DE1193049B - Verfahren zur Herstellung eines schwefelhaltigen Derivats des Vitamins B - Google Patents
Verfahren zur Herstellung eines schwefelhaltigen Derivats des Vitamins BInfo
- Publication number
- DE1193049B DE1193049B DEM55402A DEM0055402A DE1193049B DE 1193049 B DE1193049 B DE 1193049B DE M55402 A DEM55402 A DE M55402A DE M0055402 A DEM0055402 A DE M0055402A DE 1193049 B DE1193049 B DE 1193049B
- Authority
- DE
- Germany
- Prior art keywords
- disulfide
- formula
- pyridoxalyl
- compound
- solution
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 20
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 title claims description 3
- 229910052717 sulfur Inorganic materials 0.000 title claims description 3
- 239000011593 sulfur Substances 0.000 title claims description 3
- 229930003270 Vitamin B Natural products 0.000 title 1
- 235000019156 vitamin B Nutrition 0.000 title 1
- 239000011720 vitamin B Substances 0.000 title 1
- BWGNESOTFCXPMA-UHFFFAOYSA-N Dihydrogen disulfide Chemical compound SS BWGNESOTFCXPMA-UHFFFAOYSA-N 0.000 claims description 36
- 125000003172 aldehyde group Chemical group 0.000 claims description 16
- 150000001875 compounds Chemical class 0.000 claims description 12
- NUJOXMJBOLGQSY-UHFFFAOYSA-N manganese dioxide Chemical compound O=[Mn]=O NUJOXMJBOLGQSY-UHFFFAOYSA-N 0.000 claims description 8
- SRRKNRDXURUMPP-UHFFFAOYSA-N sodium disulfide Chemical compound [Na+].[Na+].[S-][S-] SRRKNRDXURUMPP-UHFFFAOYSA-N 0.000 claims description 7
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 claims description 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 2
- 229910052794 bromium Inorganic materials 0.000 claims description 2
- 239000000460 chlorine Substances 0.000 claims description 2
- 229910052801 chlorine Inorganic materials 0.000 claims description 2
- 229910052736 halogen Inorganic materials 0.000 claims description 2
- 150000002367 halogens Chemical group 0.000 claims description 2
- 150000003697 vitamin B6 derivatives Chemical class 0.000 claims 1
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 30
- 239000000243 solution Substances 0.000 description 14
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 12
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 11
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 10
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 10
- 238000006243 chemical reaction Methods 0.000 description 10
- 150000002500 ions Chemical class 0.000 description 8
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 7
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 6
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 6
- LXNHXLLTXMVWPM-UHFFFAOYSA-N pyridoxine Chemical compound CC1=NC=C(CO)C(CO)=C1O LXNHXLLTXMVWPM-UHFFFAOYSA-N 0.000 description 6
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 5
- 239000002253 acid Substances 0.000 description 5
- RADKZDMFGJYCBB-UHFFFAOYSA-N pyridoxal hydrochloride Natural products CC1=NC=C(CO)C(C=O)=C1O RADKZDMFGJYCBB-UHFFFAOYSA-N 0.000 description 5
- 235000017557 sodium bicarbonate Nutrition 0.000 description 5
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 5
- 229910052938 sodium sulfate Inorganic materials 0.000 description 5
- 235000011152 sodium sulphate Nutrition 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- 239000007832 Na2SO4 Substances 0.000 description 4
- 150000001241 acetals Chemical class 0.000 description 4
- 230000002378 acidificating effect Effects 0.000 description 4
- 238000003776 cleavage reaction Methods 0.000 description 4
- 230000007017 scission Effects 0.000 description 4
