DE1087449B - Verfahren zur Verbesserung der Farbwiedergabe in einem farbenphotographischen Material fuer das Farbentwicklungsverfahren - Google Patents
Verfahren zur Verbesserung der Farbwiedergabe in einem farbenphotographischen Material fuer das FarbentwicklungsverfahrenInfo
- Publication number
- DE1087449B DE1087449B DEG28904A DEG0028904A DE1087449B DE 1087449 B DE1087449 B DE 1087449B DE G28904 A DEG28904 A DE G28904A DE G0028904 A DEG0028904 A DE G0028904A DE 1087449 B DE1087449 B DE 1087449B
- Authority
- DE
- Germany
- Prior art keywords
- color
- compound
- gelatin
- aryl
- added
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 239000000463 material Substances 0.000 title claims description 20
- 238000000034 method Methods 0.000 title claims description 13
- 150000001875 compounds Chemical class 0.000 claims description 40
- 239000010410 layer Substances 0.000 claims description 37
- 239000000839 emulsion Substances 0.000 claims description 28
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 claims description 23
- 229910052709 silver Inorganic materials 0.000 claims description 21
- 239000004332 silver Substances 0.000 claims description 21
- 229920000159 gelatin Polymers 0.000 claims description 17
- 235000019322 gelatine Nutrition 0.000 claims description 17
- 108010010803 Gelatin Proteins 0.000 claims description 15
- 239000008273 gelatin Substances 0.000 claims description 15
- 235000011852 gelatine desserts Nutrition 0.000 claims description 15
- -1 aralkyl radical Chemical class 0.000 claims description 13
- 238000009877 rendering Methods 0.000 claims description 13
- 229910052736 halogen Inorganic materials 0.000 claims description 12
- 150000002367 halogens Chemical class 0.000 claims description 12
- 238000002360 preparation method Methods 0.000 claims description 11
- 125000003118 aryl group Chemical group 0.000 claims description 9
- 229910052739 hydrogen Inorganic materials 0.000 claims description 9
- 125000000547 substituted alkyl group Chemical group 0.000 claims description 9
- 239000001257 hydrogen Substances 0.000 claims description 8
- 239000011229 interlayer Substances 0.000 claims description 6
- 238000010521 absorption reaction Methods 0.000 claims description 5
- 150000004820 halides Chemical class 0.000 claims description 5
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 4
- 239000000084 colloidal system Substances 0.000 claims description 4
- 239000006185 dispersion Substances 0.000 claims description 4
- 150000002431 hydrogen Chemical class 0.000 claims description 4
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 3
- 229910052783 alkali metal Inorganic materials 0.000 claims description 2
- 150000001340 alkali metals Chemical group 0.000 claims description 2
- 125000000217 alkyl group Chemical group 0.000 claims description 2
- 150000005840 aryl radicals Chemical class 0.000 claims description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 2
- 238000009792 diffusion process Methods 0.000 claims description 2
- 125000000623 heterocyclic group Chemical group 0.000 claims description 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 2
- 229910052760 oxygen Inorganic materials 0.000 claims description 2
- 239000001301 oxygen Substances 0.000 claims description 2
- 238000001228 spectrum Methods 0.000 claims description 2
- 125000001424 substituent group Chemical group 0.000 claims description 2
- 230000016507 interphase Effects 0.000 claims 1
- 239000000126 substance Substances 0.000 claims 1
- 239000000047 product Substances 0.000 description 26
- 230000003647 oxidation Effects 0.000 description 19
- 238000007254 oxidation reaction Methods 0.000 description 19
- 239000000975 dye Substances 0.000 description 17
- 239000000243 solution Substances 0.000 description 10
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 9
- 238000004519 manufacturing process Methods 0.000 description 9
- 239000012071 phase Substances 0.000 description 8
