DE1033856B - Zahnpflegemittel - Google Patents
ZahnpflegemittelInfo
- Publication number
- DE1033856B DE1033856B DEC12159A DEC0012159A DE1033856B DE 1033856 B DE1033856 B DE 1033856B DE C12159 A DEC12159 A DE C12159A DE C0012159 A DEC0012159 A DE C0012159A DE 1033856 B DE1033856 B DE 1033856B
- Authority
- DE
- Germany
- Prior art keywords
- sodium
- calcium
- pyrophosphate
- fluoride
- lauroyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 239000000551 dentifrice Substances 0.000 title claims description 7
- -1 fluorine ions Chemical class 0.000 claims description 11
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 claims description 9
- 229910019142 PO4 Inorganic materials 0.000 claims description 9
- 239000003795 chemical substances by application Substances 0.000 claims description 9
- 238000005498 polishing Methods 0.000 claims description 9
- 150000002222 fluorine compounds Chemical class 0.000 claims description 8
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 claims description 7
- 239000011575 calcium Substances 0.000 claims description 7
- 229910052791 calcium Inorganic materials 0.000 claims description 7
- JUNWLZAGQLJVLR-UHFFFAOYSA-J calcium diphosphate Chemical compound [Ca+2].[Ca+2].[O-]P([O-])(=O)OP([O-])([O-])=O JUNWLZAGQLJVLR-UHFFFAOYSA-J 0.000 claims description 7
- 229940043256 calcium pyrophosphate Drugs 0.000 claims description 7
- 235000019821 dicalcium diphosphate Nutrition 0.000 claims description 7
- 239000000606 toothpaste Substances 0.000 claims description 7
- 235000019820 disodium diphosphate Nutrition 0.000 claims description 6
- GYQBBRRVRKFJRG-UHFFFAOYSA-L disodium pyrophosphate Chemical compound [Na+].[Na+].OP([O-])(=O)OP(O)([O-])=O GYQBBRRVRKFJRG-UHFFFAOYSA-L 0.000 claims description 6
- 229940038485 disodium pyrophosphate Drugs 0.000 claims description 6
- 229910052731 fluorine Inorganic materials 0.000 claims description 6
- 239000011737 fluorine Substances 0.000 claims description 6
- ANOBYBYXJXCGBS-UHFFFAOYSA-L stannous fluoride Chemical compound F[Sn]F ANOBYBYXJXCGBS-UHFFFAOYSA-L 0.000 claims description 6
- 229960002799 stannous fluoride Drugs 0.000 claims description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 6
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 claims description 5
- 239000010452 phosphate Substances 0.000 claims description 5
- PUZPDOWCWNUUKD-UHFFFAOYSA-M sodium fluoride Chemical compound [F-].[Na+] PUZPDOWCWNUUKD-UHFFFAOYSA-M 0.000 claims description 5
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 4
- 239000000796 flavoring agent Substances 0.000 claims description 4
- 235000019634 flavors Nutrition 0.000 claims description 4
- 235000003599 food sweetener Nutrition 0.000 claims description 4
- 235000011187 glycerol Nutrition 0.000 claims description 4
- 239000011734 sodium Substances 0.000 claims description 4
- KSAVQLQVUXSOCR-UHFFFAOYSA-M sodium lauroyl sarcosinate Chemical compound [Na+].CCCCCCCCCCCC(=O)N(C)CC([O-])=O KSAVQLQVUXSOCR-UHFFFAOYSA-M 0.000 claims description 4
- 239000003765 sweetening agent Substances 0.000 claims description 4
- 229940034610 toothpaste Drugs 0.000 claims description 4
- BHPQYMZQTOCNFJ-UHFFFAOYSA-N Calcium cation Chemical compound [Ca+2] BHPQYMZQTOCNFJ-UHFFFAOYSA-N 0.000 claims description 3
- BACYUWVYYTXETD-UHFFFAOYSA-N N-Lauroylsarcosine Chemical compound CCCCCCCCCCCC(=O)N(C)CC(O)=O BACYUWVYYTXETD-UHFFFAOYSA-N 0.000 claims description 3
- DPXJVFZANSGRMM-UHFFFAOYSA-N acetic acid;2,3,4,5,6-pentahydroxyhexanal;sodium Chemical compound [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O DPXJVFZANSGRMM-UHFFFAOYSA-N 0.000 claims description 3
- 239000007864 aqueous solution Substances 0.000 claims description 3
- 229910001424 calcium ion Inorganic materials 0.000 claims description 3