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical class OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 3
- WYNCHZVNFNFDNH-UHFFFAOYSA-N Oxazolidine Chemical compound C1COCN1 WYNCHZVNFNFDNH-UHFFFAOYSA-N 0.000 description 3
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical group C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 3
- 125000004036 acetal group Chemical group 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- -1 aldehyde hydrogen sulfite adducts Chemical class 0.000 description 3
- 239000006227 byproduct Substances 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 238000000354 decomposition reaction Methods 0.000 description 3
- 150000007857 hydrazones Chemical class 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 150000002923 oximes Chemical class 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- 239000011726 vitamin B6 Substances 0.000 description 3
- 235000019158 vitamin B6 Nutrition 0.000 description 3
- 229940011671 vitamin b6 Drugs 0.000 description 3
- ZILXIZUBLXVYPI-UHFFFAOYSA-N 2,4-dinitrobenzaldehyde Chemical compound [O-][N+](=O)C1=CC=C(C=O)C([N+]([O-])=O)=C1 ZILXIZUBLXVYPI-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- 239000002262 Schiff base Substances 0.000 description 2
- 150000004753 Schiff bases Chemical class 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- DHKHKXVYLBGOIT-UHFFFAOYSA-N acetaldehyde Diethyl Acetal Natural products CCOC(C)OCC DHKHKXVYLBGOIT-UHFFFAOYSA-N 0.000 description 2
- 238000005903 acid hydrolysis reaction Methods 0.000 description 2
- 239000003929 acidic solution Substances 0.000 description 2
- 150000001299 aldehydes Chemical class 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 239000008098 formaldehyde solution Substances 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 125000005597 hydrazone group Chemical group 0.000 description 2
- 230000007062 hydrolysis Effects 0.000 description 2
- 238000006460 hydrolysis reaction Methods 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 125000000160 oxazolidinyl group Chemical group 0.000 description 2
- 230000003647 oxidation Effects 0.000 description 2
- 238000007254 oxidation reaction Methods 0.000 description 2
- 230000000144 pharmacologic effect Effects 0.000 description 2
- XNGIFLGASWRNHJ-UHFFFAOYSA-N phthalic acid Chemical compound OC(=O)C1=CC=CC=C1C(O)=O XNGIFLGASWRNHJ-UHFFFAOYSA-N 0.000 description 2
- SIXLXDIJGIWWFU-UHFFFAOYSA-N pyritinol Chemical compound OCC1=C(O)C(C)=NC=C1CSSCC1=CN=C(C)C(O)=C1CO SIXLXDIJGIWWFU-UHFFFAOYSA-N 0.000 description 2
- 229960004986 pyritinol Drugs 0.000 description 2
- 230000035484 reaction time Effects 0.000 description 2
- QZAYGJVTTNCVMB-UHFFFAOYSA-N serotonin Chemical compound C1=C(O)C=C2C(CCN)=CNC2=C1 QZAYGJVTTNCVMB-UHFFFAOYSA-N 0.000 description 2
- 235000011121 sodium hydroxide Nutrition 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- DNIAPMSPPWPWGF-GSVOUGTGSA-N (R)-(-)-Propylene glycol Chemical compound C[C@@H](O)CO DNIAPMSPPWPWGF-GSVOUGTGSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- LDXJRKWFNNFDSA-UHFFFAOYSA-N 2-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)-1-[4-[2-[[3-(trifluoromethoxy)phenyl]methylamino]pyrimidin-5-yl]piperazin-1-yl]ethanone Chemical compound C1CN(CC2=NNN=C21)CC(=O)N3CCN(CC3)C4=CN=C(N=C4)NCC5=CC(=CC=C5)OC(F)(F)F LDXJRKWFNNFDSA-UHFFFAOYSA-N 0.000 description 1
- WZFUQSJFWNHZHM-UHFFFAOYSA-N 2-[4-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]piperazin-1-yl]-1-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)ethanone Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)N1CCN(CC1)CC(=O)N1CC2=C(CC1)NN=N2 WZFUQSJFWNHZHM-UHFFFAOYSA-N 0.000 description 1