- 239000011230 binding agent Substances 0.000 description 6
- ZTQSAGDEMFDKMZ-UHFFFAOYSA-N Butyraldehyde Chemical compound CCCC=O ZTQSAGDEMFDKMZ-UHFFFAOYSA-N 0.000 description 4
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 4
- 230000015572 biosynthetic process Effects 0.000 description 4
- 239000008385 outer phase Substances 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- 150000000996 L-ascorbic acids Chemical class 0.000 description 3
- DHKHKXVYLBGOIT-UHFFFAOYSA-N acetaldehyde Diethyl Acetal Natural products CCOC(C)OCC DHKHKXVYLBGOIT-UHFFFAOYSA-N 0.000 description 3
- 125000002777 acetyl group Chemical class [H]C([H])([H])C(*)=O 0.000 description 3
- 239000007864 aqueous solution Substances 0.000 description 3
- 150000002429 hydrazines Chemical class 0.000 description 3
- 230000002209 hydrophobic effect Effects 0.000 description 3
- 238000002844 melting Methods 0.000 description 3
- 230000008018 melting Effects 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- 229920002554 vinyl polymer Polymers 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- 239000003232 water-soluble binding agent Substances 0.000 description 3
- CIWBSHSKHKDKBQ-JLAZNSOCSA-N Ascorbic acid Chemical compound OC[C@H](O)[C@H]1OC(=O)C(O)=C1O CIWBSHSKHKDKBQ-JLAZNSOCSA-N 0.000 description 2
- 229910014033 C-OH Inorganic materials 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- 229910014570 C—OH Inorganic materials 0.000 description 2
- 239000001828 Gelatine Substances 0.000 description 2
- 229910021607 Silver chloride Inorganic materials 0.000 description 2
- 125000002252 acyl group Chemical group 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 230000008878 coupling Effects 0.000 description 2
- 238000010168 coupling process Methods 0.000 description 2
- 238000005859 coupling reaction Methods 0.000 description 2
- 150000001923 cyclic compounds Chemical class 0.000 description 2
- 238000002845 discoloration Methods 0.000 description 2
- 239000003995 emulsifying agent Substances 0.000 description 2
- 229940042795 hydrazides for tuberculosis treatment Drugs 0.000 description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 2
- AJDUTMFFZHIJEM-UHFFFAOYSA-N n-(9,10-dioxoanthracen-1-yl)-4-[4-[[4-[4-[(9,10-dioxoanthracen-1-yl)carbamoyl]phenyl]phenyl]diazenyl]phenyl]benzamide Chemical compound O=C1C2=CC=CC=C2C(=O)C2=C1C=CC=C2NC(=O)C(C=C1)=CC=C1C(C=C1)=CC=C1N=NC(C=C1)=CC=C1C(C=C1)=CC=C1C(=O)NC1=CC=CC2=C1C(=O)C1=CC=CC=C1C2=O AJDUTMFFZHIJEM-UHFFFAOYSA-N 0.000 description 2
- IOLCXVTUBQKXJR-UHFFFAOYSA-M potassium bromide Chemical compound [K+].[Br-] IOLCXVTUBQKXJR-UHFFFAOYSA-M 0.000 description 2
- 238000007127 saponification reaction Methods 0.000 description 2
- 238000000926 separation method Methods 0.000 description 2
- HKZLPVFGJNLROG-UHFFFAOYSA-M silver monochloride Chemical compound [Cl-].[Ag+] HKZLPVFGJNLROG-UHFFFAOYSA-M 0.000 description 2
- GEHJYWRUCIMESM-UHFFFAOYSA-L sodium sulfite Chemical compound [Na+].[Na+].[O-]S([O-])=O GEHJYWRUCIMESM-UHFFFAOYSA-L 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- HGBOYTHUEUWSSQ-UHFFFAOYSA-N valeric aldehyde Natural products CCCCC=O HGBOYTHUEUWSSQ-UHFFFAOYSA-N 0.000 description 2
- 239000001043 yellow dye Substances 0.000 description 2
- AYLDJQABCMPYEN-UHFFFAOYSA-N (4-azaniumylphenyl)-diethylazanium;sulfate Chemical compound OS(O)(=O)=O.CCN(CC)C1=CC=C(N)C=C1 AYLDJQABCMPYEN-UHFFFAOYSA-N 0.000 description 1
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 1
- WBIQQQGBSDOWNP-UHFFFAOYSA-N 2-dodecylbenzenesulfonic acid Chemical compound CCCCCCCCCCCCC1=CC=CC=C1S(O)(=O)=O WBIQQQGBSDOWNP-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- WWZKQHOCKIZLMA-UHFFFAOYSA-N Caprylic acid Natural products CCCCCCCC(O)=O WWZKQHOCKIZLMA-UHFFFAOYSA-N 0.000 description 1
- 239000005635 Caprylic acid (CAS 124-07-2) Substances 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- AMQJEAYHLZJPGS-UHFFFAOYSA-N N-Pentanol Chemical compound CCCCCO AMQJEAYHLZJPGS-UHFFFAOYSA-N 0.000 description 1