- 239000001768 carboxy methyl cellulose Substances 0.000 claims description 3
- 239000000344 soap Substances 0.000 claims description 3
- 229910052708 sodium Inorganic materials 0.000 claims description 3
- 235000019812 sodium carboxymethyl cellulose Nutrition 0.000 claims description 3
- 229920001027 sodium carboxymethylcellulose Polymers 0.000 claims description 3
- 235000013024 sodium fluoride Nutrition 0.000 claims description 3
- 239000011775 sodium fluoride Substances 0.000 claims description 3
- 239000003205 fragrance Substances 0.000 claims description 2
- 108700004121 sarkosyl Proteins 0.000 claims description 2
- WXMKPNITSTVMEF-UHFFFAOYSA-M sodium benzoate Chemical compound [Na+].[O-]C(=O)C1=CC=CC=C1 WXMKPNITSTVMEF-UHFFFAOYSA-M 0.000 claims description 2
- 235000010234 sodium benzoate Nutrition 0.000 claims description 2
- 239000004299 sodium benzoate Substances 0.000 claims description 2
- 239000002537 cosmetic Substances 0.000 claims 1
- 239000004615 ingredient Substances 0.000 claims 1
- 239000000203 mixture Substances 0.000 description 13
- 235000021317 phosphate Nutrition 0.000 description 7
- 230000002378 acidificating effect Effects 0.000 description 5
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- KRHYYFGTRYWZRS-UHFFFAOYSA-M Fluoride anion Chemical compound [F-] KRHYYFGTRYWZRS-UHFFFAOYSA-M 0.000 description 3
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 3
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- 230000000844 anti-bacterial effect Effects 0.000 description 3
- 210000003298 dental enamel Anatomy 0.000 description 3
- 235000014113 dietary fatty acids Nutrition 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 239000000194 fatty acid Substances 0.000 description 3
- 229930195729 fatty acid Natural products 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 239000000843 powder Substances 0.000 description 3
- 150000003839 salts Chemical class 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- 239000004094 surface-active agent Substances 0.000 description 3
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 2
- FBPFZTCFMRRESA-JGWLITMVSA-N D-glucitol Chemical compound OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-JGWLITMVSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- 229920000388 Polyphosphate Polymers 0.000 description 2
- 235000019827 calcium polyphosphate Nutrition 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- 230000000536 complexating effect Effects 0.000 description 2
- 239000008139 complexing agent Substances 0.000 description 2
- 239000007859 condensation product Substances 0.000 description 2
- XPPKVPWEQAFLFU-UHFFFAOYSA-N diphosphoric acid Chemical class OP(O)(=O)OP(O)(O)=O XPPKVPWEQAFLFU-UHFFFAOYSA-N 0.000 description 2
- 210000000214 mouth Anatomy 0.000 description 2
- 235000011007 phosphoric acid Nutrition 0.000 description 2
- 239000001205 polyphosphate Substances 0.000 description 2
- 235000011176 polyphosphates Nutrition 0.000 description 2
- 239000011591 potassium Substances 0.000 description 2
- 229910052700 potassium Inorganic materials 0.000 description 2
- NROKBHXJSPEDAR-UHFFFAOYSA-M potassium fluoride Chemical compound [F-].[K+] NROKBHXJSPEDAR-UHFFFAOYSA-M 0.000 description 2
- 229940005657 pyrophosphoric acid Drugs 0.000 description 2
- 239000000600 sorbitol Substances 0.000 description 2
- 239000003381 stabilizer Substances 0.000 description 2
- UNXRWKVEANCORM-UHFFFAOYSA-N triphosphoric acid Chemical class OP(O)(=O)OP(O)(=O)OP(O)(O)=O UNXRWKVEANCORM-UHFFFAOYSA-N 0.000 description 2
- BHHYHSUAOQUXJK-UHFFFAOYSA-L zinc fluoride Chemical compound F[Zn]F BHHYHSUAOQUXJK-UHFFFAOYSA-L 0.000 description 2
- TXUICONDJPYNPY-UHFFFAOYSA-N (1,10,13-trimethyl-3-oxo-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl) heptanoate Chemical compound C1CC2CC(=O)C=C(C)C2(C)C2C1C1CCC(OC(=O)CCCCCC)C1(C)CC2 TXUICONDJPYNPY-UHFFFAOYSA-N 0.000 description 1
