DE1161877B - Verfahren zur Abtrennung von Perfluorkohlenstoffen - Google Patents
Verfahren zur Abtrennung von PerfluorkohlenstoffenInfo
- Publication number
- DE1161877B DE1161877B DENDAT1161877D DE1161877DA DE1161877B DE 1161877 B DE1161877 B DE 1161877B DE NDAT1161877 D DENDAT1161877 D DE NDAT1161877D DE 1161877D A DE1161877D A DE 1161877DA DE 1161877 B DE1161877 B DE 1161877B
- Authority
- DE
- Germany
- Prior art keywords
- column
- tetrafluoroethylene
- mixture
- pyrolysis
- compounds
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 19
- 238000000926 separation method Methods 0.000 title claims description 10
- 239000000203 mixture Substances 0.000 claims description 32
- NBVXSUQYWXRMNV-UHFFFAOYSA-N fluoromethane Chemical compound FC NBVXSUQYWXRMNV-UHFFFAOYSA-N 0.000 claims description 29
- BFKJFAAPBSQJPD-UHFFFAOYSA-N tetrafluoroethene Chemical group FC(F)=C(F)F BFKJFAAPBSQJPD-UHFFFAOYSA-N 0.000 claims description 29
- 238000000197 pyrolysis Methods 0.000 claims description 28
- HCDGVLDPFQMKDK-UHFFFAOYSA-N hexafluoropropylene Chemical group FC(F)=C(F)C(F)(F)F HCDGVLDPFQMKDK-UHFFFAOYSA-N 0.000 claims description 27
- -1 ethylene, hexafluoropropylene Chemical group 0.000 claims description 23
- BCCOBQSFUDVTJQ-UHFFFAOYSA-N octafluorocyclobutane Chemical compound FC1(F)C(F)(F)C(F)(F)C1(F)F BCCOBQSFUDVTJQ-UHFFFAOYSA-N 0.000 claims description 20
- 235000019407 octafluorocyclobutane Nutrition 0.000 claims description 20
- VOPWNXZWBYDODV-UHFFFAOYSA-N Chlorodifluoromethane Chemical compound FC(F)Cl VOPWNXZWBYDODV-UHFFFAOYSA-N 0.000 claims description 19
- 238000009835 boiling Methods 0.000 claims description 17
- GRCDJFHYVYUNHM-UHFFFAOYSA-N bromodifluoromethane Chemical compound FC(F)Br GRCDJFHYVYUNHM-UHFFFAOYSA-N 0.000 claims description 15
- RWRIWBAIICGTTQ-UHFFFAOYSA-N difluoromethane Chemical compound FCF RWRIWBAIICGTTQ-UHFFFAOYSA-N 0.000 claims description 13
- YMWUJEATGCHHMB-UHFFFAOYSA-N dichloromethane Natural products ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 claims description 11
- 150000001875 compounds Chemical class 0.000 claims description 9
- 238000000895 extractive distillation Methods 0.000 claims description 9
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 claims description 9
- 239000000460 chlorine Substances 0.000 claims description 8
- 238000004821 distillation Methods 0.000 claims description 8
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 7
- 229910052801 chlorine Inorganic materials 0.000 claims description 7
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 claims description 6
- XPDWGBQVDMORPB-UHFFFAOYSA-N Fluoroform Chemical compound FC(F)F XPDWGBQVDMORPB-UHFFFAOYSA-N 0.000 claims description 6
- 239000007789 gas Substances 0.000 claims description 6
- 239000007858 starting material Substances 0.000 claims description 6
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 claims description 6
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 5
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 5
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 5
- 229910052794 bromium Inorganic materials 0.000 claims description 5
- 229910000041 hydrogen chloride Inorganic materials 0.000 claims description 5
