DE1184946B - Verfahren zur Herstellung homogener elastischer Kunststoffe - Google Patents
Verfahren zur Herstellung homogener elastischer KunststoffeInfo
- Publication number
- DE1184946B DE1184946B DEF38153A DEF0038153A DE1184946B DE 1184946 B DE1184946 B DE 1184946B DE F38153 A DEF38153 A DE F38153A DE F0038153 A DEF0038153 A DE F0038153A DE 1184946 B DE1184946 B DE 1184946B
- Authority
- DE
- Germany
- Prior art keywords
- solution
- water
- acetone
- hours
- solvent
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 14
- 230000008569 process Effects 0.000 title claims description 8
- 229920003023 plastic Polymers 0.000 title claims description 7
- 239000004033 plastic Substances 0.000 title claims description 7
- 238000004519 manufacturing process Methods 0.000 title claims description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 41
- 239000002904 solvent Substances 0.000 claims description 21
- 239000011888 foil Substances 0.000 claims description 11
- 150000001875 compounds Chemical class 0.000 claims description 10
- 239000007795 chemical reaction product Substances 0.000 claims description 8
- 239000002168 alkylating agent Substances 0.000 claims description 7
- 229940100198 alkylating agent Drugs 0.000 claims description 7
- 239000004970 Chain extender Substances 0.000 claims description 6
- 150000001412 amines Chemical class 0.000 claims description 6
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 6
- 229920001228 polyisocyanate Polymers 0.000 claims description 6
- 239000005056 polyisocyanate Substances 0.000 claims description 6
- 238000006243 chemical reaction Methods 0.000 claims description 4
- 238000000576 coating method Methods 0.000 claims description 4
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 4
- 229910052757 nitrogen Inorganic materials 0.000 claims description 4
- 238000007493 shaping process Methods 0.000 claims description 4
- 239000002318 adhesion promoter Substances 0.000 claims description 3
- 125000005843 halogen group Chemical group 0.000 claims description 2
- 239000012084 conversion product Substances 0.000 claims 1
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 79
- 239000000243 solution Substances 0.000 description 61
- 239000004814 polyurethane Substances 0.000 description 20
- 229920002635 polyurethane Polymers 0.000 description 20
- 239000000203 mixture Substances 0.000 description 19
- 239000003795 chemical substances by application Substances 0.000 description 13
- MTHSVFCYNBDYFN-UHFFFAOYSA-N diethylene glycol Chemical compound OCCOCCO MTHSVFCYNBDYFN-UHFFFAOYSA-N 0.000 description 13
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 12
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 12
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 11
- CRVGTESFCCXCTH-UHFFFAOYSA-N methyl diethanolamine Chemical compound OCCN(C)CCO CRVGTESFCCXCTH-UHFFFAOYSA-N 0.000 description 10
- 239000000155 melt Substances 0.000 description 9
- 229920000728 polyester Polymers 0.000 description 9
- 239000011521 glass Substances 0.000 description 8
- 229920000126 latex Polymers 0.000 description 8
- 239000004816 latex Substances 0.000 description 8
- 238000003756 stirring Methods 0.000 description 8
- UPMLOUAZCHDJJD-UHFFFAOYSA-N 4,4'-Diphenylmethane Diisocyanate Chemical compound C1=CC(N=C=O)=CC=C1CC1=CC=C(N=C=O)C=C1 UPMLOUAZCHDJJD-UHFFFAOYSA-N 0.000 description 7
- 125000005442 diisocyanate group Chemical group 0.000 description 7
- 229920001451 polypropylene glycol Polymers 0.000 description 7
- 238000005956 quaternization reaction Methods 0.000 description 7
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- 238000001816 cooling Methods 0.000 description 6
- 239000000047 product Substances 0.000 description 6
- 230000018044 dehydration Effects 0.000 description 5
- 238000006297 dehydration reaction Methods 0.000 description 5
- 239000006185 dispersion Substances 0.000 description 5
- 150000002334 glycols Chemical class 0.000 description 5
- 229920000570 polyether Polymers 0.000 description 5
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 4
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 4
