DE1215143B - Verfahren zur Herstellung von Sulfonylcarbodiimiden - Google Patents
Verfahren zur Herstellung von SulfonylcarbodiimidenInfo
- Publication number
- DE1215143B DE1215143B DEF43707A DEF0043707A DE1215143B DE 1215143 B DE1215143 B DE 1215143B DE F43707 A DEF43707 A DE F43707A DE F0043707 A DEF0043707 A DE F0043707A DE 1215143 B DE1215143 B DE 1215143B
- Authority
- DE
- Germany
- Prior art keywords
- isocyanide
- sulfonylcarbodiimides
- general formula
- sulfonyl
- inert solvent
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 5
- 125000004663 dialkyl amino group Chemical group 0.000 claims description 5
- LAIJUWKQSLRUBE-UHFFFAOYSA-N sulfuryl diisocyanide Chemical compound [C-]#[N+]S(=O)(=O)[N+]#[C-] LAIJUWKQSLRUBE-UHFFFAOYSA-N 0.000 claims description 4
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 claims description 3
- 239000002253 acid Substances 0.000 claims description 3
- 150000001718 carbodiimides Chemical class 0.000 claims description 3
- 239000012442 inert solvent Substances 0.000 claims description 3
- 239000008096 xylene Substances 0.000 claims description 3
- XFXPMWWXUTWYJX-UHFFFAOYSA-N Cyanide Chemical compound N#[C-] XFXPMWWXUTWYJX-UHFFFAOYSA-N 0.000 claims description 2
- 125000001931 aliphatic group Chemical group 0.000 claims description 2
- 125000003545 alkoxy group Chemical group 0.000 claims description 2
- 125000000217 alkyl group Chemical group 0.000 claims description 2
- 125000004414 alkyl thio group Chemical group 0.000 claims description 2
- 229910052736 halogen Inorganic materials 0.000 claims description 2
- 125000005843 halogen group Chemical group 0.000 claims description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 2
- 125000002924 primary amino group Chemical class [H]N([H])* 0.000 claims 2
- 150000003839 salts Chemical class 0.000 claims 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 7
- -1 acids Salts Chemical class 0.000 description 7
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- 238000006243 chemical reaction Methods 0.000 description 4
- YVBIXTNWJQVGJP-UHFFFAOYSA-N 1-isocyanosulfonyl-2-methylbenzene Chemical compound CC1=CC=CC=C1S(=O)(=O)[N+]#[C-] YVBIXTNWJQVGJP-UHFFFAOYSA-N 0.000 description 3
- HAAZMOAXEMIBAJ-UHFFFAOYSA-N 4-chloro-2-methylquinazoline Chemical compound C1=CC=CC2=NC(C)=NC(Cl)=C21 HAAZMOAXEMIBAJ-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 2
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 2
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- OCJBOOLMMGQPQU-UHFFFAOYSA-N 1,4-dichlorobenzene Chemical compound ClC1=CC=C(Cl)C=C1 OCJBOOLMMGQPQU-UHFFFAOYSA-N 0.000 description 1
- WVRVMUKRNBBJBF-UHFFFAOYSA-N 1-chloro-2-isocyanosulfonylbenzene Chemical compound ClC1=CC=CC=C1S(=O)(=O)[N+]#[C-] WVRVMUKRNBBJBF-UHFFFAOYSA-N 0.000 description 1
- SHRYMZREDDZYQY-UHFFFAOYSA-N 1-chloro-4-isocyanosulfonylbenzene Chemical compound ClC1=CC=C(C=C1)S(=O)(=O)[N+]#[C-] SHRYMZREDDZYQY-UHFFFAOYSA-N 0.000 description 1
- IZBZQUREHISXFJ-UHFFFAOYSA-N 2-[4-chloro-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]acetic acid Chemical compound CC1=C(Cl)C(C(F)(F)F)=NN1CC(O)=O IZBZQUREHISXFJ-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- RLAROPIDCNCRNR-UHFFFAOYSA-N Cl.Cl.[C-]#N Chemical class Cl.Cl.[C-]#N RLAROPIDCNCRNR-UHFFFAOYSA-N 0.000 description 1