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 claims description 5
- MIZLGWKEZAPEFJ-UHFFFAOYSA-N 1,1,2-trifluoroethene Chemical group FC=C(F)F MIZLGWKEZAPEFJ-UHFFFAOYSA-N 0.000 claims description 4
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 4
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 claims description 4
- 239000005977 Ethylene Substances 0.000 claims description 4
- 229910052799 carbon Inorganic materials 0.000 claims description 4
- CVSVTCORWBXHQV-UHFFFAOYSA-N creatine Chemical compound NC(=[NH2+])N(C)CC([O-])=O CVSVTCORWBXHQV-UHFFFAOYSA-N 0.000 claims description 4
- 239000001257 hydrogen Substances 0.000 claims description 4
- 229910052739 hydrogen Inorganic materials 0.000 claims description 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 3
- 150000008282 halocarbons Chemical class 0.000 claims description 3
- 229910052736 halogen Inorganic materials 0.000 claims description 3
- 229930195733 hydrocarbon Natural products 0.000 claims description 3
- 239000007788 liquid Substances 0.000 claims description 3
- TXEYQDLBPFQVAA-UHFFFAOYSA-N tetrafluoromethane Chemical compound FC(F)(F)F TXEYQDLBPFQVAA-UHFFFAOYSA-N 0.000 claims description 3
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 claims description 2
- CYTYCFOTNPOANT-UHFFFAOYSA-N Perchloroethylene Chemical group ClC(Cl)=C(Cl)Cl CYTYCFOTNPOANT-UHFFFAOYSA-N 0.000 claims description 2
- NEHMKBQYUWJMIP-NJFSPNSNSA-N chloro(114C)methane Chemical compound [14CH3]Cl NEHMKBQYUWJMIP-NJFSPNSNSA-N 0.000 claims description 2
- 150000002430 hydrocarbons Chemical class 0.000 claims description 2
- 229950011008 tetrachloroethylene Drugs 0.000 claims description 2
- 239000000126 substance Substances 0.000 claims 3
- 125000001931 aliphatic group Chemical group 0.000 claims 2
- 239000003795 chemical substances by application Substances 0.000 claims 2
- 239000000047 product Substances 0.000 claims 2
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 claims 1
- 239000004215 Carbon black (E152) Substances 0.000 claims 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 claims 1
- PMPVIKIVABFJJI-UHFFFAOYSA-N Cyclobutane Chemical compound C1CCC1 PMPVIKIVABFJJI-UHFFFAOYSA-N 0.000 claims 1
- VCKRHIGMZZZLHY-UHFFFAOYSA-N FC=C(F)F.[Br] Chemical compound FC=C(F)F.[Br] VCKRHIGMZZZLHY-UHFFFAOYSA-N 0.000 claims 1
- PRPAGESBURMWTI-UHFFFAOYSA-N [C].[F] Chemical class [C].[F] PRPAGESBURMWTI-UHFFFAOYSA-N 0.000 claims 1
- 230000027455 binding Effects 0.000 claims 1
- 238000009739 binding Methods 0.000 claims 1
- 239000006227 byproduct Substances 0.000 claims 1
- 125000003963 dichloro group Chemical group Cl* 0.000 claims 1
- 239000003337 fertilizer Substances 0.000 claims 1
- XUCNUKMRBVNAPB-UHFFFAOYSA-N fluoroethene Chemical group FC=C XUCNUKMRBVNAPB-UHFFFAOYSA-N 0.000 claims 1
- 238000004519 manufacturing process Methods 0.000 claims 1
- 238000006116 polymerization reaction Methods 0.000 claims 1
- 238000010992 reflux Methods 0.000 claims 1
- 125000001424 substituent group Chemical group 0.000 claims 1
- 239000013589 supplement Substances 0.000 claims 1
- 239000004338 Dichlorodifluoromethane Substances 0.000 description 10