- LDVVTQMJQSCDMK-UHFFFAOYSA-N 1,3-dihydroxypropan-2-yl formate Chemical compound OCC(CO)OC=O LDVVTQMJQSCDMK-UHFFFAOYSA-N 0.000 description 1
- LFJJOPDNPVFCNZ-UHFFFAOYSA-N 2-[hexadecanoyl(methyl)amino]acetic acid Chemical class CCCCCCCCCCCCCCCC(=O)N(C)CC(O)=O LFJJOPDNPVFCNZ-UHFFFAOYSA-N 0.000 description 1
- UBLAMKHIFZBBSS-UHFFFAOYSA-N 3-Methylbutyl pentanoate Chemical compound CCCCC(=O)OCCC(C)C UBLAMKHIFZBBSS-UHFFFAOYSA-N 0.000 description 1
- DDFHBQSCUXNBSA-UHFFFAOYSA-N 5-(5-carboxythiophen-2-yl)thiophene-2-carboxylic acid Chemical compound S1C(C(=O)O)=CC=C1C1=CC=C(C(O)=O)S1 DDFHBQSCUXNBSA-UHFFFAOYSA-N 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- 239000004132 Calcium polyphosphate Substances 0.000 description 1
- KXDHJXZQYSOELW-UHFFFAOYSA-N Carbamic acid Chemical class NC(O)=O KXDHJXZQYSOELW-UHFFFAOYSA-N 0.000 description 1
- 241000206575 Chondrus crispus Species 0.000 description 1
- 229910021594 Copper(II) fluoride Inorganic materials 0.000 description 1
- YCKRFDGAMUMZLT-UHFFFAOYSA-N Fluorine atom Chemical compound [F] YCKRFDGAMUMZLT-UHFFFAOYSA-N 0.000 description 1
- QNAYBMKLOCPYGJ-REOHCLBHSA-N L-alanine Chemical class C[C@H](N)C(O)=O QNAYBMKLOCPYGJ-REOHCLBHSA-N 0.000 description 1
- UEZVMMHDMIWARA-UHFFFAOYSA-N Metaphosphoric acid Chemical class OP(=O)=O UEZVMMHDMIWARA-UHFFFAOYSA-N 0.000 description 1
- JWGGSJFIGIGFSQ-UHFFFAOYSA-N N-dodecanoylglycine Chemical class CCCCCCCCCCCC(=O)NCC(O)=O JWGGSJFIGIGFSQ-UHFFFAOYSA-N 0.000 description 1
- 229910021626 Tin(II) chloride Inorganic materials 0.000 description 1
- HFIGWKOFZLNOQK-UHFFFAOYSA-K [O-]P([O-])(=O)OP(=O)([O-])O.[Ca+2].[Na+] Chemical compound [O-]P([O-])(=O)OP(=O)([O-])O.[Ca+2].[Na+] HFIGWKOFZLNOQK-UHFFFAOYSA-K 0.000 description 1
- YDHWWBZFRZWVHO-UHFFFAOYSA-N [hydroxy(phosphonooxy)phosphoryl] phosphono hydrogen phosphate Chemical class OP(O)(=O)OP(O)(=O)OP(O)(=O)OP(O)(O)=O YDHWWBZFRZWVHO-UHFFFAOYSA-N 0.000 description 1
- 239000003929 acidic solution Substances 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 230000000996 additive effect Effects 0.000 description 1
- 230000032683 aging Effects 0.000 description 1
- 235000004279 alanine Nutrition 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 150000001447 alkali salts Chemical class 0.000 description 1
- 125000002877 alkyl aryl group Chemical group 0.000 description 1
- 150000008051 alkyl sulfates Chemical class 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 235000001014 amino acid Nutrition 0.000 description 1
- 150000001413 amino acids Chemical class 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000007844 bleaching agent Substances 0.000 description 1
- 229940043430 calcium compound Drugs 0.000 description 1
- ROPDWRCJTIRLTR-UHFFFAOYSA-L calcium metaphosphate Chemical compound [Ca+2].[O-]P(=O)=O.[O-]P(=O)=O ROPDWRCJTIRLTR-UHFFFAOYSA-L 0.000 description 1
- 159000000007 calcium salts Chemical class 0.000 description 1
- 150000001720 carbohydrates Chemical group 0.000 description 1
- 235000014633 carbohydrates Nutrition 0.000 description 1
- ATNHDLDRLWWWCB-AENOIHSZSA-M chlorophyll a Chemical class C1([C@@H](C(=O)OC)C(=O)C2=C3C)=C2N2C3=CC(C(CC)=C3C)=[N+]4C3=CC3=C(C=C)C(C)=C5N3[Mg-2]42[N+]2=C1[C@@H](CCC(=O)OC\C=C(/C)CCC[C@H](C)CCC[C@H](C)CCCC(C)C)[C@H](C)C2=C5 ATNHDLDRLWWWCB-AENOIHSZSA-M 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 239000012459 cleaning agent Substances 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- GWFAVIIMQDUCRA-UHFFFAOYSA-L copper(ii) fluoride Chemical compound [F-].[F-].[Cu+2] GWFAVIIMQDUCRA-UHFFFAOYSA-L 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 239000003599 detergent Substances 0.000 description 1
