DE1168887B - Vorrichtung zur katalytischen Oxydation von Kohlenwasserstoffen - Google Patents
Vorrichtung zur katalytischen Oxydation von KohlenwasserstoffenInfo
- Publication number
- DE1168887B DE1168887B DEC28111A DEC0028111A DE1168887B DE 1168887 B DE1168887 B DE 1168887B DE C28111 A DEC28111 A DE C28111A DE C0028111 A DEC0028111 A DE C0028111A DE 1168887 B DE1168887 B DE 1168887B
- Authority
- DE
- Germany
- Prior art keywords
- tower
- oxidation
- circulation
- reaction
- hydrocarbons
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000007254 oxidation reaction Methods 0.000 title claims description 19
- 230000003647 oxidation Effects 0.000 title claims description 18
- 229930195733 hydrocarbon Natural products 0.000 title description 7
- 150000002430 hydrocarbons Chemical class 0.000 title description 7
- 230000003197 catalytic effect Effects 0.000 title description 2
- 238000006243 chemical reaction Methods 0.000 claims description 17
- 239000007789 gas Substances 0.000 claims description 10
- 239000002904 solvent Substances 0.000 claims description 8
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 6
- 239000001301 oxygen Substances 0.000 claims description 6
- 229910052760 oxygen Inorganic materials 0.000 claims description 6
- 239000011541 reaction mixture Substances 0.000 claims description 5
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 4
- -1 bromine ions Chemical class 0.000 claims description 4
- 229910052794 bromium Inorganic materials 0.000 claims description 4
- 229910001385 heavy metal Inorganic materials 0.000 claims description 4
- CBENFWSGALASAD-UHFFFAOYSA-N Ozone Chemical compound [O-][O+]=O CBENFWSGALASAD-UHFFFAOYSA-N 0.000 claims description 3
- 239000007791 liquid phase Substances 0.000 claims description 3
- 150000003839 salts Chemical class 0.000 claims description 3
- KKEYFWRCBNTPAC-UHFFFAOYSA-N Terephthalic acid Chemical compound OC(=O)C1=CC=C(C(O)=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-N 0.000 description 14
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 12
- URLKBWYHVLBVBO-UHFFFAOYSA-N Para-Xylene Chemical group CC1=CC=C(C)C=C1 URLKBWYHVLBVBO-UHFFFAOYSA-N 0.000 description 9
- 239000007788 liquid Substances 0.000 description 9
- 238000000034 method Methods 0.000 description 5
- QQVIHTHCMHWDBS-UHFFFAOYSA-N isophthalic acid Chemical compound OC(=O)C1=CC=CC(C(O)=O)=C1 QQVIHTHCMHWDBS-UHFFFAOYSA-N 0.000 description 4
- IVSZLXZYQVIEFR-UHFFFAOYSA-N m-xylene Chemical compound CC1=CC=CC(C)=C1 IVSZLXZYQVIEFR-UHFFFAOYSA-N 0.000 description 4
- 241001503485 Mammuthus Species 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- 239000003054 catalyst Substances 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- 125000003118 aryl group Chemical group 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 2
- 238000013021 overheating Methods 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- PWHULOQIROXLJO-UHFFFAOYSA-N Manganese Chemical compound [Mn] PWHULOQIROXLJO-UHFFFAOYSA-N 0.000 description 1
- 208000012868 Overgrowth Diseases 0.000 description 1
- 206010039509 Scab Diseases 0.000 description 1
- 238000005299 abrasion Methods 0.000 description 1
- 238000009825 accumulation Methods 0.000 description 1
- 239000003570 air Substances 0.000 description 1
- 125000002723 alicyclic group Chemical group 0.000 description 1
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 1
- NKQIMNKPSDEDMO-UHFFFAOYSA-L barium bromide Chemical compound [Br-].[Br-].[Ba+2] NKQIMNKPSDEDMO-UHFFFAOYSA-L 0.000 description 1
- 229910001620 barium bromide Inorganic materials 0.000 description 1
- 159000000009 barium salts Chemical class 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 150000001649 bromium compounds Chemical class 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 150000001785 cerium compounds Chemical class 0.000 description 1
- 238000003889 chemical engineering Methods 0.000 description 1
- 239000012295 chemical reaction liquid Substances 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 229910017052 cobalt Inorganic materials 0.000 description 1
- 239000010941 cobalt Substances 0.000 description 1
- 229940011182 cobalt acetate Drugs 0.000 description 1
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 1
- QAHREYKOYSIQPH-UHFFFAOYSA-L cobalt(II) acetate Chemical compound [Co+2].CC([O-])=O.CC([O-])=O QAHREYKOYSIQPH-UHFFFAOYSA-L 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 239000002826 coolant Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 238000005260 corrosion Methods 0.000 description 1