- PXBRQCKWGAHEHS-UHFFFAOYSA-N dichlorodifluoromethane Chemical compound FC(F)(Cl)Cl PXBRQCKWGAHEHS-UHFFFAOYSA-N 0.000 description 10
- 235000019404 dichlorodifluoromethane Nutrition 0.000 description 10
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 9
- 238000006243 chemical reaction Methods 0.000 description 6
- OTMSDBZUPAUEDD-UHFFFAOYSA-N Ethane Chemical compound CC OTMSDBZUPAUEDD-UHFFFAOYSA-N 0.000 description 4
- 239000000463 material Substances 0.000 description 4
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 3
- 229910052731 fluorine Inorganic materials 0.000 description 3
- 239000011737 fluorine Substances 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- BOUGCJDAQLKBQH-UHFFFAOYSA-N 1-chloro-1,2,2,2-tetrafluoroethane Chemical compound FC(Cl)C(F)(F)F BOUGCJDAQLKBQH-UHFFFAOYSA-N 0.000 description 2
- BKWAVXQSZLEURV-UHFFFAOYSA-N 2-chloro-1,1,1,3,3,3-hexafluoropropane Chemical compound FC(F)(F)C(Cl)C(F)(F)F BKWAVXQSZLEURV-UHFFFAOYSA-N 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 2
- 229910000990 Ni alloy Inorganic materials 0.000 description 2
- 238000010521 absorption reaction Methods 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- 150000001722 carbon compounds Chemical class 0.000 description 2
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 2
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 2
- 230000035484 reaction time Effects 0.000 description 2
- BSRRYOGYBQJAFP-UHFFFAOYSA-N 1,1,1,2,2,3-hexafluorobutane Chemical compound CC(F)C(F)(F)C(F)(F)F BSRRYOGYBQJAFP-UHFFFAOYSA-N 0.000 description 1
- LVGUZGTVOIAKKC-UHFFFAOYSA-N 1,1,1,2-tetrafluoroethane Chemical compound FCC(F)(F)F LVGUZGTVOIAKKC-UHFFFAOYSA-N 0.000 description 1
- NSGXIBWMJZWTPY-UHFFFAOYSA-N 1,1,1,3,3,3-hexafluoropropane Chemical compound FC(F)(F)CC(F)(F)F NSGXIBWMJZWTPY-UHFFFAOYSA-N 0.000 description 1
- DDMOUSALMHHKOS-UHFFFAOYSA-N 1,2-dichloro-1,1,2,2-tetrafluoroethane Chemical compound FC(F)(Cl)C(F)(F)Cl DDMOUSALMHHKOS-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- 229910000851 Alloy steel Inorganic materials 0.000 description 1
- 239000004341 Octafluorocyclobutane Substances 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- RJCQBQGAPKAMLL-UHFFFAOYSA-N bromotrifluoromethane Chemical compound FC(F)(F)Br RJCQBQGAPKAMLL-UHFFFAOYSA-N 0.000 description 1
- 239000003518 caustics Substances 0.000 description 1
- UUAGAQFQZIEFAH-UHFFFAOYSA-N chlorotrifluoroethylene Chemical group FC(F)=C(F)Cl UUAGAQFQZIEFAH-UHFFFAOYSA-N 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 238000011109 contamination Methods 0.000 description 1
- 238000005260 corrosion Methods 0.000 description 1
- 230000007797 corrosion Effects 0.000 description 1
- 229940087091 dichlorotetrafluoroethane Drugs 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 150000002222 fluorine compounds Chemical class 0.000 description 1
- 238000005194 fractionation Methods 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 150000002431 hydrogen Chemical class 0.000 description 1
- 229910000042 hydrogen bromide Inorganic materials 0.000 description 1
- 230000014759 maintenance of location Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 229910052697 platinum Inorganic materials 0.000 description 1
