DE1126668B - Fungizides Mittel - Google Patents
Fungizides MittelInfo
- Publication number
- DE1126668B DE1126668B DEH38312A DEH0038312A DE1126668B DE 1126668 B DE1126668 B DE 1126668B DE H38312 A DEH38312 A DE H38312A DE H0038312 A DEH0038312 A DE H0038312A DE 1126668 B DE1126668 B DE 1126668B
- Authority
- DE
- Germany
- Prior art keywords
- chlorine
- fungicidal agent
- dithiol
- phenyl
- active ingredient
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 239000000417 fungicide Substances 0.000 title claims description 10
- 150000001875 compounds Chemical class 0.000 claims description 15
- 239000004480 active ingredient Substances 0.000 claims description 10
- 239000000460 chlorine Substances 0.000 claims description 10
- 229910052801 chlorine Inorganic materials 0.000 claims description 10
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 6
- 229910052760 oxygen Inorganic materials 0.000 claims description 6
- 239000001301 oxygen Substances 0.000 claims description 6
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 4
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 4
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 3
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical group BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 3
- 229910052794 bromium Chemical group 0.000 claims description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 3
- 125000001037 p-tolyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 claims description 3
- 239000007787 solid Substances 0.000 claims description 3
- 125000001931 aliphatic group Chemical group 0.000 claims description 2
- 239000007788 liquid Substances 0.000 claims description 2
- 125000001309 chloro group Chemical group Cl* 0.000 claims 4
- 125000001246 bromo group Chemical group Br* 0.000 claims 1
- 239000003085 diluting agent Substances 0.000 claims 1
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 12
- 239000000126 substance Substances 0.000 description 9
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 9
- -1 aromatic hydrocarbon radical Chemical group 0.000 description 7
- 230000035784 germination Effects 0.000 description 7
- 239000002689 soil Substances 0.000 description 6
- 239000000243 solution Substances 0.000 description 6
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 4
- 241000196324 Embryophyta Species 0.000 description 4
- PCGDBWLKAYKBTN-UHFFFAOYSA-N 1,2-dithiole Chemical class C1SSC=C1 PCGDBWLKAYKBTN-UHFFFAOYSA-N 0.000 description 3
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 3
- 229910052736 halogen Inorganic materials 0.000 description 3
- 125000005843 halogen group Chemical group 0.000 description 3
- 150000002367 halogens Chemical class 0.000 description 3
- 230000007062 hydrolysis Effects 0.000 description 3
- 238000006460 hydrolysis reaction Methods 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- CTNKPQGFLBZCMV-UHFFFAOYSA-N 3,3,5-trichloro-4-phenyldithiole Chemical compound ClC1(SSC(=C1C1=CC=CC=C1)Cl)Cl CTNKPQGFLBZCMV-UHFFFAOYSA-N 0.000 description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- 241000221785 Erysiphales Species 0.000 description 2
- 241000227653 Lycopersicon Species 0.000 description 2
- 235000007688 Lycopersicon esculentum Nutrition 0.000 description 2
- 238000004458 analytical method Methods 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 150000001721 carbon Chemical group 0.000 description 2
- 235000012343 cottonseed oil Nutrition 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- RWGFKTVRMDUZSP-UHFFFAOYSA-N cumene Chemical compound CC(C)C1=CC=CC=C1 RWGFKTVRMDUZSP-UHFFFAOYSA-N 0.000 description 2
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N diphenyl Chemical compound C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 230000002538 fungal effect Effects 0.000 description 2
- 229910000039 hydrogen halide Inorganic materials 0.000 description 2
- 239000012433 hydrogen halide Substances 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 238000000034 method Methods 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- 241000894007 species Species 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 239000004563 wettable powder Substances 0.000 description 2
- IIVWHGMLFGNMOW-UHFFFAOYSA-N 2-methylpropane Chemical compound C[C](C)C IIVWHGMLFGNMOW-UHFFFAOYSA-N 0.000 description 1
- UKPKVVDYQDZSTL-UHFFFAOYSA-N 4-phenyldithiole-3-thione Chemical compound S=C1SSC=C1C1=CC=CC=C1 UKPKVVDYQDZSTL-UHFFFAOYSA-N 0.000 description 1