- 239000004793 Polystyrene Substances 0.000 description 1
- 239000004372 Polyvinyl alcohol Substances 0.000 description 1
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000008186 active pharmaceutical agent Substances 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 235000010323 ascorbic acid Nutrition 0.000 description 1
- 229960005070 ascorbic acid Drugs 0.000 description 1
- 239000011668 ascorbic acid Substances 0.000 description 1
- 238000004061 bleaching Methods 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 238000005266 casting Methods 0.000 description 1
- 229920003086 cellulose ether Polymers 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 230000002860 competitive effect Effects 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- 238000006114 decarboxylation reaction Methods 0.000 description 1
- 230000002939 deleterious effect Effects 0.000 description 1
- 229940060296 dodecylbenzenesulfonic acid Drugs 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 239000001046 green dye Substances 0.000 description 1
- 230000009931 harmful effect Effects 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 125000000687 hydroquinonyl group Chemical class C1(O)=C(C=C(O)C=C1)* 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- JEHCHYAKAXDFKV-UHFFFAOYSA-J lead tetraacetate Chemical compound CC(=O)O[Pb](OC(C)=O)(OC(C)=O)OC(C)=O JEHCHYAKAXDFKV-UHFFFAOYSA-J 0.000 description 1
- 229920002521 macromolecule Polymers 0.000 description 1
- FPYJFEHAWHCUMM-UHFFFAOYSA-N maleic anhydride Chemical compound O=C1OC(=O)C=C1 FPYJFEHAWHCUMM-UHFFFAOYSA-N 0.000 description 1
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 description 1
- 239000000178 monomer Substances 0.000 description 1
- 229960002446 octanoic acid Drugs 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- 229920002223 polystyrene Polymers 0.000 description 1
- 229920002451 polyvinyl alcohol Polymers 0.000 description 1
- 239000012286 potassium permanganate Substances 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 235000010265 sodium sulphite Nutrition 0.000 description 1
- 230000000087 stabilizing effect Effects 0.000 description 1
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 description 1
Classifications
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03C—PHOTOSENSITIVE MATERIALS FOR PHOTOGRAPHIC PURPOSES; PHOTOGRAPHIC PROCESSES, e.g. CINE, X-RAY, COLOUR, STEREO-PHOTOGRAPHIC PROCESSES; AUXILIARY PROCESSES IN PHOTOGRAPHY
- G03C7/00—Multicolour photographic processes or agents therefor; Regeneration of such processing agents; Photosensitive materials for multicolour processes
- G03C7/30—Colour processes using colour-coupling substances; Materials therefor; Preparing or processing such materials
- G03C7/392—Additives
- G03C7/39208—Organic compounds
Landscapes
- Physics & Mathematics (AREA)
- Spectroscopy & Molecular Physics (AREA)
- General Physics & Mathematics (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Silver Salt Photography Or Processing Solution Therefor (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| BE2039339 | 1959-11-05 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1087449B true DE1087449B (de) | 1960-08-18 |
Family
ID=3864711
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEG28904A Pending DE1087449B (de) | 1959-11-05 | 1960-01-28 | Verfahren zur Verbesserung der Farbwiedergabe in einem farbenphotographischen Material fuer das Farbentwicklungsverfahren |
Country Status (4)
| Country | Link |
|---|---|
| US (1) | US3180734A (enExample) |
| BE (1) | BE584331A (enExample) |
| DE (1) | DE1087449B (enExample) |
| GB (1) | GB922550A (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3180734A (en) * | 1959-11-05 | 1965-04-27 | Gevaert Photo Prod Nv | Light sensitive photographic color element |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3447928A (en) * | 1965-07-26 | 1969-06-03 | Eastman Kodak Co | Silver halide emulsion containing twoequivalent yellow dye-forming coupler |
