DE1118212B - Verfahren zur Herstellung von N-substituierten Aniliden - Google Patents
Verfahren zur Herstellung von N-substituierten AnilidenInfo
- Publication number
- DE1118212B DE1118212B DEA31562A DEA0031562A DE1118212B DE 1118212 B DE1118212 B DE 1118212B DE A31562 A DEA31562 A DE A31562A DE A0031562 A DEA0031562 A DE A0031562A DE 1118212 B DE1118212 B DE 1118212B
- Authority
- DE
- Germany
- Prior art keywords
- group
- methyl
- general formula
- molecular weight
- halogen atom
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 150000003931 anilides Chemical class 0.000 title claims description 7
- 229940051881 anilide analgesics and antipyretics Drugs 0.000 title claims description 6
- 238000000034 method Methods 0.000 title claims description 5
- 238000002360 preparation method Methods 0.000 title claims description 3
- 239000002253 acid Substances 0.000 claims description 11
- 125000005843 halogen group Chemical group 0.000 claims description 8
- 150000001875 compounds Chemical class 0.000 claims description 7
- 229910052739 hydrogen Inorganic materials 0.000 claims description 7
- 239000001257 hydrogen Substances 0.000 claims description 7
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 6
- 150000003839 salts Chemical class 0.000 claims description 6
- 150000007513 acids Chemical class 0.000 claims description 5
- 125000003545 alkoxy group Chemical group 0.000 claims description 5
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 3
- 150000008065 acid anhydrides Chemical class 0.000 claims description 2
- 125000000217 alkyl group Chemical group 0.000 claims description 2
- 125000005263 alkylenediamine group Chemical group 0.000 claims description 2
- 125000003277 amino group Chemical group 0.000 claims description 2
- 125000004432 carbon atom Chemical group C* 0.000 claims description 2
- 150000004820 halides Chemical class 0.000 claims description 2
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 18
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 9
- 239000000203 mixture Substances 0.000 description 9
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 7
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- 239000010410 layer Substances 0.000 description 5
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 4
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 4
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 4
- 229910052753 mercury Inorganic materials 0.000 description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 4
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 3
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 3
- YHASWHZGWUONAO-UHFFFAOYSA-N butanoyl butanoate Chemical compound CCCC(=O)OC(=O)CCC YHASWHZGWUONAO-UHFFFAOYSA-N 0.000 description 3
- 238000006243 chemical reaction Methods 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- RMMXTBMQSGEXHJ-UHFFFAOYSA-N Aminophenazone Chemical compound O=C1C(N(C)C)=C(C)N(C)N1C1=CC=CC=C1 RMMXTBMQSGEXHJ-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 230000000202 analgesic effect Effects 0.000 description 2
- 229940035676 analgesics Drugs 0.000 description 2
- 239000000730 antalgic agent Substances 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 2
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 2
- 238000005984 hydrogenation reaction Methods 0.000 description 2
- 229910052500 inorganic mineral Inorganic materials 0.000 description 2
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 2
- 235000019341 magnesium sulphate Nutrition 0.000 description 2
- 239000000155 melt Substances 0.000 description 2
- 239000011707 mineral Substances 0.000 description 2
- 235000010755 mineral Nutrition 0.000 description 2
- ZTHRQJQJODGZHV-UHFFFAOYSA-N n-phenylpropanamide Chemical compound CCC(=O)NC1=CC=CC=C1 ZTHRQJQJODGZHV-UHFFFAOYSA-N 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- -1 propionanilide sulfate Chemical compound 0.000 description 2
- WYVAMUWZEOHJOQ-UHFFFAOYSA-N propionic anhydride Chemical compound CCC(=O)OC(=O)CC WYVAMUWZEOHJOQ-UHFFFAOYSA-N 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- NTURQZFFJDCTMZ-UHFFFAOYSA-N 1-(2-bromoethyl)-4-nitrobenzene Chemical compound [O-][N+](=O)C1=CC=C(CCBr)C=C1 NTURQZFFJDCTMZ-UHFFFAOYSA-N 0.000 description 1
