DE1174160B - Verfahren zur Herstellung von Mehrfarben-UEbertragungsbildern - Google Patents
Verfahren zur Herstellung von Mehrfarben-UEbertragungsbildernInfo
- Publication number
- DE1174160B DE1174160B DEJ20438A DEJ0020438A DE1174160B DE 1174160 B DE1174160 B DE 1174160B DE J20438 A DEJ20438 A DE J20438A DE J0020438 A DEJ0020438 A DE J0020438A DE 1174160 B DE1174160 B DE 1174160B
- Authority
- DE
- Germany
- Prior art keywords
- onium
- compound
- developer
- dye
- bromide
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 41
- 238000012546 transfer Methods 0.000 title claims description 21
- 230000008569 process Effects 0.000 title claims description 19
- 238000004519 manufacturing process Methods 0.000 title description 3
- 150000004010 onium ions Chemical class 0.000 claims description 58
- -1 Silver halide Chemical class 0.000 claims description 47
- 229910052709 silver Inorganic materials 0.000 claims description 31
- 239000004332 silver Substances 0.000 claims description 31
- 239000003795 chemical substances by application Substances 0.000 claims description 29
- 239000000839 emulsion Substances 0.000 claims description 27
- 239000000463 material Substances 0.000 claims description 25
- 239000000126 substance Substances 0.000 claims description 20
- 150000001875 compounds Chemical class 0.000 claims description 18
- 230000002209 hydrophobic effect Effects 0.000 claims description 13
- 229910052757 nitrogen Inorganic materials 0.000 claims description 12
- 125000004432 carbon atom Chemical group C* 0.000 claims description 9
- 238000011161 development Methods 0.000 claims description 8
- 238000009792 diffusion process Methods 0.000 claims description 8
- 230000005540 biological transmission Effects 0.000 claims description 7
- 150000001768 cations Chemical class 0.000 claims description 7
- 150000003856 quaternary ammonium compounds Chemical class 0.000 claims description 7
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 6
- 150000003839 salts Chemical class 0.000 claims description 6
- 125000001453 quaternary ammonium group Chemical group 0.000 claims description 5
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 claims description 3
- 150000003868 ammonium compounds Chemical class 0.000 claims description 3
- 238000002360 preparation method Methods 0.000 claims description 3
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 2
- 125000005496 phosphonium group Chemical group 0.000 claims description 2
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical class S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 claims 1
- 238000004090 dissolution Methods 0.000 claims 1
- 239000003960 organic solvent Substances 0.000 claims 1
- 150000003222 pyridines Chemical class 0.000 claims 1
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 63
- 239000000243 solution Substances 0.000 description 47
- 239000000975 dye Substances 0.000 description 46
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 25
- DPXJVFZANSGRMM-UHFFFAOYSA-N acetic acid;2,3,4,5,6-pentahydroxyhexanal;sodium Chemical compound [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O DPXJVFZANSGRMM-UHFFFAOYSA-N 0.000 description 21
- 239000001768 carboxy methyl cellulose Substances 0.000 description 21
- 235000019812 sodium carboxymethyl cellulose Nutrition 0.000 description 21
- 229920001027 sodium carboxymethylcellulose Polymers 0.000 description 21
- 239000000203 mixture Substances 0.000 description 17
- XPAZGLFMMUODDK-UHFFFAOYSA-N 6-nitro-1h-benzimidazole Chemical compound [O-][N+](=O)C1=CC=C2N=CNC2=C1 XPAZGLFMMUODDK-UHFFFAOYSA-N 0.000 description 16
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 14
- VKYKSIONXSXAKP-UHFFFAOYSA-N hexamethylenetetramine Chemical compound C1N(C2)CN3CN1CN2C3 VKYKSIONXSXAKP-UHFFFAOYSA-N 0.000 description 12
- 229920002301 cellulose acetate Polymers 0.000 description 11
- 230000006872 improvement Effects 0.000 description 9
- 108010010803 Gelatin Proteins 0.000 description 8
- 229920000159 gelatin Polymers 0.000 description 8