- JOYRKODLDBILNP-UHFFFAOYSA-N Ethyl urethane Chemical compound CCOC(N)=O JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 description 4
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 4
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 4
- 238000004132 cross linking Methods 0.000 description 4
- 239000000463 material Substances 0.000 description 4
- 239000003960 organic solvent Substances 0.000 description 4
- DVKJHBMWWAPEIU-UHFFFAOYSA-N toluene 2,4-diisocyanate Chemical compound CC1=CC=C(N=C=O)C=C1N=C=O DVKJHBMWWAPEIU-UHFFFAOYSA-N 0.000 description 4
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 4
- GVNHOISKXMSMPX-UHFFFAOYSA-N 2-[butyl(2-hydroxyethyl)amino]ethanol Chemical compound CCCCN(CCO)CCO GVNHOISKXMSMPX-UHFFFAOYSA-N 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- 239000004721 Polyphenylene oxide Substances 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 239000000853 adhesive Substances 0.000 description 3
- 230000001070 adhesive effect Effects 0.000 description 3
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 3
- 229920001971 elastomer Polymers 0.000 description 3
- ACCCMOQWYVYDOT-UHFFFAOYSA-N hexane-1,1-diol Chemical compound CCCCCC(O)O ACCCMOQWYVYDOT-UHFFFAOYSA-N 0.000 description 3
- SYSQUGFVNFXIIT-UHFFFAOYSA-N n-[4-(1,3-benzoxazol-2-yl)phenyl]-4-nitrobenzenesulfonamide Chemical class C1=CC([N+](=O)[O-])=CC=C1S(=O)(=O)NC1=CC=C(C=2OC3=CC=CC=C3N=2)C=C1 SYSQUGFVNFXIIT-UHFFFAOYSA-N 0.000 description 3
- -1 p-toluenesulfonic acid ester Chemical class 0.000 description 3
- 229920006264 polyurethane film Polymers 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- 230000008961 swelling Effects 0.000 description 3
- 125000001302 tertiary amino group Chemical group 0.000 description 3
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 2
- LDLCZOVUSADOIV-UHFFFAOYSA-N 2-bromoethanol Chemical compound OCCBr LDLCZOVUSADOIV-UHFFFAOYSA-N 0.000 description 2
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 2
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 2
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- 230000000996 additive effect Effects 0.000 description 2
- 150000001414 amino alcohols Chemical class 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- KCXMKQUNVWSEMD-UHFFFAOYSA-N benzyl chloride Chemical compound ClCC1=CC=CC=C1 KCXMKQUNVWSEMD-UHFFFAOYSA-N 0.000 description 2
- 229940073608 benzyl chloride Drugs 0.000 description 2
- GZUXJHMPEANEGY-UHFFFAOYSA-N bromomethane Chemical compound BrC GZUXJHMPEANEGY-UHFFFAOYSA-N 0.000 description 2
- CDQSJQSWAWPGKG-UHFFFAOYSA-N butane-1,1-diol Chemical compound CCCC(O)O CDQSJQSWAWPGKG-UHFFFAOYSA-N 0.000 description 2
- WERYXYBDKMZEQL-UHFFFAOYSA-N butane-1,4-diol Chemical compound OCCCCO WERYXYBDKMZEQL-UHFFFAOYSA-N 0.000 description 2
- NEHMKBQYUWJMIP-NJFSPNSNSA-N chloro(114C)methane Chemical compound [14CH3]Cl NEHMKBQYUWJMIP-NJFSPNSNSA-N 0.000 description 2
- 150000004985 diamines Chemical class 0.000 description 2
- 239000002270 dispersing agent Substances 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- FZWBABZIGXEXES-UHFFFAOYSA-N ethane-1,2-diol;hexanedioic acid Chemical compound OCCO.OC(=O)CCCCC(O)=O FZWBABZIGXEXES-UHFFFAOYSA-N 0.000 description 2
- 150000002576 ketones Chemical class 0.000 description 2
- 239000010985 leather Substances 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 230000006855 networking Effects 0.000 description 2
- FDPIMTJIUBPUKL-UHFFFAOYSA-N pentan-3-one Chemical compound CCC(=O)CC FDPIMTJIUBPUKL-UHFFFAOYSA-N 0.000 description 2
- 229920006149 polyester-amide block copolymer Polymers 0.000 description 2
- 238000006116 polymerization reaction Methods 0.000 description 2
- 229920006324 polyoxymethylene Polymers 0.000 description 2
- 229920006295 polythiol Polymers 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 239000000758 substrate Substances 0.000 description 2
- 150000005846 sugar alcohols Polymers 0.000 description 2
- 150000003512 tertiary amines Chemical class 0.000 description 2
- 125000005628 tolylene group Chemical group 0.000 description 2
- 239000003643 water by type Substances 0.000 description 2
