DE1165673B - Vorrichtung zum automatischen Waehlen einer Telefonnummer - Google Patents
Vorrichtung zum automatischen Waehlen einer TelefonnummerInfo
- Publication number
- DE1165673B DE1165673B DEW28572A DEW0028572A DE1165673B DE 1165673 B DE1165673 B DE 1165673B DE W28572 A DEW28572 A DE W28572A DE W0028572 A DEW0028572 A DE W0028572A DE 1165673 B DE1165673 B DE 1165673B
- Authority
- DE
- Germany
- Prior art keywords
- card
- contacts
- contact
- pulse generator
- telephone
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 230000005540 biological transmission Effects 0.000 claims description 7
- 230000007723 transport mechanism Effects 0.000 description 25
- 210000000078 claw Anatomy 0.000 description 20
- 230000033001 locomotion Effects 0.000 description 13
- 230000007246 mechanism Effects 0.000 description 11
- 238000000034 method Methods 0.000 description 10
- 230000008569 process Effects 0.000 description 10
- 239000011159 matrix material Substances 0.000 description 6
- 230000009471 action Effects 0.000 description 2
- 239000003990 capacitor Substances 0.000 description 2
- 238000010276 construction Methods 0.000 description 2
- 230000000994 depressogenic effect Effects 0.000 description 2
- 238000013461 design Methods 0.000 description 2
- 238000010586 diagram Methods 0.000 description 2
- 230000005484 gravity Effects 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 230000035515 penetration Effects 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 238000012546 transfer Methods 0.000 description 2
- 230000008859 change Effects 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 238000004891 communication Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 230000005611 electricity Effects 0.000 description 1
- 238000009434 installation Methods 0.000 description 1
- 239000011810 insulating material Substances 0.000 description 1
- 239000012212 insulator Substances 0.000 description 1
- 238000012423 maintenance Methods 0.000 description 1
- 230000004044 response Effects 0.000 description 1
- 238000007493 shaping process Methods 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000013589 supplement Substances 0.000 description 1
- OWWYREKLGMILGW-UHFFFAOYSA-N δline Chemical compound COC1C2C3C4(C5C6OC(C)=O)C(OC)CCC5(C)CN(CC)C4C46OCOC42CC(OC)C1C3 OWWYREKLGMILGW-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H04—ELECTRIC COMMUNICATION TECHNIQUE
- H04M—TELEPHONIC COMMUNICATION
- H04M1/00—Substation equipment, e.g. for use by subscribers
- H04M1/26—Devices for calling a subscriber
- H04M1/27—Devices whereby a plurality of signals may be stored simultaneously
- H04M1/274—Devices whereby a plurality of signals may be stored simultaneously with provision for storing more than one subscriber number at a time, e.g. using toothed disc
- H04M1/278—Devices whereby a plurality of signals may be stored simultaneously with provision for storing more than one subscriber number at a time, e.g. using toothed disc using punched cards or tapes
Landscapes
- Engineering & Computer Science (AREA)
- Signal Processing (AREA)
- Credit Cards Or The Like (AREA)
- Prepayment Telephone Systems (AREA)
- Control Of Vending Devices And Auxiliary Devices For Vending Devices (AREA)
- Auxiliary Devices For And Details Of Packaging Control (AREA)
- Control Of Conveyors (AREA)
- Crushing And Pulverization Processes (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US84405459A | 1959-10-02 | 1959-10-02 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1165673B true DE1165673B (de) | 1964-03-19 |