- 239000008273 gelatin Substances 0.000 description 8
- 235000019322 gelatine Nutrition 0.000 description 8
- 235000011852 gelatine desserts Nutrition 0.000 description 8
- 238000000926 separation method Methods 0.000 description 7
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 7
- 235000010299 hexamethylene tetramine Nutrition 0.000 description 6
- 239000004312 hexamethylene tetramine Substances 0.000 description 6
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 6
- AKHNMLFCWUSKQB-UHFFFAOYSA-L sodium thiosulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=S AKHNMLFCWUSKQB-UHFFFAOYSA-L 0.000 description 6
- 235000019345 sodium thiosulphate Nutrition 0.000 description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 6
- 125000000217 alkyl group Chemical group 0.000 description 5
- 125000000623 heterocyclic group Chemical group 0.000 description 5
- 239000007788 liquid Substances 0.000 description 5
- 239000002904 solvent Substances 0.000 description 5
- QLAJNZSPVITUCQ-UHFFFAOYSA-N 1,3,2-dioxathietane 2,2-dioxide Chemical compound O=S1(=O)OCO1 QLAJNZSPVITUCQ-UHFFFAOYSA-N 0.000 description 4
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 4
- HIJUNUKEBATFPF-UHFFFAOYSA-M 1-ethylpyridin-1-ium;4-methylbenzenesulfonate Chemical compound CC[N+]1=CC=CC=C1.CC1=CC=C(S([O-])(=O)=O)C=C1 HIJUNUKEBATFPF-UHFFFAOYSA-M 0.000 description 3
- ABFDKXBSQCTIKH-UHFFFAOYSA-M 1-ethylpyridin-1-ium;bromide Chemical compound [Br-].CC[N+]1=CC=CC=C1 ABFDKXBSQCTIKH-UHFFFAOYSA-M 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 3
- 239000004372 Polyvinyl alcohol Substances 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- 150000001450 anions Chemical class 0.000 description 3
- 239000007864 aqueous solution Substances 0.000 description 3
- 229910052799 carbon Inorganic materials 0.000 description 3
- 230000007423 decrease Effects 0.000 description 3
- 238000009826 distribution Methods 0.000 description 3
- 230000014509 gene expression Effects 0.000 description 3
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 3
- AJDUTMFFZHIJEM-UHFFFAOYSA-N n-(9,10-dioxoanthracen-1-yl)-4-[4-[[4-[4-[(9,10-dioxoanthracen-1-yl)carbamoyl]phenyl]phenyl]diazenyl]phenyl]benzamide Chemical compound O=C1C2=CC=CC=C2C(=O)C2=C1C=CC=C2NC(=O)C(C=C1)=CC=C1C(C=C1)=CC=C1N=NC(C=C1)=CC=C1C(C=C1)=CC=C1C(=O)NC1=CC=CC2=C1C(=O)C1=CC=CC=C1C2=O AJDUTMFFZHIJEM-UHFFFAOYSA-N 0.000 description 3
- 229920002451 polyvinyl alcohol Polymers 0.000 description 3
- 239000001047 purple dye Substances 0.000 description 3
- BBFCIBZLAVOLCF-UHFFFAOYSA-N pyridin-1-ium;bromide Chemical compound Br.C1=CC=NC=C1 BBFCIBZLAVOLCF-UHFFFAOYSA-N 0.000 description 3
- 125000001424 substituent group Chemical group 0.000 description 3
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 3
- 239000001043 yellow dye Substances 0.000 description 3
- SGWZVZZVXOJRAQ-UHFFFAOYSA-N 2,6-Dimethyl-1,4-benzenediol Chemical compound CC1=CC(O)=CC(C)=C1O SGWZVZZVXOJRAQ-UHFFFAOYSA-N 0.000 description 2
- LAQYHRQFABOIFD-UHFFFAOYSA-N 2-methoxyhydroquinone Chemical compound COC1=CC(O)=CC=C1O LAQYHRQFABOIFD-UHFFFAOYSA-N 0.000 description 2
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 2
- KAESVJOAVNADME-UHFFFAOYSA-N Pyrrole Chemical compound C=1C=CNC=1 KAESVJOAVNADME-UHFFFAOYSA-N 0.000 description 2
- 239000004133 Sodium thiosulphate Substances 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- 125000003710 aryl alkyl group Chemical group 0.000 description 2
- 125000004429 atom Chemical group 0.000 description 2
- QVQLCTNNEUAWMS-UHFFFAOYSA-N barium oxide Chemical compound [Ba]=O QVQLCTNNEUAWMS-UHFFFAOYSA-N 0.000 description 2
- 229910001864 baryta Inorganic materials 0.000 description 2
- QDYLMAYUEZBUFO-UHFFFAOYSA-N cetalkonium chloride Chemical compound CCCCCCCCCCCCCCCC[N+](C)(C)CC1=CC=CC=C1 QDYLMAYUEZBUFO-UHFFFAOYSA-N 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 239000011248 coating agent Substances 0.000 description 2
- 238000000576 coating method Methods 0.000 description 2
- CUILPNURFADTPE-UHFFFAOYSA-N hypobromous acid Chemical compound BrO CUILPNURFADTPE-UHFFFAOYSA-N 0.000 description 2
