahren zur herstellung dieser dioden | |
| DE903971C (de) | Photowiderstaende, beispielsweise zur Fernbilduebertragung mittels Sekundaeremission von Photowiderstaenden und Verfahren zu deren Herstellung | |
| DE2055789A1 (de) | Mit Jodid aktivierter Thallium Chlorid Szintillator | |
| DE874181C (de) | Verfahren zur Herstellung einer photoelektrisch wirksamen Verbindung | |
| DE2011791C3 (de) | Verwendung einer Cadmium-Quecksilber-Selen-Legierung als im infra roten Spektralbereich einsetzbarer photoleitender Werkstoff und Verfahren zu deren Herstellung | |
| US3133888A (en) | Production of semiconductor materials | |
| DE2307502A1 (de) | Glashuetten- und giessereiform und deren herstellungsverfahren | |
| DE1030938B (de) | Verfahren zur Herstellung einer photoleitfaehigen Schicht | |
| DE1272452B (de) | Halbleiterstrahlungsquelle aus zinkdotiertem Galliumphosphid und Verfahren zu ihrer Herstellung | |
| DE837578C (de) | Grundstoff fuer thermische Selektivstrahler und Leuchtstoffe | |
| DE2053902C (de) | Verfahren zur Herstellung eines im ultravioletten Strahlenbereich empfindlichen photoleitfähigen Materials | |
| DE2341534A1 (de) | Verfahren zur herstellung dotierter metallhalogenide | |
| DE69715931T2 (de) | Cäsium-Lithiumboratkristall | |
| DE2010706C (de) | Gesintertes, photoleitendes Element und Verfahren zu seiner Herstellung |