DE1136693B - Verfahren zur Herstellung von basisch substituierten Thiolcarbaminsaeure-alkylestern - Google Patents
Verfahren zur Herstellung von basisch substituierten Thiolcarbaminsaeure-alkylesternInfo
- Publication number
- DE1136693B DE1136693B DEF26629A DEF0026629A DE1136693B DE 1136693 B DE1136693 B DE 1136693B DE F26629 A DEF26629 A DE F26629A DE F0026629 A DEF0026629 A DE F0026629A DE 1136693 B DE1136693 B DE 1136693B
- Authority
- DE
- Germany
- Prior art keywords
- general formula
- salts
- substituted
- basic
- acids
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 8
- 238000002360 preparation method Methods 0.000 title claims description 4
- 125000000217 alkyl group Chemical group 0.000 claims description 6
- 150000003839 salts Chemical class 0.000 claims description 6
- CKDWPUIZGOQOOM-UHFFFAOYSA-N Carbamyl chloride Chemical class NC(Cl)=O CKDWPUIZGOQOOM-UHFFFAOYSA-N 0.000 claims description 4
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical class S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 claims description 4
- 239000002253 acid Substances 0.000 claims description 4
- 150000007513 acids Chemical class 0.000 claims description 4
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 4
- 150000003242 quaternary ammonium salts Chemical class 0.000 claims description 4
- IJCVBMSXIPFVLH-UHFFFAOYSA-N [C].S=O Chemical compound [C].S=O IJCVBMSXIPFVLH-UHFFFAOYSA-N 0.000 claims description 2
- 150000001298 alcohols Chemical class 0.000 claims description 2
- 125000002947 alkylene group Chemical group 0.000 claims description 2
- 150000001412 amines Chemical class 0.000 claims description 2
- 125000003277 amino group Chemical group 0.000 claims description 2
- 150000001721 carbon Chemical group 0.000 claims description 2
- 229910052799 carbon Inorganic materials 0.000 claims description 2
- 150000002148 esters Chemical class 0.000 claims description 2
- 125000005843 halogen group Chemical group 0.000 claims description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 2
- 150000002736 metal compounds Chemical class 0.000 claims description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 2
- 150000003560 thiocarbamic acids Chemical class 0.000 claims description 2
- VNMLVHLVBFHHSN-UHFFFAOYSA-N thiophen-2-ylcarbamic acid Chemical class OC(=O)NC1=CC=CS1 VNMLVHLVBFHHSN-UHFFFAOYSA-N 0.000 claims description 2
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 27
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 24
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 12
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 12
- DMBHHRLKUKUOEG-UHFFFAOYSA-N diphenylamine Chemical compound C=1C=CC=CC=1NC1=CC=CC=C1 DMBHHRLKUKUOEG-UHFFFAOYSA-N 0.000 description 10
- 150000007970 thio esters Chemical class 0.000 description 9
- 238000009835 boiling Methods 0.000 description 8
- 238000002844 melting Methods 0.000 description 7
- 230000008018 melting Effects 0.000 description 7
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 6
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 6
- 150000001875 compounds Chemical class 0.000 description 6
- 238000001816 cooling Methods 0.000 description 6
- GABQKHQNXWNJJJ-UHFFFAOYSA-N diphenylcarbamic acid Chemical compound C=1C=CC=CC=1N(C(=O)O)C1=CC=CC=C1 GABQKHQNXWNJJJ-UHFFFAOYSA-N 0.000 description 6
- 239000000203 mixture Substances 0.000 description 6
- 239000008096 xylene Substances 0.000 description 6
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 5
- 239000002904 solvent Substances 0.000 description 5
- 239000000155 melt Substances 0.000 description 4