Family
ID=34634699
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEW28572A Pending DE1165673B (de) | 1959-10-02 | 1960-09-15 | Vorrichtung zum automatischen Waehlen einer Telefonnummer |
Country Status (9)
| Country | Link |
|---|---|
| US (3) | US3114036A (enExample) |
| JP (1) | JPS3810407B1 (enExample) |
| BE (2) | BE595602A (enExample) |
| CH (2) | CH411044A (enExample) |
| DE (1) | DE1165673B (enExample) |
| ES (1) | ES261531A1 (enExample) |
| FR (2) | FR1271832A (enExample) |
| GB (3) | GB961546A (enExample) |
| NL (3) | NL7211175A (enExample) |
Families Citing this family (19)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3250168A (en) * | 1963-02-14 | 1966-05-10 | Steinthal & Co Inc M | Preselector for the tonal control elements of an organ |
| US3293367A (en) * | 1963-08-27 | 1966-12-20 | Loehr John | Binary switching intercommunicating telephone system |
| US3286040A (en) * | 1963-10-31 | 1966-11-15 | Bell Telephone Labor Inc | Call transmitter employing a code bearing medium |
| US3340362A (en) * | 1963-11-19 | 1967-09-05 | Paul B Williams | Card reader monitoring and alarm system |
| US3320369A (en) * | 1964-03-20 | 1967-05-16 | Bell Telephone Labor Inc | Automatic code transmitter utilizing a code bearing medium having bits of information |
| US3406604A (en) * | 1965-09-07 | 1968-10-22 | Elmer E. Stickley | Time and rhythm indicating device |
| US3493730A (en) * | 1966-09-14 | 1970-02-03 | Western Electric Co | Data input card |
| US3514545A (en) * | 1967-04-05 | 1970-05-26 | Louis Pontecorvo | Automatic telephone switching device |
| US3514549A (en) * | 1967-06-01 | 1970-05-26 | American Telephone & Telegraph | Call transmitter |
| GB1193208A (en) * | 1968-05-31 | 1970-05-28 | Sontranic Ltd | Improved Code Cards for Automatic Telephone Dialling. |
| US3686573A (en) * | 1969-09-18 | 1972-08-22 | Coaxial Scient Corp | Non-duplication switching arrangement for cable television transmission |
| US3755655A (en) * | 1971-10-26 | 1973-08-28 | Tac Ind Inc | Machine processed data card |
| US4081618A (en) * | 1975-04-10 | 1978-03-28 | Vendramini D | Automatic telephone dialling apparatus |
| USD247898S (en) | 1976-04-08 | 1978-05-16 | Varel B.V. | Automatic telephone dialing unit |
| US4196345A (en) * | 1978-06-02 | 1980-04-01 | Tektronix, Inc. | Operating parameter selection and entry device |
| US4185400A (en) * | 1978-08-14 | 1980-01-29 | Sears, Roebuck And Co. | Typewriter with instructional apparatus |
| GB2118099B (en) * | 1982-02-23 | 1986-12-03 | Confon Ag | Telephone card index with automatic dialing |
| USD291436S (en) | 1984-04-13 | 1987-08-18 | Tie/Communications, Inc. | Telephone set |
| USD449855S1 (en) | 1999-11-05 | 2001-10-30 | Joel B. Shamitoff | Rotary phone dial writing instrument |
Citations (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE663777C (de) * | 1936-03-10 | 1938-08-13 | Curt Mueller | Zusatzeinrichtung fuer Selbstanschlussfernsprechapparate |
| DE886929C (de) * | 1950-07-21 | 1953-08-20 | Ericsson Telefon Ab L M | Zahlengeber mit Druckknoepfen |
| DE947175C (de) * | 1953-10-13 | 1956-08-09 | James Kilburg Corp | Vorrichtung fuer das selbsttaetige Waehlen ueber Fernsprechleitungen |
| DE1001713B (de) * | 1953-12-07 | 1957-01-31 | Telefonbau & Normalzeit Gmbh | Telefonteilnehmerstation mit tastengesteuerter Frequenzwahl und einem Schichttransistoren enthaltenden Mikrophonverstaerker |
