DE1056476B - Verfahren zur Herstellung von UEbertragungsbildern - Google Patents
Verfahren zur Herstellung von UEbertragungsbildernInfo
- Publication number
- DE1056476B DE1056476B DEI11972A DEI0011972A DE1056476B DE 1056476 B DE1056476 B DE 1056476B DE I11972 A DEI11972 A DE I11972A DE I0011972 A DEI0011972 A DE I0011972A DE 1056476 B DE1056476 B DE 1056476B
- Authority
- DE
- Germany
- Prior art keywords
- panels
- liquid
- silver
- layer
- silver halide
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 28
- 238000012546 transfer Methods 0.000 title claims description 16
- 238000004519 manufacturing process Methods 0.000 title claims description 10
- 230000008569 process Effects 0.000 title claims description 8
- 229910052709 silver Inorganic materials 0.000 claims description 91
- 239000004332 silver Substances 0.000 claims description 91
- 239000007788 liquid Substances 0.000 claims description 65
- -1 silver halide Chemical class 0.000 claims description 58
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 claims description 36
- 239000000463 material Substances 0.000 claims description 25
- 230000009471 action Effects 0.000 claims description 13
- 239000003795 chemical substances by application Substances 0.000 claims description 11
- 239000000203 mixture Substances 0.000 claims description 9
- 239000000243 solution Substances 0.000 claims description 9
- 238000003892 spreading Methods 0.000 claims description 9
- 230000007480 spreading Effects 0.000 claims description 9
- 229910052736 halogen Inorganic materials 0.000 claims description 7
- 238000012545 processing Methods 0.000 claims description 7
- GGCZERPQGJTIQP-UHFFFAOYSA-N sodium;9,10-dioxoanthracene-2-sulfonic acid Chemical compound [Na+].C1=CC=C2C(=O)C3=CC(S(=O)(=O)O)=CC=C3C(=O)C2=C1 GGCZERPQGJTIQP-UHFFFAOYSA-N 0.000 claims description 7
- 150000002367 halogens Chemical class 0.000 claims description 6
- 239000012670 alkaline solution Substances 0.000 claims description 5
- 239000003153 chemical reaction reagent Substances 0.000 claims description 5
- 239000003513 alkali Substances 0.000 claims description 4
- 230000003287 optical effect Effects 0.000 claims description 4
- 239000000654 additive Substances 0.000 claims description 3
- 238000011161 development Methods 0.000 claims description 3
- 238000009792 diffusion process Methods 0.000 claims description 3
- 239000000839 emulsion Substances 0.000 claims description 3
- 230000001376 precipitating effect Effects 0.000 claims description 3
- 230000001681 protective effect Effects 0.000 claims description 3
- 150000003839 salts Chemical class 0.000 claims description 3
- 239000000126 substance Substances 0.000 claims description 3
- 229920002301 cellulose acetate Polymers 0.000 claims description 2
- 239000011248 coating agent Substances 0.000 claims description 2
- 238000000576 coating method Methods 0.000 claims description 2
- 150000001875 compounds Chemical class 0.000 claims description 2
- 238000002360 preparation method Methods 0.000 claims description 2
- 239000004615 ingredient Substances 0.000 claims 2
- GAMPNQJDUFQVQO-UHFFFAOYSA-N acetic acid;phthalic acid Chemical compound CC(O)=O.OC(=O)C1=CC=CC=C1C(O)=O GAMPNQJDUFQVQO-UHFFFAOYSA-N 0.000 claims 1
- 230000000996 additive effect Effects 0.000 claims 1
- 239000003638 chemical reducing agent Substances 0.000 claims 1
- 238000002347 injection Methods 0.000 claims 1
- 239000007924 injection Substances 0.000 claims 1
- 239000010410 layer Substances 0.000 description 83
- 239000002904 solvent Substances 0.000 description 14
- 239000002131 composite material Substances 0.000 description 11
- 239000000853 adhesive Substances 0.000 description 7