- QQONPFPTGQHPMA-UHFFFAOYSA-N propylene Natural products CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 description 1
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 description 1
- 229910052709 silver Inorganic materials 0.000 description 1
- 239000004332 silver Substances 0.000 description 1
- 239000010959 steel Substances 0.000 description 1
- JXAQWCZDGUEFSJ-UHFFFAOYSA-K trifluorolead Chemical compound F[Pb](F)F JXAQWCZDGUEFSJ-UHFFFAOYSA-K 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C17/00—Preparation of halogenated hydrocarbons
- C07C17/38—Separation; Purification; Stabilisation; Use of additives
- C07C17/383—Separation; Purification; Stabilisation; Use of additives by distillation
- C07C17/386—Separation; Purification; Stabilisation; Use of additives by distillation with auxiliary compounds
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US25362A US3101304A (en) | 1960-04-28 | 1960-04-28 | Distillation process for fluorocarbons |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1161877B true DE1161877B (de) | 1964-01-30 |
Family
ID=21825587
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DENDAT1161877D Pending DE1161877B (de) | 1960-04-28 | Verfahren zur Abtrennung von Perfluorkohlenstoffen |
Country Status (4)
| Country | Link |
|---|---|
| US (1) | US3101304A (enExample) |
| DE (1) | DE1161877B (enExample) |
| GB (1) | GB910493A (enExample) |
| NL (1) | NL264123A (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0307673A1 (de) * | 1987-09-01 | 1989-03-22 | Hoechst Aktiengesellschaft | Verfahren zur Gewinnung von reinem Tetrafluorethylen |
Families Citing this family (32)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3212998A (en) * | 1962-12-06 | 1965-10-19 | Dow Chemical Co | Azeotropic distillation of bromine |
| NL131714C (enExample) * | 1963-02-06 | |||
| DE1468451B1 (de) * | 1963-10-25 | 1970-01-15 | Onoda Cement Co Ltd | Verfahren zur Abtrennung von Perfluoraethan,Perfluorpropan,Tetrafluoraethylen,Hexafluorpropylen,Perfluorcyclobutan aus ihren Gemischen mit bestimmten Fluorkohlenwasserstoffen |
| DE1251300B (de) * | 1964-12-29 | 1967-10-05 | E I du Pont de Nemours and Company Wilmington Del (V St A) | Verfahren zur Reinigung von Hexa fluorpropylenepoxyd unter Abtrennung von Hexafluorpropylen |
| US3236030A (en) * | 1965-05-03 | 1966-02-22 | Dow Chemical Co | Process for preferentially absorbing and recovering a fluorinated hydrocarbon |
| US3442961A (en) * | 1967-05-03 | 1969-05-06 | Du Pont | Separation of hydrogen chloride from vinylidene fluoride |
| US3522077A (en) * | 1967-08-04 | 1970-07-28 | Westinghouse Electric Corp | Inert plastic package for liquid reagent |
| US3819493A (en) * | 1973-04-26 | 1974-06-25 | Phillips Petroleum Co | Process for separating halogenated hydrocarbons by extractive distillation |
| US3887629A (en) * | 1973-10-01 | 1975-06-03 | Phillips Petroleum Co | Purification of fluorocarbons |
| US4029552A (en) * | 1975-10-24 | 1977-06-14 | Phillips Petroleum Company | Process for obtaining high purity perfluoro-n-heptane |
| US4134796A (en) * | 1977-11-17 | 1979-01-16 | Asahi Glass Company Ltd. | Method of purifying hexafluoropropylene oxide |