| DE958660C (de) * | 1954-10-15 | 1957-02-21 | Friedrich Karl Hilke | Anordnung zur automatischen Wahl von Fernsprechnummern |
| DE961550C (de) * | 1954-10-15 | 1957-04-11 | Friedrich Karl Hilke | Anordnung zur automatischen Wahl von Fernsprechnummern |
| DE1015490B (de) * | 1955-07-09 | 1957-09-12 | Phil Habil Oskar Vierling Dr | Nummerngeber zur automatischen Aussendung von Wahlimpulsserien in Fernsprechanlagen |
| DE1020372B (de) | 1955-07-27 | 1957-12-05 | Carl A Schmitt | Geraet zum selbsttaetigen Waehlen von mehrstelligen Fernsprechnummern od. dgl. mittels an Abtastorganen selbsttaetig vorbeigefuehrter Lochkarten |
| DE1034701B (de) * | 1956-09-28 | 1958-07-24 | Siemens Ag | Schaltungsanordnung fuer Teilnehmerstellen in Fernmelde-, insbesondere Fernsprechanlagen, mit Tastaturwahl |
| DE1050835B (enExample) * | 1957-03-14 | 1959-02-19 |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2095298A (en) * | 1935-10-30 | 1937-10-12 | Ibm | Telephone system |
| US2308927A (en) * | 1938-05-28 | 1943-01-19 | Maul Michael | Sorting machine |
| US2561298A (en) * | 1948-01-30 | 1951-07-17 | Vanheerswynghels Joseph | Impulse transmitter for automatic telephone systems |
| US2567812A (en) * | 1948-03-26 | 1951-09-11 | Bell Telephone Labor Inc | Code transmitter |
| US2760005A (en) * | 1955-03-07 | 1956-08-21 | Western Electric Co | Telephone call originator |
| US2966557A (en) * | 1957-08-01 | 1960-12-27 | Carl A Schmitt | Telephone dialing apparatus |
| US3025358A (en) * | 1958-04-08 | 1962-03-13 | Jr Francis Benedict Hymel | Automatic dialing system |
| US3040133A (en) * | 1958-12-31 | 1962-06-19 | Mc Graw Edison Co | Telephone calling equipment |
| US2988603A (en) * | 1959-01-02 | 1961-06-13 | Kumagai Jinji | Automatic telephone dialing system |
-
0
- US US3124659D patent/US3124659A/en not_active Expired - Lifetime
- NL NL136060D patent/NL136060C/xx active
- NL NL255940D patent/NL255940A/xx unknown
- BE BE632027D patent/BE632027A/xx unknown
- BE BE595602D patent/BE595602A/xx unknown
- GB GB961545D patent/GB961545A/en active Active
-
1960
- 1960-09-15 DE DEW28572A patent/DE1165673B/de active Pending
- 1960-09-22 GB GB8848/64A patent/GB961546A/en not_active Expired
- 1960-09-28 ES ES0261531A patent/ES261531A1/es not_active Expired
- 1960-09-30 JP JP3971760A patent/JPS3810407B1/ja active Pending
- 1960-10-01 FR FR840087A patent/FR1271832A/fr not_active Expired
- 1960-10-03 CH CH124365A patent/CH411044A/de unknown
- 1960-10-03 CH CH1108060A patent/CH391792A/de unknown
-
1961
- 1961-07-21 US US125750A patent/US3114036A/en not_active Expired - Lifetime
-
1962
- 1962-05-08 US US193267A patent/US3189692A/en not_active Expired - Lifetime
-
1963
- 1963-05-07 GB GB17935/63A patent/GB1037812A/en not_active Expired
- 1963-05-08 FR FR934153A patent/FR84056E/fr not_active Expired
-
1972
- 1972-08-16 NL NL7211175A patent/NL7211175A/xx unknown
Patent Citations (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE663777C (de) * | 1936-03-10 | 1938-08-13 | Curt Mueller | Zusatzeinrichtung fuer Selbstanschlussfernsprechapparate |
| DE886929C (de) * | 1950-07-21 | 1953-08-20 | Ericsson Telefon Ab L M | Zahlengeber mit Druckknoepfen |
| DE947175C (de) * | 1953-10-13 | 1956-08-09 | James Kilburg Corp | Vorrichtung fuer das selbsttaetige Waehlen ueber Fernsprechleitungen |
| DE1001713B (de) * | 1953-12-07 | 1957-01-31 | Telefonbau & Normalzeit Gmbh | Telefonteilnehmerstation mit tastengesteuerter Frequenzwahl und einem Schichttransistoren enthaltenden Mikrophonverstaerker |