- QPCQTYRKSFKFHR-UHFFFAOYSA-N 5-chloro-4-methyldithiol-3-one Chemical compound CC=1C(SSC1Cl)=O QPCQTYRKSFKFHR-UHFFFAOYSA-N 0.000 description 1
- 241001157812 Alternaria brassicicola Species 0.000 description 1
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 1
- 235000008733 Citrus aurantifolia Nutrition 0.000 description 1
- 229920000742 Cotton Polymers 0.000 description 1
- 240000008067 Cucumis sativus Species 0.000 description 1
- 235000010799 Cucumis sativus var sativus Nutrition 0.000 description 1
- 241000233866 Fungi Species 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- 241001518731 Monilinia fructicola Species 0.000 description 1
- 241000233614 Phytophthora Species 0.000 description 1
- YZCKVEUIGOORGS-IGMARMGPSA-N Protium Chemical compound [1H] YZCKVEUIGOORGS-IGMARMGPSA-N 0.000 description 1
- 241001361634 Rhizoctonia Species 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- 235000011941 Tilia x europaea Nutrition 0.000 description 1
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 239000007900 aqueous suspension Substances 0.000 description 1
- 235000010290 biphenyl Nutrition 0.000 description 1
- 239000004305 biphenyl Substances 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 238000005660 chlorination reaction Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000002178 crystalline material Substances 0.000 description 1
- 238000005520 cutting process Methods 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 201000010099 disease Diseases 0.000 description 1
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- SXUYADQBBAAFOO-UHFFFAOYSA-N dithiol-3-one Chemical compound O=C1C=CSS1 SXUYADQBBAAFOO-UHFFFAOYSA-N 0.000 description 1
- 239000000428 dust Substances 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 125000000816 ethylene group Chemical group [H]C([H])([*:1])C([H])([H])[*:2] 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- 230000000855 fungicidal effect Effects 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000003350 kerosene Substances 0.000 description 1
- 239000010985 leather Substances 0.000 description 1
- 239000004571 lime Substances 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 239000004579 marble Substances 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 150000002731 mercury compounds Chemical class 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 230000003472 neutralizing effect Effects 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 239000000123 paper Substances 0.000 description 1
- 230000002085 persistent effect Effects 0.000 description 1
- 239000000575 pesticide Substances 0.000 description 1
- 125000005561 phenanthryl group Chemical group 0.000 description 1
- 230000008659 phytopathology Effects 0.000 description 1
- 229920000136 polysorbate Polymers 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 125000004079 stearyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 238000004448 titration Methods 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
- 239000002023 wood Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D339/00—Heterocyclic compounds containing rings having two sulfur atoms as the only ring hetero atoms
- C07D339/02—Five-membered rings
- C07D339/04—Five-membered rings having the hetero atoms in positions 1 and 2, e.g. lipoic acid
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US794839A US3031372A (en) | 1959-02-24 | 1959-02-24 | Fungicides having the 1, 2-dithiole nucleus |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1126668B true DE1126668B (de) | 1962-03-29 |
Family
ID=25163833
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEH38312A Pending DE1126668B (de) | 1959-02-24 | 1960-01-02 | Fungizides Mittel |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US3031372A (forum.php) |
| BE (1) | BE586027A (forum.php) |
| DE (1) | DE1126668B (forum.php) |
| ES (1) | ES254654A1 (forum.php) |
| FR (1) | FR1248186A (forum.php) |
| GB (1) | GB900805A (forum.php) |
| LU (1) | LU38096A1 (forum.php) |
| NL (1) | NL246993A (forum.php) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3527867A (en) * | 1965-06-11 | 1970-09-08 | Geigy Chem Corp | Agents inhibiting fungus growth and method of controlling fungi therewith |
Families Citing this family (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3873710A (en) * | 1971-07-06 | 1975-03-25 | Betz Laboratories | Synergistic compositions for the control of aerobacter aerogenes |