- 230000001070 adhesive effect Effects 0.000 description 7
- 238000009826 distribution Methods 0.000 description 6
- 230000002829 reductive effect Effects 0.000 description 6
- 230000015572 biosynthetic process Effects 0.000 description 5
- 230000009969 flowable effect Effects 0.000 description 5
- 239000001856 Ethyl cellulose Substances 0.000 description 4
- ZZSNKZQZMQGXPY-UHFFFAOYSA-N Ethyl cellulose Chemical compound CCOCC1OC(OC)C(OCC)C(OCC)C1OC1C(O)C(O)C(OC)C(CO)O1 ZZSNKZQZMQGXPY-UHFFFAOYSA-N 0.000 description 4
- 229920001249 ethyl cellulose Polymers 0.000 description 4
- 235000019325 ethyl cellulose Nutrition 0.000 description 4
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 3
- 108010010803 Gelatin Proteins 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 229920001971 elastomer Polymers 0.000 description 3
- 239000008273 gelatin Substances 0.000 description 3
- 229920000159 gelatin Polymers 0.000 description 3
- 235000019322 gelatine Nutrition 0.000 description 3
- 235000011852 gelatine desserts Nutrition 0.000 description 3
- 239000005060 rubber Substances 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- PLIKAWJENQZMHA-UHFFFAOYSA-N 4-aminophenol Chemical compound NC1=CC=C(O)C=C1 PLIKAWJENQZMHA-UHFFFAOYSA-N 0.000 description 2
- DHMQDGOQFOQNFH-UHFFFAOYSA-N Glycine Chemical compound NCC(O)=O DHMQDGOQFOQNFH-UHFFFAOYSA-N 0.000 description 2
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- 244000052616 bacterial pathogen Species 0.000 description 2
- 150000001555 benzenes Chemical class 0.000 description 2
- 239000011888 foil Substances 0.000 description 2
- 239000011521 glass Substances 0.000 description 2
- 230000005484 gravity Effects 0.000 description 2
- 150000002443 hydroxylamines Chemical class 0.000 description 2
- 229920000620 organic polymer Polymers 0.000 description 2
- 239000000123 paper Substances 0.000 description 2
- 239000002245 particle Substances 0.000 description 2
- 229920002037 poly(vinyl butyral) polymer Polymers 0.000 description 2
- 125000006850 spacer group Chemical group 0.000 description 2
- 229920002554 vinyl polymer Polymers 0.000 description 2
- VPMMJSPGZSFEAH-UHFFFAOYSA-N 2,4-diaminophenol;hydrochloride Chemical compound [Cl-].NC1=CC=C(O)C([NH3+])=C1 VPMMJSPGZSFEAH-UHFFFAOYSA-N 0.000 description 1
- JKFYKCYQEWQPTM-UHFFFAOYSA-N 2-azaniumyl-2-(4-fluorophenyl)acetate Chemical compound OC(=O)C(N)C1=CC=C(F)C=C1 JKFYKCYQEWQPTM-UHFFFAOYSA-N 0.000 description 1
- SZTBMYHIYNGYIA-UHFFFAOYSA-M 2-chloroacrylate Chemical compound [O-]C(=O)C(Cl)=C SZTBMYHIYNGYIA-UHFFFAOYSA-M 0.000 description 1
- 229920001817 Agar Polymers 0.000 description 1
- 102000009027 Albumins Human genes 0.000 description 1
- 108010088751 Albumins Proteins 0.000 description 1
- 229920002799 BoPET Polymers 0.000 description 1
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 1
- 102000005575 Cellulases Human genes 0.000 description 1
- 108010084185 Cellulases Proteins 0.000 description 1
- PYGXAGIECVVIOZ-UHFFFAOYSA-N Dibutyl decanedioate Chemical compound CCCCOC(=O)CCCCCCCCC(=O)OCCCC PYGXAGIECVVIOZ-UHFFFAOYSA-N 0.000 description 1
- VTLYFUHAOXGGBS-UHFFFAOYSA-N Fe3+ Chemical class [Fe+3] VTLYFUHAOXGGBS-UHFFFAOYSA-N 0.000 description 1
- 241000282326 Felis catus Species 0.000 description 1
- 239000004471 Glycine Substances 0.000 description 1
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 description 1
- VVQNEPGJFQJSBK-UHFFFAOYSA-N Methyl methacrylate Chemical compound COC(=O)C(C)=C VVQNEPGJFQJSBK-UHFFFAOYSA-N 0.000 description 1
- 239000005041 Mylar™ Substances 0.000 description 1
- 239000000020 Nitrocellulose Substances 0.000 description 1
- 229920002302 Nylon 6,6 Polymers 0.000 description 1
