DE1047436B - Verfahren zur Polymerisation oder Mischpolymerisation von Estern der Acryl- und Methacrylsaeure - Google Patents
Verfahren zur Polymerisation oder Mischpolymerisation von Estern der Acryl- und MethacrylsaeureInfo
- Publication number
- DE1047436B DE1047436B DER15942A DER0015942A DE1047436B DE 1047436 B DE1047436 B DE 1047436B DE R15942 A DER15942 A DE R15942A DE R0015942 A DER0015942 A DE R0015942A DE 1047436 B DE1047436 B DE 1047436B
- Authority
- DE
- Germany
- Prior art keywords
- esters
- polymerization
- parts
- acrylic
- solution
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 150000002148 esters Chemical class 0.000 title claims description 25
- 238000006116 polymerization reaction Methods 0.000 title claims description 12
- 238000000034 method Methods 0.000 title claims description 7
- 238000007334 copolymerization reaction Methods 0.000 title claims description 5
- NIXOWILDQLNWCW-UHFFFAOYSA-N acrylic acid group Chemical group C(C=C)(=O)O NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 title description 6
- 125000005395 methacrylic acid group Chemical class 0.000 title description 2
- 239000003054 catalyst Substances 0.000 claims description 12
- CERQOIWHTDAKMF-UHFFFAOYSA-N Methacrylic acid Chemical compound CC(=C)C(O)=O CERQOIWHTDAKMF-UHFFFAOYSA-N 0.000 claims description 11
- 150000001875 compounds Chemical class 0.000 claims description 7
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 claims description 5
- 125000002573 ethenylidene group Chemical group [*]=C=C([H])[H] 0.000 claims description 5
- 239000001257 hydrogen Substances 0.000 claims description 4
- 229910052739 hydrogen Inorganic materials 0.000 claims description 4
- 229930195733 hydrocarbon Natural products 0.000 claims description 3
- 239000004215 Carbon black (E152) Substances 0.000 claims description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 2
- 125000004432 carbon atom Chemical group C* 0.000 claims description 2
- 229920006037 cross link polymer Polymers 0.000 claims description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 2
- 239000002685 polymerization catalyst Substances 0.000 claims 1
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 24
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 13
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 12
- 239000000047 product Substances 0.000 description 12
- 239000004342 Benzoyl peroxide Substances 0.000 description 11
- OMPJBNCRMGITSC-UHFFFAOYSA-N Benzoylperoxide Chemical compound C=1C=CC=CC=1C(=O)OOC(=O)C1=CC=CC=C1 OMPJBNCRMGITSC-UHFFFAOYSA-N 0.000 description 11
- 235000019400 benzoyl peroxide Nutrition 0.000 description 11
- 238000010438 heat treatment Methods 0.000 description 11
- 229920000642 polymer Polymers 0.000 description 11
- 229920001577 copolymer Polymers 0.000 description 10
- 239000000203 mixture Substances 0.000 description 7
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 6
- WTEOIRVLGSZEPR-UHFFFAOYSA-N boron trifluoride Chemical compound FB(F)F WTEOIRVLGSZEPR-UHFFFAOYSA-N 0.000 description 6
- 239000000839 emulsion Substances 0.000 description 6
- 239000002904 solvent Substances 0.000 description 6
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 6
- 239000011347 resin Substances 0.000 description 5
- 229920005989 resin Polymers 0.000 description 5
- 239000007787 solid Substances 0.000 description 5
- BAPJBEWLBFYGME-UHFFFAOYSA-N Methyl acrylate Chemical compound COC(=O)C=C BAPJBEWLBFYGME-UHFFFAOYSA-N 0.000 description 4
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 4