- 230000007797 corrosion Effects 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 230000008021 deposition Effects 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 239000002360 explosive Substances 0.000 description 1
- 230000005484 gravity Effects 0.000 description 1
- 230000006698 induction Effects 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 230000007257 malfunction Effects 0.000 description 1
- 229910052748 manganese Inorganic materials 0.000 description 1
- 239000011572 manganese Substances 0.000 description 1
- 229940071125 manganese acetate Drugs 0.000 description 1
- UOGMEBQRZBEZQT-UHFFFAOYSA-L manganese(2+);diacetate Chemical compound [Mn+2].CC([O-])=O.CC([O-])=O UOGMEBQRZBEZQT-UHFFFAOYSA-L 0.000 description 1
- 150000002736 metal compounds Chemical class 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 150000002894 organic compounds Chemical class 0.000 description 1
- 230000000149 penetrating effect Effects 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 230000000630 rising effect Effects 0.000 description 1
- 238000007789 sealing Methods 0.000 description 1
- 238000005979 thermal decomposition reaction Methods 0.000 description 1
- 238000009827 uniform distribution Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C51/00—Preparation of carboxylic acids or their salts, halides or anhydrides
- C07C51/16—Preparation of carboxylic acids or their salts, halides or anhydrides by oxidation
- C07C51/21—Preparation of carboxylic acids or their salts, halides or anhydrides by oxidation with molecular oxygen
- C07C51/255—Preparation of carboxylic acids or their salts, halides or anhydrides by oxidation with molecular oxygen of compounds containing six-membered aromatic rings without ring-splitting
- C07C51/265—Preparation of carboxylic acids or their salts, halides or anhydrides by oxidation with molecular oxygen of compounds containing six-membered aromatic rings without ring-splitting having alkyl side chains which are oxidised to carboxyl groups
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Engineering & Computer Science (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Priority Applications (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| NL294776D NL294776A (enExample) | 1962-10-06 | ||
| DEC28111A DE1168887B (de) | 1962-10-06 | 1962-10-06 | Vorrichtung zur katalytischen Oxydation von Kohlenwasserstoffen |
| US304390A US3313849A (en) | 1962-10-06 | 1963-08-26 | Method for the catalytic oxidation of hydrocarbons |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEC28111A DE1168887B (de) | 1962-10-06 | 1962-10-06 | Vorrichtung zur katalytischen Oxydation von Kohlenwasserstoffen |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1168887B true DE1168887B (de) | 1964-04-30 |
Family
ID=7018545
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEC28111A Pending DE1168887B (de) | 1962-10-06 | 1962-10-06 | Vorrichtung zur katalytischen Oxydation von Kohlenwasserstoffen |
Country Status (3)
| Country | Link |
|---|---|
| US (1) | US3313849A (enExample) |
| DE (1) | DE1168887B (enExample) |
| NL (1) | NL294776A (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5473101A (en) * | 1991-06-21 | 1995-12-05 | Solvay Interox Limited | Oxidation of alkylaromatics |
Families Citing this family (28)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH527790A (it) * | 1969-07-07 | 1972-09-15 | Sir Soc Italiana Resine Spa | Procedimento per la preparazione di acidi carbossilici aromatici |
| DE2201761C3 (de) * | 1972-01-14 | 1981-07-16 | Maruzen Oil Co., Ltd., Osaka | Verfahren zur Herstellung von Terephthalsäure |
| US7582793B2 (en) | 2004-09-02 | 2009-09-01 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7482482B2 (en) * | 2004-09-02 | 2009-01-27 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7608732B2 (en) * | 2005-03-08 | 2009-10-27 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US20060047153A1 (en) * | 2004-09-02 | 2006-03-02 | Wonders Alan G | Optimized liquid-phase oxidation |