- 239000004952 Polyamide Substances 0.000 description 1
- 239000004372 Polyvinyl alcohol Substances 0.000 description 1
- 229910021607 Silver chloride Inorganic materials 0.000 description 1
- 229910021612 Silver iodide Inorganic materials 0.000 description 1
- 239000004133 Sodium thiosulphate Substances 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 150000001252 acrylic acid derivatives Chemical class 0.000 description 1
- 239000008272 agar Substances 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- XYLMUPLGERFSHI-UHFFFAOYSA-N alpha-Methylstyrene Chemical compound CC(=C)C1=CC=CC=C1 XYLMUPLGERFSHI-UHFFFAOYSA-N 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- XYXNTHIYBIDHGM-UHFFFAOYSA-N ammonium thiosulfate Chemical compound [NH4+].[NH4+].[O-]S([O-])(=O)=S XYXNTHIYBIDHGM-UHFFFAOYSA-N 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 1
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 239000005018 casein Substances 0.000 description 1
- BECPQYXYKAMYBN-UHFFFAOYSA-N casein, tech. Chemical compound NCCCCC(C(O)=O)N=C(O)C(CC(O)=O)N=C(O)C(CCC(O)=N)N=C(O)C(CC(C)C)N=C(O)C(CCC(O)=O)N=C(O)C(CC(O)=O)N=C(O)C(CCC(O)=O)N=C(O)C(C(C)O)N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=O)N=C(O)C(CCC(O)=O)N=C(O)C(COP(O)(O)=O)N=C(O)C(CCC(O)=N)N=C(O)C(N)CC1=CC=CC=C1 BECPQYXYKAMYBN-UHFFFAOYSA-N 0.000 description 1
- 235000021240 caseins Nutrition 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 229920006217 cellulose acetate butyrate Polymers 0.000 description 1
- HGAZMNJKRQFZKS-UHFFFAOYSA-N chloroethene;ethenyl acetate Chemical compound ClC=C.CC(=O)OC=C HGAZMNJKRQFZKS-UHFFFAOYSA-N 0.000 description 1
- 239000000084 colloidal system Substances 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 238000010276 construction Methods 0.000 description 1
- 238000011109 contamination Methods 0.000 description 1
- 229920001577 copolymer Polymers 0.000 description 1
- 150000001989 diazonium salts Chemical class 0.000 description 1
- SOCTUWSJJQCPFX-UHFFFAOYSA-N dichromate(2-) Chemical compound [O-][Cr](=O)(=O)O[Cr]([O-])(=O)=O SOCTUWSJJQCPFX-UHFFFAOYSA-N 0.000 description 1
- 239000010946 fine silver Substances 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 239000002655 kraft paper Substances 0.000 description 1
- 230000000670 limiting effect Effects 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 229910052976 metal sulfide Inorganic materials 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- VDUIPQNXOQMTBF-UHFFFAOYSA-N n-ethylhydroxylamine Chemical compound CCNO VDUIPQNXOQMTBF-UHFFFAOYSA-N 0.000 description 1
- CPQCSJYYDADLCZ-UHFFFAOYSA-N n-methylhydroxylamine Chemical compound CNO CPQCSJYYDADLCZ-UHFFFAOYSA-N 0.000 description 1
- 229920001220 nitrocellulos Polymers 0.000 description 1
- 229910000510 noble metal Inorganic materials 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 239000012188 paraffin wax Substances 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 229920002647 polyamide Polymers 0.000 description 1
- 229920000728 polyester Polymers 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 229920002689 polyvinyl acetate Polymers 0.000 description 1
- 239000011118 polyvinyl acetate Substances 0.000 description 1
- 229920002451 polyvinyl alcohol Polymers 0.000 description 1
- 239000010970 precious metal Substances 0.000 description 1
- 238000003825 pressing Methods 0.000 description 1
- HJWLCRVIBGQPNF-UHFFFAOYSA-N prop-2-enylbenzene Chemical compound C=CCC1=CC=CC=C1 HJWLCRVIBGQPNF-UHFFFAOYSA-N 0.000 description 1
- 239000011241 protective layer Substances 0.000 description 1
