DE1041688B - Verwendung von Addukten aus Polyaminen und Monoepoxyden zum Haerten von Polyepoxyden - Google Patents
Verwendung von Addukten aus Polyaminen und Monoepoxyden zum Haerten von PolyepoxydenInfo
- Publication number
- DE1041688B DE1041688B DEN12174A DEN0012174A DE1041688B DE 1041688 B DE1041688 B DE 1041688B DE N12174 A DEN12174 A DE N12174A DE N0012174 A DEN0012174 A DE N0012174A DE 1041688 B DE1041688 B DE 1041688B
- Authority
- DE
- Germany
- Prior art keywords
- parts
- phenylenediamine
- epoxy
- adducts
- polyepoxides
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 229920000647 polyepoxide Polymers 0.000 title claims description 26
- 229920000768 polyamine Polymers 0.000 title claims description 18
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 claims description 20
- 229920000570 polyether Polymers 0.000 claims description 20
- 239000000203 mixture Substances 0.000 claims description 18
- WZCQRUWWHSTZEM-UHFFFAOYSA-N 1,3-phenylenediamine Chemical compound NC1=CC=CC(N)=C1 WZCQRUWWHSTZEM-UHFFFAOYSA-N 0.000 claims description 17
- 229940018564 m-phenylenediamine Drugs 0.000 claims description 16
- 239000004721 Polyphenylene oxide Substances 0.000 claims description 13
- 125000003118 aryl group Chemical group 0.000 claims description 12
- 239000004593 Epoxy Substances 0.000 claims description 9
- 239000003795 chemical substances by application Substances 0.000 claims description 9
- 229920005989 resin Polymers 0.000 claims description 8
- 239000011347 resin Substances 0.000 claims description 8
- 238000005266 casting Methods 0.000 claims description 7
- 125000004432 carbon atom Chemical group C* 0.000 claims description 6
- 125000003055 glycidyl group Chemical group C(C1CO1)* 0.000 claims description 6
- AWMVMTVKBNGEAK-UHFFFAOYSA-N Styrene oxide Chemical compound C1OC1C1=CC=CC=C1 AWMVMTVKBNGEAK-UHFFFAOYSA-N 0.000 claims description 5
- 239000002904 solvent Substances 0.000 claims description 5
- -1 aliphatic poly-phenylenediamine Chemical class 0.000 claims description 4
- 238000010438 heat treatment Methods 0.000 claims description 4
- 238000000034 method Methods 0.000 claims description 4
- 239000007787 solid Substances 0.000 claims description 4
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 claims description 3
- STMDPCBYJCIZOD-UHFFFAOYSA-N 2-(2,4-dinitroanilino)-4-methylpentanoic acid Chemical compound CC(C)CC(C(O)=O)NC1=CC=C([N+]([O-])=O)C=C1[N+]([O-])=O STMDPCBYJCIZOD-UHFFFAOYSA-N 0.000 claims description 3
- HOSGXJWQVBHGLT-UHFFFAOYSA-N 6-hydroxy-3,4-dihydro-1h-quinolin-2-one Chemical group N1C(=O)CCC2=CC(O)=CC=C21 HOSGXJWQVBHGLT-UHFFFAOYSA-N 0.000 claims description 3
- 238000001816 cooling Methods 0.000 claims description 3
- 229930195733 hydrocarbon Natural products 0.000 claims description 3
- 239000006188 syrup Substances 0.000 claims description 3
- 235000020357 syrup Nutrition 0.000 claims description 3
- GEYOCULIXLDCMW-UHFFFAOYSA-N 1,2-phenylenediamine Chemical compound NC1=CC=CC=C1N GEYOCULIXLDCMW-UHFFFAOYSA-N 0.000 claims description 2
- 239000004215 Carbon black (E152) Substances 0.000 claims description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 2
- 150000002430 hydrocarbons Chemical class 0.000 claims description 2
- QNAJAJLBHMMOJB-UHFFFAOYSA-N oxiran-2-ylmethyl propanoate Chemical compound CCC(=O)OCC1CO1 QNAJAJLBHMMOJB-UHFFFAOYSA-N 0.000 claims description 2
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 2
- 239000001294 propane Substances 0.000 claims description 2
- 239000004744 fabric Substances 0.000 claims 5
- QGMGHALXLXKCBD-UHFFFAOYSA-N 4-amino-n-(2-aminophenyl)benzamide Chemical compound C1=CC(N)=CC=C1C(=O)NC1=CC=CC=C1N QGMGHALXLXKCBD-UHFFFAOYSA-N 0.000 claims 1