| US7589231B2 (en) * | 2004-09-02 | 2009-09-15 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7572932B2 (en) | 2004-09-02 | 2009-08-11 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7399882B2 (en) * | 2004-09-02 | 2008-07-15 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7507857B2 (en) | 2004-09-02 | 2009-03-24 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7381836B2 (en) * | 2004-09-02 | 2008-06-03 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7692037B2 (en) * | 2004-09-02 | 2010-04-06 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7361784B2 (en) * | 2004-09-02 | 2008-04-22 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7563926B2 (en) * | 2004-09-02 | 2009-07-21 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7910769B2 (en) * | 2004-09-02 | 2011-03-22 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7741515B2 (en) | 2004-09-02 | 2010-06-22 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7683210B2 (en) * | 2004-09-02 | 2010-03-23 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7504535B2 (en) | 2004-09-02 | 2009-03-17 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7586000B2 (en) * | 2004-09-02 | 2009-09-08 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7572936B2 (en) | 2004-09-02 | 2009-08-11 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7608733B2 (en) * | 2004-09-02 | 2009-10-27 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7495125B2 (en) * | 2004-09-02 | 2009-02-24 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7568361B2 (en) * | 2004-09-02 | 2009-08-04 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7692036B2 (en) | 2004-11-29 | 2010-04-06 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7390921B2 (en) * | 2004-09-02 | 2008-06-24 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7884232B2 (en) * | 2005-06-16 | 2011-02-08 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7355068B2 (en) * | 2006-01-04 | 2008-04-08 | Eastman Chemical Company | Oxidation system with internal secondary reactor |
| US7358389B2 (en) * | 2006-01-04 | 2008-04-15 | Eastman Chemical Company | Oxidation system employing internal structure for enhanced hydrodynamics |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2378342A (en) * | 1941-12-31 | 1945-06-12 | Standard Oil Co | Catalytic conversion process and apparatus |
| US2963509A (en) * | 1958-03-10 | 1960-12-06 | Mid Century Corp | Process for oxidation of mono-alkyl benzene |
-
0
- NL NL294776D patent/NL294776A/xx unknown
-
1962
- 1962-10-06 DE DEC28111A patent/DE1168887B/de active Pending
-
1963
- 1963-08-26 US US304390A patent/US3313849A/en not_active Expired - Lifetime
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5473101A (en) * | 1991-06-21 | 1995-12-05 | Solvay Interox Limited | Oxidation of alkylaromatics |
Also Published As
| Publication number | Publication date |
|---|---|
| NL294776A (enExample) | |
| US3313849A (en) | 1967-04-11 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1168887B (de) | Vorrichtung zur katalytischen Oxydation von Kohlenwasserstoffen | |
| DE69610278T2 (de) | Verfahren und Vorrichtung zur Oxidation von alkylaromatischen Verbindungen zu aromatischen Carbonsäuren | |
| DE69927802T2 (de) | Herstellung von organischen säuren | |
| DE69511756T2 (de) | Herstellung von Terephthalsäure unter Verwendung der Abdampfungskühlung | |
| DE1493192A1 (de) | Verfahren zur Herstellung von aromatischen Saeuren | |
| DE3704720C2 (enExample) | ||
| US3850981A (en) | Liquid phase oxidation of p-xylene to terephthalic acid | |
| DE69522365T2 (de) | Verbesserungen bei der Oxidation organischer Chemikalien | |
| DE69425811T2 (de) | Herstellung von Terephthalsäure | |
| DE69609913T2 (de) | Verfahren zur Herstellung der aromatischen Carbonsäuren | |
| US2766273A (en) | Esterification of acids | |
| DE1919335A1 (de) | Fluessigphasenoxydation von p-Xylol zu Terephthalsaeure | |
| DE2708034A1 (de) | Verfahren und vorrichtung zur herstellung von aromatischen dicarbonsaeuren | |
| DE1927937A1 (de) | Verfahren zur Herstellung von Benzoldicarbonsaeuren bzw. Benzoldicarbonsaeureestern | |
| JPS61112044A (ja) | アルキル芳香族の液相酸化方法 | |
| JP2019524661A5 (enExample) | ||
| DE1443435A1 (de) | Kontinuierliches Verfahren zu Oxydation aromatischer Verbindungen mit Salpetersaeure | |
| US2800504A (en) | Production of lower aliphatic acids | |
| DE2540291C3 (de) | Verfahren zur kontinuierlichen Herstellung von 1,2-Dichloräthan und Katalysatorbehälter als Bestandteil einer Vorrichtung zur Durchführung des genannten Verfahrens | |
| DE971554C (de) | Verfahren und Vorrichtung zur Herstellung von Carbonsaeuren durch Oxydation organischer Stoffe mit Salpetersaeure | |
| DE926846C (de) | Verfahren zur Durchfuehrung exothermer Reaktionen, an denen Gase oder Daempfe und Fluessigkeiten beteiligt sind | |
| EP0017058B1 (de) | Verfahren zur kontinuierlichen Herstellung von Phthalimid | |
| KR910014146A (ko) | 강화된 기체-액체 반응 | |
| DE2030410C3 (de) | Verfahren zur thermischen Spaltung von Kohlenwasserstoffen | |
| DE1467471A1 (de) | Verfahren zur Herstellung von Pigmenten |