- WQGWDDDVZFFDIG-UHFFFAOYSA-N pyrogallol Chemical compound OC1=CC=CC(O)=C1O WQGWDDDVZFFDIG-UHFFFAOYSA-N 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 230000000717 retained effect Effects 0.000 description 1
- 230000002441 reversible effect Effects 0.000 description 1
- 150000003346 selenoethers Chemical class 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- ADZWSOLPGZMUMY-UHFFFAOYSA-M silver bromide Chemical compound [Ag]Br ADZWSOLPGZMUMY-UHFFFAOYSA-M 0.000 description 1
- 229940045105 silver iodide Drugs 0.000 description 1
- HKZLPVFGJNLROG-UHFFFAOYSA-M silver monochloride Chemical compound [Cl-].[Ag+] HKZLPVFGJNLROG-UHFFFAOYSA-M 0.000 description 1
- 229910052979 sodium sulfide Inorganic materials 0.000 description 1
- GRVFOGOEDUUMBP-UHFFFAOYSA-N sodium sulfide (anhydrous) Chemical compound [Na+].[Na+].[S-2] GRVFOGOEDUUMBP-UHFFFAOYSA-N 0.000 description 1
- VGTPCRGMBIAPIM-UHFFFAOYSA-M sodium thiocyanate Chemical compound [Na+].[S-]C#N VGTPCRGMBIAPIM-UHFFFAOYSA-M 0.000 description 1
- AKHNMLFCWUSKQB-UHFFFAOYSA-L sodium thiosulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=S AKHNMLFCWUSKQB-UHFFFAOYSA-L 0.000 description 1
- 235000019345 sodium thiosulphate Nutrition 0.000 description 1
- 108700024661 strong silver Proteins 0.000 description 1
- 150000003440 styrenes Chemical class 0.000 description 1
- 125000000446 sulfanediyl group Chemical group *S* 0.000 description 1
- 150000004763 sulfides Chemical class 0.000 description 1
- 239000004094 surface-active agent Substances 0.000 description 1
- 229920001169 thermoplastic Polymers 0.000 description 1
- 229920001187 thermosetting polymer Polymers 0.000 description 1
- 239000004416 thermosoftening plastic Substances 0.000 description 1
Classifications
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03D—APPARATUS FOR PROCESSING EXPOSED PHOTOGRAPHIC MATERIALS; ACCESSORIES THEREFOR
- G03D9/00—Diffusion development apparatus
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03C—PHOTOSENSITIVE MATERIALS FOR PHOTOGRAPHIC PURPOSES; PHOTOGRAPHIC PROCESSES, e.g. CINE, X-RAY, COLOUR, STEREO-PHOTOGRAPHIC PROCESSES; AUXILIARY PROCESSES IN PHOTOGRAPHY
- G03C8/00—Diffusion transfer processes or agents therefor; Photosensitive materials for such processes
- G03C8/42—Structural details
Landscapes
- Physics & Mathematics (AREA)
- General Physics & Mathematics (AREA)
- Engineering & Computer Science (AREA)
- Architecture (AREA)
- Structural Engineering (AREA)
- Silver Salt Photography Or Processing Solution Therefor (AREA)
- Photographic Developing Apparatuses (AREA)
- Packaging Of Annular Or Rod-Shaped Articles, Wearing Apparel, Cassettes, Or The Like (AREA)
- Photosensitive Polymer And Photoresist Processing (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US523885A US2982650A (en) | 1955-07-22 | 1955-07-22 | Photographic processes and products |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1056476B true DE1056476B (de) | 1959-04-30 |
Family
ID=24086837
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEI11972A Pending DE1056476B (de) | 1955-07-22 | 1956-07-19 | Verfahren zur Herstellung von UEbertragungsbildern |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US2982650A (member.php) |
| BE (1) | BE549753A (member.php) |
| DE (1) | DE1056476B (member.php) |
| FR (1) | FR1157350A (member.php) |
| GB (1) | GB814140A (member.php) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2810465A1 (de) * | 1978-03-10 | 1979-09-13 | Agfa Gevaert Ag | Verfahren zur verarbeitung eines fotografischen materials mit einer verarbeitungsfluessigkeit |
Families Citing this family (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3234022A (en) * | 1960-08-08 | 1966-02-08 | Polaroid Corp | Diffusion-transfer reversal processes and elements useful in such processes |