- VGHSXKTVMPXHNG-UHFFFAOYSA-N 1,3-diisocyanatobenzene Chemical compound O=C=NC1=CC=CC(N=C=O)=C1 VGHSXKTVMPXHNG-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- ZZHIDJWUJRKHGX-UHFFFAOYSA-N 1,4-bis(chloromethyl)benzene Chemical compound ClCC1=CC=C(CCl)C=C1 ZZHIDJWUJRKHGX-UHFFFAOYSA-N 0.000 description 1
- ALQLPWJFHRMHIU-UHFFFAOYSA-N 1,4-diisocyanatobenzene Chemical compound O=C=NC1=CC=C(N=C=O)C=C1 ALQLPWJFHRMHIU-UHFFFAOYSA-N 0.000 description 1
- SBJCUZQNHOLYMD-UHFFFAOYSA-N 1,5-Naphthalene diisocyanate Chemical compound C1=CC=C2C(N=C=O)=CC=CC2=C1N=C=O SBJCUZQNHOLYMD-UHFFFAOYSA-N 0.000 description 1
- MPPPKRYCTPRNTB-UHFFFAOYSA-N 1-bromobutane Chemical compound CCCCBr MPPPKRYCTPRNTB-UHFFFAOYSA-N 0.000 description 1
- BITAPBDLHJQAID-KTKRTIGZSA-N 2-[2-hydroxyethyl-[(z)-octadec-9-enyl]amino]ethanol Chemical compound CCCCCCCC\C=C/CCCCCCCCN(CCO)CCO BITAPBDLHJQAID-KTKRTIGZSA-N 0.000 description 1
- SZIFAVKTNFCBPC-UHFFFAOYSA-N 2-chloroethanol Chemical compound OCCCl SZIFAVKTNFCBPC-UHFFFAOYSA-N 0.000 description 1
- BFSVOASYOCHEOV-UHFFFAOYSA-N 2-diethylaminoethanol Chemical compound CCN(CC)CCO BFSVOASYOCHEOV-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- BRLQWZUYTZBJKN-UHFFFAOYSA-N Epichlorohydrin Chemical compound ClCC1CO1 BRLQWZUYTZBJKN-UHFFFAOYSA-N 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 1
- ZJCCRDAZUWHFQH-UHFFFAOYSA-N Trimethylolpropane Chemical compound CCC(CO)(CO)CO ZJCCRDAZUWHFQH-UHFFFAOYSA-N 0.000 description 1
- 229920001807 Urea-formaldehyde Polymers 0.000 description 1
- QYKIQEUNHZKYBP-UHFFFAOYSA-N Vinyl ether Chemical compound C=COC=C QYKIQEUNHZKYBP-UHFFFAOYSA-N 0.000 description 1
- KXBFLNPZHXDQLV-UHFFFAOYSA-N [cyclohexyl(diisocyanato)methyl]cyclohexane Chemical compound C1CCCCC1C(N=C=O)(N=C=O)C1CCCCC1 KXBFLNPZHXDQLV-UHFFFAOYSA-N 0.000 description 1
- KXKVLQRXCPHEJC-UHFFFAOYSA-N acetic acid trimethyl ester Natural products COC(C)=O KXKVLQRXCPHEJC-UHFFFAOYSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 238000004026 adhesive bonding Methods 0.000 description 1
- 238000013019 agitation Methods 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 239000002216 antistatic agent Substances 0.000 description 1
- 239000007900 aqueous suspension Substances 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- AGEZXYOZHKGVCM-UHFFFAOYSA-N benzyl bromide Chemical compound BrCC1=CC=CC=C1 AGEZXYOZHKGVCM-UHFFFAOYSA-N 0.000 description 1
- 230000001588 bifunctional effect Effects 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 239000000084 colloidal system Substances 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 239000007859 condensation product Substances 0.000 description 1
- 239000003431 cross linking reagent Substances 0.000 description 1
- XLJMAIOERFSOGZ-UHFFFAOYSA-M cyanate Chemical compound [O-]C#N XLJMAIOERFSOGZ-UHFFFAOYSA-M 0.000 description 1
- 150000004292 cyclic ethers Chemical class 0.000 description 1
- 230000006735 deficit Effects 0.000 description 1
- DENRZWYUOJLTMF-UHFFFAOYSA-N diethyl sulfate Chemical compound CCOS(=O)(=O)OCC DENRZWYUOJLTMF-UHFFFAOYSA-N 0.000 description 1
- 229940008406 diethyl sulfate Drugs 0.000 description 1
- JXCHMDATRWUOAP-UHFFFAOYSA-N diisocyanatomethylbenzene Chemical compound O=C=NC(N=C=O)C1=CC=CC=C1 JXCHMDATRWUOAP-UHFFFAOYSA-N 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 239000000806 elastomer Substances 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- 239000000834 fixative Substances 0.000 description 1
- 239000000499 gel Substances 0.000 description 1
- 239000003365 glass fiber Substances 0.000 description 1
- 238000010559 graft polymerization reaction Methods 0.000 description 1
- MHIBEGOZTWERHF-UHFFFAOYSA-N heptane-1,1-diol Chemical compound CCCCCCC(O)O MHIBEGOZTWERHF-UHFFFAOYSA-N 0.000 description 1
- LSSQTAFYHNYODP-UHFFFAOYSA-N heptane-2,2-diol Chemical compound CCCCCC(C)(O)O LSSQTAFYHNYODP-UHFFFAOYSA-N 0.000 description 1
- GPCIDUIBGGUBJG-UHFFFAOYSA-N hexanedioic acid;hexane-1,1-diol Chemical compound CCCCCC(O)O.OC(=O)CCCCC(O)=O GPCIDUIBGGUBJG-UHFFFAOYSA-N 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- 238000005470 impregnation Methods 0.000 description 1
- 239000002198 insoluble material Substances 0.000 description 1
- 235000015110 jellies Nutrition 0.000 description 1