- ROOXNKNUYICQNP-UHFFFAOYSA-N ammonium persulfate Chemical compound [NH4+].[NH4+].[O-]S(=O)(=O)OOS([O-])(=O)=O ROOXNKNUYICQNP-UHFFFAOYSA-N 0.000 description 4
- 238000004132 cross linking Methods 0.000 description 4
- FPYJFEHAWHCUMM-UHFFFAOYSA-N maleic anhydride Chemical compound O=C1OC(=O)C=C1 FPYJFEHAWHCUMM-UHFFFAOYSA-N 0.000 description 4
- 125000005397 methacrylic acid ester group Chemical group 0.000 description 4
- 239000000178 monomer Substances 0.000 description 4
- 238000010992 reflux Methods 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- 229920001169 thermoplastic Polymers 0.000 description 4
- 239000008096 xylene Substances 0.000 description 4
- 229910015900 BF3 Inorganic materials 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 3
- VVQNEPGJFQJSBK-UHFFFAOYSA-N Methyl methacrylate Chemical compound COC(=O)C(C)=C VVQNEPGJFQJSBK-UHFFFAOYSA-N 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 239000007789 gas Substances 0.000 description 3
- -1 hydrocarbon radical Chemical class 0.000 description 3
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- KAKZBPTYRLMSJV-UHFFFAOYSA-N Butadiene Chemical group C=CC=C KAKZBPTYRLMSJV-UHFFFAOYSA-N 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- JIGUQPWFLRLWPJ-UHFFFAOYSA-N Ethyl acrylate Chemical compound CCOC(=O)C=C JIGUQPWFLRLWPJ-UHFFFAOYSA-N 0.000 description 2
- NTIZESTWPVYFNL-UHFFFAOYSA-N Methyl isobutyl ketone Chemical compound CC(C)CC(C)=O NTIZESTWPVYFNL-UHFFFAOYSA-N 0.000 description 2
- UIHCLUNTQKBZGK-UHFFFAOYSA-N Methyl isobutyl ketone Natural products CCC(C)C(C)=O UIHCLUNTQKBZGK-UHFFFAOYSA-N 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 125000005907 alkyl ester group Chemical group 0.000 description 2
- 125000000217 alkyl group Chemical group 0.000 description 2
- 229910001870 ammonium persulfate Inorganic materials 0.000 description 2
- ISAOCJYIOMOJEB-UHFFFAOYSA-N benzoin Chemical compound C=1C=CC=CC=1C(O)C(=O)C1=CC=CC=C1 ISAOCJYIOMOJEB-UHFFFAOYSA-N 0.000 description 2
- 239000011248 coating agent Substances 0.000 description 2
- 238000000576 coating method Methods 0.000 description 2
- ZQMIGQNCOMNODD-UHFFFAOYSA-N diacetyl peroxide Chemical compound CC(=O)OOC(C)=O ZQMIGQNCOMNODD-UHFFFAOYSA-N 0.000 description 2
- 239000004744 fabric Substances 0.000 description 2
- 239000011521 glass Substances 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- PNJWIWWMYCMZRO-UHFFFAOYSA-N pent‐4‐en‐2‐one Natural products CC(=O)CC=C PNJWIWWMYCMZRO-UHFFFAOYSA-N 0.000 description 2
- CIHOLLKRGTVIJN-UHFFFAOYSA-N tert‐butyl hydroperoxide Chemical compound CC(C)(C)OO CIHOLLKRGTVIJN-UHFFFAOYSA-N 0.000 description 2
- 238000005809 transesterification reaction Methods 0.000 description 2
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 2
- 229920002554 vinyl polymer Polymers 0.000 description 2
- TXUICONDJPYNPY-UHFFFAOYSA-N (1,10,13-trimethyl-3-oxo-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl) heptanoate Chemical compound C1CC2CC(=O)C=C(C)C2(C)C2C1C1CCC(OC(=O)CCCCCC)C1(C)CC2 TXUICONDJPYNPY-UHFFFAOYSA-N 0.000 description 1
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 1
- WNXJIVFYUVYPPR-UHFFFAOYSA-N 1,3-dioxolane Chemical group C1COCO1 WNXJIVFYUVYPPR-UHFFFAOYSA-N 0.000 description 1
- IGGDKDTUCAWDAN-UHFFFAOYSA-N 1-vinylnaphthalene Chemical compound C1=CC=C2C(C=C)=CC=CC2=C1 IGGDKDTUCAWDAN-UHFFFAOYSA-N 0.000 description 1
- OEPOKWHJYJXUGD-UHFFFAOYSA-N 2-(3-phenylmethoxyphenyl)-1,3-thiazole-4-carbaldehyde Chemical compound O=CC1=CSC(C=2C=C(OCC=3C=CC=CC=3)C=CC=2)=N1 OEPOKWHJYJXUGD-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- FRIBMENBGGCKPD-UHFFFAOYSA-N 3-(2,3-dimethoxyphenyl)prop-2-enal Chemical compound COC1=CC=CC(C=CC=O)=C1OC FRIBMENBGGCKPD-UHFFFAOYSA-N 0.000 description 1