- XADCESSVHJOZHK-UHFFFAOYSA-N Meperidine Chemical compound C=1C=CC=CC=1C1(C(=O)OCC)CCN(C)CC1 XADCESSVHJOZHK-UHFFFAOYSA-N 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- 241000906446 Theraps Species 0.000 description 1
- 229960001413 acetanilide Drugs 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 125000004494 ethyl ester group Chemical group 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 150000002431 hydrogen Chemical class 0.000 description 1
- LSACYLWPPQLVSM-UHFFFAOYSA-N isobutyric acid anhydride Chemical compound CC(C)C(=O)OC(=O)C(C)C LSACYLWPPQLVSM-UHFFFAOYSA-N 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- UKVIEHSSVKSQBA-UHFFFAOYSA-N methane;palladium Chemical compound C.[Pd] UKVIEHSSVKSQBA-UHFFFAOYSA-N 0.000 description 1
- PKDTZOXTWAFJEQ-UHFFFAOYSA-N n-[3-(diethylamino)propyl]-n-phenylformamide Chemical compound CCN(CC)CCCN(C=O)C1=CC=CC=C1 PKDTZOXTWAFJEQ-UHFFFAOYSA-N 0.000 description 1
- UHANVDZCDNSILX-UHFFFAOYSA-N n-phenylbutanamide Chemical compound CCCC(=O)NC1=CC=CC=C1 UHANVDZCDNSILX-UHFFFAOYSA-N 0.000 description 1
- PGMBORLSOHYBFJ-UHFFFAOYSA-N n-phenylpentanamide Chemical compound CCCCC(=O)NC1=CC=CC=C1 PGMBORLSOHYBFJ-UHFFFAOYSA-N 0.000 description 1
- ALKIXOSJRUZYPH-UHFFFAOYSA-N n-phenylpropanamide;hydrochloride Chemical compound Cl.CCC(=O)NC1=CC=CC=C1 ALKIXOSJRUZYPH-UHFFFAOYSA-N 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- DUCKXCGALKOSJF-UHFFFAOYSA-N pentanoyl pentanoate Chemical compound CCCCC(=O)OC(=O)CCCC DUCKXCGALKOSJF-UHFFFAOYSA-N 0.000 description 1
- 229960000482 pethidine Drugs 0.000 description 1
- RZWZRACFZGVKFM-UHFFFAOYSA-N propanoyl chloride Chemical compound CCC(Cl)=O RZWZRACFZGVKFM-UHFFFAOYSA-N 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 238000007920 subcutaneous administration Methods 0.000 description 1
- 229940066765 systemic antihistamines substituted ethylene diamines Drugs 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C233/00—Carboxylic acid amides
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Hydrogenated Pyridines (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US721347A US2944081A (en) | 1958-03-14 | 1958-03-14 | Diphenyl alkylenediamines and methods of preparing the same |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1118212B true DE1118212B (de) | 1961-11-30 |
Family
ID=24897608
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEA31562A Pending DE1118212B (de) | 1958-03-14 | 1959-03-11 | Verfahren zur Herstellung von N-substituierten Aniliden |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US2944081A (OSRAM) |
| BE (1) | BE576657A (OSRAM) |
| DE (1) | DE1118212B (OSRAM) |
| ES (2) | ES247825A1 (OSRAM) |
| FR (1) | FR598M (OSRAM) |
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1170961B (de) * | 1962-04-19 | 1964-05-27 | Roehm & Haas Gmbh | Verfahren zur Herstellung von N-(N'-Methyl-N'-ª‰-phenaethylamino-tert.-butyl)-propionaniliden |
| EP0233762A3 (en) * | 1986-02-15 | 1989-05-10 | Beecham - Wuelfing Gmbh & Co. Kg | Use of aromatic diamines for the treatment of angina, and diamines therefor |
| US5602174A (en) * | 1986-02-15 | 1997-02-11 | Beecham Wuefling Gmbh & Co. | Treatment |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB944443A (OSRAM) * | 1959-09-25 | 1900-01-01 | ||
| FR1310207A (OSRAM) * | 1961-01-03 | 1963-03-06 | ||
| US3356724A (en) * | 1961-08-28 | 1967-12-05 | Monsanto Co | Herbicidal alpha-halo-nu-cyclohexyl-acetamides |
| US3255247A (en) * | 1964-09-18 | 1966-06-07 | Monsanto Co | Herbicidal alpha-halo-n-naphthylacetamides |
| US3401202A (en) * | 1966-04-12 | 1968-09-10 | American Cyanamid Co | Novel propionanilides |
| US4180522A (en) * | 1976-12-02 | 1979-12-25 | The Upjohn Company | N-(2-Dimethylaminoalkyl)-3',4'-dichloroanilides |
| US4186208A (en) * | 1976-12-02 | 1980-01-29 | The Upjohn Company | Anti-depressant N-(3,4-dichlorophenyl)-N-dimethylaminoalkylene amides |
| US4286106A (en) * | 1978-08-16 | 1981-08-25 | The Upjohn Company | N-[ω-(Dimethylamino)alkyl]-3',4'-dichloropropionanilides |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US1534525A (en) * | 1924-07-02 | 1925-04-21 | Chem Ind Basel | Acylated diamines |
| US1926015A (en) * | 1929-10-31 | 1933-09-05 | Rosenmund Karl Wilhelm | Manufacture of mono-acylated ethylene-diamine and its derivatives |
| US2654758A (en) * | 1948-08-30 | 1953-10-06 | Schering Corp | Substituted ethylenediamine derivatives |