- 125000000962 organic group Chemical group 0.000 description 2
- QNXIYXGRPXRGOB-UHFFFAOYSA-N oxolane;propan-2-one Chemical compound CC(C)=O.C1CCOC1 QNXIYXGRPXRGOB-UHFFFAOYSA-N 0.000 description 2
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 description 2
- RWSOTUBLDIXVET-UHFFFAOYSA-O sulfonium group Chemical group [SH3+] RWSOTUBLDIXVET-UHFFFAOYSA-O 0.000 description 2
- 238000012360 testing method Methods 0.000 description 2
- VDZOOKBUILJEDG-UHFFFAOYSA-M tetrabutylammonium hydroxide Chemical compound [OH-].CCCC[N+](CCCC)(CCCC)CCCC VDZOOKBUILJEDG-UHFFFAOYSA-M 0.000 description 2
- WGTYBPLFGIVFAS-UHFFFAOYSA-M tetramethylammonium hydroxide Chemical compound [OH-].C[N+](C)(C)C WGTYBPLFGIVFAS-UHFFFAOYSA-M 0.000 description 2
- 125000005425 toluyl group Chemical group 0.000 description 2
- 238000004804 winding Methods 0.000 description 2
- UJAWSGMWMKXZMP-UHFFFAOYSA-M 1,1-diethylpiperidin-1-ium;bromide Chemical compound [Br-].CC[N+]1(CC)CCCCC1 UJAWSGMWMKXZMP-UHFFFAOYSA-M 0.000 description 1
- VXUNBHPUGJFXIT-UHFFFAOYSA-M 1,1-dimethylpyrrolidin-1-ium;bromide Chemical compound [Br-].C[N+]1(C)CCCC1 VXUNBHPUGJFXIT-UHFFFAOYSA-M 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- DKEMQXFWHOQUEA-UHFFFAOYSA-M 1,4-dimethylpyridin-1-ium;4-methylbenzenesulfonate Chemical compound CC1=CC=[N+](C)C=C1.CC1=CC=C(S([O-])(=O)=O)C=C1 DKEMQXFWHOQUEA-UHFFFAOYSA-M 0.000 description 1
- HOWGOXCXIUWXSG-UHFFFAOYSA-N 1-(diethylamino)propane-1,1-diol Chemical compound CCN(CC)C(O)(O)CC HOWGOXCXIUWXSG-UHFFFAOYSA-N 0.000 description 1
- GGZHVNZHFYCSEV-UHFFFAOYSA-N 1-Phenyl-5-mercaptotetrazole Chemical compound SC1=NN=NN1C1=CC=CC=C1 GGZHVNZHFYCSEV-UHFFFAOYSA-N 0.000 description 1
- GLWHCXRACKOPRO-UHFFFAOYSA-M 1-benzylpyridin-1-ium;bromide Chemical compound [Br-].C=1C=CC=C[N+]=1CC1=CC=CC=C1 GLWHCXRACKOPRO-UHFFFAOYSA-M 0.000 description 1
- VMKOFRJSULQZRM-UHFFFAOYSA-N 1-bromooctane Chemical compound CCCCCCCCBr VMKOFRJSULQZRM-UHFFFAOYSA-N 0.000 description 1
- KCEQOESJQVRUBO-UHFFFAOYSA-M 1-dodecylpyridin-1-ium;4-methylbenzenesulfonate Chemical compound CC1=CC=C(S([O-])(=O)=O)C=C1.CCCCCCCCCCCC[N+]1=CC=CC=C1 KCEQOESJQVRUBO-UHFFFAOYSA-M 0.000 description 1
- XDGPPYJMOCHAGB-UHFFFAOYSA-N 1-methyl-1-octylpiperidin-1-ium Chemical compound CCCCCCCC[N+]1(C)CCCCC1 XDGPPYJMOCHAGB-UHFFFAOYSA-N 0.000 description 1
- SKTBLRVARGMUJY-UHFFFAOYSA-M 1-methylpyridin-1-ium;hydroxide Chemical compound [OH-].C[N+]1=CC=CC=C1 SKTBLRVARGMUJY-UHFFFAOYSA-M 0.000 description 1
- FDZXBERTWXBXIP-UHFFFAOYSA-M 1-methylquinolin-1-ium;chloride Chemical compound [Cl-].C1=CC=C2[N+](C)=CC=CC2=C1 FDZXBERTWXBXIP-UHFFFAOYSA-M 0.000 description 1
- VFQIAXMMFNWEIF-UHFFFAOYSA-M 1-methylquinolin-1-ium;methyl sulfate Chemical compound COS([O-])(=O)=O.C1=CC=C2[N+](C)=CC=CC2=C1 VFQIAXMMFNWEIF-UHFFFAOYSA-M 0.000 description 1
- SAORNRFCWXEYSW-UHFFFAOYSA-M 1-propylpyridin-1-ium;bromide Chemical compound [Br-].CCC[N+]1=CC=CC=C1 SAORNRFCWXEYSW-UHFFFAOYSA-M 0.000 description 1
- AUFZRCJENRSRLY-UHFFFAOYSA-N 2,3,5-trimethylhydroquinone Chemical compound CC1=CC(O)=C(C)C(C)=C1O AUFZRCJENRSRLY-UHFFFAOYSA-N 0.000 description 1
- QBQDROYKEQDPRX-UHFFFAOYSA-N 2,3-dimethyl-1,3-benzothiazol-3-ium Chemical compound C1=CC=C2[N+](C)=C(C)SC2=C1 QBQDROYKEQDPRX-UHFFFAOYSA-N 0.000 description 1
- IWFJNPRQSDPXDC-UHFFFAOYSA-M 2-(4-chloropyridin-1-ium-1-yl)-1-phenylethanone;bromide Chemical compound [Br-].C1=CC(Cl)=CC=[N+]1CC(=O)C1=CC=CC=C1 IWFJNPRQSDPXDC-UHFFFAOYSA-M 0.000 description 1
- KZMAWJRXKGLWGS-UHFFFAOYSA-N 2-chloro-n-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-n-(3-methoxypropyl)acetamide Chemical compound S1C(N(C(=O)CCl)CCCOC)=NC(C=2C=CC(OC)=CC=2)=C1 KZMAWJRXKGLWGS-UHFFFAOYSA-N 0.000 description 1
- BFSVOASYOCHEOV-UHFFFAOYSA-N 2-diethylaminoethanol Chemical compound CCN(CC)CCO BFSVOASYOCHEOV-UHFFFAOYSA-N 0.000 description 1
- LCRYQHWBRQFUOO-UHFFFAOYSA-N 2-methyl-3h-1,2-benzothiazole Chemical compound C1=CC=C2SN(C)CC2=C1 LCRYQHWBRQFUOO-UHFFFAOYSA-N 0.000 description 1