| US3236649A (en) * | 1960-08-29 | 1966-02-22 | Werner W Buechner | Photographic process and apparatus |
| NL123554C (member.php) * | 1961-03-09 | |||
| DE1422926A1 (de) * | 1962-01-25 | 1968-10-24 | Lumoprint Zindler Kg | Verfahren zur Herstellung seitenrichtiger,positiver Abbildungen und Material zur Durchfuehrung dieses Verfahrens |
| US3256091A (en) * | 1962-09-26 | 1966-06-14 | Polaroid Corp | Photographic processes |
| US3326683A (en) * | 1962-09-27 | 1967-06-20 | Polaroid Corp | Diffusion transfer photographic process using 4, 6-diamino-ortho cresol |
| US3309201A (en) * | 1962-12-28 | 1967-03-14 | Polaroid Corp | Photographic miniature transparency film product |
| US3352674A (en) * | 1964-01-20 | 1967-11-14 | Eastman Kodak Co | Process and product for image transfer photography |
| US3893854A (en) * | 1973-03-30 | 1975-07-08 | Xerox Corp | Photographic articles with gaps for processing fluids |
| US4317626A (en) * | 1979-01-22 | 1982-03-02 | Eastman Kodak Company | Photo-identification card pack |
| US4288533A (en) * | 1979-01-22 | 1981-09-08 | Eastman Kodak Company | Instant film unit |
| US4245035A (en) * | 1979-01-22 | 1981-01-13 | Eastman Kodak Company | Photo-identification card |
| US4283134A (en) * | 1980-04-24 | 1981-08-11 | Eastman Kodak Company | Film pack |
| US4370407A (en) * | 1980-04-24 | 1983-01-25 | Eastman Kodak Company | Photographic products including liquid spreading means |
| FR2507790A1 (fr) * | 1981-06-11 | 1982-12-17 | Eastman Kodak Co | Film pack perfectionne |
Citations (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2563342A (en) * | 1947-01-28 | 1951-08-07 | Polaroid Corp | Photographic product and process |
| US2584030A (en) * | 1947-02-07 | 1952-01-29 | Polaroid Corp | Light sensitive silver halide photographic product for image transfer and process utilizing the same |
| US2603565A (en) * | 1947-01-15 | 1952-07-15 | Polaroid Corp | Photographic film forming image transfer composition |
| US2647049A (en) * | 1947-02-25 | 1953-07-28 | Polaroid Corp | Photographic element for color photography and a process of producing multicolor pictures |
Family Cites Families (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US1231581A (en) * | 1916-10-18 | 1917-07-03 | Ernest Howard Farmer | Apparatus for the production of photographic negatives. |
| GB456471A (en) * | 1935-09-11 | 1936-11-10 | Ijzerhandel I M De Vries Nv | Improvements in methods of and devices for glueing parts together |
| US2544268A (en) * | 1948-10-07 | 1951-03-06 | Polaroid Corp | Photographic product |
| US2612450A (en) * | 1946-01-17 | 1952-09-30 | Polaroid Corp | Self-framing photographic film unit containing a liquid, and process for producing framed positive images |
| US2647055A (en) * | 1946-11-06 | 1953-07-28 | Polaroid Corp | Photographic product and process for forming a white image viewable against a dark background |
| US2543181A (en) * | 1947-01-15 | 1951-02-27 | Polaroid Corp | Photographic product comprising a rupturable container carrying a photographic processing liquid |
| FR960844A (member.php) * | 1947-02-19 | 1950-04-26 | ||
| US2471522A (en) * | 1947-09-20 | 1949-05-31 | Polaroid Corp | Photographic film holder |
| US2647056A (en) * | 1948-02-12 | 1953-07-28 | Polaroid Corp | One step photographic transfer process |
| CH278309A (de) * | 1949-07-04 | 1951-10-15 | Bayer Ag | Verfahren zur direkten Herstellung von positiven photographischen Bildern. |
| US2689306A (en) * | 1951-03-06 | 1954-09-14 | Polaroid Corp | Device for holding self-developing photographic film and apparatus for processing said film |
| US2798021A (en) * | 1953-09-25 | 1957-07-02 | Polarold Corp | Method of protectively treating and mounting photographic prints |