- SNRUBQQJIBEYMU-UHFFFAOYSA-N Dodecane Natural products CCCCCCCCCCCC SNRUBQQJIBEYMU-UHFFFAOYSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 1
- MMCPOSDMTGQNKG-UHFFFAOYSA-N anilinium chloride Chemical compound Cl.NC1=CC=CC=C1 MMCPOSDMTGQNKG-UHFFFAOYSA-N 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 description 1
- 238000005660 chlorination reaction Methods 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 150000004985 diamines Chemical class 0.000 description 1
- 229940117389 dichlorobenzene Drugs 0.000 description 1
- 125000003438 dodecyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- SKHIBNDAFWIOPB-UHFFFAOYSA-N hydron;2-phenylethanamine;chloride Chemical compound Cl.NCCC1=CC=CC=C1 SKHIBNDAFWIOPB-UHFFFAOYSA-N 0.000 description 1
- 238000002329 infrared spectrum Methods 0.000 description 1
- YHFRNYULFUZKJG-UHFFFAOYSA-N isocyanosulfonylmethane Chemical compound CS(=O)(=O)[N+]#[C-] YHFRNYULFUZKJG-UHFFFAOYSA-N 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- KUDPGZONDFORKU-UHFFFAOYSA-N n-chloroaniline Chemical compound ClNC1=CC=CC=C1 KUDPGZONDFORKU-UHFFFAOYSA-N 0.000 description 1
- VBEGHXKAFSLLGE-UHFFFAOYSA-N n-phenylnitramide Chemical compound [O-][N+](=O)NC1=CC=CC=C1 VBEGHXKAFSLLGE-UHFFFAOYSA-N 0.000 description 1
- FOKKJVHTXPJHEN-UHFFFAOYSA-N naphthalen-1-ylazanium;chloride Chemical compound Cl.C1=CC=C2C(N)=CC=CC2=C1 FOKKJVHTXPJHEN-UHFFFAOYSA-N 0.000 description 1
- 239000003973 paint Substances 0.000 description 1
- 229940048346 phenethylamine hydrochloride Drugs 0.000 description 1
- 150000004986 phenylenediamines Chemical class 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- 125000004079 stearyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229940124530 sulfonamide Drugs 0.000 description 1
- 150000003456 sulfonamides Chemical class 0.000 description 1
- 150000004992 toluidines Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C311/00—Amides of sulfonic acids, i.e. compounds having singly-bound oxygen atoms of sulfo groups replaced by nitrogen atoms, not being part of nitro or nitroso groups
- C07C311/50—Compounds containing any of the groups, X being a hetero atom, Y being any atom
- C07C311/52—Y being a hetero atom
- C07C311/54—Y being a hetero atom either X or Y, but not both, being nitrogen atoms, e.g. N-sulfonylurea
- C07C311/57—Y being a hetero atom either X or Y, but not both, being nitrogen atoms, e.g. N-sulfonylurea having sulfur atoms of the sulfonylurea groups bound to carbon atoms of six-membered aromatic rings
- C07C311/59—Y being a hetero atom either X or Y, but not both, being nitrogen atoms, e.g. N-sulfonylurea having sulfur atoms of the sulfonylurea groups bound to carbon atoms of six-membered aromatic rings having nitrogen atoms of the sulfonylurea groups bound to carbon atoms of rings other than six-membered aromatic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C303/00—Preparation of esters or amides of sulfuric acids; Preparation of sulfonic acids or of their esters, halides, anhydrides or amides
- C07C303/36—Preparation of esters or amides of sulfuric acids; Preparation of sulfonic acids or of their esters, halides, anhydrides or amides of amides of sulfonic acids