- JNRLEMMIVRBKJE-UHFFFAOYSA-N 4,4'-Methylenebis(N,N-dimethylaniline) Chemical compound C1=CC(N(C)C)=CC=C1CC1=CC=C(N(C)C)C=C1 JNRLEMMIVRBKJE-UHFFFAOYSA-N 0.000 description 1
- KFDVPJUYSDEJTH-UHFFFAOYSA-N 4-ethenylpyridine Chemical compound C=CC1=CC=NC=C1 KFDVPJUYSDEJTH-UHFFFAOYSA-N 0.000 description 1
- VFSADEQGQSFZHB-UHFFFAOYSA-M 4-methylbenzenesulfonate 1-propylpyridin-1-ium Chemical compound C1(=CC=C(C=C1)S(=O)(=O)[O-])C.C(CC)[N+]1=CC=CC=C1 VFSADEQGQSFZHB-UHFFFAOYSA-M 0.000 description 1
- OVFJVGPVSMMTSA-UHFFFAOYSA-M 4-methylbenzenesulfonate;1-methylpyridin-1-ium Chemical compound C[N+]1=CC=CC=C1.CC1=CC=C(S([O-])(=O)=O)C=C1 OVFJVGPVSMMTSA-UHFFFAOYSA-M 0.000 description 1
- FTAHLRGENXPOTQ-UHFFFAOYSA-M 4-methylbenzenesulfonate;triethylsulfanium Chemical compound CC[S+](CC)CC.CC1=CC=C(S([O-])(=O)=O)C=C1 FTAHLRGENXPOTQ-UHFFFAOYSA-M 0.000 description 1
- GVTDRUXHMYZTFF-UHFFFAOYSA-N 5,6,7,8-tetrahydronaphthalene-1,4-diol Chemical compound C1CCCC2=C1C(O)=CC=C2O GVTDRUXHMYZTFF-UHFFFAOYSA-N 0.000 description 1
- RWXZXCZBMQPOBF-UHFFFAOYSA-N 5-methyl-1H-benzimidazole Chemical compound CC1=CC=C2N=CNC2=C1 RWXZXCZBMQPOBF-UHFFFAOYSA-N 0.000 description 1
- RPZNPEMXYNMTKB-UHFFFAOYSA-N Br.CCN1CC=CC=C1 Chemical compound Br.CCN1CC=CC=C1 RPZNPEMXYNMTKB-UHFFFAOYSA-N 0.000 description 1
- 229920000623 Cellulose acetate phthalate Polymers 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- 241000577218 Phenes Species 0.000 description 1
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical group C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 1
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- UONKJIMCBFTUOW-UHFFFAOYSA-N [Br-].CC[S+](CC)CC(O)=O Chemical compound [Br-].CC[S+](CC)CC(O)=O UONKJIMCBFTUOW-UHFFFAOYSA-N 0.000 description 1
- GAMPNQJDUFQVQO-UHFFFAOYSA-N acetic acid;phthalic acid Chemical class CC(O)=O.OC(=O)C1=CC=CC=C1C(O)=O GAMPNQJDUFQVQO-UHFFFAOYSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 238000007792 addition Methods 0.000 description 1
- 230000000996 additive effect Effects 0.000 description 1
- 229910001854 alkali hydroxide Inorganic materials 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 235000019270 ammonium chloride Nutrition 0.000 description 1
- PYKYMHQGRFAEBM-UHFFFAOYSA-N anthraquinone Natural products CCC(=O)c1c(O)c2C(=O)C3C(C=CC=C3O)C(=O)c2cc1CC(=O)OC PYKYMHQGRFAEBM-UHFFFAOYSA-N 0.000 description 1
- 150000005840 aryl radicals Chemical class 0.000 description 1
- DLGYNVMUCSTYDQ-UHFFFAOYSA-N azane;pyridine Chemical group N.C1=CC=NC=C1 DLGYNVMUCSTYDQ-UHFFFAOYSA-N 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- KTHOOQOVVOZMIG-UHFFFAOYSA-N benzene-1,4-diamine dihydrobromide Chemical compound Br.Br.NC1=CC=C(N)C=C1 KTHOOQOVVOZMIG-UHFFFAOYSA-N 0.000 description 1
- XQQLGIPIFXUSET-UHFFFAOYSA-M benzenesulfonate;trimethyl(phenyl)azanium Chemical compound C[N+](C)(C)C1=CC=CC=C1.[O-]S(=O)(=O)C1=CC=CC=C1 XQQLGIPIFXUSET-UHFFFAOYSA-M 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- NTBARUNHEVSWKM-UHFFFAOYSA-N butyl(dimethyl)sulfanium Chemical compound CCCC[S+](C)C NTBARUNHEVSWKM-UHFFFAOYSA-N 0.000 description 1
- UMPZROCPMSJJNQ-UHFFFAOYSA-N carboxymethyl(triphenyl)phosphanium;bromide Chemical compound [Br-].C=1C=CC=CC=1[P+](C=1C=CC=CC=1)(CC(=O)O)C1=CC=CC=C1 UMPZROCPMSJJNQ-UHFFFAOYSA-N 0.000 description 1
- YCIMNLLNPGFGHC-UHFFFAOYSA-N catechol Chemical group OC1=CC=CC=C1O YCIMNLLNPGFGHC-UHFFFAOYSA-N 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 229940081734 cellulose acetate phthalate Drugs 0.000 description 1
- 229960000228 cetalkonium chloride Drugs 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- 238000004040 coloring Methods 0.000 description 1
- 229960002887 deanol Drugs 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 125000002704 decyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- JUXGNTZVHGHSIK-UHFFFAOYSA-M diethyl(methyl)sulfanium;4-methylbenzenesulfonate Chemical compound CC[S+](C)CC.CC1=CC=C(S([O-])(=O)=O)C=C1 JUXGNTZVHGHSIK-UHFFFAOYSA-M 0.000 description 1