| FR2409973A1 (fr) * | 1977-11-28 | 1979-06-22 | Asahi Glass Co Ltd | Procede de purification de l'oxyde d'hexafluoropropylene |
| DE3107967A1 (de) * | 1981-03-03 | 1982-09-16 | Hoechst Ag, 6000 Frankfurt | "verfahren zur herstellung von reinem hexafluorpropylenoxid" |
| US4944846A (en) * | 1988-08-01 | 1990-07-31 | E. I. Dupont De Nemours And Company | Process for the separation of HF via Azeotropic distillation |
| US5094773A (en) * | 1988-08-01 | 1992-03-10 | E. I. Du Pont De Nemours And Company | Azeotropes of HF and process for the separation of HF via azeotropic distillation |
| DE4011820A1 (de) * | 1990-04-12 | 1991-10-17 | Hoechst Ag | Verfahren zur herstellung von gemischen aus chlortetrafluorethan und octafluorcyclobutan |
| US5429720A (en) * | 1993-02-05 | 1995-07-04 | The Dow Chemical Company | Solvent recovery from waste oils |
| US5494601A (en) * | 1993-04-01 | 1996-02-27 | Minnesota Mining And Manufacturing Company | Azeotropic compositions |
| US5401429A (en) * | 1993-04-01 | 1995-03-28 | Minnesota Mining And Manufacturing Company | Azeotropic compositions containing perfluorinated cycloaminoether |
| GB9307923D0 (en) * | 1993-04-16 | 1993-06-02 | Ici Plc | Process for the purification of 1-chloro-2,2,2-trifluroethane |
| AU684757B2 (en) * | 1993-05-25 | 1998-01-08 | Showa Denko Kabushiki Kaisha | Purification process of pentafluoroethane |
| US5919340A (en) * | 1994-08-17 | 1999-07-06 | Daikin Industries Ltd. | Process for recovering pentafluoroethane |
| EP1029840B1 (en) * | 1995-07-14 | 2004-05-06 | E.I. Dupont De Nemours And Company | Process for separating HFC-32 and HFC-125 |
| US5771713A (en) * | 1997-08-20 | 1998-06-30 | Praxair Technology, Inc. | Cryogenic rectification system for recovery of fluorine compounds |
| DE60135096D1 (de) * | 2000-02-29 | 2008-09-11 | Daikin Ind Ltd | Verfahren zur herstellung von tetrafluorethylen |
| EP1985601A3 (en) * | 2000-08-10 | 2008-12-17 | SOLVAY (Société Anonyme) | Process for obtaining a purified hydrofluoroalkane |
| US7189311B2 (en) * | 2001-03-23 | 2007-03-13 | Honeywell International Inc. | Purification of difluoromethane |
| US6605193B2 (en) * | 2001-04-25 | 2003-08-12 | Atofina Chemicals, Inc. | Recovery of HFC-32 |
| RU2211209C1 (ru) * | 2002-03-07 | 2003-08-27 | Открытое акционерное общество "Кирово-Чепецкий химический комбинат им. Б.П. Константинова" | Способ комплексного выделения дифторхлорметана и гексафторпропилена |
| CN103896726B (zh) * | 2014-03-11 | 2015-11-18 | 中昊晨光化工研究院有限公司 | 一种用于四氟乙烯生产中控制水含量的方法和装置 |
| KR20180015646A (ko) | 2015-06-04 | 2018-02-13 | 알케마 인코포레이티드 | 플루오린화된 올레핀의 제조 방법 |
| JP7132523B2 (ja) * | 2020-06-22 | 2022-09-07 | ダイキン工業株式会社 | 精製されたトランス-1,2-ジフルオロエチレン(hfo-1132(e))及び/又は1,1,2-トリフルオロエチレン(hfo-1123)の製造方法 |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2339160A (en) * | 1940-08-02 | 1944-01-11 | Shell Dev | Distillation process |
| US2384449A (en) * | 1943-09-03 | 1945-09-11 | Kinetic Chemicals Inc | Separating fluorine compounds |
| US2551573A (en) * | 1945-11-30 | 1951-05-08 | Du Pont | Pyrolysis of chloro-fluoro alkanes |
-
0
- NL NL264123D patent/NL264123A/xx unknown
- DE DENDAT1161877D patent/DE1161877B/de active Pending
-
1960