- CQAIPTBBCVQRMD-UHFFFAOYSA-L dipotassium;phosphono phosphate Chemical compound [K+].[K+].OP(O)(=O)OP([O-])([O-])=O CQAIPTBBCVQRMD-UHFFFAOYSA-L 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 150000002169 ethanolamines Chemical class 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 238000005187 foaming Methods 0.000 description 1
- 239000003349 gelling agent Substances 0.000 description 1
- 239000003906 humectant Substances 0.000 description 1
- 230000001771 impaired effect Effects 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 150000002681 magnesium compounds Chemical class 0.000 description 1
- HCWCAKKEBCNQJP-UHFFFAOYSA-N magnesium orthosilicate Chemical compound [Mg+2].[Mg+2].[O-][Si]([O-])([O-])[O-] HCWCAKKEBCNQJP-UHFFFAOYSA-N 0.000 description 1
- 239000000391 magnesium silicate Substances 0.000 description 1
- 229910052919 magnesium silicate Inorganic materials 0.000 description 1
- 235000019792 magnesium silicate Nutrition 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 125000001419 myristoyl group Chemical class O=C([*])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229920003052 natural elastomer Polymers 0.000 description 1
- 229920001194 natural rubber Polymers 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- 108700009886 palmitoyl sarcosine Chemical class 0.000 description 1
- 150000003016 phosphoric acids Chemical class 0.000 description 1
- 229920001296 polysiloxane Polymers 0.000 description 1
- 235000003270 potassium fluoride Nutrition 0.000 description 1
- 239000011698 potassium fluoride Substances 0.000 description 1
- 230000002035 prolonged effect Effects 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 235000019832 sodium triphosphate Nutrition 0.000 description 1
- 239000001119 stannous chloride Substances 0.000 description 1
- 235000011150 stannous chloride Nutrition 0.000 description 1
- 229940013123 stannous chloride Drugs 0.000 description 1
- 229920003051 synthetic elastomer Polymers 0.000 description 1
- 239000005061 synthetic rubber Substances 0.000 description 1
- 230000008719 thickening Effects 0.000 description 1
- 239000002562 thickening agent Substances 0.000 description 1
- UNXRWKVEANCORM-UHFFFAOYSA-I triphosphate(5-) Chemical compound [O-]P([O-])(=O)OP([O-])(=O)OP([O-])([O-])=O UNXRWKVEANCORM-UHFFFAOYSA-I 0.000 description 1
- 229940048102 triphosphoric acid Drugs 0.000 description 1
- 238000009736 wetting Methods 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K8/00—Cosmetics or similar toiletry preparations
- A61K8/18—Cosmetics or similar toiletry preparations characterised by the composition
- A61K8/30—Cosmetics or similar toiletry preparations characterised by the composition containing organic compounds
- A61K8/40—Cosmetics or similar toiletry preparations characterised by the composition containing organic compounds containing nitrogen
- A61K8/44—Aminocarboxylic acids or derivatives thereof, e.g. aminocarboxylic acids containing sulfur; Salts; Esters or N-acylated derivatives thereof
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K8/00—Cosmetics or similar toiletry preparations
- A61K8/18—Cosmetics or similar toiletry preparations characterised by the composition
- A61K8/19—Cosmetics or similar toiletry preparations characterised by the composition containing inorganic ingredients
- A61K8/24—Phosphorous; Compounds thereof
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61Q—SPECIFIC USE OF COSMETICS OR SIMILAR TOILETRY PREPARATIONS
- A61Q11/00—Preparations for care of the teeth, of the oral cavity or of dentures; Dentifrices, e.g. toothpastes; Mouth rinses
Landscapes
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Birds (AREA)
- Epidemiology (AREA)
- Oral & Maxillofacial Surgery (AREA)
- Chemical & Material Sciences (AREA)
