DE1068380B - - Google Patents
Info
- Publication number
- DE1068380B DE1068380B DENDAT1068380D DE1068380DA DE1068380B DE 1068380 B DE1068380 B DE 1068380B DE NDAT1068380 D DENDAT1068380 D DE NDAT1068380D DE 1068380D A DE1068380D A DE 1068380DA DE 1068380 B DE1068380 B DE 1068380B
- Authority
- DE
- Germany
- Prior art keywords
- barium
- oxide
- percent
- weight
- zirconium
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- QVQLCTNNEUAWMS-UHFFFAOYSA-N barium oxide Chemical compound [Ba]=O QVQLCTNNEUAWMS-UHFFFAOYSA-N 0.000 claims description 93
- 239000000463 material Substances 0.000 claims description 40
- 238000000576 coating method Methods 0.000 claims description 31
- 239000011248 coating agent Substances 0.000 claims description 28
- 230000001681 protective effect Effects 0.000 claims description 17
- 229910021523 barium zirconate Inorganic materials 0.000 claims description 16
- DQBAOWPVHRWLJC-UHFFFAOYSA-N barium(2+);dioxido(oxo)zirconium Chemical compound [Ba+2].[O-][Zr]([O-])=O DQBAOWPVHRWLJC-UHFFFAOYSA-N 0.000 claims description 16
- IATRAKWUXMZMIY-UHFFFAOYSA-N strontium oxide Chemical compound [O-2].[Sr+2] IATRAKWUXMZMIY-UHFFFAOYSA-N 0.000 claims description 16
- 239000000292 calcium oxide Substances 0.000 claims description 10
- ODINCKMPIJJUCX-UHFFFAOYSA-N calcium oxide Inorganic materials [Ca]=O ODINCKMPIJJUCX-UHFFFAOYSA-N 0.000 claims description 10
- QCWXUUIWCKQGHC-UHFFFAOYSA-N Zirconium Chemical compound [Zr] QCWXUUIWCKQGHC-UHFFFAOYSA-N 0.000 claims description 9
- RQPZNWPYLFFXCP-UHFFFAOYSA-L barium dihydroxide Chemical compound [OH-].[OH-].[Ba+2] RQPZNWPYLFFXCP-UHFFFAOYSA-L 0.000 claims description 9
- 229910001863 barium hydroxide Inorganic materials 0.000 claims description 9
- 238000010438 heat treatment Methods 0.000 claims description 9
- 150000003755 zirconium compounds Chemical class 0.000 claims description 9
- MCMNRKCIXSYSNV-UHFFFAOYSA-N Zirconium dioxide Chemical compound O=[Zr]=O MCMNRKCIXSYSNV-UHFFFAOYSA-N 0.000 claims description 8
- 150000001553 barium compounds Chemical class 0.000 claims description 8
- 239000002245 particle Substances 0.000 claims description 8
- 229910052726 zirconium Inorganic materials 0.000 claims description 8
- 229910052788 barium Inorganic materials 0.000 claims description 7
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium atom Chemical compound [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 claims description 7
- 238000004519 manufacturing process Methods 0.000 claims description 7
- RVTZCBVAJQQJTK-UHFFFAOYSA-N oxygen(2-);zirconium(4+) Chemical compound [O-2].[O-2].[Zr+4] RVTZCBVAJQQJTK-UHFFFAOYSA-N 0.000 claims description 7
- 239000000203 mixture Substances 0.000 claims description 6
- BRPQOXSCLDDYGP-UHFFFAOYSA-N calcium oxide Chemical compound [O-2].[Ca+2] BRPQOXSCLDDYGP-UHFFFAOYSA-N 0.000 claims description 5
- 229910001928 zirconium oxide Inorganic materials 0.000 claims description 5
- 238000000034 method Methods 0.000 claims description 4
- 229910000287 alkaline earth metal oxide Inorganic materials 0.000 claims description 3
- 238000001556 precipitation Methods 0.000 claims 1
- AYJRCSIUFZENHW-UHFFFAOYSA-L barium carbonate Chemical compound [Ba+2].[O-]C([O-])=O AYJRCSIUFZENHW-UHFFFAOYSA-L 0.000 description 20
- 230000015572 biosynthetic process Effects 0.000 description 6
- 239000007789 gas Substances 0.000 description 6
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 4