- 235000002639 sodium chloride Nutrition 0.000 description 4
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 4
- 230000001988 toxicity Effects 0.000 description 4
- 231100000419 toxicity Toxicity 0.000 description 4
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 238000006243 chemical reaction Methods 0.000 description 3
- 238000001704 evaporation Methods 0.000 description 3
- 230000008020 evaporation Effects 0.000 description 3
- 239000000706 filtrate Substances 0.000 description 3
- XNBKKRFABABBPM-UHFFFAOYSA-N n,n-diphenylcarbamoyl chloride Chemical compound C=1C=CC=CC=1N(C(=O)Cl)C1=CC=CC=C1 XNBKKRFABABBPM-UHFFFAOYSA-N 0.000 description 3
- -1 pyridyl radicals Chemical group 0.000 description 3
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- JJWKPURADFRFRB-UHFFFAOYSA-N carbonyl sulfide Chemical compound O=C=S JJWKPURADFRFRB-UHFFFAOYSA-N 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 2
- 238000002329 infrared spectrum Methods 0.000 description 2
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- SNICXCGAKADSCV-JTQLQIEISA-N (-)-Nicotine Chemical compound CN1CCC[C@H]1C1=CC=CN=C1 SNICXCGAKADSCV-JTQLQIEISA-N 0.000 description 1
- LLQHSBBZNDXTIV-UHFFFAOYSA-N 6-[5-[[4-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]piperazin-1-yl]methyl]-4,5-dihydro-1,2-oxazol-3-yl]-3H-1,3-benzoxazol-2-one Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)N1CCN(CC1)CC1CC(=NO1)C1=CC2=C(NC(O2)=O)C=C1 LLQHSBBZNDXTIV-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- 241000700199 Cavia porcellus Species 0.000 description 1
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 1
- OIPILFWXSMYKGL-UHFFFAOYSA-N acetylcholine Chemical compound CC(=O)OCC[N+](C)(C)C OIPILFWXSMYKGL-UHFFFAOYSA-N 0.000 description 1
- 229960004373 acetylcholine Drugs 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 230000001004 anti-acetylcholinic effect Effects 0.000 description 1
- WDIHJSXYQDMJHN-UHFFFAOYSA-L barium chloride Chemical compound [Cl-].[Cl-].[Ba+2] WDIHJSXYQDMJHN-UHFFFAOYSA-L 0.000 description 1
- 229910001626 barium chloride Inorganic materials 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- HRYZWHHZPQKTII-UHFFFAOYSA-N chloroethane Chemical compound CCCl HRYZWHHZPQKTII-UHFFFAOYSA-N 0.000 description 1
- 239000000812 cholinergic antagonist Substances 0.000 description 1
- 230000008602 contraction Effects 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 229960003750 ethyl chloride Drugs 0.000 description 1
- 238000000227 grinding Methods 0.000 description 1
- 125000005842 heteroatom Chemical group 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- 210000000936 intestine Anatomy 0.000 description 1
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- HUDSSSKDWYXKGP-UHFFFAOYSA-N n-phenylpyridin-2-amine Chemical compound C=1C=CC=NC=1NC1=CC=CC=C1 HUDSSSKDWYXKGP-UHFFFAOYSA-N 0.000 description 1
- 229960002715 nicotine Drugs 0.000 description 1
- SNICXCGAKADSCV-UHFFFAOYSA-N nicotine Natural products CN1CCCC1C1=CC=CN=C1 SNICXCGAKADSCV-UHFFFAOYSA-N 0.000 description 1
- 239000003973 paint Substances 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- CBPYOHALYYGNOE-UHFFFAOYSA-M potassium;3,5-dinitrobenzoate Chemical compound [K+].[O-]C(=O)C1=CC([N+]([O-])=O)=CC([N+]([O-])=O)=C1 CBPYOHALYYGNOE-UHFFFAOYSA-M 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 230000000630 rising effect Effects 0.000 description 1
- ODZPKZBBUMBTMG-UHFFFAOYSA-N sodium amide Chemical compound [NH2-].[Na+] ODZPKZBBUMBTMG-UHFFFAOYSA-N 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 230000002048 spasmolytic effect Effects 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 231100001274 therapeutic index Toxicity 0.000 description 1