| US3459548A (en) * | 1967-07-24 | 1969-08-05 | Polaroid Corp | Scavengers for oxidized developing agent |
| JPS4818256B1 (enExample) * | 1968-05-20 | 1973-06-05 | ||
| JPS5436492B1 (enExample) * | 1971-07-02 | 1979-11-09 | ||
| US4042394A (en) * | 1973-05-07 | 1977-08-16 | Eastman Kodak Company | Photographic dye image stabilization |
| US4278750A (en) * | 1979-09-06 | 1981-07-14 | Eastman Kodak Company | Novel electron donor precursors and photographic elements containing them |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2336327A (en) * | 1941-11-13 | 1943-12-07 | Eastman Kodak Co | Preventing color stain in photographic emulsions |
| US2403721A (en) * | 1943-09-23 | 1946-07-09 | Eastman Kodak Co | Preventing color fog in photographic material |
| BE532579A (enExample) * | 1953-10-16 | |||
| US2937086A (en) * | 1955-07-26 | 1960-05-17 | Eastman Kodak Co | Multilayer reversal color material |
| BE584331A (enExample) * | 1959-11-05 |
-
0
- BE BE584331D patent/BE584331A/xx unknown
-
1960
- 1960-01-28 DE DEG28904A patent/DE1087449B/de active Pending
- 1960-11-07 US US67483A patent/US3180734A/en not_active Expired - Lifetime
- 1960-11-07 GB GB38149/60A patent/GB922550A/en not_active Expired
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3180734A (en) * | 1959-11-05 | 1965-04-27 | Gevaert Photo Prod Nv | Light sensitive photographic color element |
Also Published As
| Publication number | Publication date |
|---|---|
| BE584331A (enExample) | |
| GB922550A (en) | 1963-04-03 |
| US3180734A (en) | 1965-04-27 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2329587C2 (de) | Farbphotographisches Aufzeichnungsmaterial | |
| DE963295C (de) | Verfahren zur Einlagerung eines Kupplers oder Farbstoffbildners in eine photographische Halogensilber-Gelatineemulsion | |
| DE2140309A1 (de) | Photographisches Aufzeichnungs material | |
| DE2344155C2 (enExample) | ||
| DE2502820A1 (de) | Verfahren zur herstellung von cyanbildern | |
| DE1597480C3 (de) | Verfahren zum Farbentwickeln eines farbphotographischen Aufzeichnungsmaterials | |
| DE1087449B (de) | Verfahren zur Verbesserung der Farbwiedergabe in einem farbenphotographischen Material fuer das Farbentwicklungsverfahren | |
| DE2318807C2 (de) | Farbphotographisches Aufzeichnungsmaterial und Farbentwickler zum Entwickeln desselben | |
| DE2515771A1 (de) | Verfahren zur erzeugung eines farbphotographischen bildes | |
| DE1175072B (de) | Lichtempfindliches photographisches Material mit mindestens einer Halogensilber-emulsionsschicht | |
| DE2731676A1 (de) | Photographische silberhalogenidemulsion | |
| DE69116481T2 (de) | Photographisches lichtempfindliches Silberhalogenidmaterial | |
| DE19714614A1 (de) | Farbfotografisches Silberhalogenidmaterial | |
| DE1002198B (de) | Verfahren zur Herstellung von farbenphotographischen Bildern | |
| DE2448170A1 (de) | Farbenphotographisches lichtempfindliches element und verfahren zur herstellung farbenphotographischer bilder | |
| DE2364040A1 (de) | Photographisches silberhalogenidaufzeichnungsmaterial | |
| DE923891C (de) | Verfahren zur Entwicklung photographischer Halogensilberemulsionen | |
| DE2447175A1 (de) | Lichtempfindliches material mit emulgierten substanzen | |
| DE2509408C3 (de) | Farbphotographisches Aufzeichnungsmaterial | |
| DE2021367C3 (de) | Photographisches Aufzeichnungsmaterial für das Farbdiffusionsübertragungsverfahren | |
| DE19519709A1 (de) | Verfahren zur Herstellung eines chromogen entwickelten farbfotografischen Bildes unter Verwendung einer Verbindung, die mit primären aromatischen Aminen zu reagieren vermag | |
| DE3107173A1 (de) | Farbfotografisches aufzeichnungsmaterial | |
| DE2122570B2 (de) | Farbphotographisches Aufzeichnungsmaterial | |
| DE1113138B (de) | Verfahren zur Verbesserung der Farbwiedergabe eines farbenphoto-graphischen Mehrschichtenmaterials fuer die Farbentwicklung | |
| DE1547831C (de) | Farbphotographisches Material |