- Inorganic Chemistry (AREA)
- Cosmetics (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CA777556X | 1954-11-24 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1033856B true DE1033856B (de) | 1958-07-10 |
Family
ID=4172440
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEC12159A Pending DE1033856B (de) | 1954-11-24 | 1955-11-24 | Zahnpflegemittel |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US2876167A (OSRAM) |
| BE (1) | BE543046A (OSRAM) |
| DE (1) | DE1033856B (OSRAM) |
| FR (1) | FR1186136A (OSRAM) |
| GB (1) | GB777556A (OSRAM) |
| NL (2) | NL202309A (OSRAM) |
Families Citing this family (84)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3029191A (en) * | 1958-04-28 | 1962-04-10 | Colgate Palmolive Co | Dental preparations consisting essentially of a fluoride compound and a sarcoside compound to reduce the fluoride toxicity |
| US3357790A (en) * | 1963-03-18 | 1967-12-12 | Monsanto Co | Calcining method for conversion of alkaline earth orthophosphates to the pyrophosphate form |
| US3282792A (en) * | 1964-01-09 | 1966-11-01 | Bristol Myers Co | Stabilized stannous fluoride dentifrice compositions |
| SE347432B (OSRAM) * | 1969-02-27 | 1972-08-07 | Medisan Ab | |
| GB1373003A (en) * | 1971-01-28 | 1974-11-06 | Unilever Ltd | Dentifrice composition |
| NL7407759A (OSRAM) * | 1973-06-13 | 1974-12-17 | ||
| US4100269A (en) * | 1973-06-28 | 1978-07-11 | Lever Brothers Company | Anticalculus dentifrice |
| US4046872A (en) * | 1974-04-29 | 1977-09-06 | Colgate Palmolive Company | Dental cream |
| US4075317A (en) * | 1974-04-29 | 1978-02-21 | Colgate-Palmolive Company | Dental cream composition |
| US4122164A (en) * | 1975-10-02 | 1978-10-24 | Colgate-Palmolive Company | Dental cream composition |
| JPS6043324B2 (ja) * | 1977-10-20 | 1985-09-27 | ライオン株式会社 | 口腔用組成物 |
| US4146608A (en) * | 1977-11-07 | 1979-03-27 | Lever Brothers Company | Synergistic anti-plaque mixture with tetradecylamine and copper, iron, nickel, or cobalt |
| US4146607A (en) * | 1977-11-07 | 1979-03-27 | Lever Brothers Company | Synergistic anti-plaque mixture with tetradecylamine plus aluminum and/or zinc |
| US4198394A (en) * | 1978-07-25 | 1980-04-15 | Faunce Frank R | Sodium dihydrogen phosphate enhanced dentifrice composition |
| US4283385A (en) * | 1980-05-09 | 1981-08-11 | Richardson-Merrell Inc. | Dentifrices with improved soluble fluoride availability |
| EP0089136A3 (en) * | 1982-03-10 | 1984-05-30 | The Procter & Gamble Company | Oral hygiene products |
| PH22221A (en) * | 1982-06-22 | 1988-06-28 | Procter & Gamble | Oral compositions |
| US4806339A (en) * | 1982-06-22 | 1989-02-21 | The Procter & Gamble Company | Oral compositions |
| US4999184A (en) * | 1982-06-22 | 1991-03-12 | The Procter & Gamble Company | Oral compositions |
| US4885155A (en) * | 1982-06-22 | 1989-12-05 | The Procter & Gamble Company | Anticalculus compositions using pyrophosphate salt |
| US4772461A (en) * | 1982-06-22 | 1988-09-20 | The Procter & Gamble Company | Oral compositions |
| US4627977A (en) * | 1985-09-13 | 1986-12-09 | Colgate-Palmolive Company | Anticalculus oral composition |
| US4966777A (en) * | 1985-09-13 | 1990-10-30 | Colgate-Palmolive Company | Anticalculus oral composition |
| GB8608565D0 (en) * | 1986-04-05 | 1986-05-14 | Beecham Group Plc | Oral hygiene compositions |
| EP0249398A3 (en) * | 1986-06-09 | 1989-07-19 | The Procter & Gamble Company | Oral compositions |
| GB8623643D0 (en) * | 1986-10-02 | 1986-11-05 | Unilever Plc | Oral products |
| US5094870A (en) * | 1989-05-30 | 1992-03-10 | Nabisco Brands, Inc. | Canine biscuits containing an inorganic pyrophosphate |
| US5114704A (en) | 1989-05-30 | 1992-05-19 | Nabisco Brands, Inc. | Raw hide having a coating containing an inorganic pyrophosphate |