| US3876792A (en) * | 1971-07-06 | 1975-04-08 | Betz Laboratories | Slime control compositions containing phenolic compounds and their use |
| US3873711A (en) * | 1971-07-06 | 1975-03-25 | Betz Laboratories | Synergistic compositions for the control of aerobacter aerogenes |
| US3873712A (en) * | 1971-07-06 | 1975-03-25 | Betz Laboratories | Synergistic compositions for the control of aerobacter aerogenes |
| US3839008A (en) * | 1971-07-12 | 1974-10-01 | Betz Laboratories | Slime control compositions containing organo-bromine compounds |
| US3903290A (en) * | 1971-09-20 | 1975-09-02 | Bernard F Shema | Slime control composition and its use |
| US3862324A (en) * | 1971-09-20 | 1975-01-21 | Betz Laboratories | Thiocyanate slime control composition and its use |
| US3862323A (en) * | 1971-09-20 | 1975-01-21 | Betz Laboratories | Dioxide slime control composition and its use |
| US4178291A (en) * | 1976-12-03 | 1979-12-11 | E. R. Squibb & Sons, Inc. | Substituted acyl derivatives of amino acids |
-
0
- NL NL246993D patent/NL246993A/xx unknown
- LU LU38096D patent/LU38096A1/xx unknown
- BE BE586027D patent/BE586027A/xx unknown
-
1959
- 1959-02-24 US US794839A patent/US3031372A/en not_active Expired - Lifetime
- 1959-12-22 GB GB43574/59A patent/GB900805A/en not_active Expired
- 1959-12-30 ES ES0254654A patent/ES254654A1/es not_active Expired
- 1959-12-31 FR FR40035A patent/FR1248186A/fr not_active Expired
-
1960
- 1960-01-02 DE DEH38312A patent/DE1126668B/de active Pending
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3527867A (en) * | 1965-06-11 | 1970-09-08 | Geigy Chem Corp | Agents inhibiting fungus growth and method of controlling fungi therewith |
Also Published As
| Publication number | Publication date |
|---|---|
| LU38096A1 (forum.php) | |
| US3031372A (en) | 1962-04-24 |
| NL246993A (forum.php) | |
| ES254654A1 (es) | 1960-05-01 |
| GB900805A (en) | 1962-07-11 |
| FR1248186A (fr) | 1960-10-31 |
| BE586027A (forum.php) |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1126668B (de) | Fungizides Mittel | |
| DE2059872A1 (de) | Thioharnstoffe,Verfahren zu ihrer Herstellung und ihre Verwendung zur Schaedlingsbekaempfung | |
| DE1493022A1 (de) | Verfahren zur Herstellung von alpha-Monochlor-N,N-dialkylacetessigsaeureamiden | |
| DE1297111B (de) | Thiabicyclo-2-nonenverbindungen | |
| DE1209798B (de) | Insektizid, akarizid und fungizid wirksame Mittel | |
| DE1218210B (de) | Fungizide Mittel mit herbizider und nematozider Wirkung | |
| DE1793502C3 (de) | 2-Methyl-5,6-dihydropyran-3-carbonsäureanilide und diese Verbindungen enthaltende Pflanzenschutzmittel | |
| DE2156447A1 (de) | Neue Amidothionophosphonsäureester, Verfahren zu ihrer Herstellung und ihre Verwendung als Herbizide | |
| DE2050979C2 (de) | 3-(5-Sulfamoyl-1,3,4-thiadiazol-2-yl)-harnstoffverbindungen | |
| DE2031907A1 (de) | Fungizide Benzthiadiazolderivate, Ver fahren zu deren Herstellung und Präparate, die die Benzthiadiazolderivate als akti ven Bestandteil enthalten | |
| DE2730523C2 (de) | Nitroalkanolderivate, Verfahren zu deren Herstellung und diese enthaltende Pflanzenschutzmittel | |
| DE2628188A1 (de) | Phenoxyalkylamide und ihre verwendung als akarizide | |
| US2992160A (en) | Alpha-ethynylbenzyl alcohols for agricultural control of fungi | |
| DE2163381A1 (de) | Herbizide Komposition | |
| DE1567191A1 (de) | Verfahren zur Regelung des Wachstums von Pflanzen | |
| DE1932827B2 (de) | Cycloaliphatische imidazolidin-2-on- 1-carbonsaeure-amide, verfahren zu ihrer herstellung sowie ihre verwendung als herbizide | |
| US2705212A (en) | Composition for control of mite and insect pests | |
| AT209347B (de) | Verfahren zur Herstellung von neuen N-Thiotrichlormethylderivaten heterocyclischer Stickstoffverbindungen | |
| DE977346C (de) | Verfahren zur Herstellung von 1, 4, 5, 6, 7, 8, 8-Heptachlor-3a, 4, 7, 7 a-tetrahydro-4, 7-endomethyleninden | |
| AT214456B (de) | Verfahren zur Herstellung der neuen Verbindung Dimethyl-1, 2-dibrom-2, 2-dichloräthylphosphat | |
| AT305688B (de) | Herbizides und fungizides Mittel | |
| AT211603B (de) | Selektive herbizide Mischungen | |
| AT233324B (de) | Mittel zur Bekämpfung von pflanzenpathogenen Mikroorganismen | |
| DE1542715C (de) | Schädlingsbekämpfungsmittel | |
| DE2130675C2 (de) | 2,4-Dichlor-6-anilino-1,3,5-benzotrinitrile und ihre Verwendung als Biozide |