- 239000008274 jelly Substances 0.000 description 1
- 150000002605 large molecules Chemical class 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 229920003008 liquid latex Polymers 0.000 description 1
- 229940102396 methyl bromide Drugs 0.000 description 1
- 150000004702 methyl esters Chemical class 0.000 description 1
- JZMJDSHXVKJFKW-UHFFFAOYSA-M methyl sulfate(1-) Chemical compound COS([O-])(=O)=O JZMJDSHXVKJFKW-UHFFFAOYSA-M 0.000 description 1
- OEIJHBUUFURJLI-UHFFFAOYSA-N octane-1,8-diol Chemical compound OCCCCCCCCO OEIJHBUUFURJLI-UHFFFAOYSA-N 0.000 description 1
- 239000002674 ointment Substances 0.000 description 1
- 125000006503 p-nitrobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1[N+]([O-])=O)C([H])([H])* 0.000 description 1
- JOXIMZWYDAKGHI-UHFFFAOYSA-N p-toluenesulfonic acid Substances CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 1
- 239000003973 paint Substances 0.000 description 1
- 230000035699 permeability Effects 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 239000004014 plasticizer Substances 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- 229920001748 polybutylene Polymers 0.000 description 1
- 229920000151 polyglycol Polymers 0.000 description 1
- 239000010695 polyglycol Substances 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- ODGAOXROABLFNM-UHFFFAOYSA-N polynoxylin Chemical compound O=C.NC(N)=O ODGAOXROABLFNM-UHFFFAOYSA-N 0.000 description 1
- 229920003225 polyurethane elastomer Polymers 0.000 description 1
- 230000002028 premature Effects 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- ULWHHBHJGPPBCO-UHFFFAOYSA-N propane-1,1-diol Chemical compound CCC(O)O ULWHHBHJGPPBCO-UHFFFAOYSA-N 0.000 description 1
- 230000001681 protective effect Effects 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 230000004044 response Effects 0.000 description 1
- 230000000717 retained effect Effects 0.000 description 1
- 238000004513 sizing Methods 0.000 description 1
- 229910000679 solder Inorganic materials 0.000 description 1
- 230000002269 spontaneous effect Effects 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- YODZTKMDCQEPHD-UHFFFAOYSA-N thiodiglycol Chemical compound OCCSCCO YODZTKMDCQEPHD-UHFFFAOYSA-N 0.000 description 1
- 229950006389 thiodiglycol Drugs 0.000 description 1
- 150000004992 toluidines Chemical class 0.000 description 1
- XSQUKJJJFZCRTK-UHFFFAOYSA-N urea group Chemical group NC(=O)N XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 1
- 239000000052 vinegar Substances 0.000 description 1
- 235000021419 vinegar Nutrition 0.000 description 1
- 229960000834 vinyl ether Drugs 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G18/00—Polymeric products of isocyanates or isothiocyanates
- C08G18/06—Polymeric products of isocyanates or isothiocyanates with compounds having active hydrogen
- C08G18/28—Polymeric products of isocyanates or isothiocyanates with compounds having active hydrogen characterised by the compounds used containing active hydrogen
- C08G18/40—High-molecular-weight compounds
- C08G18/48—Polyethers
- C08G18/50—Polyethers having heteroatoms other than oxygen
- C08G18/5021—Polyethers having heteroatoms other than oxygen having nitrogen
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G18/00—Polymeric products of isocyanates or isothiocyanates
- C08G18/06—Polymeric products of isocyanates or isothiocyanates with compounds having active hydrogen
- C08G18/08—Processes
- C08G18/0804—Manufacture of polymers containing ionic or ionogenic groups
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G18/00—Polymeric products of isocyanates or isothiocyanates
- C08G18/06—Polymeric products of isocyanates or isothiocyanates with compounds having active hydrogen
- C08G18/08—Processes
- C08G18/0804—Manufacture of polymers containing ionic or ionogenic groups
- C08G18/0809—Manufacture of polymers containing ionic or ionogenic groups containing cationic or cationogenic groups
- C08G18/0814—Manufacture of polymers containing ionic or ionogenic groups containing cationic or cationogenic groups containing ammonium groups or groups forming them
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G18/00—Polymeric products of isocyanates or isothiocyanates