| US5000940A (en) * | 1989-05-30 | 1991-03-19 | Nabisco Brands, Inc. | Devices, compositions and the like having or containing an inorganic pyrophosphate |
| US5011679A (en) * | 1989-05-30 | 1991-04-30 | Nabisco Brands, Inc. | Raw hide having a coating containing an inorganic pyrophosphate |
| US5047231A (en) * | 1989-05-30 | 1991-09-10 | Nabisco Brands, Inc. | Raw hide containing an inorganic pyrophosphate |
| US5000943A (en) * | 1989-05-30 | 1991-03-19 | Nabisco Brands, Inc. | Canine biscuits containing an inorganic pyrophosphate |
| US5015485A (en) * | 1989-05-30 | 1991-05-14 | Nabisco Brands, Inc. | Dog biscuits having a coating containing an inorganic pyrophosphate |
| US5000973A (en) * | 1989-05-30 | 1991-03-19 | Nabisco Brands, Inc. | Nutritionally-balanced canine biscuits containing an inorganic pyrophosphate |
| US5180576A (en) * | 1991-08-30 | 1993-01-19 | Church & Dwight Co., Inc. | Anticalculus dentifrices |
| CA2133661A1 (en) * | 1992-04-07 | 1993-10-14 | John D. B. Featherstone | Dental formulation |
| DE4315070C2 (de) * | 1993-05-06 | 2000-05-31 | Werner Striebeck | Zusammensetzung zur Vorbeugung von Karies in einer auf die Zähne als Spray oder Pinsellösung applizierbaren Form |
| US5578294A (en) * | 1994-05-13 | 1996-11-26 | The Procter & Gamble Company | Oral compositions |
| US5560905A (en) * | 1994-05-13 | 1996-10-01 | The Proctor & Gamble Company | Oral compositions |
| US5849271A (en) * | 1995-06-07 | 1998-12-15 | The Procter & Gamble Company | Oral compositions |
| US6350436B1 (en) * | 1996-11-21 | 2002-02-26 | The Procter & Gamble Company | Method of reducing staining of stannous in dentifrice compositions |
| US6713049B1 (en) * | 1999-11-12 | 2004-03-30 | The Procter & Gamble Company | Oral compositions providing optimal surface conditioning |
| US6241974B1 (en) * | 1997-04-22 | 2001-06-05 | The Procter & Gamble Company | Dentifrice compositions containing β-phase calcium pyrophosphate an anticalculus agent, and fluoride |
| US20040146466A1 (en) | 1999-11-12 | 2004-07-29 | The Procter & Gamble Company | Method of protecting teeth against erosion |
| US10470985B2 (en) | 1999-11-12 | 2019-11-12 | The Procter & Gamble Company | Method of protecting teeth against erosion |
| US7041277B2 (en) * | 2000-03-10 | 2006-05-09 | Cadbury Adams Usa Llc | Chewing gum and confectionery compositions with encapsulated stain removing agent compositions, and methods of making and using the same |
| JP2003526649A (ja) * | 2000-03-14 | 2003-09-09 | ザ、プロクター、エンド、ギャンブル、カンパニー | ポリホスフェート、フッ化物及びスズ(ii)塩を含む安定な歯磨き組成物 |
| AU2002323135A1 (en) * | 2001-08-14 | 2003-03-03 | Variant Holdings, Llc. | System for marketing goods and services utilizing computerized central and remote facilities |
| US7445769B2 (en) | 2002-10-31 | 2008-11-04 | Cadbury Adams Usa Llc | Compositions for removing stains from dental surfaces and methods of making and using the same |
| US6685916B1 (en) * | 2002-10-31 | 2004-02-03 | Cadbury Adams Usa Llc | Compositions for removing stains from dental surfaces, and methods of making and using the same |
| US7390518B2 (en) * | 2003-07-11 | 2008-06-24 | Cadbury Adams Usa, Llc | Stain removing chewing gum composition |
| US20080317681A1 (en) * | 2003-07-11 | 2008-12-25 | Petros Gebreselassie | Compositions containing a stain removing complex, and methods of making and using the same |
| US20060263473A1 (en) * | 2005-05-23 | 2006-11-23 | Cadbury Adams Usa Llc | Compressed delivery system for active components as part of an edible composition |
| US8591973B2 (en) * | 2005-05-23 | 2013-11-26 | Kraft Foods Global Brands Llc | Delivery system for active components and a material having preselected hydrophobicity as part of an edible composition |
| US8389032B2 (en) * | 2005-05-23 | 2013-03-05 | Kraft Foods Global Brands Llc | Delivery system for active components as part of an edible composition having selected particle size |