- WMYMGQIVIVCVRQ-UHFFFAOYSA-N dimethyl(octyl)azanium;bromide Chemical compound Br.CCCCCCCCN(C)C WMYMGQIVIVCVRQ-UHFFFAOYSA-N 0.000 description 1
- 239000012972 dimethylethanolamine Substances 0.000 description 1
- 238000007598 dipping method Methods 0.000 description 1
- VICYBMUVWHJEFT-UHFFFAOYSA-N dodecyltrimethylammonium ion Chemical compound CCCCCCCCCCCC[N+](C)(C)C VICYBMUVWHJEFT-UHFFFAOYSA-N 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- GNOGEOVZOOFKIA-UHFFFAOYSA-N ethyl(dimethyl)sulfanium Chemical compound CC[S+](C)C GNOGEOVZOOFKIA-UHFFFAOYSA-N 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 210000003608 fece Anatomy 0.000 description 1
- 239000003337 fertilizer Substances 0.000 description 1
- 239000012458 free base Substances 0.000 description 1
- 239000001046 green dye Substances 0.000 description 1
- 230000003760 hair shine Effects 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 230000009931 harmful effect Effects 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 150000004679 hydroxides Chemical group 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 230000003993 interaction Effects 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-M iodide Chemical compound [I-] XMBWDFGMSWQBCA-UHFFFAOYSA-M 0.000 description 1
- 229940102396 methyl bromide Drugs 0.000 description 1
- GZUXJHMPEANEGY-UHFFFAOYSA-N methyl bromide Substances BrC GZUXJHMPEANEGY-UHFFFAOYSA-N 0.000 description 1
- JZMJDSHXVKJFKW-UHFFFAOYSA-M methyl sulfate(1-) Chemical compound COS([O-])(=O)=O JZMJDSHXVKJFKW-UHFFFAOYSA-M 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- MWCGLTCRJJFXKR-UHFFFAOYSA-N n-phenylethanethioamide Chemical compound CC(=S)NC1=CC=CC=C1 MWCGLTCRJJFXKR-UHFFFAOYSA-N 0.000 description 1
- 125000001400 nonyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- XNGIFLGASWRNHJ-UHFFFAOYSA-N o-dicarboxybenzene Natural products OC(=O)C1=CC=CC=C1C(O)=O XNGIFLGASWRNHJ-UHFFFAOYSA-N 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 125000006503 p-nitrobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1[N+]([O-])=O)C([H])([H])* 0.000 description 1
- CBQRJWBLUBDHAZ-UHFFFAOYSA-N phenacyl(triphenyl)phosphanium Chemical compound C=1C=CC=CC=1C(=O)C[P+](C=1C=CC=CC=1)(C=1C=CC=CC=1)C1=CC=CC=C1 CBQRJWBLUBDHAZ-UHFFFAOYSA-N 0.000 description 1
- 125000004437 phosphorous atom Chemical group 0.000 description 1
- 239000004014 plasticizer Substances 0.000 description 1
- IOLCXVTUBQKXJR-UHFFFAOYSA-M potassium bromide Inorganic materials [K+].[Br-] IOLCXVTUBQKXJR-UHFFFAOYSA-M 0.000 description 1
- 108090000623 proteins and genes Proteins 0.000 description 1
- PBMFSQRYOILNGV-UHFFFAOYSA-N pyridazine Chemical compound C1=CC=NN=C1 PBMFSQRYOILNGV-UHFFFAOYSA-N 0.000 description 1
- 150000004023 quaternary phosphonium compounds Chemical class 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 229910052711 selenium Inorganic materials 0.000 description 1
- 230000035945 sensitivity Effects 0.000 description 1
- 230000001235 sensitizing effect Effects 0.000 description 1
- 150000003384 small molecules Chemical class 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- 238000005728 strengthening Methods 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 230000008961 swelling Effects 0.000 description 1
- JRMUNVKIHCOMHV-UHFFFAOYSA-M tetrabutylammonium bromide Chemical compound [Br-].CCCC[N+](CCCC)(CCCC)CCCC JRMUNVKIHCOMHV-UHFFFAOYSA-M 0.000 description 1
- 229940073455 tetraethylammonium hydroxide Drugs 0.000 description 1
- LRGJRHZIDJQFCL-UHFFFAOYSA-M tetraethylazanium;hydroxide Chemical compound [OH-].CC[N+](CC)(CC)CC LRGJRHZIDJQFCL-UHFFFAOYSA-M 0.000 description 1
- LPSKDVINWQNWFE-UHFFFAOYSA-M tetrapropylazanium;hydroxide Chemical compound [OH-].CCC[N+](CCC)(CCC)CCC LPSKDVINWQNWFE-UHFFFAOYSA-M 0.000 description 1
- CNHDIAIOKMXOLK-UHFFFAOYSA-N toluquinol Chemical compound CC1=CC(O)=CC=C1O CNHDIAIOKMXOLK-UHFFFAOYSA-N 0.000 description 1
- HADKRTWCOYPCPH-UHFFFAOYSA-M trimethylphenylammonium hydroxide Chemical compound [OH-].C[N+](C)(C)C1=CC=CC=C1 HADKRTWCOYPCPH-UHFFFAOYSA-M 0.000 description 1