| DE958660C (de) * | 1954-10-15 | 1957-02-21 | Friedrich Karl Hilke | Anordnung zur automatischen Wahl von Fernsprechnummern |
| DE961550C (de) * | 1954-10-15 | 1957-04-11 | Friedrich Karl Hilke | Anordnung zur automatischen Wahl von Fernsprechnummern |
| DE1015490B (de) * | 1955-07-09 | 1957-09-12 | Phil Habil Oskar Vierling Dr | Nummerngeber zur automatischen Aussendung von Wahlimpulsserien in Fernsprechanlagen |
| DE1020372B (de) | 1955-07-27 | 1957-12-05 | Carl A Schmitt | Geraet zum selbsttaetigen Waehlen von mehrstelligen Fernsprechnummern od. dgl. mittels an Abtastorganen selbsttaetig vorbeigefuehrter Lochkarten |
| DE1034701B (de) * | 1956-09-28 | 1958-07-24 | Siemens Ag | Schaltungsanordnung fuer Teilnehmerstellen in Fernmelde-, insbesondere Fernsprechanlagen, mit Tastaturwahl |
| DE1050835B (enExample) * | 1957-03-14 | 1959-02-19 |
Also Published As
| Publication number | Publication date |
|---|---|
| CH391792A (de) | 1965-05-15 |
| GB961546A (en) | 1964-06-24 |
| JPS3810407B1 (enExample) | 1963-06-26 |
| US3114036A (en) | 1963-12-10 |
| BE595602A (enExample) | |
| GB961545A (enExample) | |
| NL136060C (enExample) | |
| ES261531A1 (es) | 1961-01-16 |
| US3124659A (en) | 1964-03-10 |
| BE632027A (enExample) | |
| NL7211175A (enExample) | 1972-11-27 |
| FR1271832A (fr) | 1961-09-15 |
| NL255940A (enExample) | |
| US3189692A (en) | 1965-06-15 |
| CH411044A (de) | 1966-04-15 |
| FR84056E (fr) | 1964-11-20 |
| GB1037812A (en) | 1966-08-03 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1165673B (de) | Vorrichtung zum automatischen Waehlen einer Telefonnummer | |
| DE1812466A1 (de) | Verfahren und Vorrichtung fuer die automatische Fernsteuerung eines Computers mit Hilfe bestehender Telephonanlagen | |
| DE2057676C3 (de) | Anordnung zum Überprüfen von Kreditkarten | |
| DE2233170A1 (de) | Tastschalter mit einem in einem gehaeuse verschiebbaren tastenstoessel | |
| DE1815995B2 (de) | Fernsprechwaehlvorrichtung | |
| DE646257C (de) | Druckende Tabelliermaschine mit Einrichtung zur Bildung von Salden positiver und negativer Posten | |
| CH662685A5 (de) | Vorrichtung zum speichern und wiedergeben von informationen. | |
| AT234158B (de) | Einrichtung zur automatischen Übertragung von der Kodierung einer Kodekarte entsprechenden Gleichstrom-Wählsignalen | |
| DE3037510C2 (de) | Merkblattregister mit einer Vorrichtung zur Durchführung einer Wahl in Fernmelde-, insbesondere Fernsprechanlagen | |
| AT378876B (de) | Merkblattregister | |
| DE279430C (enExample) | ||
| DE430668C (de) | Elektromechanische Vorrichtung zur selbsttaetigen UEbertragung der amtlichen Zeit auf grosse Entfernungen mit Hilfe eines Fernsprechnetzes | |
| DE904055C (de) | Folgesteuervorrichtung, insbesondere fuer Drucktelegraphensysteme | |
| DE357038C (de) | Schaltungsanordnung fuer Fernsprechanlagen | |
| DE94996C (enExample) | ||
| AT372229B (de) | Merkblattregister | |
| DE260809C (enExample) | ||
| DE574522C (de) | Boersenkursanzeigeeinrichtung | |
| DE617065C (de) | Selbsttaetiger Stromstossgeber, insbesondere fuer Teilnehmerstellen von Selbstanschluss-Fernsprechanlagen | |
| DE270067C (enExample) | ||
| DE428209C (de) | Drucktelegraph | |
| AT373460B (de) | Merkblattregister mit einer vorrichtung zur durchfuehrung einer wahl in fernmelde-, insbesondere fernsprechanlagen | |
| DE73838C (de) | Vorrichtung zur elektrischen Zeichengebung (Drucktelegraph) | |
| DE1088106B (de) | Telefonnummern-Waehlmaschine | |
| DE923305C (de) | Elektrische Fernmeldeanlage |