- APLNAFMUEHKRLM-UHFFFAOYSA-N 2-[5-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]-1,3,4-oxadiazol-2-yl]-1-(3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl)ethanone Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)C1=NN=C(O1)CC(=O)N1CC2=C(CC1)N=CN2 APLNAFMUEHKRLM-UHFFFAOYSA-N 0.000 description 1
- PEUVIOZMKDYCBM-UHFFFAOYSA-N 5-(chloromethyl)-3-hydroxy-2-methylpyridine-4-carbaldehyde Chemical compound ClCC=1C=NC(=C(C1C=O)O)C PEUVIOZMKDYCBM-UHFFFAOYSA-N 0.000 description 1
- JDMDYOBFUXONPT-UHFFFAOYSA-N 5-(chloromethyl)-4-(diethoxymethyl)-2-methylpyridin-3-ol Chemical compound ClCC=1C=NC(=C(C1C(OCC)OCC)O)C JDMDYOBFUXONPT-UHFFFAOYSA-N 0.000 description 1
- CONKBQPVFMXDOV-QHCPKHFHSA-N 6-[(5S)-5-[[4-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]piperazin-1-yl]methyl]-2-oxo-1,3-oxazolidin-3-yl]-3H-1,3-benzoxazol-2-one Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)N1CCN(CC1)C[C@H]1CN(C(O1)=O)C1=CC2=C(NC(O2)=O)C=C1 CONKBQPVFMXDOV-QHCPKHFHSA-N 0.000 description 1
- DEXFNLNNUZKHNO-UHFFFAOYSA-N 6-[3-[4-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]piperidin-1-yl]-3-oxopropyl]-3H-1,3-benzoxazol-2-one Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)C1CCN(CC1)C(CCC1=CC2=C(NC(O2)=O)C=C1)=O DEXFNLNNUZKHNO-UHFFFAOYSA-N 0.000 description 1
- YHOUBPPSSAANHP-UHFFFAOYSA-N 6-methylthieno[3,4-c]pyridin-7-ol Chemical compound OC1=C(C)N=CC2=CSC=C21 YHOUBPPSSAANHP-UHFFFAOYSA-N 0.000 description 1
- 208000019901 Anxiety disease Diseases 0.000 description 1
- 206010003840 Autonomic nervous system imbalance Diseases 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- LSDPWZHWYPCBBB-UHFFFAOYSA-N Methanethiol Chemical compound SC LSDPWZHWYPCBBB-UHFFFAOYSA-N 0.000 description 1
- 208000012902 Nervous system disease Diseases 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-N Sulfurous acid Chemical group OS(O)=O LSNNMFCWUKXFEE-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- 238000010306 acid treatment Methods 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 230000000202 analgesic effect Effects 0.000 description 1
- 230000001773 anti-convulsant effect Effects 0.000 description 1
- 230000036506 anxiety Effects 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 210000004556 brain Anatomy 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 150000001728 carbonyl compounds Chemical class 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- 230000000095 emetic effect Effects 0.000 description 1
- 229960002179 ephedrine Drugs 0.000 description 1
- 125000001033 ether group Chemical group 0.000 description 1
- 229940079826 hydrogen sulfite Drugs 0.000 description 1
- 230000003301 hydrolyzing effect Effects 0.000 description 1
- 125000004356 hydroxy functional group Chemical group O* 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 208000030159 metabolic disease Diseases 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- DEUIOTRPOZMYNK-UHFFFAOYSA-N n-[(2,4-dinitrophenyl)methylideneamino]aniline Chemical compound [O-][N+](=O)C1=CC([N+](=O)[O-])=CC=C1C=NNC1=CC=CC=C1 DEUIOTRPOZMYNK-UHFFFAOYSA-N 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- 239000007800 oxidant agent Substances 0.000 description 1
- 125000003544 oxime group Chemical class 0.000 description 1
- 229960003581 pyridoxal Drugs 0.000 description 1
- 235000008164 pyridoxal Nutrition 0.000 description 1