- ZUBQQDQYKGOZGK-UHFFFAOYSA-N trimethylphosphane;hydrobromide Chemical compound [Br-].C[PH+](C)C ZUBQQDQYKGOZGK-UHFFFAOYSA-N 0.000 description 1
- GOTIICCWNAPLMN-UHFFFAOYSA-M trimethylsulfanium;bromide Chemical compound [Br-].C[S+](C)C GOTIICCWNAPLMN-UHFFFAOYSA-M 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 238000009736 wetting Methods 0.000 description 1
Classifications
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03C—PHOTOSENSITIVE MATERIALS FOR PHOTOGRAPHIC PURPOSES; PHOTOGRAPHIC PROCESSES, e.g. CINE, X-RAY, COLOUR, STEREO-PHOTOGRAPHIC PROCESSES; AUXILIARY PROCESSES IN PHOTOGRAPHY
- G03C8/00—Diffusion transfer processes or agents therefor; Photosensitive materials for such processes
- G03C8/02—Photosensitive materials characterised by the image-forming section
- G03C8/08—Photosensitive materials characterised by the image-forming section the substances transferred by diffusion consisting of organic compounds
- G03C8/10—Photosensitive materials characterised by the image-forming section the substances transferred by diffusion consisting of organic compounds of dyes or their precursors
- G03C8/12—Photosensitive materials characterised by the image-forming section the substances transferred by diffusion consisting of organic compounds of dyes or their precursors characterised by the releasing mechanism
- G03C8/14—Oxidation of the chromogenic substances
- G03C8/16—Oxidation of the chromogenic substances initially diffusible in alkaline environment
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10—TECHNICAL SUBJECTS COVERED BY FORMER USPC
- Y10S—TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10S430/00—Radiation imagery chemistry: process, composition, or product thereof
- Y10S430/142—Dye mordant
Landscapes
- Physics & Mathematics (AREA)
- General Physics & Mathematics (AREA)
- Photosensitive Polymer And Photoresist Processing (AREA)
- Silver Salt Photography Or Processing Solution Therefor (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US50851A US3173786A (en) | 1960-08-22 | 1960-08-22 | Color diffusion transfer process, element and composition therefor |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1174160B true DE1174160B (de) | 1964-07-16 |
Family
ID=21967875
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEJ20438A Pending DE1174160B (de) | 1960-08-22 | 1961-08-22 | Verfahren zur Herstellung von Mehrfarben-UEbertragungsbildern |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US3173786A (enExample) |
| CH (1) | CH407745A (enExample) |
| DE (1) | DE1174160B (enExample) |
| GB (1) | GB938865A (enExample) |
| NL (2) | NL122760C (enExample) |
Families Citing this family (17)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3362819A (en) * | 1962-11-01 | 1968-01-09 | Polaroid Corp | Color diffusion transfer photographic products and processes utilizing an image receiving element containing a polymeric acid layer |
| US3351465A (en) * | 1962-12-28 | 1967-11-07 | Polaroid Corp | Photographic diffusion transfer processes utilizing a processing composition containing potassium and lithium ions |
| US3362821A (en) * | 1963-05-01 | 1968-01-09 | Polaroid Corp | Diffusion transfer processes utilizing photosensitive elements containing polymeric acid spacer layers |
| US3473924A (en) * | 1967-12-11 | 1969-10-21 | Polaroid Corp | Novel photographic products and processes |
| US3578447A (en) * | 1969-05-02 | 1971-05-11 | Polaroid Corp | Dye developer color liffusion transfer processes and elements comprising alpha and gamma hydroxy and gamma amino substituted pyridines |
| US3649265A (en) * | 1970-05-06 | 1972-03-14 | Eastman Kodak Co | Diffusion transfer system comprising dye developers, a pyrazolone and an onium compound |
| JPS556214B2 (enExample) * | 1972-01-07 | 1980-02-14 | ||
| US3816125A (en) * | 1972-06-16 | 1974-06-11 | Polaroid Corp | Photographic products and processes |
| JPS5932784B2 (ja) * | 1975-10-16 | 1984-08-10 | コニカ株式会社 | カラ−拡散転写法 |
| JPS55157738A (en) * | 1979-05-29 | 1980-12-08 | Mitsubishi Paper Mills Ltd | Silver complex salt diffusion transfer solution composition |