| US8389031B2 (en) * | 2005-05-23 | 2013-03-05 | Kraft Foods Global Brands Llc | Coated delivery system for active components as part of an edible composition |
| US8597703B2 (en) * | 2005-05-23 | 2013-12-03 | Kraft Foods Global Brands Llc | Delivery system for active components as part of an edible composition including a ratio of encapsulating material and active component |
| US8591972B2 (en) * | 2005-05-23 | 2013-11-26 | Kraft Foods Global Brands Llc | Delivery system for coated active components as part of an edible composition |
| US8591974B2 (en) | 2003-11-21 | 2013-11-26 | Kraft Foods Global Brands Llc | Delivery system for two or more active components as part of an edible composition |
| US20050112236A1 (en) * | 2003-11-21 | 2005-05-26 | Navroz Boghani | Delivery system for active components as part of an edible composition having preselected tensile strength |
| US8591968B2 (en) * | 2005-05-23 | 2013-11-26 | Kraft Foods Global Brands Llc | Edible composition including a delivery system for active components |
| US9271904B2 (en) | 2003-11-21 | 2016-03-01 | Intercontinental Great Brands Llc | Controlled release oral delivery systems |
| US20060263474A1 (en) * | 2005-05-23 | 2006-11-23 | Cadbury Adams Usa Llc. | Enhanced flavor-release comestible compositions and methods for same |
| CN1878526B (zh) * | 2003-12-08 | 2010-09-08 | 吉百利控股有限公司 | 固体口用牙齿增白组合物 |
| US20060024245A1 (en) * | 2004-07-29 | 2006-02-02 | Cadbury Adams, Llc. | Tooth whitening compositions and delivery systems therefor |
| US7641892B2 (en) | 2004-07-29 | 2010-01-05 | Cadburry Adams USA, LLC | Tooth whitening compositions and delivery systems therefor |
| US20060068059A1 (en) * | 2004-09-30 | 2006-03-30 | Cadbury Adams Usa Llc | Encapsulated compositions and methods of preparation |
| US7955630B2 (en) * | 2004-09-30 | 2011-06-07 | Kraft Foods Global Brands Llc | Thermally stable, high tensile strength encapsulated actives |
| US20060068058A1 (en) * | 2004-09-30 | 2006-03-30 | Cadbury Adams Usa Llc | Thermally stable, high tensile strength encapsulation compositions for actives |
| US20060263476A1 (en) * | 2004-08-25 | 2006-11-23 | Cadbury Adams Usa, Llc. | Center-filled chewing gum with barrier layer |
| US7727565B2 (en) | 2004-08-25 | 2010-06-01 | Cadbury Adams Usa Llc | Liquid-filled chewing gum composition |
| US20080063747A1 (en) * | 2004-08-25 | 2008-03-13 | Cadbury Adams Usa Llc | Dusting compositions for chewing gum products |
| US9198448B2 (en) | 2005-02-07 | 2015-12-01 | Intercontinental Great Brands Llc | Stable tooth whitening gum with reactive ingredients |
| US7851005B2 (en) * | 2005-05-23 | 2010-12-14 | Cadbury Adams Usa Llc | Taste potentiator compositions and beverages containing same |
| US7851006B2 (en) * | 2005-05-23 | 2010-12-14 | Cadbury Adams Usa Llc | Taste potentiator compositions and beverages containing same |
| EP1901622B1 (en) * | 2005-05-23 | 2014-07-16 | Intercontinental Great Brands LLC | Taste potentiator compositions and beverages containing same |
| US20070053972A1 (en) * | 2005-09-08 | 2007-03-08 | Cadbury Adams Usa Llc. | Gelatin capsules containing actives |
| US20070178188A1 (en) * | 2006-01-27 | 2007-08-02 | Cadbury Adams Usa Llc | Chewing gum compositions including free neotame sweetener compositions |
| US20070178187A1 (en) * | 2006-01-27 | 2007-08-02 | Cadbury Adams Usa Llc | Chewing gum compositions including free neotame sweetener compositions |
| EP1961452B1 (en) * | 2007-02-23 | 2013-10-23 | The Procter and Gamble Company | Oral polyphosphate compositions |
| CA2686930A1 (en) * | 2007-05-14 | 2008-11-20 | Cadbury Adams Usa Llc | Taste potentiator compositions in oral delivery systems |