- MGYMHQJELJYRQS-UHFFFAOYSA-N Ascaridole Chemical compound C1CC2(C)OOC1(C(C)C)C=C2 MGYMHQJELJYRQS-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- 239000004641 Diallyl-phthalate Substances 0.000 description 1
- 235000009161 Espostoa lanata Nutrition 0.000 description 1
- 240000001624 Espostoa lanata Species 0.000 description 1
- KIWBPDUYBMNFTB-UHFFFAOYSA-N Ethyl hydrogen sulfate Chemical compound CCOS(O)(=O)=O KIWBPDUYBMNFTB-UHFFFAOYSA-N 0.000 description 1
- 238000005727 Friedel-Crafts reaction Methods 0.000 description 1
- YIVJZNGAASQVEM-UHFFFAOYSA-N Lauroyl peroxide Chemical compound CCCCCCCCCCCC(=O)OOC(=O)CCCCCCCCCCC YIVJZNGAASQVEM-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 244000028419 Styrax benzoin Species 0.000 description 1
- 235000000126 Styrax benzoin Nutrition 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- 235000008411 Sumatra benzointree Nutrition 0.000 description 1
- 229910021626 Tin(II) chloride Inorganic materials 0.000 description 1
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 description 1
- XTXRWKRVRITETP-UHFFFAOYSA-N Vinyl acetate Chemical compound CC(=O)OC=C XTXRWKRVRITETP-UHFFFAOYSA-N 0.000 description 1
- BZHJMEDXRYGGRV-UHFFFAOYSA-N Vinyl chloride Chemical compound ClC=C BZHJMEDXRYGGRV-UHFFFAOYSA-N 0.000 description 1
- 238000005299 abrasion Methods 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- MGYMHQJELJYRQS-ZJUUUORDSA-N ascaridole Natural products C1C[C@]2(C)OO[C@@]1(C(C)C)C=C2 MGYMHQJELJYRQS-ZJUUUORDSA-N 0.000 description 1
- 229960002130 benzoin Drugs 0.000 description 1
- GCTPMLUUWLLESL-UHFFFAOYSA-N benzyl prop-2-enoate Chemical class C=CC(=O)OCC1=CC=CC=C1 GCTPMLUUWLLESL-UHFFFAOYSA-N 0.000 description 1
- QUDWYFHPNIMBFC-UHFFFAOYSA-N bis(prop-2-enyl) benzene-1,2-dicarboxylate Chemical compound C=CCOC(=O)C1=CC=CC=C1C(=O)OCC=C QUDWYFHPNIMBFC-UHFFFAOYSA-N 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 235000014510 cooky Nutrition 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- 238000007872 degassing Methods 0.000 description 1
- LSXWFXONGKSEMY-UHFFFAOYSA-N di-tert-butyl peroxide Chemical compound CC(C)(C)OOC(C)(C)C LSXWFXONGKSEMY-UHFFFAOYSA-N 0.000 description 1
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- SUPCQIBBMFXVTL-UHFFFAOYSA-N ethyl 2-methylprop-2-enoate Chemical compound CCOC(=O)C(C)=C SUPCQIBBMFXVTL-UHFFFAOYSA-N 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000011049 filling Methods 0.000 description 1
- 239000005357 flat glass Substances 0.000 description 1
- 235000019382 gum benzoic Nutrition 0.000 description 1
- PYGSKMBEVAICCR-UHFFFAOYSA-N hexa-1,5-diene Chemical group C=CCCC=C PYGSKMBEVAICCR-UHFFFAOYSA-N 0.000 description 1
- 239000003112 inhibitor Substances 0.000 description 1
- 239000010985 leather Substances 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 239000006082 mold release agent Substances 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- XNTUJOTWIMFEQS-UHFFFAOYSA-N octadecanoyl octadecaneperoxoate Chemical compound CCCCCCCCCCCCCCCCCC(=O)OOC(=O)CCCCCCCCCCCCCCCCC XNTUJOTWIMFEQS-UHFFFAOYSA-N 0.000 description 1
- 229940065472 octyl acrylate Drugs 0.000 description 1
- ANISOHQJBAQUQP-UHFFFAOYSA-N octyl prop-2-enoate Chemical compound CCCCCCCCOC(=O)C=C ANISOHQJBAQUQP-UHFFFAOYSA-N 0.000 description 1
- 239000011049 pearl Substances 0.000 description 1
- 235000021317 phosphate Nutrition 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 229920003229 poly(methyl methacrylate) Polymers 0.000 description 1