- C08G18/06—Polymeric products of isocyanates or isothiocyanates with compounds having active hydrogen
- C08G18/08—Processes
- C08G18/10—Prepolymer processes involving reaction of isocyanates or isothiocyanates with compounds having active hydrogen in a first reaction step
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10—TECHNICAL SUBJECTS COVERED BY FORMER USPC
- Y10S—TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10S424/00—Drug, bio-affecting and body treating compositions
- Y10S424/02—Resin hair settings
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10—TECHNICAL SUBJECTS COVERED BY FORMER USPC
- Y10S—TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10S516/00—Colloid systems and wetting agents; subcombinations thereof; processes of
- Y10S516/01—Wetting, emulsifying, dispersing, or stabilizing agents
- Y10S516/03—Organic sulfoxy compound containing
- Y10S516/05—Organic amine, amide, or n-base containing
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10—TECHNICAL SUBJECTS COVERED BY FORMER USPC
- Y10S—TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10S516/00—Colloid systems and wetting agents; subcombinations thereof; processes of
- Y10S516/01—Wetting, emulsifying, dispersing, or stabilizing agents
- Y10S516/07—Organic amine, amide, or n-base containing
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Engineering & Computer Science (AREA)
- Manufacturing & Machinery (AREA)
- Polyurethanes Or Polyureas (AREA)
Priority Applications (8)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| NL299775D NL299775A (OSRAM) | 1962-10-26 | ||
| BE639107D BE639107A (OSRAM) | 1962-10-26 | ||
| DEF38153A DE1184946B (de) | 1962-10-26 | 1962-10-26 | Verfahren zur Herstellung homogener elastischer Kunststoffe |
| CH1231463A CH436705A (de) | 1962-10-26 | 1963-10-07 | Verfahren zur Herstellung elastischer Kunststoffe |
| AT835363A AT240049B (de) | 1962-10-26 | 1963-10-18 | Verfahren zur Herstellung elastischer Kunststoffe |
| US318197A US3388087A (en) | 1962-10-26 | 1963-10-23 | Aqueous dispersions of quaternized polyurethanes |
| FR951593A FR1379133A (fr) | 1962-10-26 | 1963-10-24 | Procédé pour la préparation de matières élastiques en particulier en polyuréthanes |
| GB42244/63A GB1066488A (en) | 1962-10-26 | 1963-10-25 | A process for the production of elastic synthetic polyurethanes |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEF38153A DE1184946B (de) | 1962-10-26 | 1962-10-26 | Verfahren zur Herstellung homogener elastischer Kunststoffe |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1184946B true DE1184946B (de) | 1965-01-07 |
Family
ID=7097231
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEF38153A Pending DE1184946B (de) | 1962-10-26 | 1962-10-26 | Verfahren zur Herstellung homogener elastischer Kunststoffe |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US3388087A (OSRAM) |
| AT (1) | AT240049B (OSRAM) |
| BE (1) | BE639107A (OSRAM) |
| CH (1) | CH436705A (OSRAM) |
| DE (1) | DE1184946B (OSRAM) |
| GB (1) | GB1066488A (OSRAM) |
| NL (1) | NL299775A (OSRAM) |
Cited By (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2721985A1 (de) * | 1977-05-14 | 1978-11-16 | Bayer Ag | Verfahren zur herstellung von urethan- und/oder harnstoffgruppen aufweisenden polyisocyanat polyadditionsprodukten |
| US4186118A (en) | 1977-02-26 | 1980-01-29 | Bayer Aktiengesellschaft | Process for the preparation of modified aqueous synthetic resin dispersions |
| EP0354471A1 (de) | 1988-08-12 | 1990-02-14 | Henkel Kommanditgesellschaft auf Aktien | Verwendung von wässrigen Polyurethan-Dispersionen als Haushaltsalleskleber sowie deren Herstellung |
| US7321019B2 (en) | 2003-12-18 | 2008-01-22 | Wacker Chemie Ag | Dispersions containing organopolysiloxane/polyurea copolymers |
Families Citing this family (49)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1300275C2 (de) * | 1964-01-10 | 1975-07-10 | Bayer Ag, 5090 Leverkusen | Verfahren zur herstellung von gegebenenfalls verschaeumten polyurethanen |
| GB1080590A (en) * | 1964-12-28 | 1967-08-23 | Bayer Ag | Polyurethanes |
| DE1570602A1 (de) * | 1965-09-03 | 1969-08-14 | Bayer Ag | Verfahren zur Herstellung von waessrigen Polyurethan-Dispersionen |