- 239000007795 chemical reaction product Substances 0.000 claims 1
- 238000001035 drying Methods 0.000 claims 1
- 239000000374 eutectic mixture Substances 0.000 claims 1
- 239000011521 glass Substances 0.000 claims 1
- 238000005470 impregnation Methods 0.000 claims 1
- 239000004033 plastic Substances 0.000 claims 1
- 229920003023 plastic Polymers 0.000 claims 1
- 239000000047 product Substances 0.000 claims 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 9
- 125000001931 aliphatic group Chemical group 0.000 description 8
- 125000003700 epoxy group Chemical group 0.000 description 7
- 239000007788 liquid Substances 0.000 description 6
- 230000004584 weight gain Effects 0.000 description 6
- 235000019786 weight gain Nutrition 0.000 description 6
- 238000007654 immersion Methods 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- BRLQWZUYTZBJKN-UHFFFAOYSA-N Epichlorohydrin Chemical compound ClCC1CO1 BRLQWZUYTZBJKN-UHFFFAOYSA-N 0.000 description 3
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 125000004429 atom Chemical group 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 150000002989 phenols Chemical class 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- 229930185605 Bisphenol Natural products 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- FQYUMYWMJTYZTK-UHFFFAOYSA-N Phenyl glycidyl ether Chemical compound C1OC1COC1=CC=CC=C1 FQYUMYWMJTYZTK-UHFFFAOYSA-N 0.000 description 2
- ATUOYWHBWRKTHZ-UHFFFAOYSA-N Propane Chemical compound CCC ATUOYWHBWRKTHZ-UHFFFAOYSA-N 0.000 description 2
- IISBACLAFKSPIT-UHFFFAOYSA-N bisphenol A Chemical compound C=1C=C(O)C=CC=1C(C)(C)C1=CC=C(O)C=C1 IISBACLAFKSPIT-UHFFFAOYSA-N 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 150000002118 epoxides Chemical group 0.000 description 2
- 239000000945 filler Substances 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- 150000005846 sugar alcohols Polymers 0.000 description 2
- TXVWTOBHDDIASC-UHFFFAOYSA-N 1,2-diphenylethene-1,2-diamine Chemical compound C=1C=CC=CC=1C(N)=C(N)C1=CC=CC=C1 TXVWTOBHDDIASC-UHFFFAOYSA-N 0.000 description 1
- CBCKQZAAMUWICA-UHFFFAOYSA-N 1,4-phenylenediamine Chemical compound NC1=CC=C(N)C=C1 CBCKQZAAMUWICA-UHFFFAOYSA-N 0.000 description 1
- IVIDDMGBRCPGLJ-UHFFFAOYSA-N 2,3-bis(oxiran-2-ylmethoxy)propan-1-ol Chemical compound C1OC1COC(CO)COCC1CO1 IVIDDMGBRCPGLJ-UHFFFAOYSA-N 0.000 description 1
- WISUILQECWFZCN-UHFFFAOYSA-N 2-(oxiran-2-ylmethylsulfanylmethyl)oxirane Chemical compound C1OC1CSCC1CO1 WISUILQECWFZCN-UHFFFAOYSA-N 0.000 description 1
- HTJFSXYVAKSPNF-UHFFFAOYSA-N 2-[2-(oxiran-2-yl)ethyl]oxirane Chemical compound C1OC1CCC1CO1 HTJFSXYVAKSPNF-UHFFFAOYSA-N 0.000 description 1
- PLDLPVSQYMQDBL-UHFFFAOYSA-N 2-[[3-(oxiran-2-ylmethoxy)-2,2-bis(oxiran-2-ylmethoxymethyl)propoxy]methyl]oxirane Chemical class C1OC1COCC(COCC1OC1)(COCC1OC1)COCC1CO1 PLDLPVSQYMQDBL-UHFFFAOYSA-N 0.000 description 1
- KDHWWOLNIDMJOQ-UHFFFAOYSA-N 4,5-diethylbenzene-1,3-diamine Chemical compound CCC1=CC(N)=CC(N)=C1CC KDHWWOLNIDMJOQ-UHFFFAOYSA-N 0.000 description 1
- IPDXWXPSCKSIII-UHFFFAOYSA-N 4-propan-2-ylbenzene-1,3-diamine Chemical compound CC(C)C1=CC=C(N)C=C1N IPDXWXPSCKSIII-UHFFFAOYSA-N 0.000 description 1
- 238000007556 Barcol hardness test Methods 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 1
- FBPFZTCFMRRESA-KVTDHHQDSA-N D-Mannitol Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-KVTDHHQDSA-N 0.000 description 1
- ZFIVKAOQEXOYFY-UHFFFAOYSA-N Diepoxybutane Chemical compound C1OC1C1OC1 ZFIVKAOQEXOYFY-UHFFFAOYSA-N 0.000 description 1
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 1