- 1960-04-28 US US25362A patent/US3101304A/en not_active Expired - Lifetime
-
1961
- 1961-04-25 GB GB14897/61A patent/GB910493A/en not_active Expired
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0307673A1 (de) * | 1987-09-01 | 1989-03-22 | Hoechst Aktiengesellschaft | Verfahren zur Gewinnung von reinem Tetrafluorethylen |
Also Published As
| Publication number | Publication date |
|---|---|
| GB910493A (en) | 1962-11-14 |
| NL264123A (enExample) | |
| US3101304A (en) | 1963-08-20 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1161877B (de) | Verfahren zur Abtrennung von Perfluorkohlenstoffen | |
| DE69518645T2 (de) | Herstellung von 1,2-dihydro und 2,2-dihydro hexafluorpropanen und ihre azeotrope mit hf | |
| DE69937499T2 (de) | Azeotropes gemisch aus 1,1,1,3,3-pentafluorpropan und 1,1,1-trifluoro-3-chlor-2-propen, eine methode zur trennung und reinigung derselben und ein verfahren zur herstellung von1,1,1,3,3-pentafluorpropan und 1,1,1-trifluor-3-chlor-2-propen | |
| EP0012891B1 (de) | Verfahren zur Herstellung von Dichlorbenzolen | |
| DE69837514T2 (de) | Verfahren zur Abtrennung von Fluorwasserstoff aus seinen Mischungen mit einem Fluorkohlenwasserstoff die 3 bis 6 Kohlenstoffatome enthält | |
| DE69632418T2 (de) | Verfahren zur Trennung von HFC-32 und HFC-125 | |
| EP0451793B1 (de) | Verfahren zur Herstellung von Gemischen aus Chlortetrafluorethan und Octafluorcyclobutan | |
| DE2738418A1 (de) | Verbesserte extraktive destillation zur trennung von c tief 5 -kohlenwasserstoffen | |
| DE1295543B (de) | Verfahren zur Abtrennung von Tetrafluoraethylen aus den bei der Pyrolyse von Chlordifluoraralkan oder Bromdifluormethan anfallenden Gemischen | |
| DE69303093T2 (de) | Verfahren zur Reinigung von einem Hydrofluoralkan | |
| DE2332889C3 (de) | Verfahren zur Trennung von m- und p-Dichlorbenzol | |
| DE69417024T2 (de) | AZEOTROPE UND AZEOTROPARTIGE ZUSAMMENSETZUNGEN UND VERFAHREN ZUR TRENNUNG VON HCl UND HALOGENKOHLENWASSERSTOFFEN | |
| DE1108205B (de) | Verfahren zur Herstellung von Tetrafluoraethylen, Hexafluorpropylen und Perfluorcyclobutan neben Chlorfluor-kohlenwasserstoffen | |
| DE2329750A1 (de) | Verfahren zum pyrolysieren von tetrafluoraethylen zu hexafluorpropylen | |
| DE68912000T2 (de) | Verfahren zur Herstellung von fluorierten konjugierten olefinischen Produkten. | |
| DE69006820T2 (de) | Verfahren zur Herstellung von 1,1-Dichlorotetrafluorethan. | |
| EP0451720B1 (de) | Verfahren zur Trennung von m- und p-Dichlorbenzol | |
| DE19838932A1 (de) | Verfahren zur Gewinnung von Butadien-1,2 | |
| DE2026188B2 (de) | Verfahren zur Abtrennung von Tetrafluoräthylen | |
| DE1901414C (de) | Verfahren zur Trennung von Gemischen aus Vinylfluorid und Acetylen | |
| DE2046071C3 (de) | Verfahren zum Trennen von 1,1,1-Trichloräthan von als Verunreinigung vorliegenden Chlorkohlenwasserstoffe»! | |
| DE1247298B (de) | Verfahren zur Gewinnung von Tetrafluoraethylen oder Hexafluorpropen aus diese Stoffeenthaltenden Gasgemischen | |
| DE2638650A1 (de) | Verfahren zur abtrennung des tetrafluoraethylens von stickstoff und kohlenmonoxid | |
| DE1950995B2 (de) | Verfahren zur Herstellung von 1,1, 1-Trichloräthan | |
| DE1443079C (de) | Verfahren zur Abtrennung von 1,2 Dichlorathan |