- C07C303/40—Preparation of esters or amides of sulfuric acids; Preparation of sulfonic acids or of their esters, halides, anhydrides or amides of amides of sulfonic acids by reactions not involving the formation of sulfonamide groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C311/00—Amides of sulfonic acids, i.e. compounds having singly-bound oxygen atoms of sulfo groups replaced by nitrogen atoms, not being part of nitro or nitroso groups
- C07C311/15—Sulfonamides having sulfur atoms of sulfonamide groups bound to carbon atoms of six-membered aromatic rings
- C07C311/16—Sulfonamides having sulfur atoms of sulfonamide groups bound to carbon atoms of six-membered aromatic rings having the nitrogen atom of at least one of the sulfonamide groups bound to hydrogen atoms or to an acyclic carbon atom
- C07C311/18—Sulfonamides having sulfur atoms of sulfonamide groups bound to carbon atoms of six-membered aromatic rings having the nitrogen atom of at least one of the sulfonamide groups bound to hydrogen atoms or to an acyclic carbon atom to an acyclic carbon atom of a hydrocarbon radical substituted by nitrogen atoms, not being part of nitro or nitroso groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2601/00—Systems containing only non-condensed rings
- C07C2601/12—Systems containing only non-condensed rings with a six-membered ring
- C07C2601/14—The ring being saturated
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
Priority Applications (6)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEF43705A DE1219468B (de) | 1964-08-08 | 1964-08-08 | Verfahren zur Herstellung von N-Sulfonylharn-stoffen |
| DEF43707A DE1215143B (de) | 1964-08-08 | 1964-08-08 | Verfahren zur Herstellung von Sulfonylcarbodiimiden |
| NL6413827A NL6413827A (Direct) | 1964-08-08 | 1964-11-27 | |
| GB50311/64A GB1022040A (en) | 1964-08-08 | 1964-12-10 | Process for the preparation of sulphonyl carbodiimides and of n-sulphonyl ureas |
| FR1570409D FR1570409A (Direct) | 1964-08-08 | 1964-12-14 | |
| BE657061D BE657061A (Direct) | 1964-08-08 | 1964-12-14 |
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEF43705A DE1219468B (de) | 1964-08-08 | 1964-08-08 | Verfahren zur Herstellung von N-Sulfonylharn-stoffen |
| DEF43707A DE1215143B (de) | 1964-08-08 | 1964-08-08 | Verfahren zur Herstellung von Sulfonylcarbodiimiden |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1215143B true DE1215143B (de) | 1966-04-28 |
Family
ID=25976411
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEF43707A Pending DE1215143B (de) | 1964-08-08 | 1964-08-08 | Verfahren zur Herstellung von Sulfonylcarbodiimiden |
| DEF43705A Pending DE1219468B (de) | 1964-08-08 | 1964-08-08 | Verfahren zur Herstellung von N-Sulfonylharn-stoffen |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEF43705A Pending DE1219468B (de) | 1964-08-08 | 1964-08-08 | Verfahren zur Herstellung von N-Sulfonylharn-stoffen |
Country Status (5)
| Country | Link |
|---|---|
| BE (1) | BE657061A (Direct) |
| DE (2) | DE1215143B (Direct) |
| FR (1) | FR1570409A (Direct) |
| GB (1) | GB1022040A (Direct) |