-
0
- BE BE549753D patent/BE549753A/xx unknown
-
1955
- 1955-07-22 US US523885A patent/US2982650A/en not_active Expired - Lifetime
-
1956
- 1956-06-20 GB GB19072/56A patent/GB814140A/en not_active Expired
- 1956-07-19 DE DEI11972A patent/DE1056476B/de active Pending
- 1956-07-20 FR FR1157350D patent/FR1157350A/fr not_active Expired
Patent Citations (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2603565A (en) * | 1947-01-15 | 1952-07-15 | Polaroid Corp | Photographic film forming image transfer composition |
| US2563342A (en) * | 1947-01-28 | 1951-08-07 | Polaroid Corp | Photographic product and process |
| US2584030A (en) * | 1947-02-07 | 1952-01-29 | Polaroid Corp | Light sensitive silver halide photographic product for image transfer and process utilizing the same |
| US2647049A (en) * | 1947-02-25 | 1953-07-28 | Polaroid Corp | Photographic element for color photography and a process of producing multicolor pictures |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2810465A1 (de) * | 1978-03-10 | 1979-09-13 | Agfa Gevaert Ag | Verfahren zur verarbeitung eines fotografischen materials mit einer verarbeitungsfluessigkeit |
Also Published As
| Publication number | Publication date |
|---|---|
| BE549753A (member.php) | |
| GB814140A (en) | 1959-05-27 |
| FR1157350A (fr) | 1958-05-28 |
| US2982650A (en) | 1961-05-02 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1056476B (de) | Verfahren zur Herstellung von UEbertragungsbildern | |
| DE2010752A1 (de) | Verfahren und Vorrichtung zum Behandeln eines photographischen Filmverbandes | |
| DE2010489C3 (de) | Photographisches Aufzeichnungsmaterial für Diffusionsübertragungsverfahren und Verfahren zu dessen Herstellung | |
| DE1936009A1 (de) | Photographischer Filmverband fuer Selbstentwicklerkameras | |
| CH508227A (de) | Mehrschichtiges Bildempfangselement und Verwendung desselben | |
| DE1622896B2 (de) | Photographischer filmverband fuer selbstentwicklerkameras | |
| DE2441751C2 (member.php) | ||
| DE1020865B (de) | Verfahren zur Herstellung direkter photographischer Positive | |
| DE1964840A1 (de) | Filmverband fuer Selbstentwicklerkameras | |
| DE1918885A1 (de) | Filmverband fuer Selbstentwicklerkameras | |
| DE2319489A1 (de) | Photographische entwicklungs- oder behandlungsmasse, insbesondere fuer das diffusionsuebertragungsverfahren | |
| DE2102805A1 (de) | Filmverband fur Selbstentwickler kameras | |
| DE2127924C2 (de) | Photographisches Aufzeichnungsmaterial | |
| DE2263014C2 (de) | Farbphotographisches Diffusionsübertragungsverfahren und Entwicklerflüssigkeit | |
| DE3100702A1 (de) | Photographische sofortbildeinheit | |
| CH518132A (de) | Verfahren und Vorrichtung zum Auftragen einer gleichmässigen Schicht einer viskosen Masse auf die Oberfläche eines flächenförmigen Materials | |
| DE2413981A1 (de) | Zusammengesetzte filmeinheit fuer das photographische diffusionsuebertragungsverfahren | |
| DE959516C (de) | Photographisches Verfahren zur Bilderzeugung durch Kontaktuebertragung und Material zur Durchfuehrung des Verfahrens | |
| DE1957975A1 (de) | Verfahren und Vorrichtung zur Behandlung photographischer Papiere | |
| DE1622897B1 (de) | Filmverband für Selbstentwicklerkameras und Verfahren zur Behandlung belichteter Filmverbände | |
| DE2315300C2 (member.php) | ||
| DE1447968A1 (de) | Lithographisches Blatt und ein Verfahren zur Herstellung desselben | |
| DE1572210A1 (de) | Verfahren und Material zur Gewinnung photographischer Bilder | |
| DE1964534B2 (de) | Photographisches Aufzeichnungs material fur das Farbstoffdiffusions verfahren | |
| DE1937055C2 (de) | Selbstentwicklerfilmeinheit |