- YIXJRHPUWRPCBB-UHFFFAOYSA-N magnesium nitrate Chemical compound [Mg+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O YIXJRHPUWRPCBB-UHFFFAOYSA-N 0.000 description 4
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 description 4
- 238000006243 chemical reaction Methods 0.000 description 3
- 150000001875 compounds Chemical class 0.000 description 3
- 239000011521 glass Substances 0.000 description 3
- LLDZJTIZVZFNCM-UHFFFAOYSA-J 3-[18-(2-carboxyethyl)-8,13-diethyl-3,7,12,17-tetramethylporphyrin-21,24-diid-2-yl]propanoic acid;dichlorotin(2+) Chemical compound [H+].[H+].[Cl-].[Cl-].[Sn+4].[N-]1C(C=C2C(=C(C)C(=CC=3C(=C(C)C(=C4)N=3)CC)[N-]2)CCC([O-])=O)=C(CCC([O-])=O)C(C)=C1C=C1C(C)=C(CC)C4=N1 LLDZJTIZVZFNCM-UHFFFAOYSA-J 0.000 description 2
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 2
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 2
- BPQQTUXANYXVAA-UHFFFAOYSA-N Orthosilicate Chemical compound [O-][Si]([O-])([O-])[O-] BPQQTUXANYXVAA-UHFFFAOYSA-N 0.000 description 2
- 230000004913 activation Effects 0.000 description 2
- 239000001569 carbon dioxide Substances 0.000 description 2
- 229910002092 carbon dioxide Inorganic materials 0.000 description 2
- 238000011835 investigation Methods 0.000 description 2
- 239000000395 magnesium oxide Substances 0.000 description 2
- CPLXHLVBOLITMK-UHFFFAOYSA-N magnesium oxide Inorganic materials [Mg]=O CPLXHLVBOLITMK-UHFFFAOYSA-N 0.000 description 2
- AXZKOIWUVFPNLO-UHFFFAOYSA-N magnesium;oxygen(2-) Chemical compound [O-2].[Mg+2] AXZKOIWUVFPNLO-UHFFFAOYSA-N 0.000 description 2
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 2
- 229910052753 mercury Inorganic materials 0.000 description 2
- 239000011253 protective coating Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- 229910052721 tungsten Inorganic materials 0.000 description 2
- 239000010937 tungsten Substances 0.000 description 2
- OERNJTNJEZOPIA-UHFFFAOYSA-N zirconium nitrate Chemical compound [Zr+4].[O-][N+]([O-])=O.[O-][N+]([O-])=O.[O-][N+]([O-])=O.[O-][N+]([O-])=O OERNJTNJEZOPIA-UHFFFAOYSA-N 0.000 description 2
- ZSLUVFAKFWKJRC-IGMARMGPSA-N 232Th Chemical compound [232Th] ZSLUVFAKFWKJRC-IGMARMGPSA-N 0.000 description 1
- PWHULOQIROXLJO-UHFFFAOYSA-N Manganese Chemical compound [Mn] PWHULOQIROXLJO-UHFFFAOYSA-N 0.000 description 1
- 239000000020 Nitrocellulose Substances 0.000 description 1
- 229910052776 Thorium Inorganic materials 0.000 description 1
- 239000004110 Zinc silicate Substances 0.000 description 1
- FRRKSHPWTFGWIV-UHFFFAOYSA-N [Ni].[Cu].[Pb] Chemical compound [Ni].[Cu].[Pb] FRRKSHPWTFGWIV-UHFFFAOYSA-N 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 229910052786 argon Inorganic materials 0.000 description 1
- -1 barium oxide compound Chemical class 0.000 description 1
- 229910052916 barium silicate Inorganic materials 0.000 description 1
- HMOQPOVBDRFNIU-UHFFFAOYSA-N barium(2+);dioxido(oxo)silane Chemical compound [Ba+2].[O-][Si]([O-])=O HMOQPOVBDRFNIU-UHFFFAOYSA-N 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical compound OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 238000007598 dipping method Methods 0.000 description 1
- ZOIVSVWBENBHNT-UHFFFAOYSA-N dizinc;silicate Chemical compound [Zn+2].[Zn+2].[O-][Si]([O-])([O-])[O-] ZOIVSVWBENBHNT-UHFFFAOYSA-N 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 230000005611 electricity Effects 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- XMHIUKTWLZUKEX-UHFFFAOYSA-N hexacosanoic acid Chemical compound CCCCCCCCCCCCCCCCCCCCCCCCCC(O)=O XMHIUKTWLZUKEX-UHFFFAOYSA-N 0.000 description 1