- 230000000379 polymerizing effect Effects 0.000 description 1
- 239000004926 polymethyl methacrylate Substances 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 239000012262 resinous product Substances 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 125000006850 spacer group Chemical group 0.000 description 1
- 235000011150 stannous chloride Nutrition 0.000 description 1
- 239000001119 stannous chloride Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 229920001897 terpolymer Polymers 0.000 description 1
- GJBRNHKUVLOCEB-UHFFFAOYSA-N tert-butyl benzenecarboperoxoate Chemical compound CC(C)(C)OOC(=O)C1=CC=CC=C1 GJBRNHKUVLOCEB-UHFFFAOYSA-N 0.000 description 1
- 229920001187 thermosetting polymer Polymers 0.000 description 1
- 239000004416 thermosoftening plastic Substances 0.000 description 1
- 239000010936 titanium Substances 0.000 description 1
- 229910052719 titanium Inorganic materials 0.000 description 1
- 125000003944 tolyl group Chemical group 0.000 description 1
- GPRLSGONYQIRFK-MNYXATJNSA-N triton Chemical compound [3H+] GPRLSGONYQIRFK-MNYXATJNSA-N 0.000 description 1
- 229920001567 vinyl ester resin Polymers 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
- 239000002023 wood Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D317/00—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms
- C07D317/08—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3
- C07D317/10—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 not condensed with other rings
- C07D317/14—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 not condensed with other rings with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D317/18—Radicals substituted by singly bound oxygen or sulfur atoms
- C07D317/24—Radicals substituted by singly bound oxygen or sulfur atoms esterified
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F20/00—Homopolymers and copolymers of compounds having one or more unsaturated aliphatic radicals, each having only one carbon-to-carbon double bond, and only one being terminated by only one carboxyl radical or a salt, anhydride, ester, amide, imide or nitrile thereof
- C08F20/02—Monocarboxylic acids having less than ten carbon atoms, Derivatives thereof
- C08F20/10—Esters
- C08F20/26—Esters containing oxygen in addition to the carboxy oxygen
- C08F20/28—Esters containing oxygen in addition to the carboxy oxygen containing no aromatic rings in the alcohol moiety
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Addition Polymer Or Copolymer, Post-Treatments, Or Chemical Modifications (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US298008A US2680735A (en) | 1952-07-09 | 1952-07-09 | Resinous esters of acrylic acid and methacrylic acid |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1047436B true DE1047436B (de) | 1958-12-24 |
Family
ID=23148608
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DER15942A Pending DE1047436B (de) | 1952-07-09 | 1953-07-06 | Verfahren zur Polymerisation oder Mischpolymerisation von Estern der Acryl- und Methacrylsaeure |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US2680735A (enExample) |
| BE (1) | BE521281A (enExample) |
| DE (1) | DE1047436B (enExample) |
| FR (1) | FR1080302A (enExample) |
| NL (2) | NL179522B (enExample) |
Families Citing this family (28)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3058934A (en) * | 1962-10-16 | Coating compositions containing z-vinyl- | ||
| US2975156A (en) * | 1956-03-21 | 1961-03-14 | Pittsburgh Plate Glass Co | Novel monomeric compounds and homopolymers and interpolymers thereof |