| DE1595687A1 (de) * | 1966-10-01 | 1969-09-04 | Bayer Ag | Verfahren zur Herstellung grobdisperser,sedimentierender waessriger Polyurethandispersionen |
| US3412054A (en) * | 1966-10-31 | 1968-11-19 | Union Carbide Corp | Water-dilutable polyurethanes |
| DE1669423C3 (de) * | 1967-03-10 | 1974-07-18 | Bayer Ag, 5090 Leverkusen | Verfahren zur Herstellung von elastischen Polyurethanfäden |
| US3621960A (en) * | 1969-04-04 | 1971-11-23 | Kornylac Co | Conveyor with rollers having tires of high-hysteresis material |
| US3998870A (en) * | 1969-07-14 | 1976-12-21 | Minnesota Mining And Manufacturing Company | Sulfonated aromatic polyisocyanates and preparation of stable anionic polyurethane or polyurea latices therefor |
| GB1324006A (en) * | 1969-09-17 | 1973-07-18 | Lennig Chemicals Ltd | Decorative finish |
| BE757935A (fr) * | 1969-10-23 | 1971-04-01 | Bayer Ag | Procede de preparation de polymeres cationiques modifies en emulsion |
| BE757936A (fr) * | 1969-10-23 | 1971-04-01 | Bayer Ag | Procede de preparation de polymeres anioniques modifies en emulsion |
| DE1953349C3 (de) * | 1969-10-23 | 1975-07-03 | Bayer Ag, 5090 Leverkusen | Verfahren zur Herstellung wäßriger Dispersionen von Polymerisaten aus olefinisch ungesättigten Monomeren |
| US3853804A (en) * | 1970-08-14 | 1974-12-10 | California Inst Of Techn | Ionic block elastomeric polymers |
| US3897585A (en) * | 1972-05-12 | 1975-07-29 | Grace W R & Co | Integral reinforced structures with a polyurea adhesive component |
| DE2226526C3 (de) * | 1972-05-31 | 1981-10-15 | Bayer Ag, 5090 Leverkusen | Verfahren zur Herstellung von thermoplastischem Polyharnstoffpulver |
| DE2359611C3 (de) * | 1973-11-30 | 1981-09-17 | Bayer Ag, 5090 Leverkusen | Verfahren zur Herstellung von durch Harze auf Isocyanatbasis gebundenen Füllstoffen |
| JPS538355B2 (OSRAM) * | 1974-02-15 | 1978-03-28 | ||
| JPS538354B2 (OSRAM) * | 1974-02-15 | 1978-03-28 | ||
| US3969551A (en) * | 1974-07-05 | 1976-07-13 | American Cyanamid Company | Chemically sculpturing fabrics |
| FR2308646A1 (fr) * | 1975-04-23 | 1976-11-19 | Rhone Poulenc Ind | Polyurethanne hydrophile et son application |
| FR2324664A1 (fr) * | 1975-09-22 | 1977-04-15 | Rhone Poulenc Ind | Polyurethanes pour objets a usage medical |
| US4110286A (en) * | 1977-02-07 | 1978-08-29 | Alcolac Inc. | Stable polyurethane latices, emulsifiable prepolymers therefor and methods of making the same |
| DE2827156A1 (de) * | 1978-06-21 | 1980-01-10 | Bayer Ag | Waessrige dispersionen oder loesungen von oligomeren oder polymeren kunststoffen, ein verfahren zu ihrer herstellung, sowie ihre verwendung |
| GB2039930B (en) * | 1979-01-19 | 1983-05-25 | Minnesota Mining & Mfg | Coating of fine particles in polyurethane binder |
| DE3027198A1 (de) * | 1980-07-18 | 1982-02-11 | Bayer Ag, 5090 Leverkusen | Feste, in wasser dispergierbare, isocyanatgruppen aufweisende kunststoffvorlaeufer, ein verfahren zur herstellung von waessrigen kunststoffdispersionen unter verwendung dieser kunststoffvorlaeufer, sowie die verwendung der kunststoffvorlaeufer als vernetzungsmittel fuer waessrige kunststoffdispersionen |
| DE3129562C2 (de) * | 1980-07-29 | 1994-10-06 | Kao Corp | Farbvertiefendes Mittel |
| DE3137748A1 (de) * | 1981-09-23 | 1983-03-31 | Bayer Ag, 5090 Leverkusen | Verfahren zur herstellung von hitzeaktivierbare vernetzer enthaltenden waessrigen dispersionen oder loesungen von polyurethan-polyharnstoffen, die nach dem verfahren erhaeltlichen dispersionen oder loesungen, sowie ihre verwendung zur herstellung von ueberzuegen |
| DE3313237A1 (de) * | 1983-04-13 | 1984-10-18 | Bayer Ag, 5090 Leverkusen | Waessrige, vernetzerhaltige polyurethanzubereitungen und ihre verwendung zur thermoaktiv-einstrich-umkehrbeschichtung |
| DE3438563A1 (de) * | 1984-10-20 | 1986-04-24 | Bayer Ag, 5090 Leverkusen | Waessrige loesungen oder dispersionen von polyisocyanat-additionsprodukten, ein verfahren zu ihrer herstellung, sowie ihre verwendung als beschichtungsmittel oder als leimungsmittel fuer papier |
| DE3441934A1 (de) * | 1984-11-16 | 1986-05-28 | Bayer Ag, 5090 Leverkusen | Verfahren zur herstellung von flaechengebilden |