| US20090214609A1 (en) * | 2008-02-21 | 2009-08-27 | Ross Strand | Oral Polyphosphate Compositions |
| US10123953B2 (en) | 2012-06-21 | 2018-11-13 | The Procter & Gamble Company | Reduction of tooth staining derived from cationic antimicrobials |
| WO2020219323A1 (en) | 2019-04-26 | 2020-10-29 | The Procter & Gamble Company | Reduction of tooth staining derived from cationic antimicrobials |
Citations (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE675837C (de) * | 1932-06-12 | 1939-05-22 | Ig Farbenindustrie Ag | Zahnreinigungsmittel |
| AT164553B (de) * | 1945-11-14 | 1949-11-25 | Dobbelman N V | Zahnpaste |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB191503034A (en) * | 1914-09-09 | 1915-07-08 | Isaiah Hall | Improvements in or relating to Apparatus for Regulating and Controlling and/or Indicating Temperatures. |
| NL46892C (OSRAM) * | 1936-02-15 | |||
| US2191199A (en) * | 1937-09-17 | 1940-02-20 | Hall Lab Inc | Abrasive detergent composition |
| BE469075A (OSRAM) * | 1945-11-14 | |||
| US2700012A (en) * | 1949-02-05 | 1955-01-18 | Wallace & Tiernan Company Inc | Manufacture of chewing gum for fluorine prophylaxis |
| NL104948C (OSRAM) * | 1952-02-15 | |||
| BE516996A (OSRAM) * | 1952-02-19 | |||
| NL88779C (OSRAM) * | 1952-06-17 | |||
| US2749278A (en) * | 1952-10-23 | 1956-06-05 | Monsanto Chemicals | Fluorinated dialkali-alkaline earth pyrophosphates and method of producing same |
-
0
- BE BE543046D patent/BE543046A/xx unknown
- NL NL97253D patent/NL97253C/xx active
- NL NL202309D patent/NL202309A/xx unknown
-
1955
- 1955-11-22 US US548550A patent/US2876167A/en not_active Expired - Lifetime
- 1955-11-22 GB GB33478/55A patent/GB777556A/en not_active Expired
- 1955-11-23 FR FR1186136D patent/FR1186136A/fr not_active Expired
- 1955-11-24 DE DEC12159A patent/DE1033856B/de active Pending
Patent Citations (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE675837C (de) * | 1932-06-12 | 1939-05-22 | Ig Farbenindustrie Ag | Zahnreinigungsmittel |
| AT164553B (de) * | 1945-11-14 | 1949-11-25 | Dobbelman N V | Zahnpaste |
Also Published As
| Publication number | Publication date |
|---|---|
| FR1186136A (fr) | 1959-08-14 |
| NL202309A (OSRAM) | |
| US2876167A (en) | 1959-03-03 |
| GB777556A (en) | 1957-06-26 |
| BE543046A (OSRAM) | |
| NL97253C (OSRAM) |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1033856B (de) | Zahnpflegemittel | |
| DE968516C (de) | Zahnpflegemittel | |
| DE3206711C2 (de) | Im Zahnpflegebereich einsetzbare Remineralisierungslösung | |
| DE2221023B2 (de) | Zusammensetzungen fuer die mundhygiene mit einem gehalt an monofluorphosphat | |
| US2955985A (en) | Dentifrice compositions | |
| DE3044448A1 (de) | Zahncreme | |
| DE1908067A1 (de) | Oral anzuwendende Zusammensetzungen zur Verhinderung von Zahnsteinbildung | |
| DE1289246B (OSRAM) | ||
| DE3102557A1 (de) | Keine flecken bildendes, gegen zahnfleischentzuendungen wirkendes mundpflegemittel | |
| DE2454136B2 (de) | Mund- und zahnpflegemittel | |
| DE3327070A1 (de) | Opake zahncreme | |
| DE2456693A1 (de) | Verfahren zum stabilisieren von calcium-hydrogenphosphat-anhydrid gegen die umsetzung mit fluorionen | |
| DE1492027B2 (de) | Natriummonofluorphosphat enthaltende zahnpaste | |
| DE3212486A1 (de) | Zahnpflegemittel | |
| DE3216606A1 (de) | Zahnpflegemittel | |
| DE2456666A1 (de) | Verfahren zum stabilisieren von calcium-hydrogenphosphat-dihydrat gegen hydrolyse | |
| DE1106926B (de) | Zahnpflegemittel | |
| DE3504178A1 (de) | Zahnpasta | |
| US4175120A (en) | Dentifrice | |
| DE1467828C3 (de) | Zahnpflegemittel | |
| DE1014289B (de) | Mundpflegemittel | |
| DE1060095B (de) | Zahnpflegemittel | |
| DE2255177A1 (de) | Orale zubereitungen zur verhuetung von zahnstein | |
| DE2918132A1 (de) | Zahncreme-zusammensetzung | |
| USRE30675E (en) | Dentifrice |