| US2877215A (en) * | 1956-08-10 | 1959-03-10 | Du Pont | Reaction product of phosphoric acid with a dioxolane ester-ethylenically unsaturated monomer copolymer and process for making same |
| DE1131226B (de) * | 1958-12-24 | 1962-06-14 | Riedel De Haeen Ag | Verfahren zur Herstellung der Carbaminsaeureester von 4-Oxymethyl-1,3-dioxolanen |
| US3184441A (en) * | 1959-04-06 | 1965-05-18 | Du Pont | Air-drying esters of 1, 3-cyclic acetals |
| US3190446A (en) * | 1960-10-28 | 1965-06-22 | Donald G Griswold | Automatic control means for a water softener system |
| US3210327A (en) * | 1962-05-23 | 1965-10-05 | Gulf Oil Corp | Symmetrical diol alkyl esters of acrylic acids and polymers thereof |
| US3271377A (en) * | 1962-05-23 | 1966-09-06 | Gulf Oil Corp | Polymerizable 2-alkylene-m-dioxanyl acrylic esters |
| US3267084A (en) * | 1962-05-23 | 1966-08-16 | Gulf Oil Corp | Polymerizable 5-alkylene-m-dioxanyl acrylic esters |
| US3224951A (en) * | 1962-07-09 | 1965-12-21 | Scott Paper Co | Radiative processing of thermoplastic polymers |
| US3225015A (en) * | 1962-07-09 | 1965-12-21 | Scott Paper Co | Itaconic acid esters of 1,2 alkane ketals |
| US3225014A (en) * | 1962-07-09 | 1965-12-21 | Scott Paper Co | Ethylene dicarboxylic esters of 1,2 alkane ketals |
| US3256254A (en) * | 1962-08-28 | 1966-06-14 | Du Pont | Oxycarbocyclic ester compositions containing aryl peroxides and tertiary aromatic amines, polymerizable in air |
| GB1002664A (en) * | 1963-07-23 | 1965-08-25 | Ici Ltd | Unsaturated esters and polymers thereof |
| US3488335A (en) * | 1964-03-11 | 1970-01-06 | Du Pont | Heterocyclic fluorine containing compounds and polymers thereof |
| US3389112A (en) * | 1965-01-29 | 1968-06-18 | Ashland Oil Inc | Unsaturated cyclic acetals and polymers thereof |
| US3542908A (en) * | 1968-03-22 | 1970-11-24 | Us Interior | Method of manufacturing a reverse osmosis memberane |
| CH557814A (de) * | 1971-07-23 | 1975-01-15 | Givaudan & Cie Sa | Verfahren zur herstellung von neuen geschmackstoffen. |
| US4060532A (en) * | 1972-03-15 | 1977-11-29 | Ici United States Inc. | Halogenated dioxolane tranquilizers |
| US4076727A (en) * | 1976-01-19 | 1978-02-28 | Celanese Corporation | Cyclic acetal acrylates or methacrylates and processes for preparing same |
| US4634722A (en) * | 1981-05-20 | 1987-01-06 | Syntex (U.S.A.) Inc. | Copolymers and hydrogels: process and articles made thereof |
| US4401797A (en) * | 1981-05-20 | 1983-08-30 | Syntex (U.S.A.) Inc. | Copolymers and hydrogels: process and articles made thereof |
| US4568734A (en) * | 1983-02-15 | 1986-02-04 | Eastman Kodak Company | Electron-beam and X-ray sensitive polymers and resists |
| US5153290A (en) * | 1991-01-24 | 1992-10-06 | General Electric Company | Polymers of ethylenically unsaturated cyclic ortho esters |
| US6924129B2 (en) * | 2002-10-23 | 2005-08-02 | Polytechnic University | Enzyme-catalyzed esterification of pendant carboxylic acid groups |
| DE10308504A1 (de) * | 2003-02-26 | 2004-09-09 | Basf Ag | Enzymatische Herstellung von (Meth)acrylsäureestern |
| EP1945307B1 (en) * | 2005-10-11 | 2013-03-27 | DPT Laboratories, LTD. | Surfactant-free dispersions, compositions, and use in topical formulations |
| US12379677B2 (en) * | 2021-07-27 | 2025-08-05 | Xerox Corporation | Latexes and related compositions |
Citations (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2556075A (en) * | 1948-06-19 | 1951-06-05 | American Cyanamid Co | Method of polymerizing glycidyl compounds |
| US2578861A (en) * | 1949-07-26 | 1951-12-18 | American Cyanamid Co | Unsaturated dioxolane compounds, products prepared therefrom, and methods of preparation |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2312298A (en) * | 1943-02-23 | Process of preparing esters of | ||