- 159000000003 magnesium salts Chemical class 0.000 description 1
- 229910052748 manganese Inorganic materials 0.000 description 1
- 239000011572 manganese Substances 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 229920001220 nitrocellulos Polymers 0.000 description 1
- DAWBXZHBYOYVLB-UHFFFAOYSA-J oxalate;zirconium(4+) Chemical compound [Zr+4].[O-]C(=O)C([O-])=O.[O-]C(=O)C([O-])=O DAWBXZHBYOYVLB-UHFFFAOYSA-J 0.000 description 1
- 238000007747 plating Methods 0.000 description 1
- 230000002035 prolonged effect Effects 0.000 description 1
- 239000011241 protective layer Substances 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 150000004760 silicates Chemical group 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- CIOAGBVUUVVLOB-UHFFFAOYSA-N strontium atom Chemical compound [Sr] CIOAGBVUUVVLOB-UHFFFAOYSA-N 0.000 description 1
- 229910000018 strontium carbonate Inorganic materials 0.000 description 1
- ZCUFMDLYAMJYST-UHFFFAOYSA-N thorium dioxide Chemical compound O=[Th]=O ZCUFMDLYAMJYST-UHFFFAOYSA-N 0.000 description 1
- 229910003452 thorium oxide Inorganic materials 0.000 description 1
- 235000019352 zinc silicate Nutrition 0.000 description 1
- 150000003754 zirconium Chemical class 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01J—ELECTRIC DISCHARGE TUBES OR DISCHARGE LAMPS
- H01J61/00—Gas-discharge or vapour-discharge lamps
- H01J61/02—Details
- H01J61/04—Electrodes; Screens; Shields
- H01J61/06—Main electrodes
- H01J61/067—Main electrodes for low-pressure discharge lamps
- H01J61/0675—Main electrodes for low-pressure discharge lamps characterised by the material of the electrode
- H01J61/0677—Main electrodes for low-pressure discharge lamps characterised by the material of the electrode characterised by the electron emissive material
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01J—ELECTRIC DISCHARGE TUBES OR DISCHARGE LAMPS
- H01J1/00—Details of electrodes, of magnetic control means, of screens, or of the mounting or spacing thereof, common to two or more basic types of discharge tubes or lamps
- H01J1/02—Main electrodes
- H01J1/13—Solid thermionic cathodes
- H01J1/14—Solid thermionic cathodes characterised by the material
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01J—ELECTRIC DISCHARGE TUBES OR DISCHARGE LAMPS
- H01J9/00—Apparatus or processes specially adapted for the manufacture, installation, removal, maintenance of electric discharge tubes, discharge lamps, or parts thereof; Recovery of material from discharge tubes or lamps
- H01J9/02—Manufacture of electrodes or electrode systems
- H01J9/04—Manufacture of electrodes or electrode systems of thermionic cathodes
- H01J9/042—Manufacture, activation of the emissive part
Landscapes
- Engineering & Computer Science (AREA)
- Manufacturing & Machinery (AREA)
- Discharge Lamp (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US413082A US2806970A (en) | 1954-03-01 | 1954-03-01 | Electron emission coatings and method of preparing air stabilized barium oxide |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1068380B true DE1068380B (enExample) |
Family
ID=23635741
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DENDAT1068380D Pending DE1068380B (enExample) | 1954-03-01 |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US2806970A (enExample) |