- 229930195725 Mannitol Natural products 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 125000005907 alkyl ester group Chemical group 0.000 description 1
- 150000005215 alkyl ethers Chemical class 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 150000004982 aromatic amines Chemical class 0.000 description 1
- 150000001491 aromatic compounds Chemical class 0.000 description 1
- CREXVNNSNOKDHW-UHFFFAOYSA-N azaniumylideneazanide Chemical group N[N] CREXVNNSNOKDHW-UHFFFAOYSA-N 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- RUOKPLVTMFHRJE-UHFFFAOYSA-N benzene-1,2,3-triamine Chemical compound NC1=CC=CC(N)=C1N RUOKPLVTMFHRJE-UHFFFAOYSA-N 0.000 description 1
- WGQKYBSKWIADBV-UHFFFAOYSA-N benzylamine Chemical compound NCC1=CC=CC=C1 WGQKYBSKWIADBV-UHFFFAOYSA-N 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 238000004132 cross linking Methods 0.000 description 1
- GYZLOYUZLJXAJU-UHFFFAOYSA-N diglycidyl ether Chemical compound C1OC1COCC1CO1 GYZLOYUZLJXAJU-UHFFFAOYSA-N 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000003822 epoxy resin Substances 0.000 description 1
- 150000002148 esters Chemical group 0.000 description 1
- 125000001033 ether group Chemical group 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 230000005496 eutectics Effects 0.000 description 1
- 239000003365 glass fiber Substances 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- LNEPOXFFQSENCJ-UHFFFAOYSA-N haloperidol Chemical compound C1CC(O)(C=2C=CC(Cl)=CC=2)CCN1CCCC(=O)C1=CC=C(F)C=C1 LNEPOXFFQSENCJ-UHFFFAOYSA-N 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 230000007794 irritation Effects 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 239000000594 mannitol Substances 0.000 description 1
- 235000010355 mannitol Nutrition 0.000 description 1
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 1
- 229910052753 mercury Inorganic materials 0.000 description 1
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical class C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 1
- 239000002480 mineral oil Substances 0.000 description 1
- 235000010446 mineral oil Nutrition 0.000 description 1
- 239000000178 monomer Substances 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- 210000000056 organ Anatomy 0.000 description 1
- 150000002894 organic compounds Chemical class 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 239000004014 plasticizer Substances 0.000 description 1
- 239000004848 polyfunctional curative Substances 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 230000000241 respiratory effect Effects 0.000 description 1
- 239000000600 sorbitol Substances 0.000 description 1
- 239000004753 textile Substances 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- 150000003626 triacylglycerols Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G59/00—Polycondensates containing more than one epoxy group per molecule; Macromolecules obtained by polymerising compounds containing more than one epoxy group per molecule using curing agents or catalysts which react with the epoxy groups
- C08G59/18—Macromolecules obtained by polymerising compounds containing more than one epoxy group per molecule using curing agents or catalysts which react with the epoxy groups ; e.g. general methods of curing
- C08G59/40—Macromolecules obtained by polymerising compounds containing more than one epoxy group per molecule using curing agents or catalysts which react with the epoxy groups ; e.g. general methods of curing characterised by the curing agents used
- C08G59/62—Alcohols or phenols
- C08G59/64—Amino alcohols