| US2382640A (en) * | 1943-09-08 | 1945-08-14 | Eastman Kodak Co | Resinous polymer of methylene dioxolane |
-
0
- NL NL82513D patent/NL82513C/xx active
- NL NLAANVRAGE7306220,A patent/NL179522B/xx unknown
- BE BE521281D patent/BE521281A/xx unknown
-
1952
- 1952-07-09 US US298008A patent/US2680735A/en not_active Expired - Lifetime
-
1953
- 1953-07-02 FR FR1080302D patent/FR1080302A/fr not_active Expired
- 1953-07-06 DE DER15942A patent/DE1047436B/de active Pending
Patent Citations (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2556075A (en) * | 1948-06-19 | 1951-06-05 | American Cyanamid Co | Method of polymerizing glycidyl compounds |
| US2578861A (en) * | 1949-07-26 | 1951-12-18 | American Cyanamid Co | Unsaturated dioxolane compounds, products prepared therefrom, and methods of preparation |
Also Published As
| Publication number | Publication date |
|---|---|
| US2680735A (en) | 1954-06-08 |
| FR1080302A (fr) | 1954-12-08 |
| NL179522B (nl) | |
| BE521281A (enExample) | |
| NL82513C (enExample) |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1047436B (de) | Verfahren zur Polymerisation oder Mischpolymerisation von Estern der Acryl- und Methacrylsaeure | |
| US2258718A (en) | Esters of ortho inorganic acids of titanium, tin, and aluminum with alpha beta unsaturated primary alcohols | |
| EP0245647B1 (de) | Polymethacrylat-Formmasse mit hoher Wärmeformbeständigkeit und hoher thermischer Stabilität | |
| DE1069874B (de) | Verfahren zur Herstellung von Mischpolymeren | |
| DE1203475B (de) | Verfahren zur Herstellung eines gegen Frost und Tauwasser mechanisch stabilen Latex | |
| DE1032537B (de) | Verfahren zur Herstellung von phosphorhaltigen Polymerisaten | |
| DE947024C (de) | Verfahren zur Herstellung von Mischpolymerisaten auf Grundlage von Vinylidencyanid | |
| DE3855782T2 (de) | Acryl- und Methacrylsäureester und Verfahren zu ihrer Herstellung | |
| DE1932715C3 (de) | Durch Elektronenstrahlen härtbare Anstrichsmasse und Verfahren zum Überziehen von Gegenständen | |
| DE2213927C3 (de) | Stabilisierte Polyvinylchloridmassen | |
| DE1150814B (de) | Verfahren zur Beschleunigung der Polymerisation von aethylenisch ungesaettigten Monomeren und/oder teilweise polymerisierten ungesaettigten Harzen | |
| DE973440C (de) | Verfahren zur Herstellung von Kunststoffen | |
| US2335962A (en) | Polymerized mixed ester and method of manufacture thereof | |
| DE2265290A1 (de) | Verwendung von perestern | |
| DE1905487A1 (de) | Verfahren zur Herstellung von Terpolymerisaten | |
| DE1595672C3 (de) | Verfahren zur Herstellung von mit Monoolefinen modifizierten Pfropfpolymerisaten des Vinylchlorids auf Äthylen-Vinylacetat-Copolymerisate | |
| DE695756C (de) | Verfahren zur Herstellung von Mischpolymerisaten | |
| DE2419950A1 (de) | Verfahren zur herstellung von thermisch haertbaren harzen | |
| DE1061517B (de) | Verfahren zur Herstellung von Polymeren und Copolymeren von Alkenylestern von 3,4-Epoxycyclohexancarbonsaeuren | |
| AT286622B (de) | Verfahren zur herstellung thermoplastischer formmassen | |
| DE1494467A1 (de) | Polymerisierbare Massen | |
| DE1063808B (de) | Verfahren zur Herstellung von Polymerisaten | |
| DE1011619B (de) | Verfahren zur Herstellung von vernetzten Mischpolymerisaten | |
| DE1495736C (de) | Verfahren zur Herstellung von Vinylchlorid-Vinylidenchlorid-Pfropfpolymerisaten | |
| CH637661A5 (en) | Copolymer based on alpha, beta-olefinically unsaturated mononitriles, and process for the preparation thereof |