| BE (1) | BE536109A (enExample) |
| DE (1) | DE1068380B (enExample) |
| FR (1) | FR1127426A (enExample) |
| GB (1) | GB782287A (enExample) |
Families Citing this family (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3023340A (en) * | 1959-10-29 | 1962-02-27 | Westinghouse Electric Corp | Phosphor, lamp and method |
| US3023339A (en) * | 1959-10-29 | 1962-02-27 | Westinghouse Electric Corp | Phosphor, lamp and method |
| US3249788A (en) * | 1961-11-08 | 1966-05-03 | Westinghouse Electric Corp | Electrode coating material and discharge device |
| US4794308A (en) * | 1970-08-06 | 1988-12-27 | Owens-Illinois Television Products Inc. | Multiple gaseous discharge display/memory panel having improved operating life |
| US4731560A (en) * | 1970-08-06 | 1988-03-15 | Owens-Illinois Television Products, Inc. | Multiple gaseous discharge display/memory panel having improved operating life |
| US3863089A (en) * | 1970-09-28 | 1975-01-28 | Owens Illinois Inc | Gas discharge display and memory panel with magnesium oxide coatings |
| US4210840A (en) * | 1978-12-12 | 1980-07-01 | Westinghouse Electric Corp. | HID Lamp emission material |
| US4836816A (en) * | 1988-05-06 | 1989-06-06 | Gte Products Corporation | Method of treating tungsten cathodes |
| US5744905A (en) * | 1994-12-23 | 1998-04-28 | Philips Electronics North America Corporation | Emission materials for discharge lamps and method for manufacturing electrode structures with such materials |
| US6037714A (en) * | 1995-09-19 | 2000-03-14 | Philips Electronics North America Corporation | Hollow electrodes for low pressure discharge lamps, particularly narrow diameter fluorescent and neon lamps and lamps containing the same |
| US5982097A (en) * | 1995-12-29 | 1999-11-09 | Philips Electronics North America Corporation | Hollow electrodes for low pressure discharge lamps, particularly narrow diameter fluorescent and neon lamps and lamps containing the same |
| DE10242241A1 (de) * | 2002-09-12 | 2004-03-25 | Philips Intellectual Property & Standards Gmbh | Niederdruckgasentladungslampe mit Ba TiO3-ähnlichen Elektronen-Ermittersubstanzen |
| US8253331B2 (en) | 2010-04-28 | 2012-08-28 | General Electric Company | Mercury dosing method for fluorescent lamps |
| US20120104930A1 (en) * | 2010-11-03 | 2012-05-03 | General Electric Company | Core-shell electron emission material |
Citations (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE572700C (de) * | 1926-06-09 | 1933-03-22 | Friedrich Meyer Dr | Gluehkathode fuer Entladungsgefaesse |
| DE617546C (de) * | 1931-11-20 | 1935-08-21 | Patra Patent Treuhand | Gluehelektrode fuer gasgefuellte elektrische Entladungsgefaesse, insbesondere elektrische Leuchtroehren, und Verfahren zu ihrer Herstellung |
| FR966907A (fr) * | 1947-06-05 | 1950-10-20 | Sylvania Electric Prod | Perfectionnements au revêtement d'électrodes pour dispositifs à décharge |
| US2547869A (en) * | 1947-10-31 | 1951-04-03 | Sylvania Electric Prod | Fluorescent lamp electrode |
| DE857533C (de) * | 1943-03-15 | 1952-12-01 | Telefunken Gmbh | Oxydkathode fuer elektrische Entladungsgefaesse |
| DE917860C (de) * | 1951-11-01 | 1954-09-13 | Patra Patent Treuhand | Aktivierungsmaterial fuer Elektroden von elektrischen Entladungsgefaessen |
-
0
- BE BE536109D patent/BE536109A/xx unknown
- DE DENDAT1068380D patent/DE1068380B/de active Pending