| DE3512918A1 (de) * | 1985-04-11 | 1986-10-16 | Bayer Ag, 5090 Leverkusen | Carbodiimidgruppen enthaltende isocyanat-derivate, ein verfahren zu ihrer herstellung und ihre verwendung als zusatzmittel fuer waessrige loesungen oder dispersionen von kunststoffen |
| DE3523856A1 (de) * | 1985-07-04 | 1987-01-08 | Bayer Ag | Waessrige loesungen oder dispersionen von polyisocyanat-additionsprodukten, ein verfahren zu ihrer herstellung, sowie ihre verwendung als beschichtungsmittel oder als leimungsmittel fuer papier |
| DE3600595A1 (de) * | 1986-01-11 | 1987-07-16 | Bayer Ag | Verfahren zur herstellung von flaechengebilden |
| DE3603996A1 (de) * | 1986-02-08 | 1987-08-13 | Bayer Ag | Verfahren zur kontinuierlichen herstellung von waessrigen polyurethandispersionen und ihre verwendung als beschichtungsmittel oder als klebstoff |
| DE3727252A1 (de) * | 1987-08-15 | 1989-02-23 | Bayer Ag | Verfahren zur herstellung von waessrigen polyurethandispersionen |
| US5759666A (en) * | 1995-12-21 | 1998-06-02 | Minnesota Mining And Manufacturing Company | Carboxylic acid functional polyurethane polymers and blends thereof used in magnetic recording media |
| US5968494A (en) * | 1998-02-24 | 1999-10-19 | National Starch And Chemical Investment Holding Corporation | Polyurethanes with carboxylate functionality for hair fixative applications |
| FR2815350B1 (fr) * | 2000-10-17 | 2006-12-29 | Oreal | Polyurethanes cationiques a caractere elastique |
| FR2833960B1 (fr) * | 2001-12-20 | 2007-04-13 | Oreal | Polyurethannes cationiques ou amphoteres auto-adhesifs |
| US7838621B2 (en) * | 2003-11-04 | 2010-11-23 | Suprapolix B.V. | Preparation of supramolecular polymer containing quadruple hydrogen bonding units in the polymer backbone |
| US8268952B2 (en) * | 2004-07-12 | 2012-09-18 | Suprapolix B.V. | Supramolecular ionomers |
| US8883188B2 (en) * | 2005-05-04 | 2014-11-11 | Suprapolix B.V. | Modular bioresorbable or biomedical, biologically active supramolecular materials |
| FR2898603B1 (fr) * | 2006-03-20 | 2010-06-11 | Oreal | Nouveaux polyurethanes, compositions les comprenant et procede de traitement cosmetique |
| US20100076147A1 (en) * | 2006-11-20 | 2010-03-25 | Suprapolix B.V. | Supramolecular polymers from low-melting, easily processable building blocks |
| US8628789B2 (en) | 2007-03-23 | 2014-01-14 | Suprapolix, B.V. | Strong reversible hydrogels |
| EP2310376B1 (en) * | 2008-07-04 | 2014-11-05 | SupraPolix B.V. | High flow supramolecular compounds |
| WO2011163250A1 (en) * | 2010-06-21 | 2011-12-29 | Ndsu Research Foundation | Aqueous polyurethane dispersions |
| EP2450394B1 (en) | 2010-11-05 | 2017-06-07 | SupraPolix B.V. | A process for the preparation of a supramolecular polymer |
| IN2014MN00857A (OSRAM) | 2011-11-18 | 2015-04-17 | Unilever Plc |
Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB791853A (en) * | 1954-08-13 | 1958-03-12 | Du Pont | Elastomeric diisocyanate modified polyesters and polyalkylene ether glycols |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE880485C (de) * | 1944-07-02 | 1953-06-22 | Bayer Ag | Verfahren zur Herstellung von Hochpolymeren |
| US3036998A (en) * | 1959-05-25 | 1962-05-29 | Grace W R & Co | Polymeric hydrazinium salts |
| US3173896A (en) * | 1960-10-21 | 1965-03-16 | Du Pont | Process of reacting a polyisocyanate with a compound having active hydrogen using a tertiary amine n-oxide catalyst |
| US3180853A (en) * | 1961-04-06 | 1965-04-27 | Du Pont | Polyurethane prepolymer chain-extended with an n-lower alkyl amino-bislower alkyl amine |
| US3294752A (en) * | 1962-03-29 | 1966-12-27 | Du Pont | Polyurethanes containing a quaternary nitrogen in the elastomer chain |
-
0
- BE BE639107D patent/BE639107A/xx unknown
- NL NL299775D patent/NL299775A/xx unknown
-
1962
- 1962-10-26 DE DEF38153A patent/DE1184946B/de active Pending
-
1963
- 1963-10-07 CH CH1231463A patent/CH436705A/de unknown
- 1963-10-18 AT AT835363A patent/AT240049B/de active
- 1963-10-23 US US318197A patent/US3388087A/en not_active Expired - Lifetime
- 1963-10-25 GB GB42244/63A patent/GB1066488A/en not_active Expired