- ILWRPSCZWQJDMK-UHFFFAOYSA-N triethylazanium;chloride Chemical compound Cl.CCN(CC)CC ILWRPSCZWQJDMK-UHFFFAOYSA-N 0.000 description 1
- DGVVWUTYPXICAM-UHFFFAOYSA-N β‐Mercaptoethanol Chemical compound OCCS DGVVWUTYPXICAM-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/16—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms acylated on ring nitrogen atoms
- C07D295/20—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms acylated on ring nitrogen atoms by radicals derived from carbonic acid, or sulfur or nitrogen analogues thereof
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C333/00—Derivatives of thiocarbamic acids, i.e. compounds containing any of the groups, the nitrogen atom not being part of nitro or nitroso groups
- C07C333/02—Monothiocarbamic acids; Derivatives thereof
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Priority Applications (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEF26629A DE1136693B (de) | 1958-09-18 | 1958-09-18 | Verfahren zur Herstellung von basisch substituierten Thiolcarbaminsaeure-alkylestern |
| US846538A US3228949A (en) | 1958-09-18 | 1959-10-15 | Basic-substituted thioesters of carbamic acid |
| FR837162A FR563M (Direct) | 1958-09-18 | 1960-08-30 |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEF26629A DE1136693B (de) | 1958-09-18 | 1958-09-18 | Verfahren zur Herstellung von basisch substituierten Thiolcarbaminsaeure-alkylestern |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1136693B true DE1136693B (de) | 1962-09-20 |
Family
ID=7092092
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEF26629A Pending DE1136693B (de) | 1958-09-18 | 1958-09-18 | Verfahren zur Herstellung von basisch substituierten Thiolcarbaminsaeure-alkylestern |
Country Status (3)
| Country | Link |
|---|---|
| US (1) | US3228949A (Direct) |
| DE (1) | DE1136693B (Direct) |
| FR (1) | FR563M (Direct) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3621048A (en) * | 1968-03-14 | 1971-11-16 | Colgate Palmolive Co | Quaternary ammonium compounds |
| US5416212A (en) * | 1991-12-25 | 1995-05-16 | Taisho Pharmaceutical Co., Ltd. | Anilide derivatives |
Citations (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB599178A (en) * | 1945-10-03 | 1948-03-05 | John Woolley Batty | Thiolcarbamic esters |
| GB599179A (en) * | 1945-10-03 | 1948-03-05 | John Woolley Batty | Thiolcarbamic esters |
| US2642450A (en) * | 1949-12-13 | 1953-06-16 | Merck & Co Inc | Thiolurethane quaternary ammonium salts and processes for preparing them |
Family Cites Families (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2060733A (en) * | 1934-09-04 | 1936-11-10 | Du Pont | Process of treating cellulose and derivatives thereof |
| US2325720A (en) * | 1939-03-16 | 1943-08-03 | Winthrop Chem Co Inc | Parasiticide |
| US2323940A (en) * | 1939-12-05 | 1943-07-13 | Goodrich Co B F | Vulcanization of rubber |
| GB688726A (en) * | 1949-12-13 | 1953-03-11 | Merck & Co Inc | Thiolurethanes and quaternary ammonium salts derived therefrom, and processes of producing same |
| US2775539A (en) * | 1952-09-06 | 1956-12-25 | Mallinckrodt Chemical Works | Process of and compositions for combating epileptic seizures with atrolactamide |
| US2772288A (en) * | 1953-03-16 | 1956-11-27 | Searle & Co | Basic esters of n-aryl and n-cycloalkyl indancarbamic acids, their salts and methods for their preparation |
| US2772289A (en) * | 1953-03-26 | 1956-11-27 | Searle & Co | Basic esters of n-aralkyl-n-aryl-carbamic acids and the manufacture thereof |