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Epoxy Resins (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US504681A US2938004A (en) | 1955-04-28 | 1955-04-28 | Adducts of aromatic polyamines and monoepoxides |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1041688B true DE1041688B (de) | 1958-10-23 |
Family
ID=24007292
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEN12174A Pending DE1041688B (de) | 1955-04-28 | 1956-04-26 | Verwendung von Addukten aus Polyaminen und Monoepoxyden zum Haerten von Polyepoxyden |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US2938004A (forum.php) |
| BE (1) | BE547328A (forum.php) |
| CH (1) | CH361396A (forum.php) |
| DE (1) | DE1041688B (forum.php) |
| FR (1) | FR1149589A (forum.php) |
| GB (1) | GB804294A (forum.php) |
| NL (2) | NL206722A (forum.php) |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1117871B (de) * | 1959-04-29 | 1961-11-23 | Shell Int Research | Verfahren zum Haerten von Polyepoxyden |
| DE2262791A1 (de) * | 1971-12-24 | 1973-07-05 | Ciba Geigy Ag | Lagerstabile, schnell haertbare epoxidharzmasse |
Families Citing this family (17)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL235080A (forum.php) * | 1958-01-13 | 1900-01-01 | ||
| CA690538A (en) * | 1959-01-16 | 1964-07-14 | Bohme Fettchemie Gmbh | Process for the production and use of water soluble hardenable polyalkylene and/or polyamine condensation products containing epoxide and/or halogen hydrin groups in the molecule |
| US3160675A (en) * | 1961-08-07 | 1964-12-08 | Gen Dynamics Corp | High temperature adhesive |
| US3160518A (en) * | 1961-09-21 | 1964-12-08 | Shell Oil Co | Process for treating and repairing surfaces immersed in water |
| US3278561A (en) * | 1962-06-15 | 1966-10-11 | Monsanto Co | Hydrophobic diglycidylamines |
| US3269890A (en) * | 1962-09-10 | 1966-08-30 | Monsanto Co | Method of forming sized paper containing an epihalohydrin prepolymer and paper thereof |
| US3247048A (en) * | 1962-09-10 | 1966-04-19 | Monsanto Co | Nitrogen prepolymers as wet and dry strength improvers for paper |
| US3494888A (en) * | 1966-08-30 | 1970-02-10 | Wilbur R Mcelroy | Resin compositions from polyepoxides and isocyanate polymers |
| US3515698A (en) * | 1967-05-24 | 1970-06-02 | Hercules Inc | High molecular weight polymers containing the reaction product of an aliphatic amine and a mono- or dioxirane as antistatic agent |
| US4003876A (en) * | 1967-08-07 | 1977-01-18 | The United States Of America As Represented By The Secretary Of The Navy | Super cooled M-phenylene diamine as a curing agent for epoxy resins |
| US4120913A (en) * | 1976-12-10 | 1978-10-17 | Westinghouse Electric Corp. | Epoxy-amine adhesive compositions |
| US4246148A (en) * | 1979-08-27 | 1981-01-20 | Celanese Corporation | Two component aqueous coating composition based on an epoxy-polyamine adduct and a polyepoxide |
| US4517321A (en) * | 1983-05-20 | 1985-05-14 | Union Carbide Corporation | Preimpregnated reinforcements and high strength composites therefrom |
| EP0260646A3 (de) * | 1986-09-17 | 1990-04-18 | Max-Planck-Gesellschaft zur Förderung der Wissenschaften e.V. | Tetrakis(dialkylamino)aromaten und deren Charge-Transfer-Komplexe |
| US4751278A (en) * | 1987-04-29 | 1988-06-14 | Ciba-Geigy Corporation | Adducts of monoepoxides and selected diamines |
| JPH06271373A (ja) * | 1993-03-18 | 1994-09-27 | Tonen Corp | 湿潤コンクリート面のライニング用プライマー、そのライニング方法及び補強方法 |
| JP2001507729A (ja) * | 1996-12-31 | 2001-06-12 | シエル・インターナシヨネイル・リサーチ・マーチヤツピイ・ベー・ウイ | 周囲温度未満で自己硬化性のエポキシ樹脂用貯蔵安定性相溶性硬化剤組成物 |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL72379C (forum.php) * | 1948-07-05 | |||
| BE495431A (forum.php) * | 1949-04-29 | |||
| BE510201A (forum.php) * | 1949-10-25 | 1900-01-01 | ||