-
1954
- 1954-03-01 US US413082A patent/US2806970A/en not_active Expired - Lifetime
-
1955
- 1955-02-22 GB GB5219/55A patent/GB782287A/en not_active Expired
- 1955-02-28 FR FR1127426D patent/FR1127426A/fr not_active Expired
Patent Citations (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE572700C (de) * | 1926-06-09 | 1933-03-22 | Friedrich Meyer Dr | Gluehkathode fuer Entladungsgefaesse |
| DE617546C (de) * | 1931-11-20 | 1935-08-21 | Patra Patent Treuhand | Gluehelektrode fuer gasgefuellte elektrische Entladungsgefaesse, insbesondere elektrische Leuchtroehren, und Verfahren zu ihrer Herstellung |
| DE857533C (de) * | 1943-03-15 | 1952-12-01 | Telefunken Gmbh | Oxydkathode fuer elektrische Entladungsgefaesse |
| FR966907A (fr) * | 1947-06-05 | 1950-10-20 | Sylvania Electric Prod | Perfectionnements au revêtement d'électrodes pour dispositifs à décharge |
| US2547869A (en) * | 1947-10-31 | 1951-04-03 | Sylvania Electric Prod | Fluorescent lamp electrode |
| DE917860C (de) * | 1951-11-01 | 1954-09-13 | Patra Patent Treuhand | Aktivierungsmaterial fuer Elektroden von elektrischen Entladungsgefaessen |
Also Published As
| Publication number | Publication date |
|---|---|
| BE536109A (enExample) | |
| GB782287A (en) | 1957-09-04 |
| FR1127426A (fr) | 1956-12-17 |
| US2806970A (en) | 1957-09-17 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2626700C2 (de) | Hochdruckgasentladungslampe und Verfahren zu ihrer Herstellung | |
| DE1068380B (enExample) | ||
| DE2647396C2 (de) | Gasentladungs-Anzeigevorrichtung und Verfahren zu deren Herstellung | |
| DD209703A5 (de) | Verfahren zum herstellen einer nachlieferungskathode und nach diesen verfahren hergestellte nachlieferungskathode | |
| DE2161173B2 (de) | Oxydelektrode für elektrische Hochleistungs-Gasentladungslampen | |
| DE667942C (de) | Verfahren zur Herstellung von Oxydkathoden, insbesondere Gluehkathoden fuer elektrische Entladungsgefaesse | |
| DE2951741A1 (de) | Elektrode fuer eine entladungslampe | |
| DE3871883T2 (de) | Niederdruckquecksilberdampfentladungslampe. | |
| DE964793C (de) | Elektrode fuer elektrische Gas- oder Dampf-Entladungsapparate | |
| DE962461C (de) | Gluehelektrode fuer elektrische Hochdruck- und Hoechstdruck-Entladungslampen | |
| EP1104933A2 (de) | Gasentladungslampe mit Oxidemitter-Elektrode | |
| DE2845283C2 (enExample) | ||
| DE19616408A1 (de) | Elektrode für Entladungslampen | |
| DE2845333A1 (de) | Hochintensive entladungslampen | |
| DE966927C (de) | Elektrische Hochdruckentladungslampe | |
| DE2939871C2 (de) | Hochdrucknatriumdampfentladungslampe | |
| DE3119747A1 (de) | Emittierende masse und verfahren zu ihrer herstellung | |
| DE917860C (de) | Aktivierungsmaterial fuer Elektroden von elektrischen Entladungsgefaessen | |
| DE1901693A1 (de) | Rotleuchtender Leuchtstoff fuer Schirme von Elektronenstrahlroehren | |
| DE1696630A1 (de) | Verfahren zur Herstellung einer zum Einsatz in eine geeignete elektrische Entladungsanordnung dienenden Elektrode mit elektronenemittierendem UEberzug | |
| DE19618929A1 (de) | Kathode für Elektronenröhren | |
| DE1130070B (de) | Kathode fuer Gas- und/oder Dampfentladungslampen und Verfahren zu ihrer Herstellung | |
| DE974888C (de) | Verfahren zur Herstellung einer Kathode fuer elektrische Entladungsroehren | |
| DE2253012B2 (de) | Magnesium-Aluminat-Gallat-Leuchtstoff N.Y. (V.St.A.) | |
| DE1764954C3 (de) | Halogen-Glühlampe |