| US2793157A (en) * | 1954-12-28 | 1957-05-21 | Abbott Lab | Anticonvulsant 3-ethyl-5-phenyl hydantoin unit dosages and method of using same |
| US2933519A (en) * | 1956-06-11 | 1960-04-19 | Spafa Spojene Farmaceuticke Zd | Method of manufacturing pharmacodynamically effective basic esters of alkoxy substituted mono-and diphenyl carbamic acids |
| US2914533A (en) * | 1956-11-13 | 1959-11-24 | Sterling Drug Inc | Tertiary-aminoalkyl n-(pyridyl)carbamates and their preparation |
-
1958
- 1958-09-18 DE DEF26629A patent/DE1136693B/de active Pending
-
1959
- 1959-10-15 US US846538A patent/US3228949A/en not_active Expired - Lifetime
-
1960
- 1960-08-30 FR FR837162A patent/FR563M/fr active Active
Patent Citations (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB599178A (en) * | 1945-10-03 | 1948-03-05 | John Woolley Batty | Thiolcarbamic esters |
| GB599179A (en) * | 1945-10-03 | 1948-03-05 | John Woolley Batty | Thiolcarbamic esters |
| US2642450A (en) * | 1949-12-13 | 1953-06-16 | Merck & Co Inc | Thiolurethane quaternary ammonium salts and processes for preparing them |
Also Published As
| Publication number | Publication date |
|---|---|
| FR563M (Direct) | 1960-06-05 |
| US3228949A (en) | 1966-01-11 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE943771C (de) | Verfahren zur Herstellung von neuen, in 1-Stellung substituierten 4-Aminopiperazinderivaten | |
| CH622491A5 (en) | Process for the preparation of novel hydroxypropylamines | |
| DE916168C (de) | Verfahren zur Herstellung von Pyrrolidinoalkylphenothiazinen | |
| DE1136693B (de) | Verfahren zur Herstellung von basisch substituierten Thiolcarbaminsaeure-alkylestern | |
| DE1543531A1 (de) | Verfahren zur Herstellung von halogenierten Estern der Phosphorsaeuren | |
| DE1049865B (de) | Verfahren zur Herstellung von in 3-Stellung acylierten Phenthiazinderivaten | |
| DE2653251A1 (de) | Azabicyclo eckige klammer auf 3.1.o eckige klammer zu hexan-derivate, ihre herstellung und verwendung | |
| DE551777C (de) | Verfahren zur Herstellung von nicht substituierten Carbaminsaeureestern disubstituierter Aminoalkohole | |
| DE1272286C2 (de) | Verfahren zur Herstellung von N-substituierten aliphatischen Thiocarbonsaeureamiden | |
| DE1167587B (de) | Insektizides Mittel | |
| DE959551C (de) | Verfahren zur Herstellung von 4-substituierten 1-Carbobenzoxypiperazinen | |
| DE964862C (de) | Verfahren zur Herstellung von 4-(Aminopropylmercapto)-chinolinverbindungen | |
| DE1246742B (de) | Verfahren zur Herstellung von neuen Phenothiazinen | |
| AT276361B (de) | Verfahren zur Herstellung des neuen p-Methoxybenzyloxy-carbonylfluorids | |
| DE1695757C3 (de) | Pyridinmethanolcarbamate und Verfahren zu deren Herstellung | |
| DE1545568A1 (de) | Verfahren zur Herstellung von substituierten 6-Phenyl-2,3,5,6-tetrahydroimidazo[2,1-b]thiazolen | |
| DE1468351C (de) | Verfahren zur Herstellung von Hydro Chloriden von N Aryl und N Heteroarlyami dinen | |
| AT228772B (de) | Verfahren zur Herstellung von neuen basisch substituierten Malonsäuredinitrilen | |
| DE2007215C (Direct) | ||
| DE859892C (de) | Verfahren zur Herstellung von substituierten Piperidinoessigsaeureestern | |
| AT256835B (de) | Verfahren zur Herstellung von neuen Aminoalkyl-substituierten 5-gliedrigen Heterocyclen und ihren Salzen | |
| DE1161254B (de) | Verfahren zur Herstellung neuer, halogenhaltiger Carbamidsaeureester | |
| DE1150379B (de) | Verfahren zur Herstellung von basisch substituierten Thiolcarbaminsaeurealkylestern | |
| CH558318A (de) | Verfahren zur herstellung von neuen 1,3-diketonen. | |
| DE1695757B2 (de) | Pyridinmethanolcarbamate und verfahren zu deren herstellung |