| US2576458A (en) * | 1950-04-07 | 1951-11-27 | Ethyl Corp | Stabilized organic compositions |
| US2662097A (en) * | 1951-10-30 | 1953-12-08 | Ethyl Corp | Condensation process |
-
0
- NL NL102662D patent/NL102662C/xx active
- NL NL206722D patent/NL206722A/xx unknown
- BE BE547328D patent/BE547328A/xx unknown
-
1955
- 1955-04-28 US US504681A patent/US2938004A/en not_active Expired - Lifetime
-
1956
- 1956-04-26 DE DEN12174A patent/DE1041688B/de active Pending
- 1956-04-26 GB GB12846/56A patent/GB804294A/en not_active Expired
- 1956-04-26 FR FR1149589D patent/FR1149589A/fr not_active Expired
- 1956-04-26 CH CH361396D patent/CH361396A/de unknown
Non-Patent Citations (1)
| Title |
|---|
| None * |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1117871B (de) * | 1959-04-29 | 1961-11-23 | Shell Int Research | Verfahren zum Haerten von Polyepoxyden |
| DE2262791A1 (de) * | 1971-12-24 | 1973-07-05 | Ciba Geigy Ag | Lagerstabile, schnell haertbare epoxidharzmasse |
Also Published As
| Publication number | Publication date |
|---|---|
| NL102662C (forum.php) | |
| BE547328A (forum.php) | |
| CH361396A (de) | 1962-04-15 |
| US2938004A (en) | 1960-05-24 |
| FR1149589A (fr) | 1957-12-27 |
| NL206722A (forum.php) | |
| GB804294A (en) | 1958-11-12 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1041688B (de) | Verwendung von Addukten aus Polyaminen und Monoepoxyden zum Haerten von Polyepoxyden | |
| DE961029C (de) | Verfahren zur Herstellung von harten harzartigen Produkten aus AEthoxylinkondensaten | |
| DE1229544B (de) | Verfahren zur Herstellung von hoehermolekularen als Umsetzungskomponente fuer Epoxydverbindungen geeigneten Addukten | |
| EP1266920B1 (de) | Wasserverdünnbare Aminhärter für wässrige Zweikomponenten-Epoxidharz-Systeme | |
| DE1420797B2 (de) | Verfahren zur ueberfuehrung von polyglycidylpolyaethern mehrwertiger phenole in hochmolekulare vernetzte produkte | |
| DE1545049B2 (de) | Verfahren zur Herstellung von Polyadditionsprodukten | |
| DE1086886B (de) | Verfahren zur Herstellung von geformten Gebilden mit Ausnahme von Lackfilmen durch Haerten von Epoxyverbindungen | |
| DE1109887B (de) | Verfahren zur Herstellung von Kunststoffen durch Aushaerten von mehrere Epoxydgruppen aufweisenden Phenolaethern | |
| DE1745795B2 (de) | Verfahren zur Herstellung von Epoxy gruppen enthaltenden Reaktions produkten | |
| DE1009808B (de) | Verfahren zur Herstellung von Lack- und Giessharzen aus Polyglycidylaethern | |
| DE1032528B (de) | Verfahren zum Beschleunigen der Haertung von Epoxyharzen | |
| DE2549656A1 (de) | Neue haertungsmittel fuer epoxidharze | |
| DE3246297A1 (de) | Latente urethanharzsysteme | |
| DE1058255B (de) | Verfahren zur Herstellung von stickstoffhaltigen Epoxyharzen | |
| DE2338256A1 (de) | Aus zwei komponenten bestehende polymerbildende massen | |
| DE1124688B (de) | Verfahren zum Haerten von Epoxyharzen | |
| DE1057783B (de) | Verfahren zum Haerten von Glycidpolyaethern | |
| DE1301135B (de) | Verfahren zur Herstellung von Formkoerpern | |
| DE1041246B (de) | Verfahren zur Herstellung kalt- oder warmgehaerteter modifizierter Epoxyharze | |
| DE1242869B (de) | Verfahren zur Herstellung von Formkoerpern auf der Basis von Polyaddukten | |
| DE1816096C3 (de) | Langkettige, aromatische Säurereste enthaltende Polyglycldylester, Verfahren zu ihrer Herstellung und Anwendung | |
| DE1089544B (de) | Verfahren zum Haerten von endstaendige Epoxydgruppen enthaltenden Epoxyharzen | |
| DE1129287B (de) | Verfahren zur Herstellung von Epoxydharzen hohen Molekulargewichtes | |
| DE1041244B (de) | Verfahren zum Haerten von Epoxyharzen | |
| DE2607663A1 (de) | Haertbare epoxidharzmischungen |