| JPS5710141A (en) * | 1980-06-20 | 1982-01-19 | Fuji Photo Film Co Ltd | Photographic element for color diffusion transfer |
| US4543317A (en) * | 1984-12-19 | 1985-09-24 | Polaroid Corporation | Photographic system with salt of phenylmercaptoazole and quaternary radical |
| US4766056A (en) * | 1985-02-21 | 1988-08-23 | Fuji Photo Film Co., Ltd. | Light-sensitive material with compounds reactive with dye developers |
| US4677206A (en) * | 1985-08-08 | 1987-06-30 | Polaroid Corporation, Patent Dept. | 2-hydroxy ethyl benzyl pyridinium compounds |
| US4588672A (en) * | 1985-08-08 | 1986-05-13 | Polaroid Corporation | Photographic system with quaternary releaser |
| US5705312A (en) * | 1996-02-09 | 1998-01-06 | Polaroid Corporation | Photograph system |
| KR102351881B1 (ko) | 2012-04-12 | 2022-01-18 | 더 트러스티스 오브 더 유니버시티 오브 펜실베니아 | 필로바이러스 공통 항원, 이로부터 제조된 핵산 구조체 및 백신, 및 이를 사용하는 방법 |
Citations (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2403927A (en) * | 1942-12-03 | 1946-07-16 | Ilford Ltd | Improvers for photographic emulsions |
| GB601824A (en) * | 1945-10-04 | 1948-05-13 | Elliott & Sons Ltd | Improvements in photographic light sensitive emulsions |
| US2636821A (en) * | 1950-05-05 | 1953-04-28 | Gen Aniline & Film Corp | Process of rendering undevelopable the silver halides present in an outer layer of multilayer color film |
| US2725290A (en) * | 1951-11-14 | 1955-11-29 | Eastman Kodak Co | Development of multi-layer color films with developers containing mercapto azoles |
| GB804971A (en) * | 1954-03-09 | 1958-11-26 | Polaroid Corp | Improvements in or relating to photography |
| US2983606A (en) * | 1958-07-14 | 1961-05-09 | Polaroid Corp | Processes and products for forming photographic images in color |
Family Cites Families (17)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2197809A (en) * | 1938-01-03 | 1940-04-23 | Du Pont Film Mfg Corp | Photographic process and emulsion utilizing cation-active surface active agents |
| BE466375A (enExample) * | 1939-03-30 | |||
| US2275727A (en) * | 1940-02-29 | 1942-03-10 | Eastman Kodak Co | Photographic emulsion |
| US2271622A (en) * | 1940-02-29 | 1942-02-03 | Eastman Kodak Co | Photographic emulsion |
| FR959726A (enExample) * | 1942-03-20 | 1950-04-04 | ||
| US2648604A (en) * | 1951-12-28 | 1953-08-11 | Gen Aniline & Film Corp | Photographic developer containing a pyridinium salt and process of development |
| US2868077A (en) * | 1954-07-19 | 1959-01-13 | Polaroid Corp | Film stock for dichroic dye images |
| BE553031A (enExample) * | 1955-12-01 | |||
| US2997390A (en) * | 1956-09-04 | 1961-08-22 | Polaroid Corp | Novel color processes and products |
| NL214522A (enExample) * | 1956-02-13 | 1900-01-01 | ||
| US3043692A (en) * | 1958-12-17 | 1962-07-10 | Polaroid Corp | Photographic products and processes |
| US3019108A (en) * | 1959-03-18 | 1962-01-30 | Polaroid Corp | Photographic process, products and compositions |
| US3034894A (en) * | 1959-06-24 | 1962-05-15 | Eastman Kodak Co | Hardening of gelatin |
| CA684250A (en) * | 1959-08-03 | 1964-04-14 | W. Lutes Harriet | Photographic products and processes |
| US3061437A (en) * | 1959-10-26 | 1962-10-30 | Eastman Kodak Co | Sulfone bis-quaternary salts as sensitizers for photographic emulsions |
| US3065075A (en) * | 1960-07-13 | 1962-11-20 | Polaroid Corp | Photographic products and processes utilizing triptycene diol silver halide developers |
| US3077400A (en) * | 1962-04-26 | 1963-02-12 | Polaroid Corp | Color diffusion transfer using gelatinsilver halide emulsions containing cellulose ethers |
-
0
- NL NL268156D patent/NL268156A/xx unknown
- NL NL122760D patent/NL122760C/xx active
-
1960
- 1960-08-22 US US50851A patent/US3173786A/en not_active Expired - Lifetime
-
1961
- 1961-08-21 GB GB30108/61A patent/GB938865A/en not_active Expired
- 1961-08-21 CH CH974361A patent/CH407745A/fr unknown
- 1961-08-22 DE DEJ20438A patent/DE1174160B/de active Pending
Patent Citations (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2403927A (en) * | 1942-12-03 | 1946-07-16 | Ilford Ltd | Improvers for photographic emulsions |