- 239000011674 pyridoxal Substances 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 150000007659 semicarbazones Chemical class 0.000 description 1
- 230000001235 sensitizing effect Effects 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 238000002560 therapeutic procedure Methods 0.000 description 1
- 230000002936 tranquilizing effect Effects 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D495/00—Heterocyclic compounds containing in the condensed system at least one hetero ring having sulfur atoms as the only ring hetero atoms
- C07D495/02—Heterocyclic compounds containing in the condensed system at least one hetero ring having sulfur atoms as the only ring hetero atoms in which the condensed system contains two hetero rings
- C07D495/04—Ortho-condensed systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pyridine Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Priority Applications (10)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| NL301345D NL301345A (enExample) | 1963-01-12 | ||
| DEM55402A DE1193049B (de) | 1963-01-12 | 1963-01-12 | Verfahren zur Herstellung eines schwefelhaltigen Derivats des Vitamins B |
| CH1311863A CH435276A (de) | 1963-01-12 | 1963-10-25 | Verfahren zur Herstellung eines schwefelhaltigen Derivats des Vitamins B6 |
| FI2344/63A FI42329B (enExample) | 1963-01-12 | 1963-11-28 | |
| NL63301345A NL140522B (nl) | 1963-01-12 | 1963-12-04 | Werkwijze voor het bereiden van een derivaat van vitamine b6. |
| FR957102A FR3091M (fr) | 1963-01-12 | 1963-12-13 | Nouveau dérivé de la vitamine b6. |
| BR155478/63A BR6355478D0 (pt) | 1963-01-12 | 1963-12-17 | Processo para a preparacao de um derivado sulfurado da vitamina b |
| US333725A US3296271A (en) | 1963-01-12 | 1963-12-26 | Bis-[4-formyl-5-hydroxy-6-methyl-pyridyl (3) methyl] disulfide |
| DK4864AA DK109446C (da) | 1963-01-12 | 1964-01-06 | Fremgangsmåde til fremstilling af pyridoxalyldisulfid. |
| GB866/64A GB1005649A (en) | 1963-01-12 | 1964-01-08 | A sulphur-containing derivative of vitamin b and processes for its manufacture |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEM55402A DE1193049B (de) | 1963-01-12 | 1963-01-12 | Verfahren zur Herstellung eines schwefelhaltigen Derivats des Vitamins B |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1193049B true DE1193049B (de) | 1965-05-20 |
Family
ID=7308294
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEM55402A Pending DE1193049B (de) | 1963-01-12 | 1963-01-12 | Verfahren zur Herstellung eines schwefelhaltigen Derivats des Vitamins B |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US3296271A (enExample) |
| BR (1) | BR6355478D0 (enExample) |
| CH (1) | CH435276A (enExample) |
| DE (1) | DE1193049B (enExample) |
| DK (1) | DK109446C (enExample) |
| FI (1) | FI42329B (enExample) |
| FR (1) | FR3091M (enExample) |
| GB (1) | GB1005649A (enExample) |
| NL (2) | NL140522B (enExample) |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3008963A (en) * | 1961-11-14 | Production of pyridine aldehydes | ||
| US2581869A (en) * | 1946-10-04 | 1952-01-08 | Monsanto Chemicals | N-(5-halo-2-thenyl)-substituted ethylene diamines |
| US2510893A (en) * | 1946-12-20 | 1950-06-06 | Velsicol Corp | Production of organo-thiyl compounds |
| US2510894A (en) * | 1946-12-20 | 1950-06-06 | Velsicol Corp | Production of organo-thiyl compounds |
| US2543544A (en) * | 1948-05-08 | 1951-02-27 | Indiana University Foundation | N, n-dimethyl-n'-(3-thienylmethyl)-n'-(alpha-pyridyl)-ethylenediamine |
| US3090726A (en) * | 1957-06-24 | 1963-05-21 | Carter Prod Inc | Novel composition of matter for treatment of nervous disorders |