| US2670373A (en) * | 1950-08-29 | 1954-02-23 | Searle & Co | Halogenated n-aryl-n-dialkylaminoalkyl-arylcarboxamides |
| US2670374A (en) * | 1952-05-17 | 1954-02-23 | Searle & Co | N-dialkylaminoalkyl aminobenzanilides and n-aralkylaminobenzamides and their salts |
| US2746992A (en) * | 1954-04-09 | 1956-05-22 | Hoffmann La Roche | Dialkylaminoalkyl-diphenyl-acetanilides |
| US2851466A (en) * | 1955-02-04 | 1958-09-09 | Miles Lab | Substituted polyamines |
-
1958
- 1958-03-14 US US721347A patent/US2944081A/en not_active Expired - Lifetime
-
1959
- 1959-03-10 ES ES0247825A patent/ES247825A1/es not_active Expired
- 1959-03-10 ES ES0247824A patent/ES247824A1/es not_active Expired
- 1959-03-11 DE DEA31562A patent/DE1118212B/de active Pending
- 1959-03-13 BE BE576657A patent/BE576657A/fr unknown
-
1960
- 1960-08-31 FR FR837454A patent/FR598M/fr active Active
Cited By (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1170961B (de) * | 1962-04-19 | 1964-05-27 | Roehm & Haas Gmbh | Verfahren zur Herstellung von N-(N'-Methyl-N'-ª‰-phenaethylamino-tert.-butyl)-propionaniliden |
| EP0233762A3 (en) * | 1986-02-15 | 1989-05-10 | Beecham - Wuelfing Gmbh & Co. Kg | Use of aromatic diamines for the treatment of angina, and diamines therefor |
| US5494933A (en) * | 1986-02-15 | 1996-02-27 | Beecham-Wuelfing Gmbh & Co. Kg | Treatment |
| US5602174A (en) * | 1986-02-15 | 1997-02-11 | Beecham Wuefling Gmbh & Co. | Treatment |
Also Published As
| Publication number | Publication date |
|---|---|
| ES247824A1 (es) | 1959-07-16 |
| ES247825A1 (es) | 1959-07-01 |
| FR598M (OSRAM) | 1961-06-12 |
| BE576657A (fr) | 1959-09-14 |
| US2944081A (en) | 1960-07-05 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1118212B (de) | Verfahren zur Herstellung von N-substituierten Aniliden | |
| DE2044172C3 (de) | Pyrrolderivate, ein Verfahren zu ihrer Herstellung und Arzneimittel | |
| EP0005821B1 (de) | Indanaminderivate, Verfahren zur Herstellung derselben und Arzneimittel, welche diese enthalten | |
| EP0271099A2 (de) | Substituierte Aminopropionsäureamide, Verfahren zu ihrer Herstellung, diese enthaltende Mittel und ihre Verwendung sowie die bei der Herstellung anfallenden neuen Zwischenprodukte | |
| DE2061864A1 (OSRAM) | ||
| CH398595A (de) | Verfahren zur Herstellung von Indolderivaten | |
| US3555093A (en) | 2,alpha-dimenthyl-beta-ethyl-beta-(p-fluorophenyl)-ethylamines and the salts thereof | |
| CH356121A (de) | Verfahren zur Herstellung von N-monosubstituierten Amiden vona-Aminoalkyl-a-phenyl-essigsäuren | |
| AT210407B (de) | Verfahren zur Herstellung von neuen N-substituierten Aniliden und deren Salzen | |
| DE2235667A1 (de) | Hexahydrobenz/e/indolderivate | |
| DE950550C (de) | Verfahren zur Herstellung von basisch substituierten Phenylcycloalkenylpropanolen | |
| AT210408B (de) | Verfahren zur Herstellung von neuen N-substituierten Aniliden und deren Salzen | |
| DE2157694C3 (de) | Phenylessigsäurederivate, Verfahren zu ihrer Herstellung und Phenylessigsäurederivate enthaltende pharmazeutische Zubereitungen | |
| AT336001B (de) | Verfahren zur herstellung von neuen 3-(4-biphenylyl)-1-butanolen und ihren estern | |
| DE1470116C3 (de) | N(I Arylalkyl 4 pipendyl)-anilide und Verfahren zu ihrer Herstellung | |
| DE1921651A1 (de) | Verfahren zur Herstellung von neuen,substituierten Phenylalkansaeuren | |
| DE882403C (de) | Verfahren zur Herstellung von cyclischen Basen | |
| DE2557517C3 (de) | Phenylessigsäurederivate, Verfahren zu ihrer Herstellung und diese Verbindungen enthaltende Arzneimittel | |
| DE1917036C3 (de) | N-Acyl-N-(substituiertes)phenyl-4amino-buttersäuren und deren Salze, Verfahren zu ihrer Herstellung und diese enthaltende Arzneimittel | |
| AT226710B (de) | Verfahren zur Herstellung von neuen Dihydrochinoxalonen-(2) und von deren Salzen | |
| DE1768615C3 (de) | Amide der 2-Hydroxy-3-methoxy-5-allyl-benzoesäure, Verfahren zu ihrer Herstellung und sie enthaltende Arzneimittel | |
| DE1809256A1 (de) | Substituierte 4-Aryl-3-hydroxybutyramide und Verfahren zu ihrer Herstellung | |
| CH407127A (de) | Verfahren zur Herstellung von N-heterocyclischen Verbindungen | |
| DE2511621A1 (de) | Verfahren zur herstellung neuer heterocyclischer verbindungen | |
| CH628613A5 (en) | Process for the preparation of aminoalkoxyphenylalkyl benzyl ethers |