| GB601824A (en) * | 1945-10-04 | 1948-05-13 | Elliott & Sons Ltd | Improvements in photographic light sensitive emulsions |
| US2636821A (en) * | 1950-05-05 | 1953-04-28 | Gen Aniline & Film Corp | Process of rendering undevelopable the silver halides present in an outer layer of multilayer color film |
| US2725290A (en) * | 1951-11-14 | 1955-11-29 | Eastman Kodak Co | Development of multi-layer color films with developers containing mercapto azoles |
| GB804971A (en) * | 1954-03-09 | 1958-11-26 | Polaroid Corp | Improvements in or relating to photography |
| US2983606A (en) * | 1958-07-14 | 1961-05-09 | Polaroid Corp | Processes and products for forming photographic images in color |
Also Published As
| Publication number | Publication date |
|---|---|
| CH407745A (fr) | 1966-02-15 |
| GB938865A (en) | 1963-10-09 |
| NL268156A (enExample) | |
| NL122760C (enExample) | |
| US3173786A (en) | 1965-03-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1174160B (de) | Verfahren zur Herstellung von Mehrfarben-UEbertragungsbildern | |
| DE1138319B (de) | Verwendung eines besonderen Bildempfangsmaterials fuer das Farbdiffusionsverfahren, insbesondere unter Verwendung von Mehrschichtenfilmen | |
| DE1288911B (de) | Entwicklerfarbstoff-Diffusionsverfahren | |
| DE1155333B (de) | Photographisches Material fuer die Herstellung von mehrfarbigen Bildern nach einem Farbstoffentwicklersubstanzen verwendenden Diffusionsuebertragungsverfahren und Durchfuehrung des Verfahrens | |
| DE721610C (de) | Verfahren zur Herstellung von Naturfarbenbildern durch Umkehrentwicklung von Mehrschichtenfilmen mit Emulsionsschichten auf beiden Seiten des Schichttraegers | |
| DE1547673C3 (de) | Verfahren zur Herstellung von blaugrünen maskierten Bildern auf photographischem Wege | |
| DE1175074B (de) | Photographisches Material mit einer Halogen-silberemulsionsschicht, die das Fixierenueberfluessig macht | |
| DE1083124B (de) | Verfahren zur Sensibilisierung Azofarbstoffe enthaltender Schichten fuer das Silberfarbbleichverfahren | |
| DE2032711A1 (de) | Farbstoffdiffusionsübertragungsverfahren zur Herstellung positiver farbfotografischer Bilder | |
| DE2238051C3 (de) | Verfahren zur Herstellung farbphotographischer Bilder sowie farbphotographisches Aufzeichnungsmaterial | |
| AT265861B (de) | Photographisches Material für ein Farbdiffusions-Übertragungsverfahren | |
| AT248241B (de) | Verfahren zur Entwicklung lichtempfindlicher, zur Erzeugung farbiger Übertragungsbilder dienender photographischer Materialien | |
| DE2164249A1 (de) | Farbent wicklungsverfahren | |
| DE2238052C3 (de) | Photographisches Diffusionsübertragungsverfahren zur Herstellung von Farbbildern sowie photographische Aufzeichnungseinheit zur Durchführung des Verfahrens | |
| DE1253049B (de) | Waessriger Schwarz-Weiss-Entwickler fuer die photographische Umkehrverarbeitung farbphotographischer Materialien | |
| DE2650997C2 (de) | Verfahren zur Herstellung eines Farbbildes nach dem Diffusionsübertragungsverfahren | |
| DE1133977B (de) | Bildempfangsmaterial fuer das Farbdiffusionsuebertragungsverfahren, insbesondere unter Verwendung von Mehrschichtenfilmen | |
| DE1772944A1 (de) | Herstellung photographischer Farbbilder | |
| DE2945368A1 (de) | Verfahren zur erzeugung von farbbildern | |
| DE2021367B2 (de) | Photographisches Aufzeichnungsmaterial für das Farbdiffusionsübertragungsverfahren | |
| DE1167650B (de) | Mehrschichtiges, fuer Mehrfarben-Diffusionsverfahren geeignetes photographisches Material mit Entwicklersubstanzen in der Emulsionsschicht | |
| DE956018C (de) | Verfahren zur Farbkorrektur farbenphotographischer Bilder durch Azofarbstoffmasken | |
| DE1938823C3 (de) | Photographisches Aufzeichnungsmaterial für das Silberfarbbleichverfahren | |
| DE895407C (de) | Verfahren zur Farbkorrektur bei der Farbphotographie | |
| DE2151490C2 (de) | Verfahren zur Herstellung von photographischen Silberbildern oder Farbbildern sowie Aufzeichnungsmaterial hierfür |