| BE633927A (enExample) * | 1958-03-21 | |||
| FR51M (enExample) * | 1960-06-03 | 1960-11-28 | ||
| US3067205A (en) * | 1960-10-12 | 1962-12-04 | United States Steel Corp | Method of making pyridine aldehydes |
-
0
- NL NL301345D patent/NL301345A/xx unknown
-
1963
- 1963-01-12 DE DEM55402A patent/DE1193049B/de active Pending
- 1963-10-25 CH CH1311863A patent/CH435276A/de unknown
- 1963-11-28 FI FI2344/63A patent/FI42329B/fi active
- 1963-12-04 NL NL63301345A patent/NL140522B/xx unknown
- 1963-12-13 FR FR957102A patent/FR3091M/fr active Active
- 1963-12-17 BR BR155478/63A patent/BR6355478D0/pt unknown
- 1963-12-26 US US333725A patent/US3296271A/en not_active Expired - Lifetime
-
1964
- 1964-01-06 DK DK4864AA patent/DK109446C/da active
- 1964-01-08 GB GB866/64A patent/GB1005649A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| FI42329B (enExample) | 1970-03-31 |
| GB1005649A (en) | 1965-09-22 |
| FR3091M (fr) | 1965-01-25 |
| US3296271A (en) | 1967-01-03 |
| NL301345A (enExample) | |
| BR6355478D0 (pt) | 1973-08-07 |
| CH435276A (de) | 1967-05-15 |
| DK109446C (da) | 1968-04-29 |
| NL140522B (nl) | 1973-12-17 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1620694B2 (de) | Verfahren zur Herstellung von 5-Methyl-7-diäthylamino-s-triazolo [1,5-a] pyrimidin und seinen Salzen mit Säuren | |
| DE3730748A1 (de) | Neue polyoxygenierte labdanderivate, ein verfahren zu ihrer herstellung und ihre verwendung als arzneimittel | |
| DE3308719A1 (de) | 1-substituierte n-(8(alpha)-ergolinyl)-n'.n'-diethylharnstoffe, ihre herstellung und pharmakologische verwendung | |
| DE2321075A1 (de) | Verfahren zur herstellung von aminoverbindungen | |
| DE1193049B (de) | Verfahren zur Herstellung eines schwefelhaltigen Derivats des Vitamins B | |
| DE1246722B (de) | Verfahren zur Herstellung von Harnstoffderivaten | |
| EP0027956A1 (de) | Verfahren zur Herstellung von (1-(4-Chlorbenzoyl)-5-methoxy-2-methyl-3-indol)acetoxyessigsäure | |
| DE1904653A1 (de) | Substituierte Benzthiazol-N-oxide | |
| DE2314242A1 (de) | Neue 3-substituierte 2-oxo-4-hydroxy1,2,3,4-tetrahydrochinazolin-4-carbonsaeurehydrazide | |
| AT220619B (de) | Verfahren zur Herstellung von Aminoalkylbenzhydryläthern | |
| AT270647B (de) | Verfahren zur Herstellung neuer substituierter Aminopyridine, von deren Salzen und optisch aktiven Isomeren | |
| DE1244786B (de) | Verfahren zur Herstellung eines schwefelhaltigen Pyridoxal-Derivates | |
| DE1246742B (de) | Verfahren zur Herstellung von neuen Phenothiazinen | |
| CH390935A (de) | Verfahren zur Herstellung von Benzol-disulfonamiden | |
| DE866040C (de) | Verfahren zur Herstellung von schwerloeslichen kristallisierten oder oeligen Penicillinverbindungen | |
| EP0091052A2 (de) | Industrielles Verfahren zum Oxydieren von Thioethern und Thiolcarbonsäure-Derivaten | |
| DE852854C (de) | Verfahren zur Herstellung schwer wasserloeslicher Penicillinsalze | |
| AT239243B (de) | Verfahren zur Herstellung von 2, 3-Dicyan-1, 4-dithia-anthrahydrochinon und -anthrachinon | |
| DE968212C (de) | Verfahren zur Herstellung von Guanididen organischer Sulfosaeuren | |
| AT389873B (de) | Verfahren zur herstellung des 1-(2-(5-/ | |
| DE1126883B (de) | Verfahren zur Herstellung von 1-Aminoalkyl-7-aza-benzimidazolen | |
| DE2405255A1 (de) | Neue tetrazolderivate und verfahren zu ihrer herstellung | |
| DE1080114B (de) | Verfahren zur Herstellung von substituierten Cumaronen | |
| DE1210429B (de) | Verfahren zur Herstellung von Bis-pyridyl-(3)-methyl-disulfiden | |
| DE1149356B (de) | Verfahren zur Herstellung von N-substituierten Thiosaeureamiden |