| NL (1) | NL6413827A (Direct) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0107624A1 (de) * | 1982-10-25 | 1984-05-02 | Ciba-Geigy Ag | Verfahren zur Herstellung von herbizid wirksamen und den Pflanzenwuchs regulierenden Sulfonylharnstoffen |
-
1964
- 1964-08-08 DE DEF43707A patent/DE1215143B/de active Pending
- 1964-08-08 DE DEF43705A patent/DE1219468B/de active Pending
- 1964-11-27 NL NL6413827A patent/NL6413827A/xx unknown
- 1964-12-10 GB GB50311/64A patent/GB1022040A/en not_active Expired
- 1964-12-14 FR FR1570409D patent/FR1570409A/fr not_active Expired
- 1964-12-14 BE BE657061D patent/BE657061A/xx unknown
Non-Patent Citations (1)
| Title |
|---|
| None * |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0107624A1 (de) * | 1982-10-25 | 1984-05-02 | Ciba-Geigy Ag | Verfahren zur Herstellung von herbizid wirksamen und den Pflanzenwuchs regulierenden Sulfonylharnstoffen |
| US4629802A (en) * | 1982-10-25 | 1986-12-16 | Ciba-Geigy Corporation | Sulfonyl carbonoimidates |
Also Published As
| Publication number | Publication date |
|---|---|
| GB1022040A (en) | 1966-03-09 |
| BE657061A (Direct) | 1965-04-01 |
| DE1219468B (de) | 1966-06-23 |
| NL6413827A (Direct) | 1966-02-09 |
| FR1570409A (Direct) | 1969-06-13 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1231690B (de) | Verfahren zur Herstellung von N, N-Dibenzylsulfamiden | |
| DE1215143B (de) | Verfahren zur Herstellung von Sulfonylcarbodiimiden | |
| DE1251330B (de) | Verfahren zur Herstellung von Nickel Amm Komplexen von 2 2 -Thiobis (p alkylphenolen) | |
| EP0173202B1 (de) | Verfahren zur Herstellung von Chlor-o-nitroanilinen | |
| DE2214512A1 (Direct) | ||
| DE2256740C3 (de) | Verfahren zur Herstellung von N-(Diäthylaminoäthyl)-2-methoxy-5-methylsulfonyl-benzamid | |
| DE1966562A1 (de) | 2,4'-dicyclohexyldiamin und seine verwendung bei der herstellung von polyurethanen | |
| DE2307263C3 (de) | Verfahren zur Herstellung von Carbonsäureamiden | |
| DE1230425B (de) | Verfahren zur Herstellung von N, N'-Diaryluretedionen | |
| DE962699C (de) | Verfahren zur Herstellung choleretisch wirksamer N-Acylderivate der 2, 4, 6-Trijod-3-amino-benzoesaeure | |
| EP0064702B1 (de) | 4-tert.-Butoxybenzylamine | |
| DE1215709B (de) | Verfahren zur Herstellung von Sulfoxid-Zinnkomplexverbindungen | |
| DE1568203C (de) | Verfahren zur Herstellung von N-Phenyl-N-methyl-N-(2.3-dibrom-l-methylallyl)-harnstoffen | |
| DE1643763A1 (de) | Verfahren zur Herstellung von N-Hydroxyphenylcarbamaten | |
| DE1126392B (de) | Verfahren zur Herstellung cyclischer Harnstoffe und Thioharnstoffe | |
| DE1197089B (de) | Verfahren zur Herstellung von 2-Oxo-1, 2, 5, 6-tetrahydropyrazinen | |
| DE929249C (de) | Verfahren zum Stabilisieren von Aldehyden | |
| DE2252945A1 (de) | L-aminomethyl-acenaphthene und verfahren zu ihrer herstellung | |
| DE1219028B (de) | Verfahren zur Herstellung von neuen Zinnkomplexsalzen | |
| DE1259874B (de) | Verfahren zur Herstellung von (1-Chlor-formimidoyl)-carbamoylchloriden | |
| DE1204220B (de) | Verfahren zur Herstellung von Acylharnstoffen | |
| DE1219020B (de) | Verfahren zur Herstellung von Isoharnstoff-Derivaten | |
| DE1174758B (de) | Verfahren zur Herstellung von Thiurammonosulfiden | |
| DE2307263B2 (de) | Verfahren zur Herstellung von Carbonsäureamide n | |
| DE2232095A1 (de) | Verfahren zur herstellung von polyaminobiphenylenen |