Patent Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB791853A (en) * | 1954-08-13 | 1958-03-12 | Du Pont | Elastomeric diisocyanate modified polyesters and polyalkylene ether glycols |
Cited By (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4186118A (en) | 1977-02-26 | 1980-01-29 | Bayer Aktiengesellschaft | Process for the preparation of modified aqueous synthetic resin dispersions |
| DE2721985A1 (de) * | 1977-05-14 | 1978-11-16 | Bayer Ag | Verfahren zur herstellung von urethan- und/oder harnstoffgruppen aufweisenden polyisocyanat polyadditionsprodukten |
| EP0354471A1 (de) | 1988-08-12 | 1990-02-14 | Henkel Kommanditgesellschaft auf Aktien | Verwendung von wässrigen Polyurethan-Dispersionen als Haushaltsalleskleber sowie deren Herstellung |
| WO1990001508A1 (de) | 1988-08-12 | 1990-02-22 | Henkel Kommanditgesellschaft Auf Aktien | Haushaltsalleskleber auf polyurethanbasis |
| US7321019B2 (en) | 2003-12-18 | 2008-01-22 | Wacker Chemie Ag | Dispersions containing organopolysiloxane/polyurea copolymers |
Also Published As
| Publication number | Publication date |
|---|---|
| NL299775A (OSRAM) | |
| AT240049B (de) | 1965-05-10 |
| CH436705A (de) | 1967-05-31 |
| BE639107A (OSRAM) | |
| GB1066488A (en) | 1967-04-26 |
| US3388087A (en) | 1968-06-11 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1184946B (de) | Verfahren zur Herstellung homogener elastischer Kunststoffe | |
| DE1178586B (de) | Verfahren zur Herstellung elastischer Kunststoffe, einschliesslich Flaechengebilden,ach dem Polyisocyanat-Polyadditionsverfahren | |
| DE1495847C3 (de) | Verfahren zur Herstellung von anionischen Polyurethanen | |
| DE1495745C3 (de) | Verfahren zur Herstellung wäßriger, emulgatorfreier Polyurethan-Latices | |
| DE2141807C2 (de) | Selbstemulgierter wäßriger Polyurethanharnstoff- oder Polyharnstoff-Latex und dessen Verwendung zur Herstellung von Filmen | |
| DE2221751C3 (de) | Polyurethanharnstoff elastomere | |
| DE1187012B (de) | Verfahren zur Herstellung von elastischen Kunststoffen, einschliesslich Flaechengebilden aus Polyurethanmassen | |
| DE1237306B (de) | Verfahren zur Herstellung von Polyurethankunststoffen | |
| DE2211917C3 (de) | Verfahren zur Herstellung eines Polymerisationskunstharzes | |
| EP0000568B1 (de) | Verfahren zur Herstllung von wässrigen Dispersionen oder Lösungen von Isocyanat-Polyadditionsprodukten; Verwendung dieser Dispersionen bzw. Lösungen zur Herstellung von Überzügen und Beschichtungen | |
| DE1570602A1 (de) | Verfahren zur Herstellung von waessrigen Polyurethan-Dispersionen | |
| DE2221798C3 (de) | Verfahren zur Herstellung von Polyurethanharnstoff-Lösungen | |
| DE60017093T2 (de) | Verfahren zur herstellung anionischer wässrigen polymerdispersionen die kein flüchtiges tertiäres amin enthalten, die hergestellte dispersion und die darauf basierende beschichtung | |
| DE2633396A1 (de) | Verfahren zur herstellung einer anionischen waessrigen polyurethanemulsion | |
| DE2221750A1 (de) | Verfahren zur herstellung von polyurethanharnstoff-loesungen | |
| DE4016713A1 (de) | Waessrige polymerdispersionen und deren verwendung als beschichtungsmittel fuer textile substrate und leder | |
| DE2325825B2 (de) | Verfahren zur Herstellung vonvernelzten· licht- und lagerstabilen, wäßrigen Polyurethandispersionen | |
| EP0445192B2 (de) | Wässrige polyurethan- bzw. polyurethanharnstoffdispersionen, verfahren zum beflocken elastomerer formkörper sowie zur heissversiegelung von textilen flächengebilden unter verwendung dieser dispersionen | |
| DE2505462C2 (de) | Verfahren zur Herstellung einer wäßrigen, anionischen, wärmehärtbaren Polyurethanpolyharnstoffemulsion | |
| DE60020527T2 (de) | Wässrige dispersion eines blockierte reaktive stellen enthaltenden polyurethanes | |
| DE1595602A1 (de) | Verfahren zur Herstellung von Polyurethan-Kunststoffen | |
| EP0006204B1 (de) | Wässrige Dispersionen von oligomeren oder polymeren Kunststoffen, ein Verfahren zu ihrer Herstellung sowie ihre Verwendung | |
| WO2005049683A1 (de) | Kaschierklebstoffe, enthaltend polyurethan und epoxidharz | |
| DE2633817A1 (de) | Verfahren zum herstellen einer waessrigen, amphoteren waermehaertbaren polyurethanemulsion | |
| DE2002585B2 (de) | Verfahren zur Herstellung eines Polyurethanelastomer-Latex |